blob: cbd6c436c9ade4fdafd371a52539fb76eaf76604 [file] [log] [blame]
/*
* HTTP protocol analyzer
*
* Copyright 2000-2007 Willy Tarreau <w@1wt.eu>
*
* This program is free software; you can redistribute it and/or
* modify it under the terms of the GNU General Public License
* as published by the Free Software Foundation; either version
* 2 of the License, or (at your option) any later version.
*
*/
#include <ctype.h>
#include <errno.h>
#include <fcntl.h>
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <syslog.h>
#include <sys/socket.h>
#include <sys/stat.h>
#include <sys/types.h>
#include <common/appsession.h>
#include <common/compat.h>
#include <common/config.h>
#include <common/debug.h>
#include <common/memory.h>
#include <common/mini-clist.h>
#include <common/standard.h>
#include <common/time.h>
#include <common/uri_auth.h>
#include <common/version.h>
#include <types/capture.h>
#include <types/client.h>
#include <types/global.h>
#include <types/httperr.h>
#include <types/polling.h>
#include <types/proxy.h>
#include <types/server.h>
#include <proto/backend.h>
#include <proto/buffers.h>
#include <proto/fd.h>
#include <proto/log.h>
#include <proto/hdr_idx.h>
#include <proto/proto_http.h>
#include <proto/queue.h>
#include <proto/session.h>
#include <proto/task.h>
#ifdef CONFIG_HAP_TCPSPLICE
#include <libtcpsplice.h>
#endif
#define DEBUG_PARSE_NO_SPEEDUP
#undef DEBUG_PARSE_NO_SPEEDUP
/* This is used to perform a quick jump as an alternative to a break/continue
* instruction. The first argument is the label for normal operation, and the
* second one is the break/continue instruction in the no_speedup mode.
*/
#ifdef DEBUG_PARSE_NO_SPEEDUP
#define QUICK_JUMP(x,y) y
#else
#define QUICK_JUMP(x,y) goto x
#endif
/* This is used by remote monitoring */
const char HTTP_200[] =
"HTTP/1.0 200 OK\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>200 OK</h1>\nHAProxy: service ready.\n</body></html>\n";
const struct chunk http_200_chunk = {
.str = (char *)&HTTP_200,
.len = sizeof(HTTP_200)-1
};
const char *HTTP_302 =
"HTTP/1.0 302 Found\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Location: "; /* not terminated since it will be concatenated with the URL */
/* same as 302 except that the browser MUST retry with the GET method */
const char *HTTP_303 =
"HTTP/1.0 303 See Other\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Location: "; /* not terminated since it will be concatenated with the URL */
/* Warning: this one is an sprintf() fmt string, with <realm> as its only argument */
const char *HTTP_401_fmt =
"HTTP/1.0 401 Unauthorized\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"WWW-Authenticate: Basic realm=\"%s\"\r\n"
"\r\n"
"<html><body><h1>401 Unauthorized</h1>\nYou need a valid user and password to access this content.\n</body></html>\n";
const int http_err_codes[HTTP_ERR_SIZE] = {
[HTTP_ERR_400] = 400,
[HTTP_ERR_403] = 403,
[HTTP_ERR_408] = 408,
[HTTP_ERR_500] = 500,
[HTTP_ERR_502] = 502,
[HTTP_ERR_503] = 503,
[HTTP_ERR_504] = 504,
};
static const char *http_err_msgs[HTTP_ERR_SIZE] = {
[HTTP_ERR_400] =
"HTTP/1.0 400 Bad request\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>400 Bad request</h1>\nYour browser sent an invalid request.\n</body></html>\n",
[HTTP_ERR_403] =
"HTTP/1.0 403 Forbidden\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>403 Forbidden</h1>\nRequest forbidden by administrative rules.\n</body></html>\n",
[HTTP_ERR_408] =
"HTTP/1.0 408 Request Time-out\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>408 Request Time-out</h1>\nYour browser didn't send a complete request in time.\n</body></html>\n",
[HTTP_ERR_500] =
"HTTP/1.0 500 Server Error\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>500 Server Error</h1>\nAn internal server error occured.\n</body></html>\n",
[HTTP_ERR_502] =
"HTTP/1.0 502 Bad Gateway\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>502 Bad Gateway</h1>\nThe server returned an invalid or incomplete response.\n</body></html>\n",
[HTTP_ERR_503] =
"HTTP/1.0 503 Service Unavailable\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>503 Service Unavailable</h1>\nNo server is available to handle this request.\n</body></html>\n",
[HTTP_ERR_504] =
"HTTP/1.0 504 Gateway Time-out\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>504 Gateway Time-out</h1>\nThe server didn't respond in time.\n</body></html>\n",
};
/* We must put the messages here since GCC cannot initialize consts depending
* on strlen().
*/
struct chunk http_err_chunks[HTTP_ERR_SIZE];
void init_proto_http()
{
int msg;
for (msg = 0; msg < HTTP_ERR_SIZE; msg++) {
if (!http_err_msgs[msg]) {
Alert("Internal error: no message defined for HTTP return code %d. Aborting.\n", msg);
abort();
}
http_err_chunks[msg].str = (char *)http_err_msgs[msg];
http_err_chunks[msg].len = strlen(http_err_msgs[msg]);
}
}
/*
* We have 26 list of methods (1 per first letter), each of which can have
* up to 3 entries (2 valid, 1 null).
*/
struct http_method_desc {
http_meth_t meth;
int len;
const char text[8];
};
const struct http_method_desc http_methods[26][3] = {
['C' - 'A'] = {
[0] = { .meth = HTTP_METH_CONNECT , .len=7, .text="CONNECT" },
},
['D' - 'A'] = {
[0] = { .meth = HTTP_METH_DELETE , .len=6, .text="DELETE" },
},
['G' - 'A'] = {
[0] = { .meth = HTTP_METH_GET , .len=3, .text="GET" },
},
['H' - 'A'] = {
[0] = { .meth = HTTP_METH_HEAD , .len=4, .text="HEAD" },
},
['P' - 'A'] = {
[0] = { .meth = HTTP_METH_POST , .len=4, .text="POST" },
[1] = { .meth = HTTP_METH_PUT , .len=3, .text="PUT" },
},
['T' - 'A'] = {
[0] = { .meth = HTTP_METH_TRACE , .len=5, .text="TRACE" },
},
/* rest is empty like this :
* [1] = { .meth = HTTP_METH_NONE , .len=0, .text="" },
*/
};
/* It is about twice as fast on recent architectures to lookup a byte in a
* table than two perform a boolean AND or OR between two tests. Refer to
* RFC2616 for those chars.
*/
const char http_is_spht[256] = {
[' '] = 1, ['\t'] = 1,
};
const char http_is_crlf[256] = {
['\r'] = 1, ['\n'] = 1,
};
const char http_is_lws[256] = {
[' '] = 1, ['\t'] = 1,
['\r'] = 1, ['\n'] = 1,
};
const char http_is_sep[256] = {
['('] = 1, [')'] = 1, ['<'] = 1, ['>'] = 1,
['@'] = 1, [','] = 1, [';'] = 1, [':'] = 1,
['"'] = 1, ['/'] = 1, ['['] = 1, [']'] = 1,
['{'] = 1, ['}'] = 1, ['?'] = 1, ['='] = 1,
[' '] = 1, ['\t'] = 1, ['\\'] = 1,
};
const char http_is_ctl[256] = {
[0 ... 31] = 1,
[127] = 1,
};
/*
* A token is any ASCII char that is neither a separator nor a CTL char.
* Do not overwrite values in assignment since gcc-2.95 will not handle
* them correctly. Instead, define every non-CTL char's status.
*/
const char http_is_token[256] = {
[' '] = 0, ['!'] = 1, ['"'] = 0, ['#'] = 1,
['$'] = 1, ['%'] = 1, ['&'] = 1, ['\''] = 1,
['('] = 0, [')'] = 0, ['*'] = 1, ['+'] = 1,
[','] = 0, ['-'] = 1, ['.'] = 1, ['/'] = 0,
['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1,
['4'] = 1, ['5'] = 1, ['6'] = 1, ['7'] = 1,
['8'] = 1, ['9'] = 1, [':'] = 0, [';'] = 0,
['<'] = 0, ['='] = 0, ['>'] = 0, ['?'] = 0,
['@'] = 0, ['A'] = 1, ['B'] = 1, ['C'] = 1,
['D'] = 1, ['E'] = 1, ['F'] = 1, ['G'] = 1,
['H'] = 1, ['I'] = 1, ['J'] = 1, ['K'] = 1,
['L'] = 1, ['M'] = 1, ['N'] = 1, ['O'] = 1,
['P'] = 1, ['Q'] = 1, ['R'] = 1, ['S'] = 1,
['T'] = 1, ['U'] = 1, ['V'] = 1, ['W'] = 1,
['X'] = 1, ['Y'] = 1, ['Z'] = 1, ['['] = 0,
['\\'] = 0, [']'] = 0, ['^'] = 1, ['_'] = 1,
['`'] = 1, ['a'] = 1, ['b'] = 1, ['c'] = 1,
['d'] = 1, ['e'] = 1, ['f'] = 1, ['g'] = 1,
['h'] = 1, ['i'] = 1, ['j'] = 1, ['k'] = 1,
['l'] = 1, ['m'] = 1, ['n'] = 1, ['o'] = 1,
['p'] = 1, ['q'] = 1, ['r'] = 1, ['s'] = 1,
['t'] = 1, ['u'] = 1, ['v'] = 1, ['w'] = 1,
['x'] = 1, ['y'] = 1, ['z'] = 1, ['{'] = 0,
['|'] = 1, ['}'] = 0, ['~'] = 1,
};
/*
* An http ver_token is any ASCII which can be found in an HTTP version,
* which includes 'H', 'T', 'P', '/', '.' and any digit.
*/
const char http_is_ver_token[256] = {
['.'] = 1, ['/'] = 1,
['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1, ['4'] = 1,
['5'] = 1, ['6'] = 1, ['7'] = 1, ['8'] = 1, ['9'] = 1,
['H'] = 1, ['P'] = 1, ['T'] = 1,
};
#ifdef DEBUG_FULL
static char *cli_stnames[5] = {"HDR", "DAT", "SHR", "SHW", "CLS" };
static char *srv_stnames[7] = {"IDL", "CON", "HDR", "DAT", "SHR", "SHW", "CLS" };
#endif
/*
* Adds a header and its CRLF at the tail of buffer <b>, just before the last
* CRLF. Text length is measured first, so it cannot be NULL.
* The header is also automatically added to the index <hdr_idx>, and the end
* of headers is automatically adjusted. The number of bytes added is returned
* on success, otherwise <0 is returned indicating an error.
*/
int http_header_add_tail(struct buffer *b, struct http_msg *msg,
struct hdr_idx *hdr_idx, const char *text)
{
int bytes, len;
len = strlen(text);
bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len);
if (!bytes)
return -1;
msg->eoh += bytes;
return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail);
}
/*
* Adds a header and its CRLF at the tail of buffer <b>, just before the last
* CRLF. <len> bytes are copied, not counting the CRLF. If <text> is NULL, then
* the buffer is only opened and the space reserved, but nothing is copied.
* The header is also automatically added to the index <hdr_idx>, and the end
* of headers is automatically adjusted. The number of bytes added is returned
* on success, otherwise <0 is returned indicating an error.
*/
int http_header_add_tail2(struct buffer *b, struct http_msg *msg,
struct hdr_idx *hdr_idx, const char *text, int len)
{
int bytes;
bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len);
if (!bytes)
return -1;
msg->eoh += bytes;
return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail);
}
/*
* Checks if <hdr> is exactly <name> for <len> chars, and ends with a colon.
* If so, returns the position of the first non-space character relative to
* <hdr>, or <end>-<hdr> if not found before. If no value is found, it tries
* to return a pointer to the place after the first space. Returns 0 if the
* header name does not match. Checks are case-insensitive.
*/
int http_header_match2(const char *hdr, const char *end,
const char *name, int len)
{
const char *val;
if (hdr + len >= end)
return 0;
if (hdr[len] != ':')
return 0;
if (strncasecmp(hdr, name, len) != 0)
return 0;
val = hdr + len + 1;
while (val < end && HTTP_IS_SPHT(*val))
val++;
if ((val >= end) && (len + 2 <= end - hdr))
return len + 2; /* we may replace starting from second space */
return val - hdr;
}
/*
* returns a message to the client ; the connection is shut down for read,
* and the request is cleared so that no server connection can be initiated.
* The client must be in a valid state for this (HEADER, DATA ...).
* Nothing is performed on the server side. The message is contained in a
* "chunk". If it is null, then an empty message is used.
* The reply buffer doesn't need to be empty before this.
*/
void client_retnclose(struct session *s, const struct chunk *msg)
{
MY_FD_CLR(s->cli_fd, StaticReadEvent);
MY_FD_SET(s->cli_fd, StaticWriteEvent);
tv_eternity(&s->req->rex);
if (s->fe->clitimeout)
tv_delayfrom(&s->rep->wex, &now, s->fe->clitimeout);
else
tv_eternity(&s->rep->wex);
shutdown(s->cli_fd, SHUT_RD);
s->cli_state = CL_STSHUTR;
buffer_flush(s->rep);
if (msg->len)
buffer_write(s->rep, msg->str, msg->len);
s->req->l = 0;
}
/*
* returns a message into the rep buffer, and flushes the req buffer.
* The reply buffer doesn't need to be empty before this. The message
* is contained in a "chunk". If it is null, then an empty message is
* used.
*/
void client_return(struct session *s, const struct chunk *msg)
{
buffer_flush(s->rep);
if (msg->len)
buffer_write(s->rep, msg->str, msg->len);
s->req->l = 0;
}
/* This function turns the server state into the SV_STCLOSE, and sets
* indicators accordingly. Note that if <status> is 0, or if the message
* pointer is NULL, then no message is returned.
*/
void srv_close_with_err(struct session *t, int err, int finst,
int status, const struct chunk *msg)
{
t->srv_state = SV_STCLOSE;
if (status > 0 && msg) {
t->txn.status = status;
if (t->fe->mode == PR_MODE_HTTP)
client_return(t, msg);
}
if (!(t->flags & SN_ERR_MASK))
t->flags |= err;
if (!(t->flags & SN_FINST_MASK))
t->flags |= finst;
}
/* This function returns the appropriate error location for the given session
* and message.
*/
struct chunk *error_message(struct session *s, int msgnum)
{
if (s->be->beprm->errmsg[msgnum].str)
return &s->be->beprm->errmsg[msgnum];
else if (s->fe->errmsg[msgnum].str)
return &s->fe->errmsg[msgnum];
else
return &http_err_chunks[msgnum];
}
/*
* returns HTTP_METH_NONE if there is nothing valid to read (empty or non-text
* string), HTTP_METH_OTHER for unknown methods, or the identified method.
*/
static http_meth_t find_http_meth(const char *str, const int len)
{
unsigned char m;
const struct http_method_desc *h;
m = ((unsigned)*str - 'A');
if (m < 26) {
for (h = http_methods[m]; h->len > 0; h++) {
if (unlikely(h->len != len))
continue;
if (likely(memcmp(str, h->text, h->len) == 0))
return h->meth;
};
return HTTP_METH_OTHER;
}
return HTTP_METH_NONE;
}
/* Processes the client and server jobs of a session task, then
* puts it back to the wait queue in a clean state, or
* cleans up its resources if it must be deleted. Returns
* the time the task accepts to wait, or TIME_ETERNITY for
* infinity.
*/
int process_session(struct task *t)
{
struct session *s = t->context;
int fsm_resync = 0;
do {
fsm_resync = 0;
//fprintf(stderr,"before_cli:cli=%d, srv=%d\n", s->cli_state, s->srv_state);
fsm_resync |= process_cli(s);
//fprintf(stderr,"cli/srv:cli=%d, srv=%d\n", s->cli_state, s->srv_state);
fsm_resync |= process_srv(s);
//fprintf(stderr,"after_srv:cli=%d, srv=%d\n", s->cli_state, s->srv_state);
} while (fsm_resync);
if (s->cli_state != CL_STCLOSE || s->srv_state != SV_STCLOSE) {
struct timeval min1, min2;
s->req->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE;
s->rep->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE;
tv_min(&min1, &s->req->rex, &s->req->wex);
tv_min(&min2, &s->rep->rex, &s->rep->wex);
tv_min(&min1, &min1, &s->req->cex);
tv_min(&t->expire, &min1, &min2);
/* restore t to its place in the task list */
task_queue(t);
#ifdef DEBUG_FULL
/* DEBUG code : this should never ever happen, otherwise it indicates
* that a task still has something to do and will provoke a quick loop.
*/
if (tv_remain2(&now, &t->expire) <= 0)
exit(100);
#endif
return tv_remain2(&now, &t->expire); /* nothing more to do */
}
s->fe->feconn--;
if (s->flags & SN_BE_ASSIGNED)
s->be->beprm->beconn--;
actconn--;
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
int len;
len = sprintf(trash, "%08x:%s.closed[%04x:%04x]\n",
s->uniq_id, s->be->beprm->id,
(unsigned short)s->cli_fd, (unsigned short)s->srv_fd);
write(1, trash, len);
}
s->logs.t_close = tv_diff(&s->logs.tv_accept, &now);
if (s->req != NULL)
s->logs.bytes_in = s->req->total;
if (s->rep != NULL)
s->logs.bytes_out = s->rep->total;
s->fe->bytes_in += s->logs.bytes_in;
s->fe->bytes_out += s->logs.bytes_out;
if (s->be->beprm != s->fe) {
s->be->beprm->bytes_in += s->logs.bytes_in;
s->be->beprm->bytes_out += s->logs.bytes_out;
}
if (s->srv) {
s->srv->bytes_in += s->logs.bytes_in;
s->srv->bytes_out += s->logs.bytes_out;
}
/* let's do a final log if we need it */
if (s->logs.logwait &&
!(s->flags & SN_MONITOR) &&
(!(s->fe->options & PR_O_NULLNOLOG) || s->req->total))
sess_log(s);
/* the task MUST not be in the run queue anymore */
task_delete(t);
session_free(s);
task_free(t);
return TIME_ETERNITY; /* rest in peace for eternity */
}
/* either we find an LF at <ptr> or we jump to <bad>.
*/
#define EXPECT_LF_HERE(ptr, bad) do { if (unlikely(*(ptr) != '\n')) goto bad; } while (0)
/* plays with variables <ptr>, <end> and <state>. Jumps to <good> if OK,
* otherwise to <http_msg_ood> with <state> set to <st>.
*/
#define EAT_AND_JUMP_OR_RETURN(good, st) do { \
ptr++; \
if (likely(ptr < end)) \
goto good; \
else { \
state = (st); \
goto http_msg_ood; \
} \
} while (0)
/*
* Capture headers from message starting at <som> according to header list
* <cap_hdr>, and fill the <idx> structure appropriately.
*/
void capture_headers(char *som, struct hdr_idx *idx,
char **cap, struct cap_hdr *cap_hdr)
{
char *eol, *sol, *col, *sov;
int cur_idx;
struct cap_hdr *h;
int len;
sol = som + hdr_idx_first_pos(idx);
cur_idx = hdr_idx_first_idx(idx);
while (cur_idx) {
eol = sol + idx->v[cur_idx].len;
col = sol;
while (col < eol && *col != ':')
col++;
sov = col + 1;
while (sov < eol && http_is_lws[(unsigned char)*sov])
sov++;
for (h = cap_hdr; h; h = h->next) {
if ((h->namelen == col - sol) &&
(strncasecmp(sol, h->name, h->namelen) == 0)) {
if (cap[h->index] == NULL)
cap[h->index] =
pool_alloc_from(h->pool, h->len + 1);
if (cap[h->index] == NULL) {
Alert("HTTP capture : out of memory.\n");
continue;
}
len = eol - sov;
if (len > h->len)
len = h->len;
memcpy(cap[h->index], sov, len);
cap[h->index][len]=0;
}
}
sol = eol + idx->v[cur_idx].cr + 1;
cur_idx = idx->v[cur_idx].next;
}
}
/*
* This function parses a status line between <ptr> and <end>, starting with
* parser state <state>. Only states HTTP_MSG_RPVER, HTTP_MSG_RPVER_SP,
* HTTP_MSG_RPCODE, HTTP_MSG_RPCODE_SP and HTTP_MSG_RPREASON are handled. Others
* will give undefined results.
* Note that it is upon the caller's responsibility to ensure that ptr < end,
* and that msg->sol points to the beginning of the response.
* If a complete line is found (which implies that at least one CR or LF is
* found before <end>, the updated <ptr> is returned, otherwise NULL is
* returned indicating an incomplete line (which does not mean that parts have
* not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are
* non-NULL, they are fed with the new <ptr> and <state> values to be passed
* upon next call.
*
* This function was intentionnally designed to be called from
* http_msg_analyzer() with the lowest overhead. It should integrate perfectly
* within its state machine and use the same macros, hence the need for same
* labels and variable names.
*/
const char *http_parse_stsline(struct http_msg *msg, const char *msg_buf, int state,
const char *ptr, const char *end,
char **ret_ptr, int *ret_state)
{
__label__
http_msg_rpver,
http_msg_rpver_sp,
http_msg_rpcode,
http_msg_rpcode_sp,
http_msg_rpreason,
http_msg_rpline_eol,
http_msg_ood, /* out of data */
http_msg_invalid;
switch (state) {
http_msg_rpver:
case HTTP_MSG_RPVER:
if (likely(HTTP_IS_VER_TOKEN(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rpver, HTTP_MSG_RPVER);
if (likely(HTTP_IS_SPHT(*ptr))) {
msg->sl.st.v_l = (ptr - msg_buf) - msg->som;
EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP);
}
goto http_msg_invalid;
http_msg_rpver_sp:
case HTTP_MSG_RPVER_SP:
if (likely(!HTTP_IS_LWS(*ptr))) {
msg->sl.st.c = ptr - msg_buf;
goto http_msg_rpcode;
}
if (likely(HTTP_IS_SPHT(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP);
/* so it's a CR/LF, this is invalid */
goto http_msg_invalid;
http_msg_rpcode:
case HTTP_MSG_RPCODE:
if (likely(!HTTP_IS_LWS(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rpcode, HTTP_MSG_RPCODE);
if (likely(HTTP_IS_SPHT(*ptr))) {
msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c;
EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP);
}
/* so it's a CR/LF, so there is no reason phrase */
msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c;
http_msg_rsp_reason:
/* FIXME: should we support HTTP responses without any reason phrase ? */
msg->sl.st.r = ptr - msg_buf;
msg->sl.st.r_l = 0;
goto http_msg_rpline_eol;
http_msg_rpcode_sp:
case HTTP_MSG_RPCODE_SP:
if (likely(!HTTP_IS_LWS(*ptr))) {
msg->sl.st.r = ptr - msg_buf;
goto http_msg_rpreason;
}
if (likely(HTTP_IS_SPHT(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP);
/* so it's a CR/LF, so there is no reason phrase */
goto http_msg_rsp_reason;
http_msg_rpreason:
case HTTP_MSG_RPREASON:
if (likely(!HTTP_IS_CRLF(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rpreason, HTTP_MSG_RPREASON);
msg->sl.st.r_l = (ptr - msg_buf) - msg->sl.st.r;
http_msg_rpline_eol:
/* We have seen the end of line. Note that we do not
* necessarily have the \n yet, but at least we know that we
* have EITHER \r OR \n, otherwise the response would not be
* complete. We can then record the response length and return
* to the caller which will be able to register it.
*/
msg->sl.st.l = ptr - msg->sol;
return ptr;
#ifdef DEBUG_FULL
default:
fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
exit(1);
#endif
}
http_msg_ood:
/* out of data */
if (ret_state)
*ret_state = state;
if (ret_ptr)
*ret_ptr = (char *)ptr;
return NULL;
http_msg_invalid:
/* invalid message */
if (ret_state)
*ret_state = HTTP_MSG_ERROR;
return NULL;
}
/*
* This function parses a request line between <ptr> and <end>, starting with
* parser state <state>. Only states HTTP_MSG_RQMETH, HTTP_MSG_RQMETH_SP,
* HTTP_MSG_RQURI, HTTP_MSG_RQURI_SP and HTTP_MSG_RQVER are handled. Others
* will give undefined results.
* Note that it is upon the caller's responsibility to ensure that ptr < end,
* and that msg->sol points to the beginning of the request.
* If a complete line is found (which implies that at least one CR or LF is
* found before <end>, the updated <ptr> is returned, otherwise NULL is
* returned indicating an incomplete line (which does not mean that parts have
* not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are
* non-NULL, they are fed with the new <ptr> and <state> values to be passed
* upon next call.
*
* This function was intentionnally designed to be called from
* http_msg_analyzer() with the lowest overhead. It should integrate perfectly
* within its state machine and use the same macros, hence the need for same
* labels and variable names.
*/
const char *http_parse_reqline(struct http_msg *msg, const char *msg_buf, int state,
const char *ptr, const char *end,
char **ret_ptr, int *ret_state)
{
__label__
http_msg_rqmeth,
http_msg_rqmeth_sp,
http_msg_rquri,
http_msg_rquri_sp,
http_msg_rqver,
http_msg_rqline_eol,
http_msg_ood, /* out of data */
http_msg_invalid;
switch (state) {
http_msg_rqmeth:
case HTTP_MSG_RQMETH:
if (likely(HTTP_IS_TOKEN(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth, HTTP_MSG_RQMETH);
if (likely(HTTP_IS_SPHT(*ptr))) {
msg->sl.rq.m_l = (ptr - msg_buf) - msg->som;
EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP);
}
if (likely(HTTP_IS_CRLF(*ptr))) {
/* HTTP 0.9 request */
msg->sl.rq.m_l = (ptr - msg_buf) - msg->som;
http_msg_req09_uri:
msg->sl.rq.u = ptr - msg_buf;
http_msg_req09_uri_e:
msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u;
http_msg_req09_ver:
msg->sl.rq.v = ptr - msg_buf;
msg->sl.rq.v_l = 0;
goto http_msg_rqline_eol;
}
goto http_msg_invalid;
http_msg_rqmeth_sp:
case HTTP_MSG_RQMETH_SP:
if (likely(!HTTP_IS_LWS(*ptr))) {
msg->sl.rq.u = ptr - msg_buf;
goto http_msg_rquri;
}
if (likely(HTTP_IS_SPHT(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP);
/* so it's a CR/LF, meaning an HTTP 0.9 request */
goto http_msg_req09_uri;
http_msg_rquri:
case HTTP_MSG_RQURI:
if (likely(!HTTP_IS_LWS(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rquri, HTTP_MSG_RQURI);
if (likely(HTTP_IS_SPHT(*ptr))) {
msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u;
EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP);
}
/* so it's a CR/LF, meaning an HTTP 0.9 request */
goto http_msg_req09_uri_e;
http_msg_rquri_sp:
case HTTP_MSG_RQURI_SP:
if (likely(!HTTP_IS_LWS(*ptr))) {
msg->sl.rq.v = ptr - msg_buf;
goto http_msg_rqver;
}
if (likely(HTTP_IS_SPHT(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP);
/* so it's a CR/LF, meaning an HTTP 0.9 request */
goto http_msg_req09_ver;
http_msg_rqver:
case HTTP_MSG_RQVER:
if (likely(HTTP_IS_VER_TOKEN(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rqver, HTTP_MSG_RQVER);
if (likely(HTTP_IS_CRLF(*ptr))) {
msg->sl.rq.v_l = (ptr - msg_buf) - msg->sl.rq.v;
http_msg_rqline_eol:
/* We have seen the end of line. Note that we do not
* necessarily have the \n yet, but at least we know that we
* have EITHER \r OR \n, otherwise the request would not be
* complete. We can then record the request length and return
* to the caller which will be able to register it.
*/
msg->sl.rq.l = ptr - msg->sol;
return ptr;
}
/* neither an HTTP_VER token nor a CRLF */
goto http_msg_invalid;
#ifdef DEBUG_FULL
default:
fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
exit(1);
#endif
}
http_msg_ood:
/* out of data */
if (ret_state)
*ret_state = state;
if (ret_ptr)
*ret_ptr = (char *)ptr;
return NULL;
http_msg_invalid:
/* invalid message */
if (ret_state)
*ret_state = HTTP_MSG_ERROR;
return NULL;
}
/*
* This function parses an HTTP message, either a request or a response,
* depending on the initial msg->msg_state. It can be preempted everywhere
* when data are missing and recalled at the exact same location with no
* information loss. The header index is re-initialized when switching from
* MSG_R[PQ]BEFORE to MSG_RPVER|MSG_RQMETH.
*/
void http_msg_analyzer(struct buffer *buf, struct http_msg *msg, struct hdr_idx *idx)
{
__label__
http_msg_rqbefore,
http_msg_rqbefore_cr,
http_msg_rqmeth,
http_msg_rqline_end,
http_msg_hdr_first,
http_msg_hdr_name,
http_msg_hdr_l1_sp,
http_msg_hdr_l1_lf,
http_msg_hdr_l1_lws,
http_msg_hdr_val,
http_msg_hdr_l2_lf,
http_msg_hdr_l2_lws,
http_msg_complete_header,
http_msg_last_lf,
http_msg_ood, /* out of data */
http_msg_invalid;
int state; /* updated only when leaving the FSM */
register char *ptr, *end; /* request pointers, to avoid dereferences */
state = msg->msg_state;
ptr = buf->lr;
end = buf->r;
if (unlikely(ptr >= end))
goto http_msg_ood;
switch (state) {
/*
* First, states that are specific to the response only.
* We check them first so that request and headers are
* closer to each other (accessed more often).
*/
http_msg_rpbefore:
case HTTP_MSG_RPBEFORE:
if (likely(HTTP_IS_TOKEN(*ptr))) {
if (likely(ptr == buf->data)) {
msg->sol = ptr;
msg->som = 0;
} else {
#if PARSE_PRESERVE_EMPTY_LINES
/* only skip empty leading lines, don't remove them */
msg->sol = ptr;
msg->som = ptr - buf->data;
#else
/* Remove empty leading lines, as recommended by
* RFC2616. This takes a lot of time because we
* must move all the buffer backwards, but this
* is rarely needed. The method above will be
* cleaner when we'll be able to start sending
* the request from any place in the buffer.
*/
buf->lr = ptr;
buffer_replace2(buf, buf->data, buf->lr, NULL, 0);
msg->som = 0;
msg->sol = buf->data;
ptr = buf->data;
end = buf->r;
#endif
}
hdr_idx_init(idx);
state = HTTP_MSG_RPVER;
goto http_msg_rpver;
}
if (unlikely(!HTTP_IS_CRLF(*ptr)))
goto http_msg_invalid;
if (unlikely(*ptr == '\n'))
EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE);
EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore_cr, HTTP_MSG_RPBEFORE_CR);
/* stop here */
http_msg_rpbefore_cr:
case HTTP_MSG_RPBEFORE_CR:
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE);
/* stop here */
http_msg_rpver:
case HTTP_MSG_RPVER:
case HTTP_MSG_RPVER_SP:
case HTTP_MSG_RPCODE:
case HTTP_MSG_RPCODE_SP:
case HTTP_MSG_RPREASON:
ptr = (char *)http_parse_stsline(msg, buf->data, state, ptr, end,
&buf->lr, &msg->msg_state);
if (unlikely(!ptr))
return;
/* we have a full response and we know that we have either a CR
* or an LF at <ptr>.
*/
//fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.st.l, *ptr);
hdr_idx_set_start(idx, msg->sl.st.l, *ptr == '\r');
msg->sol = ptr;
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_rpline_end, HTTP_MSG_RPLINE_END);
goto http_msg_rpline_end;
http_msg_rpline_end:
case HTTP_MSG_RPLINE_END:
/* msg->sol must point to the first of CR or LF. */
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST);
/* stop here */
/*
* Second, states that are specific to the request only
*/
http_msg_rqbefore:
case HTTP_MSG_RQBEFORE:
if (likely(HTTP_IS_TOKEN(*ptr))) {
if (likely(ptr == buf->data)) {
msg->sol = ptr;
msg->som = 0;
} else {
#if PARSE_PRESERVE_EMPTY_LINES
/* only skip empty leading lines, don't remove them */
msg->sol = ptr;
msg->som = ptr - buf->data;
#else
/* Remove empty leading lines, as recommended by
* RFC2616. This takes a lot of time because we
* must move all the buffer backwards, but this
* is rarely needed. The method above will be
* cleaner when we'll be able to start sending
* the request from any place in the buffer.
*/
buf->lr = ptr;
buffer_replace2(buf, buf->data, buf->lr, NULL, 0);
msg->som = 0;
msg->sol = buf->data;
ptr = buf->data;
end = buf->r;
#endif
}
/* we will need this when keep-alive will be supported
hdr_idx_init(idx);
*/
state = HTTP_MSG_RQMETH;
goto http_msg_rqmeth;
}
if (unlikely(!HTTP_IS_CRLF(*ptr)))
goto http_msg_invalid;
if (unlikely(*ptr == '\n'))
EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE);
EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore_cr, HTTP_MSG_RQBEFORE_CR);
/* stop here */
http_msg_rqbefore_cr:
case HTTP_MSG_RQBEFORE_CR:
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE);
/* stop here */
http_msg_rqmeth:
case HTTP_MSG_RQMETH:
case HTTP_MSG_RQMETH_SP:
case HTTP_MSG_RQURI:
case HTTP_MSG_RQURI_SP:
case HTTP_MSG_RQVER:
ptr = (char *)http_parse_reqline(msg, buf->data, state, ptr, end,
&buf->lr, &msg->msg_state);
if (unlikely(!ptr))
return;
/* we have a full request and we know that we have either a CR
* or an LF at <ptr>.
*/
//fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.rq.l, *ptr);
hdr_idx_set_start(idx, msg->sl.rq.l, *ptr == '\r');
msg->sol = ptr;
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_rqline_end, HTTP_MSG_RQLINE_END);
goto http_msg_rqline_end;
http_msg_rqline_end:
case HTTP_MSG_RQLINE_END:
/* check for HTTP/0.9 request : no version information available.
* msg->sol must point to the first of CR or LF.
*/
if (unlikely(msg->sl.rq.v_l == 0))
goto http_msg_last_lf;
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST);
/* stop here */
/*
* Common states below
*/
http_msg_hdr_first:
case HTTP_MSG_HDR_FIRST:
msg->sol = ptr;
if (likely(!HTTP_IS_CRLF(*ptr))) {
goto http_msg_hdr_name;
}
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF);
goto http_msg_last_lf;
http_msg_hdr_name:
case HTTP_MSG_HDR_NAME:
/* assumes msg->sol points to the first char */
if (likely(HTTP_IS_TOKEN(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_name, HTTP_MSG_HDR_NAME);
if (likely(*ptr == ':')) {
msg->col = ptr - buf->data;
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP);
}
goto http_msg_invalid;
http_msg_hdr_l1_sp:
case HTTP_MSG_HDR_L1_SP:
/* assumes msg->sol points to the first char and msg->col to the colon */
if (likely(HTTP_IS_SPHT(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP);
/* header value can be basically anything except CR/LF */
msg->sov = ptr - buf->data;
if (likely(!HTTP_IS_CRLF(*ptr))) {
goto http_msg_hdr_val;
}
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lf, HTTP_MSG_HDR_L1_LF);
goto http_msg_hdr_l1_lf;
http_msg_hdr_l1_lf:
case HTTP_MSG_HDR_L1_LF:
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lws, HTTP_MSG_HDR_L1_LWS);
http_msg_hdr_l1_lws:
case HTTP_MSG_HDR_L1_LWS:
if (likely(HTTP_IS_SPHT(*ptr))) {
/* replace HT,CR,LF with spaces */
for (; buf->data+msg->sov < ptr; msg->sov++)
buf->data[msg->sov] = ' ';
goto http_msg_hdr_l1_sp;
}
/* we had a header consisting only in spaces ! */
msg->eol = buf->data + msg->sov;
goto http_msg_complete_header;
http_msg_hdr_val:
case HTTP_MSG_HDR_VAL:
/* assumes msg->sol points to the first char, msg->col to the
* colon, and msg->sov points to the first character of the
* value.
*/
if (likely(!HTTP_IS_CRLF(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_val, HTTP_MSG_HDR_VAL);
msg->eol = ptr;
/* Note: we could also copy eol into ->eoh so that we have the
* real header end in case it ends with lots of LWS, but is this
* really needed ?
*/
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lf, HTTP_MSG_HDR_L2_LF);
goto http_msg_hdr_l2_lf;
http_msg_hdr_l2_lf:
case HTTP_MSG_HDR_L2_LF:
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lws, HTTP_MSG_HDR_L2_LWS);
http_msg_hdr_l2_lws:
case HTTP_MSG_HDR_L2_LWS:
if (unlikely(HTTP_IS_SPHT(*ptr))) {
/* LWS: replace HT,CR,LF with spaces */
for (; msg->eol < ptr; msg->eol++)
*msg->eol = ' ';
goto http_msg_hdr_val;
}
http_msg_complete_header:
/*
* It was a new header, so the last one is finished.
* Assumes msg->sol points to the first char, msg->col to the
* colon, msg->sov points to the first character of the value
* and msg->eol to the first CR or LF so we know how the line
* ends. We insert last header into the index.
*/
/*
fprintf(stderr,"registering %-2d bytes : ", msg->eol - msg->sol);
write(2, msg->sol, msg->eol-msg->sol);
fprintf(stderr,"\n");
*/
if (unlikely(hdr_idx_add(msg->eol - msg->sol, *msg->eol == '\r',
idx, idx->tail) < 0))
goto http_msg_invalid;
msg->sol = ptr;
if (likely(!HTTP_IS_CRLF(*ptr))) {
goto http_msg_hdr_name;
}
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF);
goto http_msg_last_lf;
http_msg_last_lf:
case HTTP_MSG_LAST_LF:
/* Assumes msg->sol points to the first of either CR or LF */
EXPECT_LF_HERE(ptr, http_msg_invalid);
ptr++;
buf->lr = ptr;
msg->eoh = msg->sol - buf->data;
msg->msg_state = HTTP_MSG_BODY;
return;
#ifdef DEBUG_FULL
default:
fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
exit(1);
#endif
}
http_msg_ood:
/* out of data */
msg->msg_state = state;
buf->lr = ptr;
return;
http_msg_invalid:
/* invalid message */
msg->msg_state = HTTP_MSG_ERROR;
return;
}
/*
* manages the client FSM and its socket. BTW, it also tries to handle the
* cookie. It returns 1 if a state has changed (and a resync may be needed),
* 0 else.
*/
int process_cli(struct session *t)
{
int s = t->srv_state;
int c = t->cli_state;
struct buffer *req = t->req;
struct buffer *rep = t->rep;
DPRINTF(stderr,"process_cli: c=%s s=%s set(r,w)=%d,%d exp(r,w)=%d.%d,%d.%d\n",
cli_stnames[c], srv_stnames[s],
MY_FD_ISSET(t->cli_fd, StaticReadEvent), MY_FD_ISSET(t->cli_fd, StaticWriteEvent),
req->rex.tv_sec, req->rex.tv_usec,
rep->wex.tv_sec, rep->wex.tv_usec);
if (c == CL_STHEADERS) {
/*
* Now parse the partial (or complete) lines.
* We will check the request syntax, and also join multi-line
* headers. An index of all the lines will be elaborated while
* parsing.
*
* For the parsing, we use a 28 states FSM.
*
* Here is the information we currently have :
* req->data + req->som = beginning of request
* req->data + req->eoh = end of processed headers / start of current one
* req->data + req->eol = end of current header or line (LF or CRLF)
* req->lr = first non-visited byte
* req->r = end of data
*/
int cur_idx;
struct http_txn *txn = &t->txn;
struct http_msg *msg = &txn->req;
struct proxy *cur_proxy;
if (likely(req->lr < req->r))
http_msg_analyzer(req, msg, &txn->hdr_idx);
/* 1: we might have to print this header in debug mode */
if (unlikely((global.mode & MODE_DEBUG) &&
(!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) &&
(msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) {
char *eol, *sol;
sol = req->data + msg->som;
eol = sol + msg->sl.rq.l;
debug_hdr("clireq", t, sol, eol);
sol += hdr_idx_first_pos(&txn->hdr_idx);
cur_idx = hdr_idx_first_idx(&txn->hdr_idx);
while (cur_idx) {
eol = sol + txn->hdr_idx.v[cur_idx].len;
debug_hdr("clihdr", t, sol, eol);
sol = eol + txn->hdr_idx.v[cur_idx].cr + 1;
cur_idx = txn->hdr_idx.v[cur_idx].next;
}
}
/*
* Now we quickly check if we have found a full valid request.
* If not so, we check the FD and buffer states before leaving.
* A full request is indicated by the fact that we have seen
* the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid
* requests are checked first.
*
*/
if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
/*
* First, let's catch bad requests.
*/
if (unlikely(msg->msg_state == HTTP_MSG_ERROR))
goto return_bad_req;
/* 1: Since we are in header mode, if there's no space
* left for headers, we won't be able to free more
* later, so the session will never terminate. We
* must terminate it now.
*/
if (unlikely(req->l >= req->rlim - req->data)) {
/* FIXME: check if URI is set and return Status
* 414 Request URI too long instead.
*/
goto return_bad_req;
}
/* 2: have we encountered a read error or a close ? */
else if (unlikely(req->flags & (BF_READ_ERROR | BF_READ_NULL))) {
/* read error, or last read : give up. */
tv_eternity(&req->rex);
fd_delete(t->cli_fd);
t->cli_state = CL_STCLOSE;
t->fe->failed_req++;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_CLICL;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_R;
return 1;
}
/* 3: has the read timeout expired ? */
else if (unlikely(tv_cmp2_ms(&req->rex, &now) <= 0)) {
/* read timeout : give up with an error message. */
txn->status = 408;
client_retnclose(t, error_message(t, HTTP_ERR_408));
t->fe->failed_req++;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_CLITO;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_R;
return 1;
}
/* 4: do we need to re-enable the read socket ? */
else if (unlikely(! MY_FD_ISSET(t->cli_fd, StaticReadEvent))) {
/* fd in StaticReadEvent was disabled, perhaps because of a previous buffer
* full. We cannot loop here since stream_sock_read will disable it only if
* req->l == rlim-data
*/
MY_FD_SET(t->cli_fd, StaticReadEvent);
if (t->fe->clitimeout)
tv_delayfrom(&req->rex, &now, t->fe->clitimeout);
else
tv_eternity(&req->rex);
}
return t->cli_state != CL_STHEADERS;
}
/****************************************************************
* More interesting part now : we know that we have a complete *
* request which at least looks like HTTP. We have an indicator *
* of each header's length, so we can parse them quickly. *
****************************************************************/
/*
* 1: identify the method
*/
txn->meth = find_http_meth(&req->data[msg->som], msg->sl.rq.m_l);
/*
* 2: check if the URI matches the monitor_uri.
* We have to do this for every request which gets in, because
* the monitor-uri is defined by the frontend.
*/
if (unlikely((t->fe->monitor_uri_len != 0) &&
(t->fe->monitor_uri_len == msg->sl.rq.u_l) &&
!memcmp(&req->data[msg->sl.rq.u],
t->fe->monitor_uri,
t->fe->monitor_uri_len))) {
/*
* We have found the monitor URI
*/
t->flags |= SN_MONITOR;
txn->status = 200;
client_retnclose(t, &http_200_chunk);
goto return_prx_cond;
}
/*
* 3: Maybe we have to copy the original REQURI for the logs ?
* Note: we cannot log anymore if the request has been
* classified as invalid.
*/
if (unlikely(t->logs.logwait & LW_REQ)) {
/* we have a complete HTTP request that we must log */
if ((txn->uri = pool_alloc(requri)) != NULL) {
int urilen = msg->sl.rq.l;
if (urilen >= REQURI_LEN)
urilen = REQURI_LEN - 1;
memcpy(txn->uri, &req->data[msg->som], urilen);
txn->uri[urilen] = 0;
if (!(t->logs.logwait &= ~LW_REQ))
sess_log(t);
} else {
Alert("HTTP logging : out of memory.\n");
}
}
/* 4. We may have to convert HTTP/0.9 requests to HTTP/1.0 */
if (unlikely(msg->sl.rq.v_l == 0)) {
int delta;
char *cur_end;
msg->sol = req->data + msg->som;
cur_end = msg->sol + msg->sl.rq.l;
delta = 0;
if (msg->sl.rq.u_l == 0) {
/* if no URI was set, add "/" */
delta = buffer_replace2(req, cur_end, cur_end, " /", 2);
cur_end += delta;
msg->eoh += delta;
}
/* add HTTP version */
delta = buffer_replace2(req, cur_end, cur_end, " HTTP/1.0\r\n", 11);
msg->eoh += delta;
cur_end += delta;
cur_end = (char *)http_parse_reqline(msg, req->data,
HTTP_MSG_RQMETH,
msg->sol, cur_end + 1,
NULL, NULL);
if (unlikely(!cur_end))
goto return_bad_req;
/* we have a full HTTP/1.0 request now and we know that
* we have either a CR or an LF at <ptr>.
*/
hdr_idx_set_start(&txn->hdr_idx, msg->sl.rq.l, *cur_end == '\r');
}
/* 5: we may need to capture headers */
if (unlikely((t->logs.logwait & LW_REQHDR) && t->fe->fiprm->req_cap))
capture_headers(req->data + msg->som, &txn->hdr_idx,
txn->req.cap, t->fe->fiprm->req_cap);
/*
* 6: we will have to evaluate the filters.
* As opposed to version 1.2, now they will be evaluated in the
* filters order and not in the header order. This means that
* each filter has to be validated among all headers.
*
* We can now check whether we want to switch to another
* backend, in which case we will re-check the backend's
* filters and various options. In order to support 3-level
* switching, here's how we should proceed :
*
* a) run be->fiprm.
* if (switch) then switch ->be to the new backend.
* b) run be->fiprm if (be != fe).
* There cannot be any switch from there, so ->be cannot be
* changed anymore.
*
* => filters always apply to ->be, then ->be may change.
*
* The response path will be able to apply either ->be, or
* ->be then ->fe filters in order to match the reverse of
* the forward sequence.
*/
do {
struct proxy *rule_set = t->be->fiprm;
cur_proxy = t->be;
/* try headers filters */
if (rule_set->req_exp != NULL) {
if (apply_filters_to_request(t, req, rule_set->req_exp) < 0)
goto return_bad_req;
}
if (!(t->flags & SN_BE_ASSIGNED) && (t->be != cur_proxy)) {
/* to ensure correct connection accounting on
* the backend, we count the connection for the
* one managing the queue.
*/
t->be->beprm->beconn++;
if (t->be->beprm->beconn > t->be->beprm->beconn_max)
t->be->beprm->beconn_max = t->be->beprm->beconn;
t->be->beprm->cum_beconn++;
t->flags |= SN_BE_ASSIGNED;
}
/* has the request been denied ? */
if (txn->flags & TX_CLDENY) {
/* no need to go further */
txn->status = 403;
/* let's log the request time */
t->logs.t_request = tv_diff(&t->logs.tv_accept, &now);
client_retnclose(t, error_message(t, HTTP_ERR_403));
goto return_prx_cond;
}
/* We might have to check for "Connection:" */
if (((t->fe->options | t->be->beprm->options) & PR_O_HTTP_CLOSE) &&
!(t->flags & SN_CONN_CLOSED)) {
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx, delta, val;
struct hdr_idx_elem *cur_hdr;
cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
old_idx = 0;
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
val = http_header_match2(cur_ptr, cur_end, "Connection", 10);
if (val) {
/* 3 possibilities :
* - we have already set Connection: close,
* so we remove this line.
* - we have not yet set Connection: close,
* but this line indicates close. We leave
* it untouched and set the flag.
* - we have not yet set Connection: close,
* and this line indicates non-close. We
* replace it.
*/
if (t->flags & SN_CONN_CLOSED) {
delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
txn->req.eoh += delta;
cur_next += delta;
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
} else {
if (strncasecmp(cur_ptr + val, "close", 5) != 0) {
delta = buffer_replace2(req, cur_ptr + val, cur_end,
"close", 5);
cur_next += delta;
cur_hdr->len += delta;
txn->req.eoh += delta;
}
t->flags |= SN_CONN_CLOSED;
}
}
old_idx = cur_idx;
}
}
/* add request headers from the rule sets in the same order */
for (cur_idx = 0; cur_idx < rule_set->nb_reqadd; cur_idx++) {
if (unlikely(http_header_add_tail(req,
&txn->req,
&txn->hdr_idx,
rule_set->req_add[cur_idx])) < 0)
goto return_bad_req;
}
/* check if stats URI was requested, and if an auth is needed */
if (rule_set->uri_auth != NULL &&
(txn->meth == HTTP_METH_GET || txn->meth == HTTP_METH_HEAD)) {
/* we have to check the URI and auth for this request */
if (stats_check_uri_auth(t, rule_set))
return 1;
}
if (!(t->flags & SN_BE_ASSIGNED) && cur_proxy->defbe.be) {
/* No backend was set, but there was a default
* backend set in the frontend, so we use it and
* loop again.
*/
t->be = cur_proxy->defbe.be;
t->be->beprm->beconn++;
if (t->be->beprm->beconn > t->be->beprm->beconn_max)
t->be->beprm->beconn_max = t->be->beprm->beconn;
t->be->beprm->cum_beconn++;
t->flags |= SN_BE_ASSIGNED;
}
} while (t->be != cur_proxy); /* we loop only if t->be has changed */
if (!(t->flags & SN_BE_ASSIGNED)) {
/* To ensure correct connection accounting on
* the backend, we count the connection for the
* one managing the queue.
*/
t->be->beprm->beconn++;
if (t->be->beprm->beconn > t->be->beprm->beconn_max)
t->be->beprm->beconn_max = t->be->beprm->beconn;
t->be->beprm->cum_beconn++;
t->flags |= SN_BE_ASSIGNED;
}
/*
* Right now, we know that we have processed the entire headers
* and that unwanted requests have been filtered out. We can do
* whatever we want with the remaining request. Also, now we
* may have separate values for ->fe, ->be.
*/
/*
* 7: the appsession cookie was looked up very early in 1.2,
* so let's do the same now.
*/
/* It needs to look into the URI */
if (t->be->beprm->appsession_name) {
get_srv_from_appsession(t, &req->data[msg->som], msg->sl.rq.l);
}
/*
* 8: Now we can work with the cookies.
* Note that doing so might move headers in the request, but
* the fields will stay coherent and the URI will not move.
* This should only be performed in the backend.
*/
if (!(txn->flags & (TX_CLDENY|TX_CLTARPIT)))
manage_client_side_cookies(t, req);
/*
* 9: add X-Forwarded-For if either the frontend or the backend
* asks for it.
*/
if ((t->fe->options | t->be->beprm->options) & PR_O_FWDFOR) {
if (t->cli_addr.ss_family == AF_INET) {
/* Add an X-Forwarded-For header unless the source IP is
* in the 'except' network range.
*/
if ((!t->fe->except_mask.s_addr ||
(((struct sockaddr_in *)&t->cli_addr)->sin_addr.s_addr & t->fe->except_mask.s_addr)
!= t->fe->except_net.s_addr) &&
(!t->be->except_mask.s_addr ||
(((struct sockaddr_in *)&t->cli_addr)->sin_addr.s_addr & t->be->except_mask.s_addr)
!= t->be->except_net.s_addr)) {
int len;
unsigned char *pn;
pn = (unsigned char *)&((struct sockaddr_in *)&t->cli_addr)->sin_addr;
len = sprintf(trash, "X-Forwarded-For: %d.%d.%d.%d",
pn[0], pn[1], pn[2], pn[3]);
if (unlikely(http_header_add_tail2(req, &txn->req,
&txn->hdr_idx, trash, len)) < 0)
goto return_bad_req;
}
}
else if (t->cli_addr.ss_family == AF_INET6) {
/* FIXME: for the sake of completeness, we should also support
* 'except' here, although it is mostly useless in this case.
*/
int len;
char pn[INET6_ADDRSTRLEN];
inet_ntop(AF_INET6,
(const void *)&((struct sockaddr_in6 *)(&t->cli_addr))->sin6_addr,
pn, sizeof(pn));
len = sprintf(trash, "X-Forwarded-For: %s", pn);
if (unlikely(http_header_add_tail2(req, &txn->req,
&txn->hdr_idx, trash, len)) < 0)
goto return_bad_req;
}
}
/*
* 10: add "Connection: close" if needed and not yet set.
* Note that we do not need to add it in case of HTTP/1.0.
*/
if (!(t->flags & SN_CONN_CLOSED) &&
((t->fe->options | t->be->beprm->options) & PR_O_HTTP_CLOSE)) {
if ((unlikely(msg->sl.rq.v_l != 8) ||
unlikely(req->data[msg->som + msg->sl.rq.v + 7] != '0')) &&
unlikely(http_header_add_tail2(req, &txn->req, &txn->hdr_idx,
"Connection: close", 17)) < 0)
goto return_bad_req;
t->flags |= SN_CONN_CLOSED;
}
/*************************************************************
* OK, that's finished for the headers. We have done what we *
* could. Let's switch to the DATA state. *
************************************************************/
t->cli_state = CL_STDATA;
req->rlim = req->data + BUFSIZE; /* no more rewrite needed */
t->logs.t_request = tv_diff(&t->logs.tv_accept, &now);
if (!t->fe->clitimeout ||
(t->srv_state < SV_STDATA && t->be->beprm->srvtimeout)) {
/* If the client has no timeout, or if the server is not ready yet,
* and we know for sure that it can expire, then it's cleaner to
* disable the timeout on the client side so that too low values
* cannot make the sessions abort too early.
*
* FIXME-20050705: the server needs a way to re-enable this time-out
* when it switches its state, otherwise a client can stay connected
* indefinitely. This now seems to be OK.
*/
tv_eternity(&req->rex);
}
/* When a connection is tarpitted, we use the queue timeout for the
* tarpit delay, which currently happens to be the server's connect
* timeout. If unset, then set it to zero because we really want it
* to expire at one moment.
*/
if (txn->flags & TX_CLTARPIT) {
t->req->l = 0;
/* flush the request so that we can drop the connection early
* if the client closes first.
*/
tv_delayfrom(&req->cex, &now,
t->be->beprm->contimeout ? t->be->beprm->contimeout : 0);
}
/* OK let's go on with the BODY now */
goto process_data;
return_bad_req: /* let's centralize all bad requests */
txn->req.msg_state = HTTP_MSG_ERROR;
txn->status = 400;
client_retnclose(t, error_message(t, HTTP_ERR_400));
t->fe->failed_req++;
return_prx_cond:
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_PRXCOND;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_R;
return 1;
}
else if (c == CL_STDATA) {
process_data:
/* FIXME: this error handling is partly buggy because we always report
* a 'DATA' phase while we don't know if the server was in IDLE, CONN
* or HEADER phase. BTW, it's not logical to expire the client while
* we're waiting for the server to connect.
*/
/* read or write error */
if (rep->flags & BF_WRITE_ERROR || req->flags & BF_READ_ERROR) {
tv_eternity(&req->rex);
tv_eternity(&rep->wex);
fd_delete(t->cli_fd);
t->cli_state = CL_STCLOSE;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_CLICL;
if (!(t->flags & SN_FINST_MASK)) {
if (t->pend_pos)
t->flags |= SN_FINST_Q;
else if (s == SV_STCONN)
t->flags |= SN_FINST_C;
else
t->flags |= SN_FINST_D;
}
return 1;
}
/* last read, or end of server write */
else if (req->flags & BF_READ_NULL || s == SV_STSHUTW || s == SV_STCLOSE) {
MY_FD_CLR(t->cli_fd, StaticReadEvent);
tv_eternity(&req->rex);
shutdown(t->cli_fd, SHUT_RD);
t->cli_state = CL_STSHUTR;
return 1;
}
/* last server read and buffer empty */
else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0)) {
MY_FD_CLR(t->cli_fd, StaticWriteEvent);
tv_eternity(&rep->wex);
shutdown(t->cli_fd, SHUT_WR);
/* We must ensure that the read part is still alive when switching
* to shutw */
MY_FD_SET(t->cli_fd, StaticReadEvent);
if (t->fe->clitimeout)
tv_delayfrom(&req->rex, &now, t->fe->clitimeout);
t->cli_state = CL_STSHUTW;
//fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
return 1;
}
/* read timeout */
else if (tv_cmp2_ms(&req->rex, &now) <= 0) {
MY_FD_CLR(t->cli_fd, StaticReadEvent);
tv_eternity(&req->rex);
shutdown(t->cli_fd, SHUT_RD);
t->cli_state = CL_STSHUTR;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_CLITO;
if (!(t->flags & SN_FINST_MASK)) {
if (t->pend_pos)
t->flags |= SN_FINST_Q;
else if (s == SV_STCONN)
t->flags |= SN_FINST_C;
else
t->flags |= SN_FINST_D;
}
return 1;
}
/* write timeout */
else if (tv_cmp2_ms(&rep->wex, &now) <= 0) {
MY_FD_CLR(t->cli_fd, StaticWriteEvent);
tv_eternity(&rep->wex);
shutdown(t->cli_fd, SHUT_WR);
/* We must ensure that the read part is still alive when switching
* to shutw */
MY_FD_SET(t->cli_fd, StaticReadEvent);
if (t->fe->clitimeout)
tv_delayfrom(&req->rex, &now, t->fe->clitimeout);
t->cli_state = CL_STSHUTW;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_CLITO;
if (!(t->flags & SN_FINST_MASK)) {
if (t->pend_pos)
t->flags |= SN_FINST_Q;
else if (s == SV_STCONN)
t->flags |= SN_FINST_C;
else
t->flags |= SN_FINST_D;
}
return 1;
}
if (req->l >= req->rlim - req->data) {
/* no room to read more data */
if (MY_FD_ISSET(t->cli_fd, StaticReadEvent)) {
/* stop reading until we get some space */
MY_FD_CLR(t->cli_fd, StaticReadEvent);
tv_eternity(&req->rex);
}
} else {
/* there's still some space in the buffer */
if (! MY_FD_ISSET(t->cli_fd, StaticReadEvent)) {
MY_FD_SET(t->cli_fd, StaticReadEvent);
if (!t->fe->clitimeout ||
(t->srv_state < SV_STDATA && t->be->beprm->srvtimeout))
/* If the client has no timeout, or if the server not ready yet, and we
* know for sure that it can expire, then it's cleaner to disable the
* timeout on the client side so that too low values cannot make the
* sessions abort too early.
*/
tv_eternity(&req->rex);
else
tv_delayfrom(&req->rex, &now, t->fe->clitimeout);
}
}
if ((rep->l == 0) ||
((s < SV_STDATA) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) {
if (MY_FD_ISSET(t->cli_fd, StaticWriteEvent)) {
MY_FD_CLR(t->cli_fd, StaticWriteEvent); /* stop writing */
tv_eternity(&rep->wex);
}
} else {
/* buffer not empty */
if (! MY_FD_ISSET(t->cli_fd, StaticWriteEvent)) {
MY_FD_SET(t->cli_fd, StaticWriteEvent); /* restart writing */
if (t->fe->clitimeout) {
tv_delayfrom(&rep->wex, &now, t->fe->clitimeout);
/* FIXME: to prevent the client from expiring read timeouts during writes,
* we refresh it. */
req->rex = rep->wex;
}
else
tv_eternity(&rep->wex);
}
}
return 0; /* other cases change nothing */
}
else if (c == CL_STSHUTR) {
if (rep->flags & BF_WRITE_ERROR) {
tv_eternity(&rep->wex);
fd_delete(t->cli_fd);
t->cli_state = CL_STCLOSE;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_CLICL;
if (!(t->flags & SN_FINST_MASK)) {
if (t->pend_pos)
t->flags |= SN_FINST_Q;
else if (s == SV_STCONN)
t->flags |= SN_FINST_C;
else
t->flags |= SN_FINST_D;
}
return 1;
}
else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0)
&& !(t->flags & SN_SELF_GEN)) {
tv_eternity(&rep->wex);
fd_delete(t->cli_fd);
t->cli_state = CL_STCLOSE;
return 1;
}
else if (tv_cmp2_ms(&rep->wex, &now) <= 0) {
tv_eternity(&rep->wex);
fd_delete(t->cli_fd);
t->cli_state = CL_STCLOSE;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_CLITO;
if (!(t->flags & SN_FINST_MASK)) {
if (t->pend_pos)
t->flags |= SN_FINST_Q;
else if (s == SV_STCONN)
t->flags |= SN_FINST_C;
else
t->flags |= SN_FINST_D;
}
return 1;
}
if (t->flags & SN_SELF_GEN) {
produce_content(t);
if (rep->l == 0) {
tv_eternity(&rep->wex);
fd_delete(t->cli_fd);
t->cli_state = CL_STCLOSE;
return 1;
}
}
if ((rep->l == 0)
|| ((s == SV_STHEADERS) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) {
if (MY_FD_ISSET(t->cli_fd, StaticWriteEvent)) {
MY_FD_CLR(t->cli_fd, StaticWriteEvent); /* stop writing */
tv_eternity(&rep->wex);
}
} else {
/* buffer not empty */
if (! MY_FD_ISSET(t->cli_fd, StaticWriteEvent)) {
MY_FD_SET(t->cli_fd, StaticWriteEvent); /* restart writing */
if (t->fe->clitimeout) {
tv_delayfrom(&rep->wex, &now, t->fe->clitimeout);
/* FIXME: to prevent the client from expiring read timeouts during writes,
* we refresh it. */
req->rex = rep->wex;
}
else
tv_eternity(&rep->wex);
}
}
return 0;
}
else if (c == CL_STSHUTW) {
if (req->flags & BF_READ_ERROR) {
tv_eternity(&req->rex);
fd_delete(t->cli_fd);
t->cli_state = CL_STCLOSE;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_CLICL;
if (!(t->flags & SN_FINST_MASK)) {
if (t->pend_pos)
t->flags |= SN_FINST_Q;
else if (s == SV_STCONN)
t->flags |= SN_FINST_C;
else
t->flags |= SN_FINST_D;
}
return 1;
}
else if (req->flags & BF_READ_NULL || s == SV_STSHUTW || s == SV_STCLOSE) {
tv_eternity(&req->rex);
fd_delete(t->cli_fd);
t->cli_state = CL_STCLOSE;
return 1;
}
else if (tv_cmp2_ms(&req->rex, &now) <= 0) {
tv_eternity(&req->rex);
fd_delete(t->cli_fd);
t->cli_state = CL_STCLOSE;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_CLITO;
if (!(t->flags & SN_FINST_MASK)) {
if (t->pend_pos)
t->flags |= SN_FINST_Q;
else if (s == SV_STCONN)
t->flags |= SN_FINST_C;
else
t->flags |= SN_FINST_D;
}
return 1;
}
else if (req->l >= req->rlim - req->data) {
/* no room to read more data */
/* FIXME-20050705: is it possible for a client to maintain a session
* after the timeout by sending more data after it receives a close ?
*/
if (MY_FD_ISSET(t->cli_fd, StaticReadEvent)) {
/* stop reading until we get some space */
MY_FD_CLR(t->cli_fd, StaticReadEvent);
tv_eternity(&req->rex);
//fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
}
} else {
/* there's still some space in the buffer */
if (! MY_FD_ISSET(t->cli_fd, StaticReadEvent)) {
MY_FD_SET(t->cli_fd, StaticReadEvent);
if (t->fe->clitimeout)
tv_delayfrom(&req->rex, &now, t->fe->clitimeout);
else
tv_eternity(&req->rex);
//fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
}
}
return 0;
}
else { /* CL_STCLOSE: nothing to do */
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
int len;
len = sprintf(trash, "%08x:%s.clicls[%04x:%04x]\n", t->uniq_id, t->be->beprm->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
write(1, trash, len);
}
return 0;
}
return 0;
}
/*
* manages the server FSM and its socket. It returns 1 if a state has changed
* (and a resync may be needed), 0 else.
*/
int process_srv(struct session *t)
{
int s = t->srv_state;
int c = t->cli_state;
struct http_txn *txn = &t->txn;
struct buffer *req = t->req;
struct buffer *rep = t->rep;
int conn_err;
#ifdef DEBUG_FULL
fprintf(stderr,"process_srv: c=%s, s=%s\n", cli_stnames[c], srv_stnames[s]);
#endif
//fprintf(stderr,"process_srv: c=%d, s=%d, cr=%d, cw=%d, sr=%d, sw=%d\n", c, s,
//MY_FD_ISSET(t->cli_fd, StaticReadEvent), MY_FD_ISSET(t->cli_fd, StaticWriteEvent),
//MY_FD_ISSET(t->srv_fd, StaticReadEvent), MY_FD_ISSET(t->srv_fd, StaticWriteEvent)
//);
if (s == SV_STIDLE) {
if (c == CL_STHEADERS)
return 0; /* stay in idle, waiting for data to reach the client side */
else if (c == CL_STCLOSE || c == CL_STSHUTW ||
(c == CL_STSHUTR &&
(t->req->l == 0 || t->be->beprm->options & PR_O_ABRT_CLOSE))) { /* give up */
tv_eternity(&req->cex);
if (t->pend_pos)
t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now);
/* note that this must not return any error because it would be able to
* overwrite the client_retnclose() output.
*/
if (txn->flags & TX_CLTARPIT)
srv_close_with_err(t, SN_ERR_CLICL, SN_FINST_T, 0, NULL);
else
srv_close_with_err(t, SN_ERR_CLICL, t->pend_pos ? SN_FINST_Q : SN_FINST_C, 0, NULL);
return 1;
}
else {
if (txn->flags & TX_CLTARPIT) {
/* This connection is being tarpitted. The CLIENT side has
* already set the connect expiration date to the right
* timeout. We just have to check that it has not expired.
*/
if (tv_cmp2_ms(&req->cex, &now) > 0)
return 0;
/* We will set the queue timer to the time spent, just for
* logging purposes. We fake a 500 server error, so that the
* attacker will not suspect his connection has been tarpitted.
* It will not cause trouble to the logs because we can exclude
* the tarpitted connections by filtering on the 'PT' status flags.
*/
tv_eternity(&req->cex);
t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now);
srv_close_with_err(t, SN_ERR_PRXCOND, SN_FINST_T,
500, error_message(t, HTTP_ERR_500));
return 1;
}
/* Right now, we will need to create a connection to the server.
* We might already have tried, and got a connection pending, in
* which case we will not do anything till it's pending. It's up
* to any other session to release it and wake us up again.
*/
if (t->pend_pos) {
if (tv_cmp2_ms(&req->cex, &now) > 0)
return 0;
else {
/* we've been waiting too long here */
tv_eternity(&req->cex);
t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now);
srv_close_with_err(t, SN_ERR_SRVTO, SN_FINST_Q,
503, error_message(t, HTTP_ERR_503));
if (t->srv)
t->srv->failed_conns++;
t->fe->failed_conns++;
return 1;
}
}
do {
/* first, get a connection */
if (srv_redispatch_connect(t))
return t->srv_state != SV_STIDLE;
/* try to (re-)connect to the server, and fail if we expire the
* number of retries.
*/
if (srv_retryable_connect(t)) {
t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now);
return t->srv_state != SV_STIDLE;
}
} while (1);
}
}
else if (s == SV_STCONN) { /* connection in progress */
if (c == CL_STCLOSE || c == CL_STSHUTW ||
(c == CL_STSHUTR &&
(t->req->l == 0 || t->be->beprm->options & PR_O_ABRT_CLOSE))) { /* give up */
tv_eternity(&req->cex);
fd_delete(t->srv_fd);
if (t->srv)
t->srv->cur_sess--;
/* note that this must not return any error because it would be able to
* overwrite the client_retnclose() output.
*/
srv_close_with_err(t, SN_ERR_CLICL, SN_FINST_C, 0, NULL);
return 1;
}
if (!(req->flags & BF_WRITE_STATUS) && tv_cmp2_ms(&req->cex, &now) > 0) {
//fprintf(stderr,"1: c=%d, s=%d, now=%d.%06d, exp=%d.%06d\n", c, s, now.tv_sec, now.tv_usec, req->cex.tv_sec, req->cex.tv_usec);
return 0; /* nothing changed */
}
else if (!(req->flags & BF_WRITE_STATUS) || (req->flags & BF_WRITE_ERROR)) {
/* timeout, asynchronous connect error or first write error */
//fprintf(stderr,"2: c=%d, s=%d\n", c, s);
fd_delete(t->srv_fd);
if (t->srv)
t->srv->cur_sess--;
if (!(req->flags & BF_WRITE_STATUS))
conn_err = SN_ERR_SRVTO; // it was a connect timeout.
else
conn_err = SN_ERR_SRVCL; // it was an asynchronous connect error.
/* ensure that we have enough retries left */
if (srv_count_retry_down(t, conn_err))
return 1;
if (t->srv && t->conn_retries == 0 && t->be->beprm->options & PR_O_REDISP) {
/* We're on our last chance, and the REDISP option was specified.
* We will ignore cookie and force to balance or use the dispatcher.
*/
/* let's try to offer this slot to anybody */
if (may_dequeue_tasks(t->srv, t->be->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
if (t->srv)
t->srv->failed_conns++;
t->be->beprm->failed_conns++;
t->flags &= ~(SN_DIRECT | SN_ASSIGNED | SN_ADDR_SET);
t->srv = NULL; /* it's left to the dispatcher to choose a server */
http_flush_cookie_flags(txn);
/* first, get a connection */
if (srv_redispatch_connect(t))
return t->srv_state != SV_STIDLE;
}
do {
/* Now we will try to either reconnect to the same server or
* connect to another server. If the connection gets queued
* because all servers are saturated, then we will go back to
* the SV_STIDLE state.
*/
if (srv_retryable_connect(t)) {
t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now);
return t->srv_state != SV_STCONN;
}
/* we need to redispatch the connection to another server */
if (srv_redispatch_connect(t))
return t->srv_state != SV_STCONN;
} while (1);
}
else { /* no error or write 0 */
t->logs.t_connect = tv_diff(&t->logs.tv_accept, &now);
//fprintf(stderr,"3: c=%d, s=%d\n", c, s);
if (req->l == 0) /* nothing to write */ {
MY_FD_CLR(t->srv_fd, StaticWriteEvent);
tv_eternity(&req->wex);
} else /* need the right to write */ {
MY_FD_SET(t->srv_fd, StaticWriteEvent);
if (t->be->beprm->srvtimeout) {
tv_delayfrom(&req->wex, &now, t->be->beprm->srvtimeout);
/* FIXME: to prevent the server from expiring read timeouts during writes,
* we refresh it. */
rep->rex = req->wex;
}
else
tv_eternity(&req->wex);
}
if (t->be->beprm->mode == PR_MODE_TCP) { /* let's allow immediate data connection in this case */
MY_FD_SET(t->srv_fd, StaticReadEvent);
if (t->be->beprm->srvtimeout)
tv_delayfrom(&rep->rex, &now, t->be->beprm->srvtimeout);
else
tv_eternity(&rep->rex);
t->srv_state = SV_STDATA;
if (t->srv)
t->srv->cum_sess++;
rep->rlim = rep->data + BUFSIZE; /* no rewrite needed */
/* if the user wants to log as soon as possible, without counting
bytes from the server, then this is the right moment. */
if (t->fe->to_log && !(t->logs.logwait & LW_BYTES)) {
t->logs.t_close = t->logs.t_connect; /* to get a valid end date */
sess_log(t);
}
#ifdef CONFIG_HAP_TCPSPLICE
if ((t->fe->options & t->be->beprm->options) & PR_O_TCPSPLICE) {
/* TCP splicing supported by both FE and BE */
tcp_splice_splicefd(t->cli_fd, t->srv_fd, 0);
}
#endif
}
else {
t->srv_state = SV_STHEADERS;
if (t->srv)
t->srv->cum_sess++;
rep->rlim = rep->data + BUFSIZE - MAXREWRITE; /* rewrite needed */
t->txn.rsp.msg_state = HTTP_MSG_RPBEFORE;
/* reset hdr_idx which was already initialized by the request.
* right now, the http parser does it.
* hdr_idx_init(&t->txn.hdr_idx);
*/
}
tv_eternity(&req->cex);
return 1;
}
}
else if (s == SV_STHEADERS) { /* receiving server headers */
/*
* Now parse the partial (or complete) lines.
* We will check the response syntax, and also join multi-line
* headers. An index of all the lines will be elaborated while
* parsing.
*
* For the parsing, we use a 28 states FSM.
*
* Here is the information we currently have :
* rep->data + req->som = beginning of response
* rep->data + req->eoh = end of processed headers / start of current one
* rep->data + req->eol = end of current header or line (LF or CRLF)
* rep->lr = first non-visited byte
* rep->r = end of data
*/
int cur_idx;
struct http_msg *msg = &txn->rsp;
struct proxy *cur_proxy;
if (likely(rep->lr < rep->r))
http_msg_analyzer(rep, msg, &txn->hdr_idx);
/* 1: we might have to print this header in debug mode */
if (unlikely((global.mode & MODE_DEBUG) &&
(!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) &&
(msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) {
char *eol, *sol;
sol = rep->data + msg->som;
eol = sol + msg->sl.rq.l;
debug_hdr("srvrep", t, sol, eol);
sol += hdr_idx_first_pos(&txn->hdr_idx);
cur_idx = hdr_idx_first_idx(&txn->hdr_idx);
while (cur_idx) {
eol = sol + txn->hdr_idx.v[cur_idx].len;
debug_hdr("srvhdr", t, sol, eol);
sol = eol + txn->hdr_idx.v[cur_idx].cr + 1;
cur_idx = txn->hdr_idx.v[cur_idx].next;
}
}
if ((rep->l < rep->rlim - rep->data) && ! MY_FD_ISSET(t->srv_fd, StaticReadEvent)) {
/* fd in StaticReadEvent was disabled, perhaps because of a previous buffer
* full. We cannot loop here since stream_sock_read will disable it only if
* rep->l == rlim-data
*/
MY_FD_SET(t->srv_fd, StaticReadEvent);
if (t->be->beprm->srvtimeout)
tv_delayfrom(&rep->rex, &now, t->be->beprm->srvtimeout);
else
tv_eternity(&rep->rex);
}
/*
* Now we quickly check if we have found a full valid response.
* If not so, we check the FD and buffer states before leaving.
* A full response is indicated by the fact that we have seen
* the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid
* responses are checked first.
*
* Depending on whether the client is still there or not, we
* may send an error response back or not. Note that normally
* we should only check for HTTP status there, and check I/O
* errors somewhere else.
*/
if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
/* Invalid response, or read error or write error */
if (unlikely((msg->msg_state == HTTP_MSG_ERROR) ||
(req->flags & BF_WRITE_ERROR) ||
(rep->flags & BF_READ_ERROR))) {
tv_eternity(&rep->rex);
tv_eternity(&req->wex);
fd_delete(t->srv_fd);
if (t->srv) {
t->srv->cur_sess--;
t->srv->failed_resp++;
}
t->be->failed_resp++;
t->srv_state = SV_STCLOSE;
txn->status = 502;
client_return(t, error_message(t, HTTP_ERR_502));
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVCL;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_H;
/* We used to have a free connection slot. Since we'll never use it,
* we have to inform the server that it may be used by another session.
*/
if (t->srv && may_dequeue_tasks(t->srv, t->be->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
return 1;
}
/* end of client write or end of server read.
* since we are in header mode, if there's no space left for headers, we
* won't be able to free more later, so the session will never terminate.
*/
else if (unlikely(rep->flags & BF_READ_NULL ||
c == CL_STSHUTW || c == CL_STCLOSE ||
rep->l >= rep->rlim - rep->data)) {
MY_FD_CLR(t->srv_fd, StaticReadEvent);
tv_eternity(&rep->rex);
shutdown(t->srv_fd, SHUT_RD);
t->srv_state = SV_STSHUTR;
//fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
return 1;
}
/* read timeout : return a 504 to the client.
*/
else if (unlikely(MY_FD_ISSET(t->srv_fd, StaticReadEvent) &&
tv_cmp2_ms(&rep->rex, &now) <= 0)) {
tv_eternity(&rep->rex);
tv_eternity(&req->wex);
fd_delete(t->srv_fd);
if (t->srv) {
t->srv->cur_sess--;
t->srv->failed_resp++;
}
t->be->failed_resp++;
t->srv_state = SV_STCLOSE;
txn->status = 504;
client_return(t, error_message(t, HTTP_ERR_504));
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVTO;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_H;
/* We used to have a free connection slot. Since we'll never use it,
* we have to inform the server that it may be used by another session.
*/
if (t->srv && may_dequeue_tasks(t->srv, t->be->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
return 1;
}
/* last client read and buffer empty */
/* FIXME!!! here, we don't want to switch to SHUTW if the
* client shuts read too early, because we may still have
* some work to do on the headers.
* The side-effect is that if the client completely closes its
* connection during SV_STHEADER, the connection to the server
* is kept until a response comes back or the timeout is reached.
*/
else if (unlikely((/*c == CL_STSHUTR ||*/ c == CL_STCLOSE) &&
(req->l == 0))) {
MY_FD_CLR(t->srv_fd, StaticWriteEvent);
tv_eternity(&req->wex);
/* We must ensure that the read part is still
* alive when switching to shutw */
MY_FD_SET(t->srv_fd, StaticReadEvent);
if (t->be->beprm->srvtimeout)
tv_delayfrom(&rep->rex, &now, t->be->beprm->srvtimeout);
shutdown(t->srv_fd, SHUT_WR);
t->srv_state = SV_STSHUTW;
return 1;
}
/* write timeout */
/* FIXME!!! here, we don't want to switch to SHUTW if the
* client shuts read too early, because we may still have
* some work to do on the headers.
*/
else if (unlikely(MY_FD_ISSET(t->srv_fd, StaticWriteEvent) &&
tv_cmp2_ms(&req->wex, &now) <= 0)) {
MY_FD_CLR(t->srv_fd, StaticWriteEvent);
tv_eternity(&req->wex);
shutdown(t->srv_fd, SHUT_WR);
/* We must ensure that the read part is still alive
* when switching to shutw */
MY_FD_SET(t->srv_fd, StaticReadEvent);
if (t->be->beprm->srvtimeout)
tv_delayfrom(&rep->rex, &now, t->be->beprm->srvtimeout);
t->srv_state = SV_STSHUTW;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVTO;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_H;
return 1;
}
/*
* And now the non-error cases.
*/
/* Data remaining in the request buffer.
* This happens during the first pass here, and during
* long posts.
*/
else if (likely(req->l)) {
if (! MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
MY_FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */
if (t->be->beprm->srvtimeout) {
tv_delayfrom(&req->wex, &now, t->be->beprm->srvtimeout);
/* FIXME: to prevent the server from expiring read timeouts during writes,
* we refresh it. */
rep->rex = req->wex;
}
else
tv_eternity(&req->wex);
}
}
/* nothing left in the request buffer */
else {
if (MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
MY_FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */
tv_eternity(&req->wex);
}
}
return t->srv_state != SV_STHEADERS;
}
/*****************************************************************
* More interesting part now : we know that we have a complete *
* response which at least looks like HTTP. We have an indicator *
* of each header's length, so we can parse them quickly. *
****************************************************************/
/*
* 1: get the status code and check for cacheability.
*/
t->logs.logwait &= ~LW_RESP;
txn->status = strl2ui(rep->data + msg->sl.st.c, msg->sl.st.c_l);
switch (txn->status) {
case 200:
case 203:
case 206:
case 300:
case 301:
case 410:
/* RFC2616 @13.4:
* "A response received with a status code of
* 200, 203, 206, 300, 301 or 410 MAY be stored
* by a cache (...) unless a cache-control
* directive prohibits caching."
*
* RFC2616 @9.5: POST method :
* "Responses to this method are not cacheable,
* unless the response includes appropriate
* Cache-Control or Expires header fields."
*/
if (likely(txn->meth != HTTP_METH_POST) &&
unlikely(t->be->beprm->options & PR_O_CHK_CACHE))
txn->flags |= TX_CACHEABLE | TX_CACHE_COOK;
break;
default:
break;
}
/*
* 2: we may need to capture headers
*/
if (unlikely((t->logs.logwait & LW_RSPHDR) && t->fe->fiprm->rsp_cap))
capture_headers(rep->data + msg->som, &txn->hdr_idx,
txn->rsp.cap, t->fe->fiprm->rsp_cap);
/*
* 3: we will have to evaluate the filters.
* As opposed to version 1.2, now they will be evaluated in the
* filters order and not in the header order. This means that
* each filter has to be validated among all headers.
*
* Filters are tried with ->be first, then with ->fe if it is
* different from ->be.
*/
t->flags &= ~SN_CONN_CLOSED; /* prepare for inspection */
cur_proxy = t->be;
while (1) {
struct proxy *rule_set = cur_proxy->fiprm;
/* try headers filters */
if (rule_set->rsp_exp != NULL) {
if (apply_filters_to_response(t, rep, rule_set->rsp_exp) < 0) {
return_bad_resp:
if (t->srv) {
t->srv->cur_sess--;
t->srv->failed_resp++;
}
cur_proxy->beprm->failed_resp++;
return_srv_prx_502:
tv_eternity(&rep->rex);
tv_eternity(&req->wex);
fd_delete(t->srv_fd);
t->srv_state = SV_STCLOSE;
txn->status = 502;
client_return(t, error_message(t, HTTP_ERR_502));
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_PRXCOND;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_H;
/* We used to have a free connection slot. Since we'll never use it,
* we have to inform the server that it may be used by another session.
*/
if (t->srv && may_dequeue_tasks(t->srv, cur_proxy->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
return 1;
}
}
/* has the response been denied ? */
if (txn->flags & TX_SVDENY) {
if (t->srv) {
t->srv->cur_sess--;
t->srv->failed_secu++;
}
cur_proxy->beprm->denied_resp++;
goto return_srv_prx_502;
}
/* We might have to check for "Connection:" */
if (((t->fe->options | t->be->beprm->options) & PR_O_HTTP_CLOSE) &&
!(t->flags & SN_CONN_CLOSED)) {
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx, delta, val;
struct hdr_idx_elem *cur_hdr;
cur_next = rep->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
old_idx = 0;
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
val = http_header_match2(cur_ptr, cur_end, "Connection", 10);
if (val) {
/* 3 possibilities :
* - we have already set Connection: close,
* so we remove this line.
* - we have not yet set Connection: close,
* but this line indicates close. We leave
* it untouched and set the flag.
* - we have not yet set Connection: close,
* and this line indicates non-close. We
* replace it.
*/
if (t->flags & SN_CONN_CLOSED) {
delta = buffer_replace2(rep, cur_ptr, cur_next, NULL, 0);
txn->rsp.eoh += delta;
cur_next += delta;
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
} else {
if (strncasecmp(cur_ptr + val, "close", 5) != 0) {
delta = buffer_replace2(rep, cur_ptr + val, cur_end,
"close", 5);
cur_next += delta;
cur_hdr->len += delta;
txn->rsp.eoh += delta;
}
t->flags |= SN_CONN_CLOSED;
}
}
old_idx = cur_idx;
}
}
/* add response headers from the rule sets in the same order */
for (cur_idx = 0; cur_idx < rule_set->nb_rspadd; cur_idx++) {
if (unlikely(http_header_add_tail(rep, &txn->rsp, &txn->hdr_idx,
rule_set->rsp_add[cur_idx])) < 0)
goto return_bad_resp;
}
/* check whether we're already working on the frontend */
if (cur_proxy == t->fe)
break;
cur_proxy = t->fe;
}
/*
* 4: check for server cookie.
*/
manage_server_side_cookies(t, rep);
/*
* 5: add server cookie in the response if needed
*/
if ((t->srv) && !(t->flags & SN_DIRECT) && (t->be->beprm->options & PR_O_COOK_INS) &&
(!(t->be->beprm->options & PR_O_COOK_POST) || (txn->meth == HTTP_METH_POST))) {
int len;
/* the server is known, it's not the one the client requested, we have to
* insert a set-cookie here, except if we want to insert only on POST
* requests and this one isn't. Note that servers which don't have cookies
* (eg: some backup servers) will return a full cookie removal request.
*/
len = sprintf(trash, "Set-Cookie: %s=%s; path=/",
t->be->beprm->cookie_name,
t->srv->cookie ? t->srv->cookie : "; Expires=Thu, 01-Jan-1970 00:00:01 GMT");
if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
trash, len)) < 0)
goto return_bad_resp;
txn->flags |= TX_SCK_INSERTED;
/* Here, we will tell an eventual cache on the client side that we don't
* want it to cache this reply because HTTP/1.0 caches also cache cookies !
* Some caches understand the correct form: 'no-cache="set-cookie"', but
* others don't (eg: apache <= 1.3.26). So we use 'private' instead.
*/
if (t->be->beprm->options & PR_O_COOK_NOC) {
if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
"Cache-control: private", 22)) < 0)
goto return_bad_resp;
}
}
/*
* 6: check for cache-control or pragma headers.
*/
check_response_for_cacheability(t, rep);
/*
* 7: check if result will be cacheable with a cookie.
* We'll block the response if security checks have caught
* nasty things such as a cacheable cookie.
*/
if (((txn->flags & (TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) ==
(TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) &&
(t->be->beprm->options & PR_O_CHK_CACHE)) {
/* we're in presence of a cacheable response containing
* a set-cookie header. We'll block it as requested by
* the 'checkcache' option, and send an alert.
*/
if (t->srv) {
t->srv->cur_sess--;
t->srv->failed_secu++;
}
t->be->beprm->denied_resp++;
Alert("Blocking cacheable cookie in response from instance %s, server %s.\n",
t->be->beprm->id, t->srv?t->srv->id:"<dispatch>");
send_log(t->be, LOG_ALERT,
"Blocking cacheable cookie in response from instance %s, server %s.\n",
t->be->beprm->id, t->srv?t->srv->id:"<dispatch>");
goto return_srv_prx_502;
}
/*
* 8: add "Connection: close" if needed and not yet set.
* Note that we do not need to add it in case of HTTP/1.0.
*/
if (!(t->flags & SN_CONN_CLOSED) &&
((t->fe->options | t->be->beprm->options) & PR_O_HTTP_CLOSE)) {
if ((unlikely(msg->sl.st.v_l != 8) ||
unlikely(req->data[msg->som + 7] != '0')) &&
unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
"Connection: close", 17)) < 0)
goto return_bad_resp;
t->flags |= SN_CONN_CLOSED;
}
/*************************************************************
* OK, that's finished for the headers. We have done what we *
* could. Let's switch to the DATA state. *
************************************************************/
t->srv_state = SV_STDATA;
rep->rlim = rep->data + BUFSIZE; /* no more rewrite needed */
t->logs.t_data = tv_diff(&t->logs.tv_accept, &now);
/* client connection already closed or option 'forceclose' required :
* we close the server's outgoing connection right now.
*/
if ((req->l == 0) &&
(c == CL_STSHUTR || c == CL_STCLOSE || t->be->beprm->options & PR_O_FORCE_CLO)) {
MY_FD_CLR(t->srv_fd, StaticWriteEvent);
tv_eternity(&req->wex);
/* We must ensure that the read part is still alive when switching
* to shutw */
MY_FD_SET(t->srv_fd, StaticReadEvent);
if (t->be->beprm->srvtimeout)
tv_delayfrom(&rep->rex, &now, t->be->beprm->srvtimeout);
shutdown(t->srv_fd, SHUT_WR);
t->srv_state = SV_STSHUTW;
}
#ifdef CONFIG_HAP_TCPSPLICE
if ((t->fe->options & t->be->beprm->options) & PR_O_TCPSPLICE) {
/* TCP splicing supported by both FE and BE */
tcp_splice_splicefd(t->cli_fd, t->srv_fd, 0);
}
#endif
/* if the user wants to log as soon as possible, without counting
bytes from the server, then this is the right moment. */
if (t->fe->to_log && !(t->logs.logwait & LW_BYTES)) {
t->logs.t_close = t->logs.t_data; /* to get a valid end date */
t->logs.bytes_in = txn->rsp.eoh;
sess_log(t);
}
/* Note: we must not try to cheat by jumping directly to DATA,
* otherwise we would not let the client side wake up.
*/
return 1;
}
else if (s == SV_STDATA) {
/* read or write error */
if (req->flags & BF_WRITE_ERROR || rep->flags & BF_READ_ERROR) {
tv_eternity(&rep->rex);
tv_eternity(&req->wex);
fd_delete(t->srv_fd);
if (t->srv) {
t->srv->cur_sess--;
t->srv->failed_resp++;
}
t->be->failed_resp++;
t->srv_state = SV_STCLOSE;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVCL;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_D;
/* We used to have a free connection slot. Since we'll never use it,
* we have to inform the server that it may be used by another session.
*/
if (may_dequeue_tasks(t->srv, t->be->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
return 1;
}
/* last read, or end of client write */
else if (rep->flags & BF_READ_NULL || c == CL_STSHUTW || c == CL_STCLOSE) {
MY_FD_CLR(t->srv_fd, StaticReadEvent);
tv_eternity(&rep->rex);
shutdown(t->srv_fd, SHUT_RD);
t->srv_state = SV_STSHUTR;
//fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
return 1;
}
/* end of client read and no more data to send */
else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) {
MY_FD_CLR(t->srv_fd, StaticWriteEvent);
tv_eternity(&req->wex);
shutdown(t->srv_fd, SHUT_WR);
/* We must ensure that the read part is still alive when switching
* to shutw */
MY_FD_SET(t->srv_fd, StaticReadEvent);
if (t->be->beprm->srvtimeout)
tv_delayfrom(&rep->rex, &now, t->be->beprm->srvtimeout);
t->srv_state = SV_STSHUTW;
return 1;
}
/* read timeout */
else if (tv_cmp2_ms(&rep->rex, &now) <= 0) {
MY_FD_CLR(t->srv_fd, StaticReadEvent);
tv_eternity(&rep->rex);
shutdown(t->srv_fd, SHUT_RD);
t->srv_state = SV_STSHUTR;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVTO;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_D;
return 1;
}
/* write timeout */
else if (tv_cmp2_ms(&req->wex, &now) <= 0) {
MY_FD_CLR(t->srv_fd, StaticWriteEvent);
tv_eternity(&req->wex);
shutdown(t->srv_fd, SHUT_WR);
/* We must ensure that the read part is still alive when switching
* to shutw */
MY_FD_SET(t->srv_fd, StaticReadEvent);
if (t->be->beprm->srvtimeout)
tv_delayfrom(&rep->rex, &now, t->be->beprm->srvtimeout);
t->srv_state = SV_STSHUTW;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVTO;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_D;
return 1;
}
/* recompute request time-outs */
if (req->l == 0) {
if (MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
MY_FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */
tv_eternity(&req->wex);
}
}
else { /* buffer not empty, there are still data to be transferred */
if (! MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
MY_FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */
if (t->be->beprm->srvtimeout) {
tv_delayfrom(&req->wex, &now, t->be->beprm->srvtimeout);
/* FIXME: to prevent the server from expiring read timeouts during writes,
* we refresh it. */
rep->rex = req->wex;
}
else
tv_eternity(&req->wex);
}
}
/* recompute response time-outs */
if (rep->l == BUFSIZE) { /* no room to read more data */
if (MY_FD_ISSET(t->srv_fd, StaticReadEvent)) {
MY_FD_CLR(t->srv_fd, StaticReadEvent);
tv_eternity(&rep->rex);
}
}
else {
if (! MY_FD_ISSET(t->srv_fd, StaticReadEvent)) {
MY_FD_SET(t->srv_fd, StaticReadEvent);
if (t->be->beprm->srvtimeout)
tv_delayfrom(&rep->rex, &now, t->be->beprm->srvtimeout);
else
tv_eternity(&rep->rex);
}
}
return 0; /* other cases change nothing */
}
else if (s == SV_STSHUTR) {
if (req->flags & BF_WRITE_ERROR) {
//MY_FD_CLR(t->srv_fd, StaticWriteEvent);
tv_eternity(&req->wex);
fd_delete(t->srv_fd);
if (t->srv) {
t->srv->cur_sess--;
t->srv->failed_resp++;
}
t->be->failed_resp++;
//close(t->srv_fd);
t->srv_state = SV_STCLOSE;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVCL;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_D;
/* We used to have a free connection slot. Since we'll never use it,
* we have to inform the server that it may be used by another session.
*/
if (may_dequeue_tasks(t->srv, t->be->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
return 1;
}
else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) {
//MY_FD_CLR(t->srv_fd, StaticWriteEvent);
tv_eternity(&req->wex);
fd_delete(t->srv_fd);
if (t->srv)
t->srv->cur_sess--;
//close(t->srv_fd);
t->srv_state = SV_STCLOSE;
/* We used to have a free connection slot. Since we'll never use it,
* we have to inform the server that it may be used by another session.
*/
if (may_dequeue_tasks(t->srv, t->be->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
return 1;
}
else if (tv_cmp2_ms(&req->wex, &now) <= 0) {
//MY_FD_CLR(t->srv_fd, StaticWriteEvent);
tv_eternity(&req->wex);
fd_delete(t->srv_fd);
if (t->srv)
t->srv->cur_sess--;
//close(t->srv_fd);
t->srv_state = SV_STCLOSE;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVTO;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_D;
/* We used to have a free connection slot. Since we'll never use it,
* we have to inform the server that it may be used by another session.
*/
if (may_dequeue_tasks(t->srv, t->be->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
return 1;
}
else if (req->l == 0) {
if (MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
MY_FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */
tv_eternity(&req->wex);
}
}
else { /* buffer not empty */
if (! MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
MY_FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */
if (t->be->beprm->srvtimeout) {
tv_delayfrom(&req->wex, &now, t->be->beprm->srvtimeout);
/* FIXME: to prevent the server from expiring read timeouts during writes,
* we refresh it. */
rep->rex = req->wex;
}
else
tv_eternity(&req->wex);
}
}
return 0;
}
else if (s == SV_STSHUTW) {
if (rep->flags & BF_READ_ERROR) {
//MY_FD_CLR(t->srv_fd, StaticReadEvent);
tv_eternity(&rep->rex);
fd_delete(t->srv_fd);
if (t->srv) {
t->srv->cur_sess--;
t->srv->failed_resp++;
}
t->be->failed_resp++;
//close(t->srv_fd);
t->srv_state = SV_STCLOSE;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVCL;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_D;
/* We used to have a free connection slot. Since we'll never use it,
* we have to inform the server that it may be used by another session.
*/
if (may_dequeue_tasks(t->srv, t->be->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
return 1;
}
else if (rep->flags & BF_READ_NULL || c == CL_STSHUTW || c == CL_STCLOSE) {
//MY_FD_CLR(t->srv_fd, StaticReadEvent);
tv_eternity(&rep->rex);
fd_delete(t->srv_fd);
if (t->srv)
t->srv->cur_sess--;
//close(t->srv_fd);
t->srv_state = SV_STCLOSE;
/* We used to have a free connection slot. Since we'll never use it,
* we have to inform the server that it may be used by another session.
*/
if (may_dequeue_tasks(t->srv, t->be->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
return 1;
}
else if (tv_cmp2_ms(&rep->rex, &now) <= 0) {
//MY_FD_CLR(t->srv_fd, StaticReadEvent);
tv_eternity(&rep->rex);
fd_delete(t->srv_fd);
if (t->srv)
t->srv->cur_sess--;
//close(t->srv_fd);
t->srv_state = SV_STCLOSE;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVTO;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_D;
/* We used to have a free connection slot. Since we'll never use it,
* we have to inform the server that it may be used by another session.
*/
if (may_dequeue_tasks(t->srv, t->be->beprm))
task_wakeup(&rq, t->srv->queue_mgt);
return 1;
}
else if (rep->l == BUFSIZE) { /* no room to read more data */
if (MY_FD_ISSET(t->srv_fd, StaticReadEvent)) {
MY_FD_CLR(t->srv_fd, StaticReadEvent);
tv_eternity(&rep->rex);
}
}
else {
if (! MY_FD_ISSET(t->srv_fd, StaticReadEvent)) {
MY_FD_SET(t->srv_fd, StaticReadEvent);
if (t->be->beprm->srvtimeout)
tv_delayfrom(&rep->rex, &now, t->be->beprm->srvtimeout);
else
tv_eternity(&rep->rex);
}
}
return 0;
}
else { /* SV_STCLOSE : nothing to do */
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
int len;
len = sprintf(trash, "%08x:%s.srvcls[%04x:%04x]\n",
t->uniq_id, t->be->beprm->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
write(1, trash, len);
}
return 0;
}
return 0;
}
/*
* Produces data for the session <s> depending on its source. Expects to be
* called with s->cli_state == CL_STSHUTR. Right now, only statistics can be
* produced. It stops by itself by unsetting the SN_SELF_GEN flag from the
* session, which it uses to keep on being called when there is free space in
* the buffer, of simply by letting an empty buffer upon return. It returns 1
* if it changes the session state from CL_STSHUTR, otherwise 0.
*/
int produce_content(struct session *s)
{
if (s->data_source == DATA_SRC_NONE) {
s->flags &= ~SN_SELF_GEN;
return 1;
}
else if (s->data_source == DATA_SRC_STATS) {
/* dump server statistics */
return produce_content_stats(s);
}
else {
/* unknown data source */
s->txn.status = 500;
client_retnclose(s, error_message(s, HTTP_ERR_500));
if (!(s->flags & SN_ERR_MASK))
s->flags |= SN_ERR_PRXCOND;
if (!(s->flags & SN_FINST_MASK))
s->flags |= SN_FINST_R;
s->flags &= ~SN_SELF_GEN;
return 1;
}
}
/*
* Produces statistics data for the session <s>. Expects to be called with
* s->cli_state == CL_STSHUTR. It stops by itself by unsetting the SN_SELF_GEN
* flag from the session, which it uses to keep on being called when there is
* free space in the buffer, of simply by letting an empty buffer upon return.
* It returns 1 if it changes the session state from CL_STSHUTR, otherwise 0.
*/
int produce_content_stats(struct session *s)
{
struct buffer *rep = s->rep;
struct proxy *px;
struct chunk msg;
unsigned int up;
msg.len = 0;
msg.str = trash;
switch (s->data_state) {
case DATA_ST_INIT:
/* the function had not been called yet */
s->flags |= SN_SELF_GEN; // more data will follow
chunk_printf(&msg, sizeof(trash),
"HTTP/1.0 200 OK\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n");
s->txn.status = 200;
client_retnclose(s, &msg); // send the start of the response.
msg.len = 0;
if (!(s->flags & SN_ERR_MASK)) // this is not really an error but it is
s->flags |= SN_ERR_PRXCOND; // to mark that it comes from the proxy
if (!(s->flags & SN_FINST_MASK))
s->flags |= SN_FINST_R;
if (s->txn.meth == HTTP_METH_HEAD) {
/* that's all we return in case of HEAD request */
s->data_state = DATA_ST_FIN;
s->flags &= ~SN_SELF_GEN;
return 1;
}
s->data_state = DATA_ST_HEAD; /* let's start producing data */
/* fall through */
case DATA_ST_HEAD:
/* WARNING! This must fit in the first buffer !!! */
chunk_printf(&msg, sizeof(trash),
"<html><head><title>Statistics Report for " PRODUCT_NAME "</title>\n"
"<meta http-equiv=\"content-type\" content=\"text/html; charset=iso-8859-1\">\n"
"<style type=\"text/css\"><!--\n"
"body {"
" font-family: helvetica, arial;"
" font-size: 12px;"
" font-weight: normal;"
" color: black;"
" background: white;"
"}\n"
"th,td {"
" font-size: 0.8em;"
" align: center;"
"}\n"
"h1 {"
" font-size: xx-large;"
" margin-bottom: 0.5em;"
"}\n"
"h2 {"
" font-family: helvetica, arial;"
" font-size: x-large;"
" font-weight: bold;"
" font-style: italic;"
" color: #6020a0;"
" margin-top: 0em;"
" margin-bottom: 0em;"
"}\n"
"h3 {"
" font-family: helvetica, arial;"
" font-size: 16px;"
" font-weight: bold;"
" color: #b00040;"
" background: #e8e8d0;"
" margin-top: 0em;"
" margin-bottom: 0em;"
"}\n"
"li {"
" margin-top: 0.25em;"
" margin-right: 2em;"
"}\n"
".hr {margin-top: 0.25em;"
" border-color: black;"
" border-bottom-style: solid;"
"}\n"
".pxname {background: #b00040;color: #ffff40;font-weight: bold;}\n"
".titre {background: #20D0D0;color: #000000;font-weight: bold;}\n"
".total {background: #20D0D0;color: #ffff80;}\n"
".frontend {background: #e8e8d0;}\n"
".backend {background: #e8e8d0;}\n"
".active0 {background: #ff9090;}\n"
".active1 {background: #ffd020;}\n"
".active2 {background: #ffffa0;}\n"
".active3 {background: #c0ffc0;}\n"
".active4 {background: #e0e0e0;}\n"
".backup0 {background: #ff9090;}\n"
".backup1 {background: #ff80ff;}\n"
".backup2 {background: #c060ff;}\n"
".backup3 {background: #b0d0ff;}\n"
".backup4 {background: #e0e0e0;}\n"
"table.tbl { border-collapse: collapse; border-style: none;}\n"
"table.tbl td { border-width: 1px 1px 1px 1px; border-style: solid solid solid solid; padding: 2px 3px; border-color: gray;}\n"
"table.tbl th { border-width: 1px; border-style: solid solid solid solid; border-color: gray;}\n"
"table.tbl th.empty { border-style: none; empty-cells: hide;}\n"
"table.lgd { border-collapse: collapse; border-width: 1px; border-style: none none none solid; border-color: black;}\n"
"table.lgd td { border-width: 1px; border-style: solid solid solid solid; border-color: gray; padding: 2px;}\n"
"table.lgd td.noborder { border-style: none; padding: 2px; white-space: nowrap;}\n"
"-->\n"
"</style></head>\n");
if (buffer_write_chunk(rep, &msg) != 0)
return 0;
s->data_state = DATA_ST_INFO;
/* fall through */
case DATA_ST_INFO:
up = (now.tv_sec - start_date.tv_sec);
/* WARNING! this has to fit the first packet too.
* We are around 3.5 kB, add adding entries will
* become tricky if we want to support 4kB buffers !
*/
chunk_printf(&msg, sizeof(trash),
"<body><h1><a href=\"" PRODUCT_URL "\" style=\"text-decoration: none;\">"
PRODUCT_NAME "</a></h1>\n"
"<h2>Statistics Report for pid %d</h2>\n"
"<hr width=\"100%%\" class=\"hr\">\n"
"<h3>&gt; General process information</h3>\n"
"<table border=0 cols=3><tr><td align=\"left\" nowrap width=\"1%%\">\n"
"<p><b>pid = </b> %d (nbproc = %d)<br>\n"
"<b>uptime = </b> %dd %dh%02dm%02ds<br>\n"
"<b>system limits :</b> memmax = %s%s ; ulimit-n = %d<br>\n"
"<b>maxsock = </b> %d<br>\n"
"<b>maxconn = </b> %d (current conns = %d)<br>\n"
"</td><td align=\"center\" nowrap>\n"
"<table class=\"lgd\"><tr>\n"
"<td class=\"active3\">&nbsp;</td><td class=\"noborder\">active UP </td>"
"<td class=\"backup3\">&nbsp;</td><td class=\"noborder\">backup UP </td>"
"</tr><tr>\n"
"<td class=\"active2\"></td><td class=\"noborder\">active UP, going down </td>"
"<td class=\"backup2\"></td><td class=\"noborder\">backup UP, going down </td>"
"</tr><tr>\n"
"<td class=\"active1\"></td><td class=\"noborder\">active DOWN, going up </td>"
"<td class=\"backup1\"></td><td class=\"noborder\">backup DOWN, going up </td>"
"</tr><tr>\n"
"<td class=\"active0\"></td><td class=\"noborder\">active or backup DOWN &nbsp;</td>"
"<td class=\"active4\"></td><td class=\"noborder\">not checked </td>"
"</tr></table>\n"
"</td>"
"<td align=\"left\" nowrap width=\"1%%\">"
"<b>External ressources:</b><ul style=\"margin-top: 0.25em;\">\n"
"<li><a href=\"" PRODUCT_URL "\">Primary site</a><br>\n"
"<li><a href=\"" PRODUCT_URL_UPD "\">Updates (v" PRODUCT_BRANCH ")</a><br>\n"
"<li><a href=\"" PRODUCT_URL_DOC "\">Online manual</a><br>\n"
"</ul>"
"</td>"
"</tr></table>\n"
"",
pid, pid, global.nbproc,
up / 86400, (up % 86400) / 3600,
(up % 3600) / 60, (up % 60),
global.rlimit_memmax ? ultoa(global.rlimit_memmax) : "unlimited",
global.rlimit_memmax ? " MB" : "",
global.rlimit_nofile,
global.maxsock,
global.maxconn,
actconn
);
if (buffer_write_chunk(rep, &msg) != 0)
return 0;
memset(&s->data_ctx, 0, sizeof(s->data_ctx));
s->data_ctx.stats.px = proxy;
s->data_ctx.stats.px_st = DATA_ST_PX_INIT;
s->data_state = DATA_ST_LIST;
/* fall through */
case DATA_ST_LIST:
/* dump proxies */
while (s->data_ctx.stats.px) {
px = s->data_ctx.stats.px;
/* skip the disabled proxies and non-networked ones */
if (px->state != PR_STSTOPPED && (px->cap & (PR_CAP_FE | PR_CAP_BE)))
if (produce_content_stats_proxy(s, px) == 0)
return 0;
s->data_ctx.stats.px = px->next;
s->data_ctx.stats.px_st = DATA_ST_PX_INIT;
}
/* here, we just have reached the last proxy */
s->data_state = DATA_ST_END;
/* fall through */
case DATA_ST_END:
chunk_printf(&msg, sizeof(trash), "</body></html>\n");
if (buffer_write_chunk(rep, &msg) != 0)
return 0;
s->data_state = DATA_ST_FIN;
/* fall through */
case DATA_ST_FIN:
s->flags &= ~SN_SELF_GEN;
return 1;
default:
/* unknown state ! */
s->txn.status = 500;
client_retnclose(s, error_message(s, HTTP_ERR_500));
if (!(s->flags & SN_ERR_MASK))
s->flags |= SN_ERR_PRXCOND;
if (!(s->flags & SN_FINST_MASK))
s->flags |= SN_FINST_R;
s->flags &= ~SN_SELF_GEN;
return 1;
}
}
/*
* Dumps statistics for a proxy.
* Returns 0 if it had to stop dumping data because of lack of buffer space,
* ot non-zero if everything completed.
*/
int produce_content_stats_proxy(struct session *s, struct proxy *px)
{
struct buffer *rep = s->rep;
struct server *sv;
struct chunk msg;
msg.len = 0;
msg.str = trash;
switch (s->data_ctx.stats.px_st) {
case DATA_ST_PX_INIT:
/* we are on a new proxy */
if (s->be->fiprm->uri_auth && s->be->fiprm->uri_auth->scope) {
/* we have a limited scope, we have to check the proxy name */
struct stat_scope *scope;
int len;
len = strlen(px->id);
scope = s->be->fiprm->uri_auth->scope;
while (scope) {
/* match exact proxy name */
if (scope->px_len == len && !memcmp(px->id, scope->px_id, len))
break;
/* match '.' which means 'self' proxy */
if (!strcmp(scope->px_id, ".") && px == s->fe)
break;
scope = scope->next;
}
/* proxy name not found : don't dump anything */
if (scope == NULL)
return 1;
}
s->data_ctx.stats.px_st = DATA_ST_PX_TH;
/* fall through */
case DATA_ST_PX_TH:
/* print a new table */
chunk_printf(&msg, sizeof(trash),
"<table cols=\"20\" class=\"tbl\" width=\"100%%\">\n"
"<tr align=\"center\" class=\"titre\">"
"<th colspan=2 class=\"pxname\">%s</th>"
"<th colspan=18 class=\"empty\"></th>"
"</tr>\n"
"<tr align=\"center\" class=\"titre\">"
"<th rowspan=2></th>"
"<th colspan=2>Queue</th><th colspan=4>Sessions</th>"
"<th colspan=2>Bytes</th><th colspan=2>Denied</th>"
"<th colspan=3>Errors</th><th colspan=6>Server</th>"
"</tr>\n"
"<tr align=\"center\" class=\"titre\">"
"<th>Cur</th><th>Max</th><th>Cur</th><th>Max</th>"
"<th>Limit</th><th>Cumul</th><th>In</th><th>Out</th>"
"<th>Req</th><th>Resp</th><th>Req</th><th>Conn</th>"
"<th>Resp</th><th>Status</th><th>Weight</th><th>Act</th>"
"<th>Bck</th><th>Check</th><th>Down</th></tr>\n"
"",
px->id);
if (buffer_write_chunk(rep, &msg) != 0)
return 0;
s->data_ctx.stats.px_st = DATA_ST_PX_FE;
/* fall through */
case DATA_ST_PX_FE:
/* print the frontend */
if (px->cap & PR_CAP_FE) {
chunk_printf(&msg, sizeof(trash),
/* name, queue */
"<tr align=center class=\"frontend\"><td>Frontend</td><td colspan=2></td>"
/* sessions : current, max, limit, cumul. */
"<td align=right>%d</td><td align=right>%d</td><td align=right>%d</td><td align=right>%d</td>"
/* bytes : in, out */
"<td align=right>%lld</td><td align=right>%lld</td>"
/* denied: req, resp */
"<td align=right>%d</td><td align=right>%d</td>"
/* errors : request, connect, response */
"<td align=right>%d</td><td align=right></td><td align=right></td>"
/* server status : reflect backend status */
"<td align=center>%s</td>"
/* rest of server: nothing */
"<td align=center colspan=5></td></tr>"
"",
px->feconn, px->feconn_max, px->maxconn, px->cum_feconn,
px->bytes_in, px->bytes_out,
px->denied_req, px->denied_resp,
px->failed_req,
px->state == PR_STRUN ? "OPEN" :
px->state == PR_STIDLE ? "FULL" : "STOP");
if (buffer_write_chunk(rep, &msg) != 0)
return 0;
}
s->data_ctx.stats.sv = px->srv; /* may be NULL */
s->data_ctx.stats.px_st = DATA_ST_PX_SV;
/* fall through */
case DATA_ST_PX_SV:
/* stats.sv has been initialized above */
while (s->data_ctx.stats.sv != NULL) {
static char *srv_hlt_st[5] = { "DOWN", "DN %d/%d &uarr;", "UP %d/%d &darr;", "UP", "<i>no check</i>" };
int sv_state; /* 0=DOWN, 1=going up, 2=going down, 3=UP, 4=unchecked */
sv = s->data_ctx.stats.sv;
/* FIXME: produce some small strings for "UP/DOWN x/y &#xxxx;" */
if (!(sv->state & SRV_CHECKED))
sv_state = 4;
else if (sv->state & SRV_RUNNING)
if (sv->health == sv->rise + sv->fall - 1)
sv_state = 3; /* UP */
else
sv_state = 2; /* going down */
else
if (sv->health)
sv_state = 1; /* going up */
else
sv_state = 0; /* DOWN */
chunk_printf(&msg, sizeof(trash),
/* name */
"<tr align=\"center\" class=\"%s%d\"><td>%s</td>"
/* queue : current, max */
"<td align=right>%d</td><td align=right>%d</td>"
/* sessions : current, max, limit, cumul */
"<td align=right>%d</td><td align=right>%d</td><td align=right>%s</td><td align=right>%d</td>"
/* bytes : in, out */
"<td align=right>%lld</td><td align=right>%lld</td>"
/* denied: req, resp */
"<td align=right></td><td align=right>%d</td>"
/* errors : request, connect, response */
"<td align=right></td><td align=right>%d</td><td align=right>%d</td>\n"
"",
(sv->state & SRV_BACKUP) ? "backup" : "active",
sv_state, sv->id,
sv->nbpend, sv->nbpend_max,
sv->cur_sess, sv->cur_sess_max, sv->maxconn ? ultoa(sv->maxconn) : "-", sv->cum_sess,
sv->bytes_in, sv->bytes_out,
sv->failed_secu,
sv->failed_conns, sv->failed_resp);
/* status */
chunk_printf(&msg, sizeof(trash), "<td nowrap>");
chunk_printf(&msg, sizeof(trash),
srv_hlt_st[sv_state],
(sv->state & SRV_RUNNING) ? (sv->health - sv->rise + 1) : (sv->health),
(sv->state & SRV_RUNNING) ? (sv->fall) : (sv->rise));
chunk_printf(&msg, sizeof(trash),
/* weight */
"</td><td>%d</td>"
/* act, bck */
"<td>%s</td><td>%s</td>"
"",
sv->uweight,
(sv->state & SRV_BACKUP) ? "-" : "Y",
(sv->state & SRV_BACKUP) ? "Y" : "-");
/* check failures : unique, fatal */
if (sv->state & SRV_CHECKED)
chunk_printf(&msg, sizeof(trash),
"<td align=right>%d</td><td align=right>%d</td></tr>\n",
sv->failed_checks, sv->down_trans);
else
chunk_printf(&msg, sizeof(trash),
"<td colspan=2></td></tr>\n");
if (buffer_write_chunk(rep, &msg) != 0)
return 0;
s->data_ctx.stats.sv = sv->next;
} /* while sv */
s->data_ctx.stats.px_st = DATA_ST_PX_BE;
/* fall through */
case DATA_ST_PX_BE:
/* print the backend */
if (px->cap & PR_CAP_BE) {
chunk_printf(&msg, sizeof(trash),
/* name */
"<tr align=center class=\"backend\"><td>Backend</td>"
/* queue : current, max */
"<td align=right>%d</td><td align=right>%d</td>"
/* sessions : current, max, limit, cumul. */
"<td align=right>%d</td><td align=right>%d</td><td align=right>%d</td><td align=right>%d</td>"
/* bytes : in, out */
"<td align=right>%lld</td><td align=right>%lld</td>"
/* denied: req, resp */
"<td align=right>%d</td><td align=right>%d</td>"
/* errors : request, connect, response */
"<td align=right></td><td align=right>%d</td><td align=right>%d</td>\n"
/* server status : reflect backend status (up/down) : we display UP
* if the backend has known working servers or if it has no server at
* all (eg: for stats). Tthen we display the total weight, number of
* active and backups. */
"<td align=center>%s</td><td align=center>%d</td>"
"<td align=center>%d</td><td align=center>%d</td>"
/* rest of server: nothing */
"<td align=center colspan=2></td></tr>"
"",
px->nbpend /* or px->totpend ? */, px->nbpend_max,
px->beconn, px->beconn_max, px->fullconn, px->cum_beconn,
px->bytes_in, px->bytes_out,
px->denied_req, px->denied_resp,
px->failed_conns, px->failed_resp,
(px->srv_map_sz > 0 || !px->srv) ? "UP" : "DOWN",
px->srv_map_sz, px->srv_act, px->srv_bck);
if (buffer_write_chunk(rep, &msg) != 0)
return 0;
}
s->data_ctx.stats.px_st = DATA_ST_PX_END;
/* fall through */
case DATA_ST_PX_END:
chunk_printf(&msg, sizeof(trash), "</table><p>\n");
if (buffer_write_chunk(rep, &msg) != 0)
return 0;
s->data_ctx.stats.px_st = DATA_ST_PX_FIN;
/* fall through */
case DATA_ST_PX_FIN:
return 1;
default:
/* unknown state, we should put an abort() here ! */
return 1;
}
}
/* Iterate the same filter through all request headers.
* Returns 1 if this filter can be stopped upon return, otherwise 0.
* Since it can manage the switch to another backend, it updates the per-proxy
* DENY stats.
*/
int apply_filter_to_req_headers(struct session *t, struct buffer *req, struct hdr_exp *exp)
{
char term;
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx, last_hdr;
struct http_txn *txn = &t->txn;
struct hdr_idx_elem *cur_hdr;
int len, delta;
last_hdr = 0;
cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
old_idx = 0;
while (!last_hdr) {
if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT)))
return 1;
else if (unlikely(txn->flags & TX_CLALLOW) &&
(exp->action == ACT_ALLOW ||
exp->action == ACT_DENY ||
exp->action == ACT_TARPIT))
return 0;
cur_idx = txn->hdr_idx.v[old_idx].next;
if (!cur_idx)
break;
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
/* Now we have one header between cur_ptr and cur_end,
* and the next header starts at cur_next.
*/
/* The annoying part is that pattern matching needs
* that we modify the contents to null-terminate all
* strings before testing them.
*/
term = *cur_end;
*cur_end = '\0';
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
switch (exp->action) {
case ACT_SETBE:
/* It is not possible to jump a second time.
* FIXME: should we return an HTTP/500 here so that
* the admin knows there's a problem ?
*/
if (t->be != t->fe)
break;
/* Swithing Proxy */
t->be = (struct proxy *) exp->replace;
/* right now, the backend switch is not too much complicated
* because we have associated req_cap and rsp_cap to the
* frontend, and the beconn will be updated later.
*/
t->rep->rto = t->req->wto = t->be->beprm->srvtimeout;
t->req->cto = t->be->beprm->contimeout;
last_hdr = 1;
break;
case ACT_ALLOW:
txn->flags |= TX_CLALLOW;
last_hdr = 1;
break;
case ACT_DENY:
txn->flags |= TX_CLDENY;
last_hdr = 1;
t->be->beprm->denied_req++;
break;
case ACT_TARPIT:
txn->flags |= TX_CLTARPIT;
last_hdr = 1;
t->be->beprm->denied_req++;
break;
case ACT_REPLACE:
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
delta = buffer_replace2(req, cur_ptr, cur_end, trash, len);
/* FIXME: if the user adds a newline in the replacement, the
* index will not be recalculated for now, and the new line
* will not be counted as a new header.
*/
cur_end += delta;
cur_next += delta;
cur_hdr->len += delta;
txn->req.eoh += delta;
break;
case ACT_REMOVE:
delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
cur_next += delta;
/* FIXME: this should be a separate function */
txn->req.eoh += delta;
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
cur_end = NULL; /* null-term has been rewritten */
break;
}
}
if (cur_end)
*cur_end = term; /* restore the string terminator */
/* keep the link from this header to next one in case of later
* removal of next header.
*/
old_idx = cur_idx;
}
return 0;
}
/* Apply the filter to the request line.
* Returns 0 if nothing has been done, 1 if the filter has been applied,
* or -1 if a replacement resulted in an invalid request line.
* Since it can manage the switch to another backend, it updates the per-proxy
* DENY stats.
*/
int apply_filter_to_req_line(struct session *t, struct buffer *req, struct hdr_exp *exp)
{
char term;
char *cur_ptr, *cur_end;
int done;
struct http_txn *txn = &t->txn;
int len, delta;
if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT)))
return 1;
else if (unlikely(txn->flags & TX_CLALLOW) &&
(exp->action == ACT_ALLOW ||
exp->action == ACT_DENY ||
exp->action == ACT_TARPIT))
return 0;
else if (exp->action == ACT_REMOVE)
return 0;
done = 0;
cur_ptr = req->data + txn->req.som;
cur_end = cur_ptr + txn->req.sl.rq.l;
/* Now we have the request line between cur_ptr and cur_end */
/* The annoying part is that pattern matching needs
* that we modify the contents to null-terminate all
* strings before testing them.
*/
term = *cur_end;
*cur_end = '\0';
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
switch (exp->action) {
case ACT_SETBE:
/* It is not possible to jump a second time.
* FIXME: should we return an HTTP/500 here so that
* the admin knows there's a problem ?
*/
if (t->be != t->fe)
break;
/* Swithing Proxy */
t->be = (struct proxy *) exp->replace;
/* right now, the backend switch is not too much complicated
* because we have associated req_cap and rsp_cap to the
* frontend, and the beconn will be updated later.
*/
t->rep->rto = t->req->wto = t->be->beprm->srvtimeout;
t->req->cto = t->be->beprm->contimeout;
done = 1;
break;
case ACT_ALLOW:
txn->flags |= TX_CLALLOW;
done = 1;
break;
case ACT_DENY:
txn->flags |= TX_CLDENY;
t->be->beprm->denied_req++;
done = 1;
break;
case ACT_TARPIT:
txn->flags |= TX_CLTARPIT;
t->be->beprm->denied_req++;
done = 1;
break;
case ACT_REPLACE:
*cur_end = term; /* restore the string terminator */
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
delta = buffer_replace2(req, cur_ptr, cur_end, trash, len);
/* FIXME: if the user adds a newline in the replacement, the
* index will not be recalculated for now, and the new line
* will not be counted as a new header.
*/
txn->req.eoh += delta;
cur_end += delta;
cur_end = (char *)http_parse_reqline(&txn->req, req->data,
HTTP_MSG_RQMETH,
cur_ptr, cur_end + 1,
NULL, NULL);
if (unlikely(!cur_end))
return -1;
/* we have a full request and we know that we have either a CR
* or an LF at <ptr>.
*/
txn->meth = find_http_meth(cur_ptr, txn->req.sl.rq.m_l);
hdr_idx_set_start(&txn->hdr_idx, txn->req.sl.rq.l, *cur_end == '\r');
/* there is no point trying this regex on headers */
return 1;
}
}
*cur_end = term; /* restore the string terminator */
return done;
}
/*
* Apply all the req filters <exp> to all headers in buffer <req> of session <t>.
* Returns 0 if everything is alright, or -1 in case a replacement lead to an
* unparsable request. Since it can manage the switch to another backend, it
* updates the per-proxy DENY stats.
*/
int apply_filters_to_request(struct session *t, struct buffer *req, struct hdr_exp *exp)
{
struct http_txn *txn = &t->txn;
/* iterate through the filters in the outer loop */
while (exp && !(txn->flags & (TX_CLDENY|TX_CLTARPIT))) {
int ret;
/*
* The interleaving of transformations and verdicts
* makes it difficult to decide to continue or stop
* the evaluation.
*/
if ((txn->flags & TX_CLALLOW) &&
(exp->action == ACT_ALLOW || exp->action == ACT_DENY ||
exp->action == ACT_TARPIT || exp->action == ACT_PASS)) {
exp = exp->next;
continue;
}
/* Apply the filter to the request line. */
ret = apply_filter_to_req_line(t, req, exp);
if (unlikely(ret < 0))
return -1;
if (likely(ret == 0)) {
/* The filter did not match the request, it can be
* iterated through all headers.
*/
apply_filter_to_req_headers(t, req, exp);
}
exp = exp->next;
}
return 0;
}
/*
* Manager client-side cookie
*/
void manage_client_side_cookies(struct session *t, struct buffer *req)
{
struct http_txn *txn = &t->txn;
char *p1, *p2, *p3, *p4;
char *del_colon, *del_cookie, *colon;
int app_cookies;
appsess *asession_temp = NULL;
appsess local_asession;
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx;
if (t->be->beprm->cookie_name == NULL &&
t->be->beprm->appsession_name == NULL &&
t->be->fiprm->capture_name == NULL)
return;
/* Iterate through the headers.
* we start with the start line.
*/
old_idx = 0;
cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
struct hdr_idx_elem *cur_hdr;
int val;
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
/* We have one full header between cur_ptr and cur_end, and the
* next header starts at cur_next. We're only interested in
* "Cookie:" headers.
*/
val = http_header_match2(cur_ptr, cur_end, "Cookie", 6);
if (!val) {
old_idx = cur_idx;
continue;
}
/* Now look for cookies. Conforming to RFC2109, we have to support
* attributes whose name begin with a '$', and associate them with
* the right cookie, if we want to delete this cookie.
* So there are 3 cases for each cookie read :
* 1) it's a special attribute, beginning with a '$' : ignore it.
* 2) it's a server id cookie that we *MAY* want to delete : save
* some pointers on it (last semi-colon, beginning of cookie...)
* 3) it's an application cookie : we *MAY* have to delete a previous
* "special" cookie.
* At the end of loop, if a "special" cookie remains, we may have to
* remove it. If no application cookie persists in the header, we
* *MUST* delete it
*/
colon = p1 = cur_ptr + val; /* first non-space char after 'Cookie:' */
/* del_cookie == NULL => nothing to be deleted */
del_colon = del_cookie = NULL;
app_cookies = 0;
while (p1 < cur_end) {
/* skip spaces and colons, but keep an eye on these ones */
while (p1 < cur_end) {
if (*p1 == ';' || *p1 == ',')
colon = p1;
else if (!isspace((int)*p1))
break;
p1++;
}
if (p1 == cur_end)
break;
/* p1 is at the beginning of the cookie name */
p2 = p1;
while (p2 < cur_end && *p2 != '=')
p2++;
if (p2 == cur_end)
break;
p3 = p2 + 1; /* skips the '=' sign */
if (p3 == cur_end)
break;
p4 = p3;
while (p4 < cur_end && !isspace((int)*p4) && *p4 != ';' && *p4 != ',')
p4++;
/* here, we have the cookie name between p1 and p2,
* and its value between p3 and p4.
* we can process it :
*
* Cookie: NAME=VALUE;
* | || || |
* | || || +--> p4
* | || |+-------> p3
* | || +--------> p2
* | |+------------> p1
* | +-------------> colon
* +--------------------> cur_ptr
*/
if (*p1 == '$') {
/* skip this one */
}
else {
/* first, let's see if we want to capture it */
if (t->fe->fiprm->capture_name != NULL &&
txn->cli_cookie == NULL &&
(p4 - p1 >= t->fe->fiprm->capture_namelen) &&
memcmp(p1, t->fe->fiprm->capture_name, t->fe->fiprm->capture_namelen) == 0) {
int log_len = p4 - p1;
if ((txn->cli_cookie = pool_alloc(capture)) == NULL) {
Alert("HTTP logging : out of memory.\n");
} else {
if (log_len > t->fe->fiprm->capture_len)
log_len = t->fe->fiprm->capture_len;
memcpy(txn->cli_cookie, p1, log_len);
txn->cli_cookie[log_len] = 0;
}
}
if ((p2 - p1 == t->be->beprm->cookie_len) && (t->be->beprm->cookie_name != NULL) &&
(memcmp(p1, t->be->beprm->cookie_name, p2 - p1) == 0)) {
/* Cool... it's the right one */
struct server *srv = t->be->beprm->srv;
char *delim;
/* if we're in cookie prefix mode, we'll search the delimitor so that we
* have the server ID betweek p3 and delim, and the original cookie between
* delim+1 and p4. Otherwise, delim==p4 :
*
* Cookie: NAME=SRV~VALUE;
* | || || | |
* | || || | +--> p4
* | || || +--------> delim
* | || |+-----------> p3
* | || +------------> p2
* | |+----------------> p1
* | +-----------------> colon
* +------------------------> cur_ptr
*/
if (t->be->beprm->options & PR_O_COOK_PFX) {
for (delim = p3; delim < p4; delim++)
if (*delim == COOKIE_DELIM)
break;
}
else
delim = p4;
/* Here, we'll look for the first running server which supports the cookie.
* This allows to share a same cookie between several servers, for example
* to dedicate backup servers to specific servers only.
* However, to prevent clients from sticking to cookie-less backup server
* when they have incidentely learned an empty cookie, we simply ignore
* empty cookies and mark them as invalid.
*/
if (delim == p3)
srv = NULL;
while (srv) {
if (srv->cookie && (srv->cklen == delim - p3) &&
!memcmp(p3, srv->cookie, delim - p3)) {
if (srv->state & SRV_RUNNING || t->be->beprm->options & PR_O_PERSIST) {
/* we found the server and it's usable */
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_VALID;
t->flags |= SN_DIRECT | SN_ASSIGNED;
t->srv = srv;
break;
} else {
/* we found a server, but it's down */
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_DOWN;
}
}
srv = srv->next;
}
if (!srv && !(txn->flags & TX_CK_DOWN)) {
/* no server matched this cookie */
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_INVALID;
}
/* depending on the cookie mode, we may have to either :
* - delete the complete cookie if we're in insert+indirect mode, so that
* the server never sees it ;
* - remove the server id from the cookie value, and tag the cookie as an
* application cookie so that it does not get accidentely removed later,
* if we're in cookie prefix mode
*/
if ((t->be->beprm->options & PR_O_COOK_PFX) && (delim != p4)) {
int delta; /* negative */
delta = buffer_replace2(req, p3, delim + 1, NULL, 0);
p4 += delta;
cur_end += delta;
cur_next += delta;
cur_hdr->len += delta;
txn->req.eoh += delta;
del_cookie = del_colon = NULL;
app_cookies++; /* protect the header from deletion */
}
else if (del_cookie == NULL &&
(t->be->beprm->options & (PR_O_COOK_INS | PR_O_COOK_IND)) == (PR_O_COOK_INS | PR_O_COOK_IND)) {
del_cookie = p1;
del_colon = colon;
}
} else {
/* now we know that we must keep this cookie since it's
* not ours. But if we wanted to delete our cookie
* earlier, we cannot remove the complete header, but we
* can remove the previous block itself.
*/
app_cookies++;
if (del_cookie != NULL) {
int delta; /* negative */
delta = buffer_replace2(req, del_cookie, p1, NULL, 0);
p4 += delta;
cur_end += delta;
cur_next += delta;
cur_hdr->len += delta;
txn->req.eoh += delta;
del_cookie = del_colon = NULL;
}
}
if ((t->be->beprm->appsession_name != NULL) &&
(memcmp(p1, t->be->beprm->appsession_name, p2 - p1) == 0)) {
/* first, let's see if the cookie is our appcookie*/
/* Cool... it's the right one */
asession_temp = &local_asession;
if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) {
Alert("Not enough memory process_cli():asession->sessid:malloc().\n");
send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession->sessid:malloc().\n");
return;
}
memcpy(asession_temp->sessid, p3, t->be->beprm->appsession_len);
asession_temp->sessid[t->be->beprm->appsession_len] = 0;
asession_temp->serverid = NULL;
/* only do insert, if lookup fails */
if (chtbl_lookup(&(t->be->beprm->htbl_proxy), (void *) &asession_temp) != 0) {
if ((asession_temp = pool_alloc(appsess)) == NULL) {
/* free previously allocated memory */
pool_free_to(apools.sessid, local_asession.sessid);
Alert("Not enough memory process_cli():asession:calloc().\n");
send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
return;
}
asession_temp->sessid = local_asession.sessid;
asession_temp->serverid = local_asession.serverid;
chtbl_insert(&(t->be->beprm->htbl_proxy), (void *) asession_temp);
} else {
/* free previously allocated memory */
pool_free_to(apools.sessid, local_asession.sessid);
}
if (asession_temp->serverid == NULL) {
Alert("Found Application Session without matching server.\n");
} else {
struct server *srv = t->be->beprm->srv;
while (srv) {
if (strcmp(srv->id, asession_temp->serverid) == 0) {
if (srv->state & SRV_RUNNING || t->be->beprm->options & PR_O_PERSIST) {
/* we found the server and it's usable */
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_VALID;
t->flags |= SN_DIRECT | SN_ASSIGNED;
t->srv = srv;
break;
} else {
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_DOWN;
}
}
srv = srv->next;
}/* end while(srv) */
}/* end else if server == NULL */
tv_delayfrom(&asession_temp->expire, &now, t->be->beprm->appsession_timeout);
}/* end if ((t->proxy->appsession_name != NULL) ... */
}
/* we'll have to look for another cookie ... */
p1 = p4;
} /* while (p1 < cur_end) */
/* There's no more cookie on this line.
* We may have marked the last one(s) for deletion.
* We must do this now in two ways :
* - if there is no app cookie, we simply delete the header ;
* - if there are app cookies, we must delete the end of the
* string properly, including the colon/semi-colon before
* the cookie name.
*/
if (del_cookie != NULL) {
int delta;
if (app_cookies) {
delta = buffer_replace2(req, del_colon, cur_end, NULL, 0);
cur_end = del_colon;
cur_hdr->len += delta;
} else {
delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
/* FIXME: this should be a separate function */
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
}
cur_next += delta;
txn->req.eoh += delta;
}
/* keep the link from this header to next one */
old_idx = cur_idx;
} /* end of cookie processing on this header */
}
/* Iterate the same filter through all response headers contained in <rtr>.
* Returns 1 if this filter can be stopped upon return, otherwise 0.
*/
int apply_filter_to_resp_headers(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
{
char term;
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx, last_hdr;
struct http_txn *txn = &t->txn;
struct hdr_idx_elem *cur_hdr;
int len, delta;
last_hdr = 0;
cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
old_idx = 0;
while (!last_hdr) {
if (unlikely(txn->flags & TX_SVDENY))
return 1;
else if (unlikely(txn->flags & TX_SVALLOW) &&
(exp->action == ACT_ALLOW ||
exp->action == ACT_DENY))
return 0;
cur_idx = txn->hdr_idx.v[old_idx].next;
if (!cur_idx)
break;
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
/* Now we have one header between cur_ptr and cur_end,
* and the next header starts at cur_next.
*/
/* The annoying part is that pattern matching needs
* that we modify the contents to null-terminate all
* strings before testing them.
*/
term = *cur_end;
*cur_end = '\0';
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
switch (exp->action) {
case ACT_ALLOW:
txn->flags |= TX_SVALLOW;
last_hdr = 1;
break;
case ACT_DENY:
txn->flags |= TX_SVDENY;
last_hdr = 1;
break;
case ACT_REPLACE:
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len);
/* FIXME: if the user adds a newline in the replacement, the
* index will not be recalculated for now, and the new line
* will not be counted as a new header.
*/
cur_end += delta;
cur_next += delta;
cur_hdr->len += delta;
txn->rsp.eoh += delta;
break;
case ACT_REMOVE:
delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0);
cur_next += delta;
/* FIXME: this should be a separate function */
txn->rsp.eoh += delta;
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
cur_end = NULL; /* null-term has been rewritten */
break;
}
}
if (cur_end)
*cur_end = term; /* restore the string terminator */
/* keep the link from this header to next one in case of later
* removal of next header.
*/
old_idx = cur_idx;
}
return 0;
}
/* Apply the filter to the status line in the response buffer <rtr>.
* Returns 0 if nothing has been done, 1 if the filter has been applied,
* or -1 if a replacement resulted in an invalid status line.
*/
int apply_filter_to_sts_line(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
{
char term;
char *cur_ptr, *cur_end;
int done;
struct http_txn *txn = &t->txn;
int len, delta;
if (unlikely(txn->flags & TX_SVDENY))
return 1;
else if (unlikely(txn->flags & TX_SVALLOW) &&
(exp->action == ACT_ALLOW ||
exp->action == ACT_DENY))
return 0;
else if (exp->action == ACT_REMOVE)
return 0;
done = 0;
cur_ptr = rtr->data + txn->rsp.som;
cur_end = cur_ptr + txn->rsp.sl.rq.l;
/* Now we have the status line between cur_ptr and cur_end */
/* The annoying part is that pattern matching needs
* that we modify the contents to null-terminate all
* strings before testing them.
*/
term = *cur_end;
*cur_end = '\0';
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
switch (exp->action) {
case ACT_ALLOW:
txn->flags |= TX_SVALLOW;
done = 1;
break;
case ACT_DENY:
txn->flags |= TX_SVDENY;
done = 1;
break;
case ACT_REPLACE:
*cur_end = term; /* restore the string terminator */
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len);
/* FIXME: if the user adds a newline in the replacement, the
* index will not be recalculated for now, and the new line
* will not be counted as a new header.
*/
txn->rsp.eoh += delta;
cur_end += delta;
cur_end = (char *)http_parse_stsline(&txn->rsp, rtr->data,
HTTP_MSG_RQMETH,
cur_ptr, cur_end + 1,
NULL, NULL);
if (unlikely(!cur_end))
return -1;
/* we have a full respnse and we know that we have either a CR
* or an LF at <ptr>.
*/
txn->status = strl2ui(rtr->data + txn->rsp.sl.st.c, txn->rsp.sl.st.c_l);
hdr_idx_set_start(&txn->hdr_idx, txn->rsp.sl.rq.l, *cur_end == '\r');
/* there is no point trying this regex on headers */
return 1;
}
}
*cur_end = term; /* restore the string terminator */
return done;
}
/*
* Apply all the resp filters <exp> to all headers in buffer <rtr> of session <t>.
* Returns 0 if everything is alright, or -1 in case a replacement lead to an
* unparsable response.
*/
int apply_filters_to_response(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
{
struct http_txn *txn = &t->txn;
/* iterate through the filters in the outer loop */
while (exp && !(txn->flags & TX_SVDENY)) {
int ret;
/*
* The interleaving of transformations and verdicts
* makes it difficult to decide to continue or stop
* the evaluation.
*/
if ((txn->flags & TX_SVALLOW) &&
(exp->action == ACT_ALLOW || exp->action == ACT_DENY ||
exp->action == ACT_PASS)) {
exp = exp->next;
continue;
}
/* Apply the filter to the status line. */
ret = apply_filter_to_sts_line(t, rtr, exp);
if (unlikely(ret < 0))
return -1;
if (likely(ret == 0)) {
/* The filter did not match the response, it can be
* iterated through all headers.
*/
apply_filter_to_resp_headers(t, rtr, exp);
}
exp = exp->next;
}
return 0;
}
/*
* Manager server-side cookies
*/
void manage_server_side_cookies(struct session *t, struct buffer *rtr)
{
struct http_txn *txn = &t->txn;
char *p1, *p2, *p3, *p4;
appsess *asession_temp = NULL;
appsess local_asession;
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx, delta;
if (t->be->beprm->cookie_name == NULL &&
t->be->beprm->appsession_name == NULL &&
t->be->fiprm->capture_name == NULL &&
!(t->be->beprm->options & PR_O_CHK_CACHE))
return;
/* Iterate through the headers.
* we start with the start line.
*/
old_idx = 0;
cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
struct hdr_idx_elem *cur_hdr;
int val;
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
/* We have one full header between cur_ptr and cur_end, and the
* next header starts at cur_next. We're only interested in
* "Cookie:" headers.
*/
val = http_header_match2(cur_ptr, cur_end, "Set-Cookie", 10);
if (!val) {
old_idx = cur_idx;
continue;
}
/* OK, right now we know we have a set-cookie at cur_ptr */
txn->flags |= TX_SCK_ANY;
/* maybe we only wanted to see if there was a set-cookie */
if (t->be->beprm->cookie_name == NULL &&
t->be->beprm->appsession_name == NULL &&
t->be->fiprm->capture_name == NULL)
return;
p1 = cur_ptr + val; /* first non-space char after 'Set-Cookie:' */
while (p1 < cur_end) { /* in fact, we'll break after the first cookie */
if (p1 == cur_end || *p1 == ';') /* end of cookie */
break;
/* p1 is at the beginning of the cookie name */
p2 = p1;
while (p2 < cur_end && *p2 != '=' && *p2 != ';')
p2++;
if (p2 == cur_end || *p2 == ';') /* next cookie */
break;
p3 = p2 + 1; /* skip the '=' sign */
if (p3 == cur_end)
break;
p4 = p3;
while (p4 < cur_end && !isspace((int)*p4) && *p4 != ';')
p4++;
/* here, we have the cookie name between p1 and p2,
* and its value between p3 and p4.
* we can process it.
*/
/* first, let's see if we want to capture it */
if (t->be->fiprm->capture_name != NULL &&
txn->srv_cookie == NULL &&
(p4 - p1 >= t->be->fiprm->capture_namelen) &&
memcmp(p1, t->be->fiprm->capture_name, t->be->fiprm->capture_namelen) == 0) {
int log_len = p4 - p1;
if ((txn->srv_cookie = pool_alloc(capture)) == NULL) {
Alert("HTTP logging : out of memory.\n");
}
if (log_len > t->be->fiprm->capture_len)
log_len = t->be->fiprm->capture_len;
memcpy(txn->srv_cookie, p1, log_len);
txn->srv_cookie[log_len] = 0;
}
/* now check if we need to process it for persistence */
if ((p2 - p1 == t->be->beprm->cookie_len) && (t->be->beprm->cookie_name != NULL) &&
(memcmp(p1, t->be->beprm->cookie_name, p2 - p1) == 0)) {
/* Cool... it's the right one */
txn->flags |= TX_SCK_SEEN;
/* If the cookie is in insert mode on a known server, we'll delete
* this occurrence because we'll insert another one later.
* We'll delete it too if the "indirect" option is set and we're in
* a direct access. */
if (((t->srv) && (t->be->beprm->options & PR_O_COOK_INS)) ||
((t->flags & SN_DIRECT) && (t->be->beprm->options & PR_O_COOK_IND))) {
/* this header must be deleted */
delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0);
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
cur_next += delta;
txn->rsp.eoh += delta;
txn->flags |= TX_SCK_DELETED;
}
else if ((t->srv) && (t->srv->cookie) &&
(t->be->beprm->options & PR_O_COOK_RW)) {
/* replace bytes p3->p4 with the cookie name associated
* with this server since we know it.
*/
delta = buffer_replace2(rtr, p3, p4, t->srv->cookie, t->srv->cklen);
cur_hdr->len += delta;
cur_next += delta;
txn->rsp.eoh += delta;
txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED;
}
else if ((t->srv) && (t->srv->cookie) &&
(t->be->beprm->options & PR_O_COOK_PFX)) {
/* insert the cookie name associated with this server
* before existing cookie, and insert a delimitor between them..
*/
delta = buffer_replace2(rtr, p3, p3, t->srv->cookie, t->srv->cklen + 1);
cur_hdr->len += delta;
cur_next += delta;
txn->rsp.eoh += delta;
p3[t->srv->cklen] = COOKIE_DELIM;
txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED;
}
}
/* next, let's see if the cookie is our appcookie */
else if ((t->be->beprm->appsession_name != NULL) &&
(memcmp(p1, t->be->beprm->appsession_name, p2 - p1) == 0)) {
/* Cool... it's the right one */
size_t server_id_len = strlen(t->srv->id) + 1;
asession_temp = &local_asession;
if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) {
Alert("Not enough Memory process_srv():asession->sessid:malloc().\n");
send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n");
return;
}
memcpy(asession_temp->sessid, p3, t->be->beprm->appsession_len);
asession_temp->sessid[t->be->beprm->appsession_len] = 0;
asession_temp->serverid = NULL;
/* only do insert, if lookup fails */
if (chtbl_lookup(&(t->be->htbl_proxy), (void *) &asession_temp) != 0) {
if ((asession_temp = pool_alloc(appsess)) == NULL) {
Alert("Not enough Memory process_srv():asession:calloc().\n");
send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession:calloc().\n");
return;
}
asession_temp->sessid = local_asession.sessid;
asession_temp->serverid = local_asession.serverid;
chtbl_insert(&(t->be->beprm->htbl_proxy), (void *) asession_temp);
}/* end if (chtbl_lookup()) */
else {
/* free wasted memory */
pool_free_to(apools.sessid, local_asession.sessid);
} /* end else from if (chtbl_lookup()) */
if (asession_temp->serverid == NULL) {
if ((asession_temp->serverid = pool_alloc_from(apools.serverid, apools.ser_msize)) == NULL) {
Alert("Not enough Memory process_srv():asession->sessid:malloc().\n");
send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n");
return;
}
asession_temp->serverid[0] = '\0';
}
if (asession_temp->serverid[0] == '\0')
memcpy(asession_temp->serverid, t->srv->id, server_id_len);
tv_delayfrom(&asession_temp->expire, &now, t->be->beprm->appsession_timeout);
#if defined(DEBUG_HASH)
print_table(&(t->be->beprm->htbl_proxy));
#endif
}/* end if ((t->proxy->appsession_name != NULL) ... */
break; /* we don't want to loop again since there cannot be another cookie on the same line */
} /* we're now at the end of the cookie value */
/* keep the link from this header to next one */
old_idx = cur_idx;
} /* end of cookie processing on this header */
}
/*
* Check if response is cacheable or not. Updates t->flags.
*/
void check_response_for_cacheability(struct session *t, struct buffer *rtr)
{
struct http_txn *txn = &t->txn;
char *p1, *p2;
char *cur_ptr, *cur_end, *cur_next;
int cur_idx;
if (!txn->flags & TX_CACHEABLE)
return;
/* Iterate through the headers.
* we start with the start line.
*/
cur_idx = 0;
cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) {
struct hdr_idx_elem *cur_hdr;
int val;
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
/* We have one full header between cur_ptr and cur_end, and the
* next header starts at cur_next. We're only interested in
* "Cookie:" headers.
*/
val = http_header_match2(cur_ptr, cur_end, "Pragma", 6);
if (val) {
if ((cur_end - (cur_ptr + val) >= 8) &&
strncasecmp(cur_ptr + val, "no-cache", 8) == 0) {
txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
return;
}
}
val = http_header_match2(cur_ptr, cur_end, "Cache-control", 13);
if (!val)
continue;
/* OK, right now we know we have a cache-control header at cur_ptr */
p1 = cur_ptr + val; /* first non-space char after 'cache-control:' */
if (p1 >= cur_end) /* no more info */
continue;
/* p1 is at the beginning of the value */
p2 = p1;
while (p2 < cur_end && *p2 != '=' && *p2 != ',' && !isspace((int)*p2))
p2++;
/* we have a complete value between p1 and p2 */
if (p2 < cur_end && *p2 == '=') {
/* we have something of the form no-cache="set-cookie" */
if ((cur_end - p1 >= 21) &&
strncasecmp(p1, "no-cache=\"set-cookie", 20) == 0
&& (p1[20] == '"' || p1[20] == ','))
txn->flags &= ~TX_CACHE_COOK;
continue;
}
/* OK, so we know that either p2 points to the end of string or to a comma */
if (((p2 - p1 == 7) && strncasecmp(p1, "private", 7) == 0) ||
((p2 - p1 == 8) && strncasecmp(p1, "no-store", 8) == 0) ||
((p2 - p1 == 9) && strncasecmp(p1, "max-age=0", 9) == 0) ||
((p2 - p1 == 10) && strncasecmp(p1, "s-maxage=0", 10) == 0)) {
txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
return;
}
if ((p2 - p1 == 6) && strncasecmp(p1, "public", 6) == 0) {
txn->flags |= TX_CACHEABLE | TX_CACHE_COOK;
continue;
}
}
}
/*
* Try to retrieve a known appsession in the URI, then the associated server.
* If the server is found, it's assigned to the session.
*/
void get_srv_from_appsession(struct session *t, const char *begin, int len)
{
struct http_txn *txn = &t->txn;
appsess *asession_temp = NULL;
appsess local_asession;
char *request_line;
if (t->be->beprm->appsession_name == NULL ||
(t->txn.meth != HTTP_METH_GET && t->txn.meth != HTTP_METH_POST) ||
(request_line = memchr(begin, ';', len)) == NULL ||
((1 + t->be->beprm->appsession_name_len + 1 + t->be->beprm->appsession_len) > (begin + len - request_line)))
return;
/* skip ';' */
request_line++;
/* look if we have a jsessionid */
if (strncasecmp(request_line, t->be->beprm->appsession_name, t->be->beprm->appsession_name_len) != 0)
return;
/* skip jsessionid= */
request_line += t->be->beprm->appsession_name_len + 1;
/* First try if we already have an appsession */
asession_temp = &local_asession;
if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) {
Alert("Not enough memory process_cli():asession_temp->sessid:calloc().\n");
send_log(t->be, LOG_ALERT, "Not enough Memory process_cli():asession_temp->sessid:calloc().\n");
return;
}
/* Copy the sessionid */
memcpy(asession_temp->sessid, request_line, t->be->beprm->appsession_len);
asession_temp->sessid[t->be->beprm->appsession_len] = 0;
asession_temp->serverid = NULL;
/* only do insert, if lookup fails */
if (chtbl_lookup(&(t->be->beprm->htbl_proxy), (void *)&asession_temp)) {
if ((asession_temp = pool_alloc(appsess)) == NULL) {
/* free previously allocated memory */
pool_free_to(apools.sessid, local_asession.sessid);
Alert("Not enough memory process_cli():asession:calloc().\n");
send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
return;
}
asession_temp->sessid = local_asession.sessid;
asession_temp->serverid = local_asession.serverid;
chtbl_insert(&(t->be->beprm->htbl_proxy), (void *) asession_temp);
}
else {
/* free previously allocated memory */
pool_free_to(apools.sessid, local_asession.sessid);
}
tv_delayfrom(&asession_temp->expire, &now, t->be->beprm->appsession_timeout);
asession_temp->request_count++;
#if defined(DEBUG_HASH)
print_table(&(t->proxy->htbl_proxy));
#endif
if (asession_temp->serverid == NULL) {
Alert("Found Application Session without matching server.\n");
} else {
struct server *srv = t->be->beprm->srv;
while (srv) {
if (strcmp(srv->id, asession_temp->serverid) == 0) {
if (srv->state & SRV_RUNNING || t->be->beprm->options & PR_O_PERSIST) {
/* we found the server and it's usable */
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_VALID;
t->flags |= SN_DIRECT | SN_ASSIGNED;
t->srv = srv;
break;
} else {
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_DOWN;
}
}
srv = srv->next;
}
}
}
/*
* In a GET or HEAD request, check if the requested URI matches the stats uri
* for the current backend, and if an authorization has been passed and is valid.
*
* It is assumed that the request is either a HEAD or GET and that the
* t->be->fiprm->uri_auth field is valid. An HTTP/401 response may be sent, or
* produce_content() can be called to start sending data.
*
* Returns 1 if the session's state changes, otherwise 0.
*/
int stats_check_uri_auth(struct session *t, struct proxy *backend)
{
struct http_txn *txn = &t->txn;
struct uri_auth *uri_auth = backend->uri_auth;
struct user_auth *user;
int authenticated, cur_idx;
char *h;
/* check URI size */
if (uri_auth->uri_len > txn->req.sl.rq.u_l)
return 0;
h = t->req->data + txn->req.sl.rq.u;
/* the URI is in h */
if (memcmp(h, uri_auth->uri_prefix, uri_auth->uri_len) != 0)
return 0;
/* we are in front of a interceptable URI. Let's check
* if there's an authentication and if it's valid.
*/
user = uri_auth->users;
if (!user) {
/* no user auth required, it's OK */
authenticated = 1;
} else {
authenticated = 0;
/* a user list is defined, we have to check.
* skip 21 chars for "Authorization: Basic ".
*/
/* FIXME: this should move to an earlier place */
cur_idx = 0;
h = t->req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) {
int len = txn->hdr_idx.v[cur_idx].len;
if (len > 14 &&
!strncasecmp("Authorization:", h, 14)) {
txn->auth_hdr.str = h;
txn->auth_hdr.len = len;
break;
}
h += len + txn->hdr_idx.v[cur_idx].cr + 1;
}
if (txn->auth_hdr.len < 21 ||
memcmp(txn->auth_hdr.str + 14, " Basic ", 7))
user = NULL;
while (user) {
if ((txn->auth_hdr.len == user->user_len + 14 + 7)
&& !memcmp(txn->auth_hdr.str + 14 + 7,
user->user_pwd, user->user_len)) {
authenticated = 1;
break;
}
user = user->next;
}
}
if (!authenticated) {
struct chunk msg;
/* no need to go further */
msg.str = trash;
msg.len = sprintf(trash, HTTP_401_fmt, uri_auth->auth_realm);
txn->status = 401;
client_retnclose(t, &msg);
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_PRXCOND;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_R;
return 1;
}
/* The request is valid, the user is authenticate. Let's start sending
* data.
*/
t->cli_state = CL_STSHUTR;
t->req->rlim = t->req->data + BUFSIZE; /* no more rewrite needed */
t->logs.t_request = tv_diff(&t->logs.tv_accept, &now);
t->data_source = DATA_SRC_STATS;
t->data_state = DATA_ST_INIT;
produce_content(t);
return 1;
}
/*
* Print a debug line with a header
*/
void debug_hdr(const char *dir, struct session *t, const char *start, const char *end)
{
int len, max;
len = sprintf(trash, "%08x:%s.%s[%04x:%04x]: ", t->uniq_id, t->be->id,
dir, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
max = end - start;
UBOUND(max, sizeof(trash) - len - 1);
len += strlcpy2(trash + len, start, max + 1);
trash[len++] = '\n';
write(1, trash, len);
}
/*
* Local variables:
* c-indent-level: 8
* c-basic-offset: 8
* End:
*/