blob: 23007384310f33376d2c2203dbd42d286389f882 [file] [log] [blame]
/*
* HTTP protocol analyzer
*
* Copyright 2000-2008 Willy Tarreau <w@1wt.eu>
*
* This program is free software; you can redistribute it and/or
* modify it under the terms of the GNU General Public License
* as published by the Free Software Foundation; either version
* 2 of the License, or (at your option) any later version.
*
*/
#include <ctype.h>
#include <errno.h>
#include <fcntl.h>
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <syslog.h>
#include <time.h>
#include <sys/socket.h>
#include <sys/stat.h>
#include <sys/types.h>
#include <common/appsession.h>
#include <common/compat.h>
#include <common/config.h>
#include <common/debug.h>
#include <common/memory.h>
#include <common/mini-clist.h>
#include <common/standard.h>
#include <common/ticks.h>
#include <common/time.h>
#include <common/uri_auth.h>
#include <common/version.h>
#include <types/capture.h>
#include <types/global.h>
#include <proto/acl.h>
#include <proto/backend.h>
#include <proto/buffers.h>
#include <proto/client.h>
#include <proto/dumpstats.h>
#include <proto/fd.h>
#include <proto/log.h>
#include <proto/hdr_idx.h>
#include <proto/proto_tcp.h>
#include <proto/proto_http.h>
#include <proto/proxy.h>
#include <proto/queue.h>
#include <proto/server.h>
#include <proto/session.h>
#include <proto/stream_interface.h>
#include <proto/stream_sock.h>
#include <proto/task.h>
/* This is used by remote monitoring */
const char HTTP_200[] =
"HTTP/1.0 200 OK\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>200 OK</h1>\nHAProxy: service ready.\n</body></html>\n";
const struct chunk http_200_chunk = {
.str = (char *)&HTTP_200,
.len = sizeof(HTTP_200)-1
};
const char *HTTP_301 =
"HTTP/1.0 301 Moved Permantenly\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Location: "; /* not terminated since it will be concatenated with the URL */
const char *HTTP_302 =
"HTTP/1.0 302 Found\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Location: "; /* not terminated since it will be concatenated with the URL */
/* same as 302 except that the browser MUST retry with the GET method */
const char *HTTP_303 =
"HTTP/1.0 303 See Other\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Location: "; /* not terminated since it will be concatenated with the URL */
/* Warning: this one is an sprintf() fmt string, with <realm> as its only argument */
const char *HTTP_401_fmt =
"HTTP/1.0 401 Unauthorized\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"WWW-Authenticate: Basic realm=\"%s\"\r\n"
"\r\n"
"<html><body><h1>401 Unauthorized</h1>\nYou need a valid user and password to access this content.\n</body></html>\n";
const int http_err_codes[HTTP_ERR_SIZE] = {
[HTTP_ERR_400] = 400,
[HTTP_ERR_403] = 403,
[HTTP_ERR_408] = 408,
[HTTP_ERR_500] = 500,
[HTTP_ERR_502] = 502,
[HTTP_ERR_503] = 503,
[HTTP_ERR_504] = 504,
};
static const char *http_err_msgs[HTTP_ERR_SIZE] = {
[HTTP_ERR_400] =
"HTTP/1.0 400 Bad request\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>400 Bad request</h1>\nYour browser sent an invalid request.\n</body></html>\n",
[HTTP_ERR_403] =
"HTTP/1.0 403 Forbidden\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>403 Forbidden</h1>\nRequest forbidden by administrative rules.\n</body></html>\n",
[HTTP_ERR_408] =
"HTTP/1.0 408 Request Time-out\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>408 Request Time-out</h1>\nYour browser didn't send a complete request in time.\n</body></html>\n",
[HTTP_ERR_500] =
"HTTP/1.0 500 Server Error\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>500 Server Error</h1>\nAn internal server error occured.\n</body></html>\n",
[HTTP_ERR_502] =
"HTTP/1.0 502 Bad Gateway\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>502 Bad Gateway</h1>\nThe server returned an invalid or incomplete response.\n</body></html>\n",
[HTTP_ERR_503] =
"HTTP/1.0 503 Service Unavailable\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>503 Service Unavailable</h1>\nNo server is available to handle this request.\n</body></html>\n",
[HTTP_ERR_504] =
"HTTP/1.0 504 Gateway Time-out\r\n"
"Cache-Control: no-cache\r\n"
"Connection: close\r\n"
"Content-Type: text/html\r\n"
"\r\n"
"<html><body><h1>504 Gateway Time-out</h1>\nThe server didn't respond in time.\n</body></html>\n",
};
/* We must put the messages here since GCC cannot initialize consts depending
* on strlen().
*/
struct chunk http_err_chunks[HTTP_ERR_SIZE];
#define FD_SETS_ARE_BITFIELDS
#ifdef FD_SETS_ARE_BITFIELDS
/*
* This map is used with all the FD_* macros to check whether a particular bit
* is set or not. Each bit represents an ACSII code. FD_SET() sets those bytes
* which should be encoded. When FD_ISSET() returns non-zero, it means that the
* byte should be encoded. Be careful to always pass bytes from 0 to 255
* exclusively to the macros.
*/
fd_set hdr_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))];
fd_set url_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))];
#else
#error "Check if your OS uses bitfields for fd_sets"
#endif
void init_proto_http()
{
int i;
char *tmp;
int msg;
for (msg = 0; msg < HTTP_ERR_SIZE; msg++) {
if (!http_err_msgs[msg]) {
Alert("Internal error: no message defined for HTTP return code %d. Aborting.\n", msg);
abort();
}
http_err_chunks[msg].str = (char *)http_err_msgs[msg];
http_err_chunks[msg].len = strlen(http_err_msgs[msg]);
}
/* initialize the log header encoding map : '{|}"#' should be encoded with
* '#' as prefix, as well as non-printable characters ( <32 or >= 127 ).
* URL encoding only requires '"', '#' to be encoded as well as non-
* printable characters above.
*/
memset(hdr_encode_map, 0, sizeof(hdr_encode_map));
memset(url_encode_map, 0, sizeof(url_encode_map));
for (i = 0; i < 32; i++) {
FD_SET(i, hdr_encode_map);
FD_SET(i, url_encode_map);
}
for (i = 127; i < 256; i++) {
FD_SET(i, hdr_encode_map);
FD_SET(i, url_encode_map);
}
tmp = "\"#{|}";
while (*tmp) {
FD_SET(*tmp, hdr_encode_map);
tmp++;
}
tmp = "\"#";
while (*tmp) {
FD_SET(*tmp, url_encode_map);
tmp++;
}
/* memory allocations */
pool2_requri = create_pool("requri", REQURI_LEN, MEM_F_SHARED);
pool2_capture = create_pool("capture", CAPTURE_LEN, MEM_F_SHARED);
}
/*
* We have 26 list of methods (1 per first letter), each of which can have
* up to 3 entries (2 valid, 1 null).
*/
struct http_method_desc {
http_meth_t meth;
int len;
const char text[8];
};
const struct http_method_desc http_methods[26][3] = {
['C' - 'A'] = {
[0] = { .meth = HTTP_METH_CONNECT , .len=7, .text="CONNECT" },
},
['D' - 'A'] = {
[0] = { .meth = HTTP_METH_DELETE , .len=6, .text="DELETE" },
},
['G' - 'A'] = {
[0] = { .meth = HTTP_METH_GET , .len=3, .text="GET" },
},
['H' - 'A'] = {
[0] = { .meth = HTTP_METH_HEAD , .len=4, .text="HEAD" },
},
['P' - 'A'] = {
[0] = { .meth = HTTP_METH_POST , .len=4, .text="POST" },
[1] = { .meth = HTTP_METH_PUT , .len=3, .text="PUT" },
},
['T' - 'A'] = {
[0] = { .meth = HTTP_METH_TRACE , .len=5, .text="TRACE" },
},
/* rest is empty like this :
* [1] = { .meth = HTTP_METH_NONE , .len=0, .text="" },
*/
};
/* It is about twice as fast on recent architectures to lookup a byte in a
* table than to perform a boolean AND or OR between two tests. Refer to
* RFC2616 for those chars.
*/
const char http_is_spht[256] = {
[' '] = 1, ['\t'] = 1,
};
const char http_is_crlf[256] = {
['\r'] = 1, ['\n'] = 1,
};
const char http_is_lws[256] = {
[' '] = 1, ['\t'] = 1,
['\r'] = 1, ['\n'] = 1,
};
const char http_is_sep[256] = {
['('] = 1, [')'] = 1, ['<'] = 1, ['>'] = 1,
['@'] = 1, [','] = 1, [';'] = 1, [':'] = 1,
['"'] = 1, ['/'] = 1, ['['] = 1, [']'] = 1,
['{'] = 1, ['}'] = 1, ['?'] = 1, ['='] = 1,
[' '] = 1, ['\t'] = 1, ['\\'] = 1,
};
const char http_is_ctl[256] = {
[0 ... 31] = 1,
[127] = 1,
};
/*
* A token is any ASCII char that is neither a separator nor a CTL char.
* Do not overwrite values in assignment since gcc-2.95 will not handle
* them correctly. Instead, define every non-CTL char's status.
*/
const char http_is_token[256] = {
[' '] = 0, ['!'] = 1, ['"'] = 0, ['#'] = 1,
['$'] = 1, ['%'] = 1, ['&'] = 1, ['\''] = 1,
['('] = 0, [')'] = 0, ['*'] = 1, ['+'] = 1,
[','] = 0, ['-'] = 1, ['.'] = 1, ['/'] = 0,
['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1,
['4'] = 1, ['5'] = 1, ['6'] = 1, ['7'] = 1,
['8'] = 1, ['9'] = 1, [':'] = 0, [';'] = 0,
['<'] = 0, ['='] = 0, ['>'] = 0, ['?'] = 0,
['@'] = 0, ['A'] = 1, ['B'] = 1, ['C'] = 1,
['D'] = 1, ['E'] = 1, ['F'] = 1, ['G'] = 1,
['H'] = 1, ['I'] = 1, ['J'] = 1, ['K'] = 1,
['L'] = 1, ['M'] = 1, ['N'] = 1, ['O'] = 1,
['P'] = 1, ['Q'] = 1, ['R'] = 1, ['S'] = 1,
['T'] = 1, ['U'] = 1, ['V'] = 1, ['W'] = 1,
['X'] = 1, ['Y'] = 1, ['Z'] = 1, ['['] = 0,
['\\'] = 0, [']'] = 0, ['^'] = 1, ['_'] = 1,
['`'] = 1, ['a'] = 1, ['b'] = 1, ['c'] = 1,
['d'] = 1, ['e'] = 1, ['f'] = 1, ['g'] = 1,
['h'] = 1, ['i'] = 1, ['j'] = 1, ['k'] = 1,
['l'] = 1, ['m'] = 1, ['n'] = 1, ['o'] = 1,
['p'] = 1, ['q'] = 1, ['r'] = 1, ['s'] = 1,
['t'] = 1, ['u'] = 1, ['v'] = 1, ['w'] = 1,
['x'] = 1, ['y'] = 1, ['z'] = 1, ['{'] = 0,
['|'] = 1, ['}'] = 0, ['~'] = 1,
};
/*
* An http ver_token is any ASCII which can be found in an HTTP version,
* which includes 'H', 'T', 'P', '/', '.' and any digit.
*/
const char http_is_ver_token[256] = {
['.'] = 1, ['/'] = 1,
['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1, ['4'] = 1,
['5'] = 1, ['6'] = 1, ['7'] = 1, ['8'] = 1, ['9'] = 1,
['H'] = 1, ['P'] = 1, ['T'] = 1,
};
/*
* Adds a header and its CRLF at the tail of buffer <b>, just before the last
* CRLF. Text length is measured first, so it cannot be NULL.
* The header is also automatically added to the index <hdr_idx>, and the end
* of headers is automatically adjusted. The number of bytes added is returned
* on success, otherwise <0 is returned indicating an error.
*/
int http_header_add_tail(struct buffer *b, struct http_msg *msg,
struct hdr_idx *hdr_idx, const char *text)
{
int bytes, len;
len = strlen(text);
bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len);
if (!bytes)
return -1;
msg->eoh += bytes;
return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail);
}
/*
* Adds a header and its CRLF at the tail of buffer <b>, just before the last
* CRLF. <len> bytes are copied, not counting the CRLF. If <text> is NULL, then
* the buffer is only opened and the space reserved, but nothing is copied.
* The header is also automatically added to the index <hdr_idx>, and the end
* of headers is automatically adjusted. The number of bytes added is returned
* on success, otherwise <0 is returned indicating an error.
*/
int http_header_add_tail2(struct buffer *b, struct http_msg *msg,
struct hdr_idx *hdr_idx, const char *text, int len)
{
int bytes;
bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len);
if (!bytes)
return -1;
msg->eoh += bytes;
return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail);
}
/*
* Checks if <hdr> is exactly <name> for <len> chars, and ends with a colon.
* If so, returns the position of the first non-space character relative to
* <hdr>, or <end>-<hdr> if not found before. If no value is found, it tries
* to return a pointer to the place after the first space. Returns 0 if the
* header name does not match. Checks are case-insensitive.
*/
int http_header_match2(const char *hdr, const char *end,
const char *name, int len)
{
const char *val;
if (hdr + len >= end)
return 0;
if (hdr[len] != ':')
return 0;
if (strncasecmp(hdr, name, len) != 0)
return 0;
val = hdr + len + 1;
while (val < end && HTTP_IS_SPHT(*val))
val++;
if ((val >= end) && (len + 2 <= end - hdr))
return len + 2; /* we may replace starting from second space */
return val - hdr;
}
/* Find the end of the header value contained between <s> and <e>.
* See RFC2616, par 2.2 for more information. Note that it requires
* a valid header to return a valid result.
*/
const char *find_hdr_value_end(const char *s, const char *e)
{
int quoted, qdpair;
quoted = qdpair = 0;
for (; s < e; s++) {
if (qdpair) qdpair = 0;
else if (quoted && *s == '\\') qdpair = 1;
else if (quoted && *s == '"') quoted = 0;
else if (*s == '"') quoted = 1;
else if (*s == ',') return s;
}
return s;
}
/* Find the first or next occurrence of header <name> in message buffer <sol>
* using headers index <idx>, and return it in the <ctx> structure. This
* structure holds everything necessary to use the header and find next
* occurrence. If its <idx> member is 0, the header is searched from the
* beginning. Otherwise, the next occurrence is returned. The function returns
* 1 when it finds a value, and 0 when there is no more.
*/
int http_find_header2(const char *name, int len,
const char *sol, struct hdr_idx *idx,
struct hdr_ctx *ctx)
{
const char *eol, *sov;
int cur_idx;
if (ctx->idx) {
/* We have previously returned a value, let's search
* another one on the same line.
*/
cur_idx = ctx->idx;
sol = ctx->line;
sov = sol + ctx->val + ctx->vlen;
eol = sol + idx->v[cur_idx].len;
if (sov >= eol)
/* no more values in this header */
goto next_hdr;
/* values remaining for this header, skip the comma */
sov++;
while (sov < eol && http_is_lws[(unsigned char)*sov])
sov++;
goto return_hdr;
}
/* first request for this header */
sol += hdr_idx_first_pos(idx);
cur_idx = hdr_idx_first_idx(idx);
while (cur_idx) {
eol = sol + idx->v[cur_idx].len;
if (len == 0) {
/* No argument was passed, we want any header.
* To achieve this, we simply build a fake request. */
while (sol + len < eol && sol[len] != ':')
len++;
name = sol;
}
if ((len < eol - sol) &&
(sol[len] == ':') &&
(strncasecmp(sol, name, len) == 0)) {
sov = sol + len + 1;
while (sov < eol && http_is_lws[(unsigned char)*sov])
sov++;
return_hdr:
ctx->line = sol;
ctx->idx = cur_idx;
ctx->val = sov - sol;
eol = find_hdr_value_end(sov, eol);
ctx->vlen = eol - sov;
return 1;
}
next_hdr:
sol = eol + idx->v[cur_idx].cr + 1;
cur_idx = idx->v[cur_idx].next;
}
return 0;
}
int http_find_header(const char *name,
const char *sol, struct hdr_idx *idx,
struct hdr_ctx *ctx)
{
return http_find_header2(name, strlen(name), sol, idx, ctx);
}
/* This function handles a server error at the stream interface level. The
* stream interface is assumed to be already in a closed state. An optional
* message is copied into the input buffer, and an HTTP status code stored.
* The error flags are set to the values in arguments. Any pending request
* in this buffer will be lost.
*/
static void http_server_error(struct session *t, struct stream_interface *si,
int err, int finst, int status, const struct chunk *msg)
{
buffer_erase(si->ob);
buffer_erase(si->ib);
buffer_auto_close(si->ib);
if (status > 0 && msg) {
t->txn.status = status;
buffer_write(si->ib, msg->str, msg->len);
}
if (!(t->flags & SN_ERR_MASK))
t->flags |= err;
if (!(t->flags & SN_FINST_MASK))
t->flags |= finst;
}
/* This function returns the appropriate error location for the given session
* and message.
*/
struct chunk *error_message(struct session *s, int msgnum)
{
if (s->be->errmsg[msgnum].str)
return &s->be->errmsg[msgnum];
else if (s->fe->errmsg[msgnum].str)
return &s->fe->errmsg[msgnum];
else
return &http_err_chunks[msgnum];
}
/*
* returns HTTP_METH_NONE if there is nothing valid to read (empty or non-text
* string), HTTP_METH_OTHER for unknown methods, or the identified method.
*/
static http_meth_t find_http_meth(const char *str, const int len)
{
unsigned char m;
const struct http_method_desc *h;
m = ((unsigned)*str - 'A');
if (m < 26) {
for (h = http_methods[m]; h->len > 0; h++) {
if (unlikely(h->len != len))
continue;
if (likely(memcmp(str, h->text, h->len) == 0))
return h->meth;
};
return HTTP_METH_OTHER;
}
return HTTP_METH_NONE;
}
/* Parse the URI from the given transaction (which is assumed to be in request
* phase) and look for the "/" beginning the PATH. If not found, return NULL.
* It is returned otherwise.
*/
static char *
http_get_path(struct http_txn *txn)
{
char *ptr, *end;
ptr = txn->req.sol + txn->req.sl.rq.u;
end = ptr + txn->req.sl.rq.u_l;
if (ptr >= end)
return NULL;
/* RFC2616, par. 5.1.2 :
* Request-URI = "*" | absuri | abspath | authority
*/
if (*ptr == '*')
return NULL;
if (isalpha((unsigned char)*ptr)) {
/* this is a scheme as described by RFC3986, par. 3.1 */
ptr++;
while (ptr < end &&
(isalnum((unsigned char)*ptr) || *ptr == '+' || *ptr == '-' || *ptr == '.'))
ptr++;
/* skip '://' */
if (ptr == end || *ptr++ != ':')
return NULL;
if (ptr == end || *ptr++ != '/')
return NULL;
if (ptr == end || *ptr++ != '/')
return NULL;
}
/* skip [user[:passwd]@]host[:[port]] */
while (ptr < end && *ptr != '/')
ptr++;
if (ptr == end)
return NULL;
/* OK, we got the '/' ! */
return ptr;
}
/* Returns a 302 for a redirectable request. This may only be called just after
* the stream interface has moved to SI_ST_ASS. Unprocessable requests are
* left unchanged and will follow normal proxy processing.
*/
void perform_http_redirect(struct session *s, struct stream_interface *si)
{
struct http_txn *txn;
struct chunk rdr;
char *path;
int len;
/* 1: create the response header */
rdr.len = strlen(HTTP_302);
rdr.str = trash;
memcpy(rdr.str, HTTP_302, rdr.len);
/* 2: add the server's prefix */
if (rdr.len + s->srv->rdr_len > rdr.size)
return;
memcpy(rdr.str + rdr.len, s->srv->rdr_pfx, s->srv->rdr_len);
rdr.len += s->srv->rdr_len;
/* 3: add the request URI */
txn = &s->txn;
path = http_get_path(txn);
if (!path)
return;
len = txn->req.sl.rq.u_l + (txn->req.sol+txn->req.sl.rq.u) - path;
if (rdr.len + len > rdr.size - 4) /* 4 for CRLF-CRLF */
return;
memcpy(rdr.str + rdr.len, path, len);
rdr.len += len;
memcpy(rdr.str + rdr.len, "\r\n\r\n", 4);
rdr.len += 4;
/* prepare to return without error. */
si->shutr(si);
si->shutw(si);
si->err_type = SI_ET_NONE;
si->err_loc = NULL;
si->state = SI_ST_CLO;
/* send the message */
http_server_error(s, si, SN_ERR_PRXCOND, SN_FINST_C, 302, &rdr);
/* FIXME: we should increase a counter of redirects per server and per backend. */
if (s->srv)
srv_inc_sess_ctr(s->srv);
}
/* Return the error message corresponding to si->err_type. It is assumed
* that the server side is closed. Note that err_type is actually a
* bitmask, where almost only aborts may be cumulated with other
* values. We consider that aborted operations are more important
* than timeouts or errors due to the fact that nobody else in the
* logs might explain incomplete retries. All others should avoid
* being cumulated. It should normally not be possible to have multiple
* aborts at once, but just in case, the first one in sequence is reported.
*/
void http_return_srv_error(struct session *s, struct stream_interface *si)
{
int err_type = si->err_type;
if (err_type & SI_ET_QUEUE_ABRT)
http_server_error(s, si, SN_ERR_CLICL, SN_FINST_Q,
503, error_message(s, HTTP_ERR_503));
else if (err_type & SI_ET_CONN_ABRT)
http_server_error(s, si, SN_ERR_CLICL, SN_FINST_C,
503, error_message(s, HTTP_ERR_503));
else if (err_type & SI_ET_QUEUE_TO)
http_server_error(s, si, SN_ERR_SRVTO, SN_FINST_Q,
503, error_message(s, HTTP_ERR_503));
else if (err_type & SI_ET_QUEUE_ERR)
http_server_error(s, si, SN_ERR_SRVCL, SN_FINST_Q,
503, error_message(s, HTTP_ERR_503));
else if (err_type & SI_ET_CONN_TO)
http_server_error(s, si, SN_ERR_SRVTO, SN_FINST_C,
503, error_message(s, HTTP_ERR_503));
else if (err_type & SI_ET_CONN_ERR)
http_server_error(s, si, SN_ERR_SRVCL, SN_FINST_C,
503, error_message(s, HTTP_ERR_503));
else /* SI_ET_CONN_OTHER and others */
http_server_error(s, si, SN_ERR_INTERNAL, SN_FINST_C,
500, error_message(s, HTTP_ERR_500));
}
extern const char sess_term_cond[8];
extern const char sess_fin_state[8];
extern const char *monthname[12];
const char sess_cookie[4] = "NIDV"; /* No cookie, Invalid cookie, cookie for a Down server, Valid cookie */
const char sess_set_cookie[8] = "N1I3PD5R"; /* No set-cookie, unknown, Set-Cookie Inserted, unknown,
Set-cookie seen and left unchanged (passive), Set-cookie Deleted,
unknown, Set-cookie Rewritten */
struct pool_head *pool2_requri;
struct pool_head *pool2_capture;
void http_sess_clflog(struct session *s)
{
char pn[INET6_ADDRSTRLEN + strlen(":65535")];
struct proxy *fe = s->fe;
struct proxy *be = s->be;
struct proxy *prx_log;
struct http_txn *txn = &s->txn;
int tolog, level, err;
char *uri, *h;
char *svid;
struct tm tm;
static char tmpline[MAX_SYSLOG_LEN];
int hdr;
size_t w;
int t_request;
prx_log = fe;
err = (s->flags & (SN_ERR_MASK | SN_REDISP)) ||
(s->conn_retries != be->conn_retries) ||
txn->status >= 500;
if (s->cli_addr.ss_family == AF_INET)
inet_ntop(AF_INET,
(const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr,
pn, sizeof(pn));
else
inet_ntop(AF_INET6,
(const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr,
pn, sizeof(pn));
get_gmtime(s->logs.accept_date.tv_sec, &tm);
/* FIXME: let's limit ourselves to frontend logging for now. */
tolog = fe->to_log;
h = tmpline;
w = snprintf(h, sizeof(tmpline),
"%s - - [%02d/%s/%04d:%02d:%02d:%02d +0000]",
pn,
tm.tm_mday, monthname[tm.tm_mon], tm.tm_year+1900,
tm.tm_hour, tm.tm_min, tm.tm_sec);
if (w < 0 || w >= sizeof(tmpline) - (h - tmpline))
goto trunc;
h += w;
if (h >= tmpline + sizeof(tmpline) - 4)
goto trunc;
*(h++) = ' ';
*(h++) = '\"';
uri = txn->uri ? txn->uri : "<BADREQ>";
h = encode_string(h, tmpline + sizeof(tmpline) - 1,
'#', url_encode_map, uri);
*(h++) = '\"';
w = snprintf(h, sizeof(tmpline) - (h - tmpline), " %d %lld", txn->status, s->logs.bytes_out);
if (w < 0 || w >= sizeof(tmpline) - (h - tmpline))
goto trunc;
h += w;
if (h >= tmpline + sizeof(tmpline) - 9)
goto trunc;
memcpy(h, " \"-\" \"-\"", 8);
h += 8;
w = snprintf(h, sizeof(tmpline) - (h - tmpline),
" %d %03d",
(s->cli_addr.ss_family == AF_INET) ?
ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) :
ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port),
(int)s->logs.accept_date.tv_usec/1000);
if (w < 0 || w >= sizeof(tmpline) - (h - tmpline))
goto trunc;
h += w;
w = strlen(fe->id);
if (h >= tmpline + sizeof(tmpline) - 4 - w)
goto trunc;
*(h++) = ' ';
*(h++) = '\"';
memcpy(h, fe->id, w);
h += w;
*(h++) = '\"';
w = strlen(be->id);
if (h >= tmpline + sizeof(tmpline) - 4 - w)
goto trunc;
*(h++) = ' ';
*(h++) = '\"';
memcpy(h, be->id, w);
h += w;
*(h++) = '\"';
svid = (tolog & LW_SVID) ?
(s->data_source != DATA_SRC_STATS) ?
(s->srv != NULL) ? s->srv->id : "<NOSRV>" : "<STATS>" : "-";
w = strlen(svid);
if (h >= tmpline + sizeof(tmpline) - 4 - w)
goto trunc;
*(h++) = ' ';
*(h++) = '\"';
memcpy(h, svid, w);
h += w;
*(h++) = '\"';
t_request = -1;
if (tv_isge(&s->logs.tv_request, &s->logs.tv_accept))
t_request = tv_ms_elapsed(&s->logs.tv_accept, &s->logs.tv_request);
w = snprintf(h, sizeof(tmpline) - (h - tmpline),
" %d %ld %ld %ld %ld",
t_request,
(s->logs.t_queue >= 0) ? s->logs.t_queue - t_request : -1,
(s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_queue : -1,
(s->logs.t_data >= 0) ? s->logs.t_data - s->logs.t_connect : -1,
s->logs.t_close);
if (w < 0 || w >= sizeof(tmpline) - (h - tmpline))
goto trunc;
h += w;
if (h >= tmpline + sizeof(tmpline) - 8)
goto trunc;
*(h++) = ' ';
*(h++) = '\"';
*(h++) = sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT];
*(h++) = sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT];
*(h++) = (be->options & PR_O_COOK_ANY) ? sess_cookie[(txn->flags & TX_CK_MASK) >> TX_CK_SHIFT] : '-',
*(h++) = (be->options & PR_O_COOK_ANY) ? sess_set_cookie[(txn->flags & TX_SCK_MASK) >> TX_SCK_SHIFT] : '-';
*(h++) = '\"';
w = snprintf(h, sizeof(tmpline) - (h - tmpline),
" %d %d %d %d %d %ld %ld",
actconn, fe->feconn, be->beconn, s->srv ? s->srv->cur_sess : 0,
(s->conn_retries > 0) ? (be->conn_retries - s->conn_retries) : be->conn_retries,
s->logs.srv_queue_size, s->logs.prx_queue_size);
if (w < 0 || w >= sizeof(tmpline) - (h - tmpline))
goto trunc;
h += w;
if (txn->cli_cookie) {
w = strlen(txn->cli_cookie);
if (h >= tmpline + sizeof(tmpline) - 4 - w)
goto trunc;
*(h++) = ' ';
*(h++) = '\"';
memcpy(h, txn->cli_cookie, w);
h += w;
*(h++) = '\"';
} else {
if (h >= tmpline + sizeof(tmpline) - 5)
goto trunc;
memcpy(h, " \"-\"", 4);
h += 4;
}
if (txn->srv_cookie) {
w = strlen(txn->srv_cookie);
if (h >= tmpline + sizeof(tmpline) - 4 - w)
goto trunc;
*(h++) = ' ';
*(h++) = '\"';
memcpy(h, txn->srv_cookie, w);
h += w;
*(h++) = '\"';
} else {
if (h >= tmpline + sizeof(tmpline) - 5)
goto trunc;
memcpy(h, " \"-\"", 4);
h += 4;
}
if ((fe->to_log & LW_REQHDR) && txn->req.cap) {
for (hdr = 0; hdr < fe->nb_req_cap; hdr++) {
if (h >= sizeof (tmpline) + tmpline - 4)
goto trunc;
*(h++) = ' ';
*(h++) = '\"';
h = encode_string(h, tmpline + sizeof(tmpline) - 2,
'#', hdr_encode_map, txn->req.cap[hdr]);
*(h++) = '\"';
}
}
if ((fe->to_log & LW_RSPHDR) && txn->rsp.cap) {
for (hdr = 0; hdr < fe->nb_rsp_cap; hdr++) {
if (h >= sizeof (tmpline) + tmpline - 4)
goto trunc;
*(h++) = ' ';
*(h++) = '\"';
h = encode_string(h, tmpline + sizeof(tmpline) - 2,
'#', hdr_encode_map, txn->rsp.cap[hdr]);
*(h++) = '\"';
}
}
trunc:
*h = '\0';
level = LOG_INFO;
if (err && (fe->options2 & PR_O2_LOGERRORS))
level = LOG_ERR;
send_log(prx_log, level, "%s\n", tmpline);
s->logs.logwait = 0;
}
/*
* send a log for the session when we have enough info about it.
* Will not log if the frontend has no log defined.
*/
void http_sess_log(struct session *s)
{
char pn[INET6_ADDRSTRLEN + strlen(":65535")];
struct proxy *fe = s->fe;
struct proxy *be = s->be;
struct proxy *prx_log;
struct http_txn *txn = &s->txn;
int tolog, level, err;
char *uri, *h;
char *svid;
struct tm tm;
static char tmpline[MAX_SYSLOG_LEN];
int t_request;
int hdr;
/* if we don't want to log normal traffic, return now */
err = (s->flags & (SN_ERR_MASK | SN_REDISP)) ||
(s->conn_retries != be->conn_retries) ||
txn->status >= 500;
if (!err && (fe->options2 & PR_O2_NOLOGNORM))
return;
if (fe->logfac1 < 0 && fe->logfac2 < 0)
return;
prx_log = fe;
if (prx_log->options2 & PR_O2_CLFLOG)
return http_sess_clflog(s);
if (s->cli_addr.ss_family == AF_INET)
inet_ntop(AF_INET,
(const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr,
pn, sizeof(pn));
else
inet_ntop(AF_INET6,
(const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr,
pn, sizeof(pn));
get_localtime(s->logs.accept_date.tv_sec, &tm);
/* FIXME: let's limit ourselves to frontend logging for now. */
tolog = fe->to_log;
h = tmpline;
if (fe->to_log & LW_REQHDR &&
txn->req.cap &&
(h < tmpline + sizeof(tmpline) - 10)) {
*(h++) = ' ';
*(h++) = '{';
for (hdr = 0; hdr < fe->nb_req_cap; hdr++) {
if (hdr)
*(h++) = '|';
if (txn->req.cap[hdr] != NULL)
h = encode_string(h, tmpline + sizeof(tmpline) - 7,
'#', hdr_encode_map, txn->req.cap[hdr]);
}
*(h++) = '}';
}
if (fe->to_log & LW_RSPHDR &&
txn->rsp.cap &&
(h < tmpline + sizeof(tmpline) - 7)) {
*(h++) = ' ';
*(h++) = '{';
for (hdr = 0; hdr < fe->nb_rsp_cap; hdr++) {
if (hdr)
*(h++) = '|';
if (txn->rsp.cap[hdr] != NULL)
h = encode_string(h, tmpline + sizeof(tmpline) - 4,
'#', hdr_encode_map, txn->rsp.cap[hdr]);
}
*(h++) = '}';
}
if (h < tmpline + sizeof(tmpline) - 4) {
*(h++) = ' ';
*(h++) = '"';
uri = txn->uri ? txn->uri : "<BADREQ>";
h = encode_string(h, tmpline + sizeof(tmpline) - 1,
'#', url_encode_map, uri);
*(h++) = '"';
}
*h = '\0';
svid = (tolog & LW_SVID) ?
(s->data_source != DATA_SRC_STATS) ?
(s->srv != NULL) ? s->srv->id : "<NOSRV>" : "<STATS>" : "-";
t_request = -1;
if (tv_isge(&s->logs.tv_request, &s->logs.tv_accept))
t_request = tv_ms_elapsed(&s->logs.tv_accept, &s->logs.tv_request);
level = LOG_INFO;
if (err && (fe->options2 & PR_O2_LOGERRORS))
level = LOG_ERR;
send_log(prx_log, level,
"%s:%d [%02d/%s/%04d:%02d:%02d:%02d.%03d]"
" %s %s/%s %d/%ld/%ld/%ld/%s%ld %d %s%lld"
" %s %s %c%c%c%c %d/%d/%d/%d/%s%u %ld/%ld%s\n",
pn,
(s->cli_addr.ss_family == AF_INET) ?
ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) :
ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port),
tm.tm_mday, monthname[tm.tm_mon], tm.tm_year+1900,
tm.tm_hour, tm.tm_min, tm.tm_sec, (int)s->logs.accept_date.tv_usec/1000,
fe->id, be->id, svid,
t_request,
(s->logs.t_queue >= 0) ? s->logs.t_queue - t_request : -1,
(s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_queue : -1,
(s->logs.t_data >= 0) ? s->logs.t_data - s->logs.t_connect : -1,
(tolog & LW_BYTES) ? "" : "+", s->logs.t_close,
txn->status,
(tolog & LW_BYTES) ? "" : "+", s->logs.bytes_out,
txn->cli_cookie ? txn->cli_cookie : "-",
txn->srv_cookie ? txn->srv_cookie : "-",
sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT],
sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT],
(be->options & PR_O_COOK_ANY) ? sess_cookie[(txn->flags & TX_CK_MASK) >> TX_CK_SHIFT] : '-',
(be->options & PR_O_COOK_ANY) ? sess_set_cookie[(txn->flags & TX_SCK_MASK) >> TX_SCK_SHIFT] : '-',
actconn, fe->feconn, be->beconn, s->srv ? s->srv->cur_sess : 0,
(s->flags & SN_REDISP)?"+":"",
(s->conn_retries>0)?(be->conn_retries - s->conn_retries):be->conn_retries,
s->logs.srv_queue_size, s->logs.prx_queue_size, tmpline);
s->logs.logwait = 0;
}
/*
* Capture headers from message starting at <som> according to header list
* <cap_hdr>, and fill the <idx> structure appropriately.
*/
void capture_headers(char *som, struct hdr_idx *idx,
char **cap, struct cap_hdr *cap_hdr)
{
char *eol, *sol, *col, *sov;
int cur_idx;
struct cap_hdr *h;
int len;
sol = som + hdr_idx_first_pos(idx);
cur_idx = hdr_idx_first_idx(idx);
while (cur_idx) {
eol = sol + idx->v[cur_idx].len;
col = sol;
while (col < eol && *col != ':')
col++;
sov = col + 1;
while (sov < eol && http_is_lws[(unsigned char)*sov])
sov++;
for (h = cap_hdr; h; h = h->next) {
if ((h->namelen == col - sol) &&
(strncasecmp(sol, h->name, h->namelen) == 0)) {
if (cap[h->index] == NULL)
cap[h->index] =
pool_alloc2(h->pool);
if (cap[h->index] == NULL) {
Alert("HTTP capture : out of memory.\n");
continue;
}
len = eol - sov;
if (len > h->len)
len = h->len;
memcpy(cap[h->index], sov, len);
cap[h->index][len]=0;
}
}
sol = eol + idx->v[cur_idx].cr + 1;
cur_idx = idx->v[cur_idx].next;
}
}
/* either we find an LF at <ptr> or we jump to <bad>.
*/
#define EXPECT_LF_HERE(ptr, bad) do { if (unlikely(*(ptr) != '\n')) goto bad; } while (0)
/* plays with variables <ptr>, <end> and <state>. Jumps to <good> if OK,
* otherwise to <http_msg_ood> with <state> set to <st>.
*/
#define EAT_AND_JUMP_OR_RETURN(good, st) do { \
ptr++; \
if (likely(ptr < end)) \
goto good; \
else { \
state = (st); \
goto http_msg_ood; \
} \
} while (0)
/*
* This function parses a status line between <ptr> and <end>, starting with
* parser state <state>. Only states HTTP_MSG_RPVER, HTTP_MSG_RPVER_SP,
* HTTP_MSG_RPCODE, HTTP_MSG_RPCODE_SP and HTTP_MSG_RPREASON are handled. Others
* will give undefined results.
* Note that it is upon the caller's responsibility to ensure that ptr < end,
* and that msg->sol points to the beginning of the response.
* If a complete line is found (which implies that at least one CR or LF is
* found before <end>, the updated <ptr> is returned, otherwise NULL is
* returned indicating an incomplete line (which does not mean that parts have
* not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are
* non-NULL, they are fed with the new <ptr> and <state> values to be passed
* upon next call.
*
* This function was intentionally designed to be called from
* http_msg_analyzer() with the lowest overhead. It should integrate perfectly
* within its state machine and use the same macros, hence the need for same
* labels and variable names. Note that msg->sol is left unchanged.
*/
const char *http_parse_stsline(struct http_msg *msg, const char *msg_buf,
unsigned int state, const char *ptr, const char *end,
char **ret_ptr, unsigned int *ret_state)
{
switch (state) {
http_msg_rpver:
case HTTP_MSG_RPVER:
if (likely(HTTP_IS_VER_TOKEN(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rpver, HTTP_MSG_RPVER);
if (likely(HTTP_IS_SPHT(*ptr))) {
msg->sl.st.v_l = (ptr - msg_buf) - msg->som;
EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP);
}
state = HTTP_MSG_ERROR;
break;
http_msg_rpver_sp:
case HTTP_MSG_RPVER_SP:
if (likely(!HTTP_IS_LWS(*ptr))) {
msg->sl.st.c = ptr - msg_buf;
goto http_msg_rpcode;
}
if (likely(HTTP_IS_SPHT(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP);
/* so it's a CR/LF, this is invalid */
state = HTTP_MSG_ERROR;
break;
http_msg_rpcode:
case HTTP_MSG_RPCODE:
if (likely(!HTTP_IS_LWS(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rpcode, HTTP_MSG_RPCODE);
if (likely(HTTP_IS_SPHT(*ptr))) {
msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c;
EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP);
}
/* so it's a CR/LF, so there is no reason phrase */
msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c;
http_msg_rsp_reason:
/* FIXME: should we support HTTP responses without any reason phrase ? */
msg->sl.st.r = ptr - msg_buf;
msg->sl.st.r_l = 0;
goto http_msg_rpline_eol;
http_msg_rpcode_sp:
case HTTP_MSG_RPCODE_SP:
if (likely(!HTTP_IS_LWS(*ptr))) {
msg->sl.st.r = ptr - msg_buf;
goto http_msg_rpreason;
}
if (likely(HTTP_IS_SPHT(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP);
/* so it's a CR/LF, so there is no reason phrase */
goto http_msg_rsp_reason;
http_msg_rpreason:
case HTTP_MSG_RPREASON:
if (likely(!HTTP_IS_CRLF(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rpreason, HTTP_MSG_RPREASON);
msg->sl.st.r_l = (ptr - msg_buf) - msg->sl.st.r;
http_msg_rpline_eol:
/* We have seen the end of line. Note that we do not
* necessarily have the \n yet, but at least we know that we
* have EITHER \r OR \n, otherwise the response would not be
* complete. We can then record the response length and return
* to the caller which will be able to register it.
*/
msg->sl.st.l = ptr - msg->sol;
return ptr;
#ifdef DEBUG_FULL
default:
fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
exit(1);
#endif
}
http_msg_ood:
/* out of valid data */
if (ret_state)
*ret_state = state;
if (ret_ptr)
*ret_ptr = (char *)ptr;
return NULL;
}
/*
* This function parses a request line between <ptr> and <end>, starting with
* parser state <state>. Only states HTTP_MSG_RQMETH, HTTP_MSG_RQMETH_SP,
* HTTP_MSG_RQURI, HTTP_MSG_RQURI_SP and HTTP_MSG_RQVER are handled. Others
* will give undefined results.
* Note that it is upon the caller's responsibility to ensure that ptr < end,
* and that msg->sol points to the beginning of the request.
* If a complete line is found (which implies that at least one CR or LF is
* found before <end>, the updated <ptr> is returned, otherwise NULL is
* returned indicating an incomplete line (which does not mean that parts have
* not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are
* non-NULL, they are fed with the new <ptr> and <state> values to be passed
* upon next call.
*
* This function was intentionally designed to be called from
* http_msg_analyzer() with the lowest overhead. It should integrate perfectly
* within its state machine and use the same macros, hence the need for same
* labels and variable names. Note that msg->sol is left unchanged.
*/
const char *http_parse_reqline(struct http_msg *msg, const char *msg_buf,
unsigned int state, const char *ptr, const char *end,
char **ret_ptr, unsigned int *ret_state)
{
switch (state) {
http_msg_rqmeth:
case HTTP_MSG_RQMETH:
if (likely(HTTP_IS_TOKEN(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth, HTTP_MSG_RQMETH);
if (likely(HTTP_IS_SPHT(*ptr))) {
msg->sl.rq.m_l = (ptr - msg_buf) - msg->som;
EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP);
}
if (likely(HTTP_IS_CRLF(*ptr))) {
/* HTTP 0.9 request */
msg->sl.rq.m_l = (ptr - msg_buf) - msg->som;
http_msg_req09_uri:
msg->sl.rq.u = ptr - msg_buf;
http_msg_req09_uri_e:
msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u;
http_msg_req09_ver:
msg->sl.rq.v = ptr - msg_buf;
msg->sl.rq.v_l = 0;
goto http_msg_rqline_eol;
}
state = HTTP_MSG_ERROR;
break;
http_msg_rqmeth_sp:
case HTTP_MSG_RQMETH_SP:
if (likely(!HTTP_IS_LWS(*ptr))) {
msg->sl.rq.u = ptr - msg_buf;
goto http_msg_rquri;
}
if (likely(HTTP_IS_SPHT(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP);
/* so it's a CR/LF, meaning an HTTP 0.9 request */
goto http_msg_req09_uri;
http_msg_rquri:
case HTTP_MSG_RQURI:
if (likely(!HTTP_IS_LWS(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rquri, HTTP_MSG_RQURI);
if (likely(HTTP_IS_SPHT(*ptr))) {
msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u;
EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP);
}
/* so it's a CR/LF, meaning an HTTP 0.9 request */
goto http_msg_req09_uri_e;
http_msg_rquri_sp:
case HTTP_MSG_RQURI_SP:
if (likely(!HTTP_IS_LWS(*ptr))) {
msg->sl.rq.v = ptr - msg_buf;
goto http_msg_rqver;
}
if (likely(HTTP_IS_SPHT(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP);
/* so it's a CR/LF, meaning an HTTP 0.9 request */
goto http_msg_req09_ver;
http_msg_rqver:
case HTTP_MSG_RQVER:
if (likely(HTTP_IS_VER_TOKEN(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_rqver, HTTP_MSG_RQVER);
if (likely(HTTP_IS_CRLF(*ptr))) {
msg->sl.rq.v_l = (ptr - msg_buf) - msg->sl.rq.v;
http_msg_rqline_eol:
/* We have seen the end of line. Note that we do not
* necessarily have the \n yet, but at least we know that we
* have EITHER \r OR \n, otherwise the request would not be
* complete. We can then record the request length and return
* to the caller which will be able to register it.
*/
msg->sl.rq.l = ptr - msg->sol;
return ptr;
}
/* neither an HTTP_VER token nor a CRLF */
state = HTTP_MSG_ERROR;
break;
#ifdef DEBUG_FULL
default:
fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
exit(1);
#endif
}
http_msg_ood:
/* out of valid data */
if (ret_state)
*ret_state = state;
if (ret_ptr)
*ret_ptr = (char *)ptr;
return NULL;
}
/*
* This function parses an HTTP message, either a request or a response,
* depending on the initial msg->msg_state. It can be preempted everywhere
* when data are missing and recalled at the exact same location with no
* information loss. The header index is re-initialized when switching from
* MSG_R[PQ]BEFORE to MSG_RPVER|MSG_RQMETH. It modifies msg->sol among other
* fields.
*/
void http_msg_analyzer(struct buffer *buf, struct http_msg *msg, struct hdr_idx *idx)
{
unsigned int state; /* updated only when leaving the FSM */
register char *ptr, *end; /* request pointers, to avoid dereferences */
state = msg->msg_state;
ptr = buf->lr;
end = buf->r;
if (unlikely(ptr >= end))
goto http_msg_ood;
switch (state) {
/*
* First, states that are specific to the response only.
* We check them first so that request and headers are
* closer to each other (accessed more often).
*/
http_msg_rpbefore:
case HTTP_MSG_RPBEFORE:
if (likely(HTTP_IS_TOKEN(*ptr))) {
#if !defined(PARSE_PRESERVE_EMPTY_LINES)
if (likely(ptr != buf->data)) {
/* Remove empty leading lines, as recommended by
* RFC2616. This takes a lot of time because we
* must move all the buffer backwards, but this
* is rarely needed. The method above will be
* cleaner when we'll be able to start sending
* the request from any place in the buffer.
*/
ptr += buffer_replace2(buf, buf->lr, ptr, NULL, 0);
end = buf->r;
}
#endif
msg->sol = ptr;
msg->som = ptr - buf->data;
hdr_idx_init(idx);
state = HTTP_MSG_RPVER;
goto http_msg_rpver;
}
if (unlikely(!HTTP_IS_CRLF(*ptr)))
goto http_msg_invalid;
if (unlikely(*ptr == '\n'))
EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE);
EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore_cr, HTTP_MSG_RPBEFORE_CR);
/* stop here */
http_msg_rpbefore_cr:
case HTTP_MSG_RPBEFORE_CR:
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE);
/* stop here */
http_msg_rpver:
case HTTP_MSG_RPVER:
case HTTP_MSG_RPVER_SP:
case HTTP_MSG_RPCODE:
case HTTP_MSG_RPCODE_SP:
case HTTP_MSG_RPREASON:
ptr = (char *)http_parse_stsline(msg, buf->data, state, ptr, end,
&buf->lr, &msg->msg_state);
if (unlikely(!ptr))
return;
/* we have a full response and we know that we have either a CR
* or an LF at <ptr>.
*/
//fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.st.l, *ptr);
hdr_idx_set_start(idx, msg->sl.st.l, *ptr == '\r');
msg->sol = ptr;
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_rpline_end, HTTP_MSG_RPLINE_END);
goto http_msg_rpline_end;
http_msg_rpline_end:
case HTTP_MSG_RPLINE_END:
/* msg->sol must point to the first of CR or LF. */
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST);
/* stop here */
/*
* Second, states that are specific to the request only
*/
http_msg_rqbefore:
case HTTP_MSG_RQBEFORE:
if (likely(HTTP_IS_TOKEN(*ptr))) {
if (likely(ptr == buf->data)) {
msg->sol = ptr;
msg->som = 0;
} else {
#if PARSE_PRESERVE_EMPTY_LINES
/* only skip empty leading lines, don't remove them */
msg->sol = ptr;
msg->som = ptr - buf->data;
#else
/* Remove empty leading lines, as recommended by
* RFC2616. This takes a lot of time because we
* must move all the buffer backwards, but this
* is rarely needed. The method above will be
* cleaner when we'll be able to start sending
* the request from any place in the buffer.
*/
buf->lr = ptr;
buffer_replace2(buf, buf->data, buf->lr, NULL, 0);
msg->som = 0;
msg->sol = buf->data;
ptr = buf->data;
end = buf->r;
#endif
}
/* we will need this when keep-alive will be supported
hdr_idx_init(idx);
*/
state = HTTP_MSG_RQMETH;
goto http_msg_rqmeth;
}
if (unlikely(!HTTP_IS_CRLF(*ptr)))
goto http_msg_invalid;
if (unlikely(*ptr == '\n'))
EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE);
EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore_cr, HTTP_MSG_RQBEFORE_CR);
/* stop here */
http_msg_rqbefore_cr:
case HTTP_MSG_RQBEFORE_CR:
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE);
/* stop here */
http_msg_rqmeth:
case HTTP_MSG_RQMETH:
case HTTP_MSG_RQMETH_SP:
case HTTP_MSG_RQURI:
case HTTP_MSG_RQURI_SP:
case HTTP_MSG_RQVER:
ptr = (char *)http_parse_reqline(msg, buf->data, state, ptr, end,
&buf->lr, &msg->msg_state);
if (unlikely(!ptr))
return;
/* we have a full request and we know that we have either a CR
* or an LF at <ptr>.
*/
//fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.rq.l, *ptr);
hdr_idx_set_start(idx, msg->sl.rq.l, *ptr == '\r');
msg->sol = ptr;
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_rqline_end, HTTP_MSG_RQLINE_END);
goto http_msg_rqline_end;
http_msg_rqline_end:
case HTTP_MSG_RQLINE_END:
/* check for HTTP/0.9 request : no version information available.
* msg->sol must point to the first of CR or LF.
*/
if (unlikely(msg->sl.rq.v_l == 0))
goto http_msg_last_lf;
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST);
/* stop here */
/*
* Common states below
*/
http_msg_hdr_first:
case HTTP_MSG_HDR_FIRST:
msg->sol = ptr;
if (likely(!HTTP_IS_CRLF(*ptr))) {
goto http_msg_hdr_name;
}
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF);
goto http_msg_last_lf;
http_msg_hdr_name:
case HTTP_MSG_HDR_NAME:
/* assumes msg->sol points to the first char */
if (likely(HTTP_IS_TOKEN(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_name, HTTP_MSG_HDR_NAME);
if (likely(*ptr == ':')) {
msg->col = ptr - buf->data;
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP);
}
if (likely(msg->err_pos < -1) || *ptr == '\n')
goto http_msg_invalid;
if (msg->err_pos == -1) /* capture error pointer */
msg->err_pos = ptr - buf->data; /* >= 0 now */
/* and we still accept this non-token character */
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_name, HTTP_MSG_HDR_NAME);
http_msg_hdr_l1_sp:
case HTTP_MSG_HDR_L1_SP:
/* assumes msg->sol points to the first char and msg->col to the colon */
if (likely(HTTP_IS_SPHT(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP);
/* header value can be basically anything except CR/LF */
msg->sov = ptr - buf->data;
if (likely(!HTTP_IS_CRLF(*ptr))) {
goto http_msg_hdr_val;
}
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lf, HTTP_MSG_HDR_L1_LF);
goto http_msg_hdr_l1_lf;
http_msg_hdr_l1_lf:
case HTTP_MSG_HDR_L1_LF:
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lws, HTTP_MSG_HDR_L1_LWS);
http_msg_hdr_l1_lws:
case HTTP_MSG_HDR_L1_LWS:
if (likely(HTTP_IS_SPHT(*ptr))) {
/* replace HT,CR,LF with spaces */
for (; buf->data+msg->sov < ptr; msg->sov++)
buf->data[msg->sov] = ' ';
goto http_msg_hdr_l1_sp;
}
/* we had a header consisting only in spaces ! */
msg->eol = buf->data + msg->sov;
goto http_msg_complete_header;
http_msg_hdr_val:
case HTTP_MSG_HDR_VAL:
/* assumes msg->sol points to the first char, msg->col to the
* colon, and msg->sov points to the first character of the
* value.
*/
if (likely(!HTTP_IS_CRLF(*ptr)))
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_val, HTTP_MSG_HDR_VAL);
msg->eol = ptr;
/* Note: we could also copy eol into ->eoh so that we have the
* real header end in case it ends with lots of LWS, but is this
* really needed ?
*/
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lf, HTTP_MSG_HDR_L2_LF);
goto http_msg_hdr_l2_lf;
http_msg_hdr_l2_lf:
case HTTP_MSG_HDR_L2_LF:
EXPECT_LF_HERE(ptr, http_msg_invalid);
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lws, HTTP_MSG_HDR_L2_LWS);
http_msg_hdr_l2_lws:
case HTTP_MSG_HDR_L2_LWS:
if (unlikely(HTTP_IS_SPHT(*ptr))) {
/* LWS: replace HT,CR,LF with spaces */
for (; msg->eol < ptr; msg->eol++)
*msg->eol = ' ';
goto http_msg_hdr_val;
}
http_msg_complete_header:
/*
* It was a new header, so the last one is finished.
* Assumes msg->sol points to the first char, msg->col to the
* colon, msg->sov points to the first character of the value
* and msg->eol to the first CR or LF so we know how the line
* ends. We insert last header into the index.
*/
/*
fprintf(stderr,"registering %-2d bytes : ", msg->eol - msg->sol);
write(2, msg->sol, msg->eol-msg->sol);
fprintf(stderr,"\n");
*/
if (unlikely(hdr_idx_add(msg->eol - msg->sol, *msg->eol == '\r',
idx, idx->tail) < 0))
goto http_msg_invalid;
msg->sol = ptr;
if (likely(!HTTP_IS_CRLF(*ptr))) {
goto http_msg_hdr_name;
}
if (likely(*ptr == '\r'))
EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF);
goto http_msg_last_lf;
http_msg_last_lf:
case HTTP_MSG_LAST_LF:
/* Assumes msg->sol points to the first of either CR or LF */
EXPECT_LF_HERE(ptr, http_msg_invalid);
ptr++;
buf->lr = ptr;
msg->eoh = msg->sol - buf->data;
msg->msg_state = HTTP_MSG_BODY;
return;
#ifdef DEBUG_FULL
default:
fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
exit(1);
#endif
}
http_msg_ood:
/* out of data */
msg->msg_state = state;
buf->lr = ptr;
return;
http_msg_invalid:
/* invalid message */
msg->msg_state = HTTP_MSG_ERROR;
buf->lr = ptr;
return;
}
/* convert an HTTP/0.9 request into an HTTP/1.0 request. Returns 1 if the
* conversion succeeded, 0 in case of error. If the request was already 1.X,
* nothing is done and 1 is returned.
*/
static int http_upgrade_v09_to_v10(struct buffer *req, struct http_msg *msg, struct http_txn *txn)
{
int delta;
char *cur_end;
if (msg->sl.rq.v_l != 0)
return 1;
msg->sol = req->data + msg->som;
cur_end = msg->sol + msg->sl.rq.l;
delta = 0;
if (msg->sl.rq.u_l == 0) {
/* if no URI was set, add "/" */
delta = buffer_replace2(req, cur_end, cur_end, " /", 2);
cur_end += delta;
msg->eoh += delta;
}
/* add HTTP version */
delta = buffer_replace2(req, cur_end, cur_end, " HTTP/1.0\r\n", 11);
msg->eoh += delta;
cur_end += delta;
cur_end = (char *)http_parse_reqline(msg, req->data,
HTTP_MSG_RQMETH,
msg->sol, cur_end + 1,
NULL, NULL);
if (unlikely(!cur_end))
return 0;
/* we have a full HTTP/1.0 request now and we know that
* we have either a CR or an LF at <ptr>.
*/
hdr_idx_set_start(&txn->hdr_idx, msg->sl.rq.l, *cur_end == '\r');
return 1;
}
/* This stream analyser waits for a complete HTTP request. It returns 1 if the
* processing can continue on next analysers, or zero if it either needs more
* data or wants to immediately abort the request (eg: timeout, error, ...). It
* is tied to AN_REQ_WAIT_HTTP and may may remove itself from s->req->analysers
* when it has nothing left to do, and may remove any analyser when it wants to
* abort.
*/
int http_wait_for_request(struct session *s, struct buffer *req, int an_bit)
{
/*
* We will parse the partial (or complete) lines.
* We will check the request syntax, and also join multi-line
* headers. An index of all the lines will be elaborated while
* parsing.
*
* For the parsing, we use a 28 states FSM.
*
* Here is the information we currently have :
* req->data + msg->som = beginning of request
* req->data + req->eoh = end of processed headers / start of current one
* req->data + req->eol = end of current header or line (LF or CRLF)
* req->lr = first non-visited byte
* req->r = end of data
*
* At end of parsing, we may perform a capture of the error (if any), and
* we will set a few fields (msg->sol, txn->meth, sn->flags/SN_REDIRECTABLE).
* We also check for monitor-uri, logging, HTTP/0.9 to 1.0 conversion, and
* finally headers capture.
*/
int cur_idx;
struct http_txn *txn = &s->txn;
struct http_msg *msg = &txn->req;
DPRINTF(stderr,"[%u] %s: session=%p b=%p, exp(r,w)=%u,%u bf=%08x bl=%d analysers=%02x\n",
now_ms, __FUNCTION__,
s,
req,
req->rex, req->wex,
req->flags,
req->l,
req->analysers);
/* we're speaking HTTP here, so let's speak HTTP to the client */
s->srv_error = http_return_srv_error;
if (likely(req->lr < req->r))
http_msg_analyzer(req, msg, &txn->hdr_idx);
/* 1: we might have to print this header in debug mode */
if (unlikely((global.mode & MODE_DEBUG) &&
(!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) &&
(msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) {
char *eol, *sol;
sol = req->data + msg->som;
eol = sol + msg->sl.rq.l;
debug_hdr("clireq", s, sol, eol);
sol += hdr_idx_first_pos(&txn->hdr_idx);
cur_idx = hdr_idx_first_idx(&txn->hdr_idx);
while (cur_idx) {
eol = sol + txn->hdr_idx.v[cur_idx].len;
debug_hdr("clihdr", s, sol, eol);
sol = eol + txn->hdr_idx.v[cur_idx].cr + 1;
cur_idx = txn->hdr_idx.v[cur_idx].next;
}
}
/*
* Now we quickly check if we have found a full valid request.
* If not so, we check the FD and buffer states before leaving.
* A full request is indicated by the fact that we have seen
* the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid
* requests are checked first.
*
*/
if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
/*
* First, let's catch bad requests.
*/
if (unlikely(msg->msg_state == HTTP_MSG_ERROR))
goto return_bad_req;
/* 1: Since we are in header mode, if there's no space
* left for headers, we won't be able to free more
* later, so the session will never terminate. We
* must terminate it now.
*/
if (unlikely(req->flags & BF_FULL)) {
/* FIXME: check if URI is set and return Status
* 414 Request URI too long instead.
*/
goto return_bad_req;
}
/* 2: have we encountered a read error ? */
else if (req->flags & BF_READ_ERROR) {
/* we cannot return any message on error */
if (msg->err_pos >= 0)
http_capture_bad_message(&s->fe->invalid_req, s, req, msg, s->fe);
msg->msg_state = HTTP_MSG_ERROR;
req->analysers = 0;
s->fe->counters.failed_req++;
if (s->listener->counters)
s->listener->counters->failed_req++;
if (!(s->flags & SN_ERR_MASK))
s->flags |= SN_ERR_CLICL;
if (!(s->flags & SN_FINST_MASK))
s->flags |= SN_FINST_R;
return 0;
}
/* 3: has the read timeout expired ? */
else if (req->flags & BF_READ_TIMEOUT || tick_is_expired(req->analyse_exp, now_ms)) {
/* read timeout : give up with an error message. */
if (msg->err_pos >= 0)
http_capture_bad_message(&s->fe->invalid_req, s, req, msg, s->fe);
txn->status = 408;
stream_int_retnclose(req->prod, error_message(s, HTTP_ERR_408));
msg->msg_state = HTTP_MSG_ERROR;
req->analysers = 0;
s->fe->counters.failed_req++;
if (s->listener->counters)
s->listener->counters->failed_req++;
if (!(s->flags & SN_ERR_MASK))
s->flags |= SN_ERR_CLITO;
if (!(s->flags & SN_FINST_MASK))
s->flags |= SN_FINST_R;
return 0;
}
/* 4: have we encountered a close ? */
else if (req->flags & BF_SHUTR) {
if (msg->err_pos >= 0)
http_capture_bad_message(&s->fe->invalid_req, s, req, msg, s->fe);
txn->status = 400;
stream_int_retnclose(req->prod, error_message(s, HTTP_ERR_400));
msg->msg_state = HTTP_MSG_ERROR;
req->analysers = 0;
s->fe->counters.failed_req++;
if (s->listener->counters)
s->listener->counters->failed_req++;
if (!(s->flags & SN_ERR_MASK))
s->flags |= SN_ERR_CLICL;
if (!(s->flags & SN_FINST_MASK))
s->flags |= SN_FINST_R;
return 0;
}
buffer_dont_connect(req);
req->flags |= BF_READ_DONTWAIT; /* try to get back here ASAP */
/* just set the request timeout once at the beginning of the request */
if (!tick_isset(req->analyse_exp))
req->analyse_exp = tick_add_ifset(now_ms, s->be->timeout.httpreq);
/* we're not ready yet */
return 0;
}
/* OK now we have a complete HTTP request with indexed headers. Let's
* complete the request parsing by setting a few fields we will need
* later.
*/
/* Maybe we found in invalid header name while we were configured not
* to block on that, so we have to capture it now.
*/
if (unlikely(msg->err_pos >= 0))
http_capture_bad_message(&s->fe->invalid_req, s, req, msg, s->fe);
/* ensure we keep this pointer to the beginning of the message */
msg->sol = req->data + msg->som;
/*
* 1: identify the method
*/
txn->meth = find_http_meth(&req->data[msg->som], msg->sl.rq.m_l);
/* we can make use of server redirect on GET and HEAD */
if (txn->meth == HTTP_METH_GET || txn->meth == HTTP_METH_HEAD)
s->flags |= SN_REDIRECTABLE;
/*
* 2: check if the URI matches the monitor_uri.
* We have to do this for every request which gets in, because
* the monitor-uri is defined by the frontend.
*/
if (unlikely((s->fe->monitor_uri_len != 0) &&
(s->fe->monitor_uri_len == msg->sl.rq.u_l) &&
!memcmp(&req->data[msg->sl.rq.u],
s->fe->monitor_uri,
s->fe->monitor_uri_len))) {
/*
* We have found the monitor URI
*/
struct acl_cond *cond;
s->flags |= SN_MONITOR;
/* Check if we want to fail this monitor request or not */
list_for_each_entry(cond, &s->fe->mon_fail_cond, list) {
int ret = acl_exec_cond(cond, s->fe, s, txn, ACL_DIR_REQ);
ret = acl_pass(ret);
if (cond->pol == ACL_COND_UNLESS)
ret = !ret;
if (ret) {
/* we fail this request, let's return 503 service unavail */
txn->status = 503;
stream_int_retnclose(req->prod, error_message(s, HTTP_ERR_503));
goto return_prx_cond;
}
}
/* nothing to fail, let's reply normaly */
txn->status = 200;
stream_int_retnclose(req->prod, &http_200_chunk);
goto return_prx_cond;
}
/*
* 3: Maybe we have to copy the original REQURI for the logs ?
* Note: we cannot log anymore if the request has been
* classified as invalid.
*/
if (unlikely(s->logs.logwait & LW_REQ)) {
/* we have a complete HTTP request that we must log */
if ((txn->uri = pool_alloc2(pool2_requri)) != NULL) {
int urilen = msg->sl.rq.l;
if (urilen >= REQURI_LEN)
urilen = REQURI_LEN - 1;
memcpy(txn->uri, &req->data[msg->som], urilen);
txn->uri[urilen] = 0;
if (!(s->logs.logwait &= ~LW_REQ))
s->do_log(s);
} else {
Alert("HTTP logging : out of memory.\n");
}
}
/* 4. We may have to convert HTTP/0.9 requests to HTTP/1.0 */
if (unlikely(msg->sl.rq.v_l == 0) && !http_upgrade_v09_to_v10(req, msg, txn))
goto return_bad_req;
/* 5: we may need to capture headers */
if (unlikely((s->logs.logwait & LW_REQHDR) && s->fe->req_cap))
capture_headers(req->data + msg->som, &txn->hdr_idx,
txn->req.cap, s->fe->req_cap);
/* end of job, return OK */
req->analysers &= ~an_bit;
req->analyse_exp = TICK_ETERNITY;
return 1;
return_bad_req:
/* We centralize bad requests processing here */
if (unlikely(msg->msg_state == HTTP_MSG_ERROR) || msg->err_pos >= 0) {
/* we detected a parsing error. We want to archive this request
* in the dedicated proxy area for later troubleshooting.
*/
http_capture_bad_message(&s->fe->invalid_req, s, req, msg, s->fe);
}
txn->req.msg_state = HTTP_MSG_ERROR;
txn->status = 400;
stream_int_retnclose(req->prod, error_message(s, HTTP_ERR_400));
s->fe->counters.failed_req++;
if (s->listener->counters)
s->listener->counters->failed_req++;
return_prx_cond:
if (!(s->flags & SN_ERR_MASK))
s->flags |= SN_ERR_PRXCOND;
if (!(s->flags & SN_FINST_MASK))
s->flags |= SN_FINST_R;
req->analysers = 0;
req->analyse_exp = TICK_ETERNITY;
return 0;
}
/* This stream analyser runs all HTTP request processing which is common to
* frontends and backends, which means blocking ACLs, filters, connection-close,
* reqadd, stats and redirects. This is performed for the designated proxy.
* It returns 1 if the processing can continue on next analysers, or zero if it
* either needs more data or wants to immediately abort the request (eg: deny,
* error, ...).
*/
int http_process_req_common(struct session *s, struct buffer *req, int an_bit, struct proxy *px)
{
struct http_txn *txn = &s->txn;
struct http_msg *msg = &txn->req;
struct acl_cond *cond;
struct redirect_rule *rule;
int cur_idx;
if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
/* we need more data */
buffer_dont_connect(req);
return 0;
}
req->analysers &= ~an_bit;
req->analyse_exp = TICK_ETERNITY;
DPRINTF(stderr,"[%u] %s: session=%p b=%p, exp(r,w)=%u,%u bf=%08x bl=%d analysers=%02x\n",
now_ms, __FUNCTION__,
s,
req,
req->rex, req->wex,
req->flags,
req->l,
req->analysers);
/* first check whether we have some ACLs set to block this request */
list_for_each_entry(cond, &px->block_cond, list) {
int ret = acl_exec_cond(cond, px, s, txn, ACL_DIR_REQ);
ret = acl_pass(ret);
if (cond->pol == ACL_COND_UNLESS)
ret = !ret;
if (ret) {
txn->status = 403;
/* let's log the request time */
s->logs.tv_request = now;
stream_int_retnclose(req->prod, error_message(s, HTTP_ERR_403));
goto return_prx_cond;
}
}
/* try headers filters */
if (px->req_exp != NULL) {
if (apply_filters_to_request(s, req, px->req_exp) < 0)
goto return_bad_req;
/* has the request been denied ? */
if (txn->flags & TX_CLDENY) {
/* no need to go further */
txn->status = 403;
/* let's log the request time */
s->logs.tv_request = now;
stream_int_retnclose(req->prod, error_message(s, HTTP_ERR_403));
goto return_prx_cond;
}
/* When a connection is tarpitted, we use the tarpit timeout,
* which may be the same as the connect timeout if unspecified.
* If unset, then set it to zero because we really want it to
* eventually expire. We build the tarpit as an analyser.
*/
if (txn->flags & TX_CLTARPIT) {
buffer_erase(s->req);
/* wipe the request out so that we can drop the connection early
* if the client closes first.
*/
buffer_dont_connect(req);
req->analysers = 0; /* remove switching rules etc... */
req->analysers |= AN_REQ_HTTP_TARPIT;
req->analyse_exp = tick_add_ifset(now_ms, s->be->timeout.tarpit);
if (!req->analyse_exp)
req->analyse_exp = tick_add(now_ms, 0);
return 1;
}
}
/* We might have to check for "Connection:" */
if (((s->fe->options | s->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO)) &&
!(s->flags & SN_CONN_CLOSED)) {
char *cur_ptr, *cur_end, *cur_next;
int old_idx, delta, val;
struct hdr_idx_elem *cur_hdr;
cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
old_idx = 0;
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
val = http_header_match2(cur_ptr, cur_end, "Connection", 10);
if (val) {
/* 3 possibilities :
* - we have already set Connection: close,
* so we remove this line.
* - we have not yet set Connection: close,
* but this line indicates close. We leave
* it untouched and set the flag.
* - we have not yet set Connection: close,
* and this line indicates non-close. We
* replace it.
*/
if (s->flags & SN_CONN_CLOSED) {
delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
txn->req.eoh += delta;
cur_next += delta;
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
} else {
if (strncasecmp(cur_ptr + val, "close", 5) != 0) {
delta = buffer_replace2(req, cur_ptr + val, cur_end,
"close", 5);
cur_next += delta;
cur_hdr->len += delta;
txn->req.eoh += delta;
}
s->flags |= SN_CONN_CLOSED;
}
}
old_idx = cur_idx;
}
}
/* add request headers from the rule sets in the same order */
for (cur_idx = 0; cur_idx < px->nb_reqadd; cur_idx++) {
if (unlikely(http_header_add_tail(req,
&txn->req,
&txn->hdr_idx,
px->req_add[cur_idx])) < 0)
goto return_bad_req;
}
/* check if stats URI was requested, and if an auth is needed */
if (px->uri_auth != NULL &&
(txn->meth == HTTP_METH_GET || txn->meth == HTTP_METH_HEAD)) {
/* we have to check the URI and auth for this request.
* FIXME!!! that one is rather dangerous, we want to
* make it follow standard rules (eg: clear req->analysers).
*/
if (stats_check_uri_auth(s, px)) {
req->analysers = 0;
return 0;
}
}
/* check whether we have some ACLs set to redirect this request */
list_for_each_entry(rule, &px->redirect_rules, list) {
int ret = acl_exec_cond(rule->cond, px, s, txn, ACL_DIR_REQ);
ret = acl_pass(ret);
if (rule->cond->pol == ACL_COND_UNLESS)
ret = !ret;
if (ret) {
struct chunk rdr = { trash, 0 };
const char *msg_fmt;
/* build redirect message */
switch(rule->code) {
case 303:
msg_fmt = HTTP_303;
break;
case 301:
msg_fmt = HTTP_301;
break;
case 302:
default:
msg_fmt = HTTP_302;
break;
}
if (unlikely(chunk_strcpy(&rdr, msg_fmt)))
goto return_bad_req;
switch(rule->type) {
case REDIRECT_TYPE_PREFIX: {
const char *path;
int pathlen;
path = http_get_path(txn);
/* build message using path */
if (path) {
pathlen = txn->req.sl.rq.u_l + (txn->req.sol+txn->req.sl.rq.u) - path;
if (rule->flags & REDIRECT_FLAG_DROP_QS) {
int qs = 0;
while (qs < pathlen) {
if (path[qs] == '?') {
pathlen = qs;
break;
}
qs++;
}
}
} else {
path = "/";
pathlen = 1;
}
if (rdr.len + rule->rdr_len + pathlen > rdr.size - 4)
goto return_bad_req;
/* add prefix. Note that if prefix == "/", we don't want to
* add anything, otherwise it makes it hard for the user to
* configure a self-redirection.
*/
if (rule->rdr_len != 1 || *rule->rdr_str != '/') {
memcpy(rdr.str + rdr.len, rule->rdr_str, rule->rdr_len);
rdr.len += rule->rdr_len;
}
/* add path */
memcpy(rdr.str + rdr.len, path, pathlen);
rdr.len += pathlen;
break;
}
case REDIRECT_TYPE_LOCATION:
default:
if (rdr.len + rule->rdr_len > rdr.size - 4)
goto return_bad_req;
/* add location */
memcpy(rdr.str + rdr.len, rule->rdr_str, rule->rdr_len);
rdr.len += rule->rdr_len;
break;
}
if (rule->cookie_len) {
memcpy(rdr.str + rdr.len, "\r\nSet-Cookie: ", 14);
rdr.len += 14;
memcpy(rdr.str + rdr.len, rule->cookie_str, rule->cookie_len);
rdr.len += rule->cookie_len;
memcpy(rdr.str + rdr.len, "\r\n", 2);
rdr.len += 2;
}
/* add end of headers */
memcpy(rdr.str + rdr.len, "\r\n\r\n", 4);
rdr.len += 4;
txn->status = rule->code;
/* let's log the request time */
s->logs.tv_request = now;
stream_int_retnclose(req->prod, &rdr);
goto return_prx_cond;
}
}
/* that's OK for us now, let's move on to next analysers */
return 1;
return_bad_req:
/* We centralize bad requests processing here */
if (unlikely(msg->msg_state == HTTP_MSG_ERROR) || msg->err_pos >= 0) {
/* we detected a parsing error. We want to archive this request
* in the dedicated proxy area for later troubleshooting.
*/
http_capture_bad_message(&s->fe->invalid_req, s, req, msg, s->fe);
}
txn->req.msg_state = HTTP_MSG_ERROR;
txn->status = 400;
stream_int_retnclose(req->prod, error_message(s, HTTP_ERR_400));
s->fe->counters.failed_req++;
if (s->listener->counters)
s->listener->counters->failed_req++;
return_prx_cond:
if (!(s->flags & SN_ERR_MASK))
s->flags |= SN_ERR_PRXCOND;
if (!(s->flags & SN_FINST_MASK))
s->flags |= SN_FINST_R;
req->analysers = 0;
req->analyse_exp = TICK_ETERNITY;
return 0;
}
/* This function performs all the processing enabled for the current request.
* It returns 1 if the processing can continue on next analysers, or zero if it
* needs more data, encounters an error, or wants to immediately abort the
* request. It relies on buffers flags, and updates s->req->analysers.
*/
int http_process_request(struct session *s, struct buffer *req, int an_bit)
{
struct http_txn *txn = &s->txn;
struct http_msg *msg = &txn->req;
if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
/* we need more data */
buffer_dont_connect(req);
return 0;
}
req->analysers &= ~an_bit;
req->analyse_exp = TICK_ETERNITY;
DPRINTF(stderr,"[%u] %s: session=%p b=%p, exp(r,w)=%u,%u bf=%08x bl=%d analysers=%02x\n",
now_ms, __FUNCTION__,
s,
req,
req->rex, req->wex,
req->flags,
req->l,
req->analysers);
/*
* Right now, we know that we have processed the entire headers
* and that unwanted requests have been filtered out. We can do
* whatever we want with the remaining request. Also, now we
* may have separate values for ->fe, ->be.
*/
/*
* If HTTP PROXY is set we simply get remote server address
* parsing incoming request.
*/
if ((s->be->options & PR_O_HTTP_PROXY) && !(s->flags & SN_ADDR_SET)) {
url2sa(req->data + msg->sl.rq.u, msg->sl.rq.u_l, &s->srv_addr);
}
/*
* 7: the appsession cookie was looked up very early in 1.2,
* so let's do the same now.
*/
/* It needs to look into the URI */
if (s->be->appsession_name) {
get_srv_from_appsession(s, &req->data[msg->som], msg->sl.rq.l);
}
/*
* 8: Now we can work with the cookies.
* Note that doing so might move headers in the request, but
* the fields will stay coherent and the URI will not move.
* This should only be performed in the backend.
*/
if ((s->be->cookie_name || s->be->appsession_name || s->fe->capture_name)
&& !(txn->flags & (TX_CLDENY|TX_CLTARPIT)))
manage_client_side_cookies(s, req);
/*
* 9: add X-Forwarded-For if either the frontend or the backend
* asks for it.
*/
if ((s->fe->options | s->be->options) & PR_O_FWDFOR) {
if (s->cli_addr.ss_family == AF_INET) {
/* Add an X-Forwarded-For header unless the source IP is
* in the 'except' network range.
*/
if ((!s->fe->except_mask.s_addr ||
(((struct sockaddr_in *)&s->cli_addr)->sin_addr.s_addr & s->fe->except_mask.s_addr)
!= s->fe->except_net.s_addr) &&
(!s->be->except_mask.s_addr ||
(((struct sockaddr_in *)&s->cli_addr)->sin_addr.s_addr & s->be->except_mask.s_addr)
!= s->be->except_net.s_addr)) {
int len;
unsigned char *pn;
pn = (unsigned char *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr;
/* Note: we rely on the backend to get the header name to be used for
* x-forwarded-for, because the header is really meant for the backends.
* However, if the backend did not specify any option, we have to rely
* on the frontend's header name.
*/
if (s->be->fwdfor_hdr_len) {
len = s->be->fwdfor_hdr_len;
memcpy(trash, s->be->fwdfor_hdr_name, len);
} else {
len = s->fe->fwdfor_hdr_len;
memcpy(trash, s->fe->fwdfor_hdr_name, len);
}
len += sprintf(trash + len, ": %d.%d.%d.%d", pn[0], pn[1], pn[2], pn[3]);
if (unlikely(http_header_add_tail2(req, &txn->req,
&txn->hdr_idx, trash, len)) < 0)
goto return_bad_req;
}
}
else if (s->cli_addr.ss_family == AF_INET6) {
/* FIXME: for the sake of completeness, we should also support
* 'except' here, although it is mostly useless in this case.
*/
int len;
char pn[INET6_ADDRSTRLEN];
inet_ntop(AF_INET6,
(const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr,
pn, sizeof(pn));
/* Note: we rely on the backend to get the header name to be used for
* x-forwarded-for, because the header is really meant for the backends.
* However, if the backend did not specify any option, we have to rely
* on the frontend's header name.
*/
if (s->be->fwdfor_hdr_len) {
len = s->be->fwdfor_hdr_len;
memcpy(trash, s->be->fwdfor_hdr_name, len);
} else {
len = s->fe->fwdfor_hdr_len;
memcpy(trash, s->fe->fwdfor_hdr_name, len);
}
len += sprintf(trash + len, ": %s", pn);
if (unlikely(http_header_add_tail2(req, &txn->req,
&txn->hdr_idx, trash, len)) < 0)
goto return_bad_req;
}
}
/*
* 10: add X-Original-To if either the frontend or the backend
* asks for it.
*/
if ((s->fe->options | s->be->options) & PR_O_ORGTO) {
/* FIXME: don't know if IPv6 can handle that case too. */
if (s->cli_addr.ss_family == AF_INET) {
/* Add an X-Original-To header unless the destination IP is
* in the 'except' network range.
*/
if (!(s->flags & SN_FRT_ADDR_SET))
get_frt_addr(s);
if ((!s->fe->except_mask_to.s_addr ||
(((struct sockaddr_in *)&s->frt_addr)->sin_addr.s_addr & s->fe->except_mask_to.s_addr)
!= s->fe->except_to.s_addr) &&
(!s->be->except_mask_to.s_addr ||
(((struct sockaddr_in *)&s->frt_addr)->sin_addr.s_addr & s->be->except_mask_to.s_addr)
!= s->be->except_to.s_addr)) {
int len;
unsigned char *pn;
pn = (unsigned char *)&((struct sockaddr_in *)&s->frt_addr)->sin_addr;
/* Note: we rely on the backend to get the header name to be used for
* x-original-to, because the header is really meant for the backends.
* However, if the backend did not specify any option, we have to rely
* on the frontend's header name.
*/
if (s->be->orgto_hdr_len) {
len = s->be->orgto_hdr_len;
memcpy(trash, s->be->orgto_hdr_name, len);
} else {
len = s->fe->orgto_hdr_len;
memcpy(trash, s->fe->orgto_hdr_name, len);
}
len += sprintf(trash + len, ": %d.%d.%d.%d", pn[0], pn[1], pn[2], pn[3]);
if (unlikely(http_header_add_tail2(req, &txn->req,
&txn->hdr_idx, trash, len)) < 0)
goto return_bad_req;
}
}
}
/*
* 11: add "Connection: close" if needed and not yet set.
* Note that we do not need to add it in case of HTTP/1.0.
*/
if (!(s->flags & SN_CONN_CLOSED) &&
((s->fe->options | s->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO))) {
if ((unlikely(msg->sl.rq.v_l != 8) ||
unlikely(req->data[msg->som + msg->sl.rq.v + 7] != '0')) &&
unlikely(http_header_add_tail2(req, &txn->req, &txn->hdr_idx,
"Connection: close", 17)) < 0)
goto return_bad_req;
s->flags |= SN_CONN_CLOSED;
}
/* Before we switch to data, was assignment set in manage_client_side_cookie?
* If not assigned, perhaps we are balancing on url_param, but this is a
* POST; and the parameters are in the body, maybe scan there to find our server.
* (unless headers overflowed the buffer?)
*/
if (!(s->flags & (SN_ASSIGNED|SN_DIRECT)) &&
s->txn.meth == HTTP_METH_POST && s->be->url_param_name != NULL &&
s->be->url_param_post_limit != 0 && !(req->flags & BF_FULL) &&
memchr(msg->sol + msg->sl.rq.u, '?', msg->sl.rq.u_l) == NULL) {
/* are there enough bytes here? total == l || r || rlim ?
* len is unsigned, but eoh is int,
* how many bytes of body have we received?
* eoh is the first empty line of the header
*/
/* already established CRLF or LF at eoh, move to start of message, find message length in buffer */
unsigned long len = req->l - (msg->sol[msg->eoh] == '\r' ? msg->eoh + 2 : msg->eoh + 1);
/* If we have HTTP/1.1 and Expect: 100-continue, then abort.
* We can't assume responsibility for the server's decision,
* on this URI and header set. See rfc2616: 14.20, 8.2.3,
* We also can't change our mind later, about which server to choose, so round robin.
*/
if ((likely(msg->sl.rq.v_l == 8) && req->data[msg->som + msg->sl.rq.v + 7] == '1')) {
struct hdr_ctx ctx;
ctx.idx = 0;
/* Expect is allowed in 1.1, look for it */
http_find_header2("Expect", 6, msg->sol, &txn->hdr_idx, &ctx);
if (ctx.idx != 0 &&
unlikely(ctx.vlen == 12 && strncasecmp(ctx.line+ctx.val, "100-continue", 12) == 0))
/* We can't reliablly stall and wait for data, because of
* .NET clients that don't conform to rfc2616; so, no need for
* the next block to check length expectations.
* We could send 100 status back to the client, but then we need to
* re-write headers, and send the message. And this isn't the right
* place for that action.
* TODO: support Expect elsewhere and delete this block.
*/
goto end_check_maybe_wait_for_body;
}
if (likely(len > s->be->url_param_post_limit)) {
/* nothing to do, we got enough */
} else {
/* limit implies we are supposed to need this many bytes
* to find the parameter. Let's see how many bytes we can wait for.
*/
long long hint = len;
struct hdr_ctx ctx;
ctx.idx = 0;
http_find_header2("Transfer-Encoding", 17, msg->sol, &txn->hdr_idx, &ctx);
if (ctx.idx && ctx.vlen >= 7 && strncasecmp(ctx.line+ctx.val, "chunked", 7) == 0) {
buffer_dont_connect(req);
req->analysers |= AN_REQ_HTTP_BODY;
}
else {
ctx.idx = 0;
http_find_header2("Content-Length", 14, msg->sol, &txn->hdr_idx, &ctx);
/* now if we have a length, we'll take the hint */
if (ctx.idx) {
/* We have Content-Length */
if (strl2llrc(ctx.line+ctx.val,ctx.vlen, &hint))
hint = 0; /* parse failure, untrusted client */
else {
if (hint > 0)
msg->hdr_content_len = hint;
else
hint = 0; /* bad client, sent negative length */
}
}
/* but limited to what we care about, maybe we don't expect any entity data (hint == 0) */
if (s->be->url_param_post_limit < hint)
hint = s->be->url_param_post_limit;
/* now do we really need to buffer more data? */
if (len < hint) {
buffer_dont_connect(req);
req->analysers |= AN_REQ_HTTP_BODY;
}
/* else... There are no body bytes to wait for */
}
}
}
end_check_maybe_wait_for_body:
/*************************************************************
* OK, that's finished for the headers. We have done what we *
* could. Let's switch to the DATA state. *
************************************************************/
buffer_set_rlim(req, req->size); /* no more rewrite needed */
s->logs.tv_request = now;
/* OK let's go on with the BODY now */
return 1;
return_bad_req: /* let's centralize all bad requests */
if (unlikely(msg->msg_state == HTTP_MSG_ERROR) || msg->err_pos >= 0) {
/* we detected a parsing error. We want to archive this request
* in the dedicated proxy area for later troubleshooting.
*/
http_capture_bad_message(&s->fe->invalid_req, s, req, msg, s->fe);
}
txn->req.msg_state = HTTP_MSG_ERROR;
txn->status = 400;
req->analysers = 0;
stream_int_retnclose(req->prod, error_message(s, HTTP_ERR_400));
s->fe->counters.failed_req++;
if (s->listener->counters)
s->listener->counters->failed_req++;
if (!(s->flags & SN_ERR_MASK))
s->flags |= SN_ERR_PRXCOND;
if (!(s->flags & SN_FINST_MASK))
s->flags |= SN_FINST_R;
return 0;
}
/* This function is an analyser which processes the HTTP tarpit. It always
* returns zero, at the beginning because it prevents any other processing
* from occurring, and at the end because it terminates the request.
*/
int http_process_tarpit(struct session *s, struct buffer *req, int an_bit)
{
struct http_txn *txn = &s->txn;
/* This connection is being tarpitted. The CLIENT side has
* already set the connect expiration date to the right
* timeout. We just have to check that the client is still
* there and that the timeout has not expired.
*/
buffer_dont_connect(req);
if ((req->flags & (BF_SHUTR|BF_READ_ERROR)) == 0 &&
!tick_is_expired(req->analyse_exp, now_ms))
return 0;
/* We will set the queue timer to the time spent, just for
* logging purposes. We fake a 500 server error, so that the
* attacker will not suspect his connection has been tarpitted.
* It will not cause trouble to the logs because we can exclude
* the tarpitted connections by filtering on the 'PT' status flags.
*/
s->logs.t_queue = tv_ms_elapsed(&s->logs.tv_accept, &now);
txn->status = 500;
if (req->flags != BF_READ_ERROR)
stream_int_retnclose(req->prod, error_message(s, HTTP_ERR_500));
req->analysers = 0;
req->analyse_exp = TICK_ETERNITY;
s->fe->counters.failed_req++;
if (s->listener->counters)
s->listener->counters->failed_req++;
if (!(s->flags & SN_ERR_MASK))
s->flags |= SN_ERR_PRXCOND;
if (!(s->flags & SN_FINST_MASK))
s->flags |= SN_FINST_T;
return 0;
}
/* This function is an analyser which processes the HTTP request body. It looks
* for parameters to be used for the load balancing algorithm (url_param). It
* must only be called after the standard HTTP request processing has occurred,
* because it expects the request to be parsed. It returns zero if it needs to
* read more data, or 1 once it has completed its analysis.
*/
int http_process_request_body(struct session *s, struct buffer *req, int an_bit)
{
struct http_msg *msg = &s->txn.req;
unsigned long body = msg->sol[msg->eoh] == '\r' ? msg->eoh + 2 : msg->eoh + 1;
long long limit = s->be->url_param_post_limit;
struct hdr_ctx ctx;
if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
/* we need more data */
buffer_dont_connect(req);
return 0;
}
/* We have to parse the HTTP request body to find any required data.
* "balance url_param check_post" should have been the only way to get
* into this. We were brought here after HTTP header analysis, so all
* related structures are ready.
*/
ctx.idx = 0;
/* now if we have a length, we'll take the hint */
http_find_header2("Transfer-Encoding", 17, msg->sol, &s->txn.hdr_idx, &ctx);
if (ctx.idx && ctx.vlen >= 7 && strncasecmp(ctx.line+ctx.val, "chunked", 7) == 0) {
unsigned int chunk = 0;
while (body < req->l && !HTTP_IS_CRLF(msg->sol[body])) {
char c = msg->sol[body];
if (ishex(c)) {
unsigned int hex = toupper(c) - '0';
if (hex > 9)
hex -= 'A' - '9' - 1;
chunk = (chunk << 4) | hex;
} else
break;
body++;
}
if (body + 2 >= req->l) /* we want CRLF too */
goto http_body_end; /* end of buffer? data missing! */
if (memcmp(msg->sol+body, "\r\n", 2) != 0)
goto http_body_end; /* chunked encoding len ends with CRLF, and we don't have it yet */
body += 2; // skip CRLF
/* if we support more then one chunk here, we have to do it again when assigning server
* 1. how much entity data do we have? new var
* 2. should save entity_start, entity_cursor, elen & rlen in req; so we don't repeat scanning here
* 3. test if elen > limit, or set new limit to elen if 0 (end of entity found)
*/
if (chunk < limit)
limit = chunk; /* only reading one chunk */
} else {
if (msg->hdr_content_len < limit)
limit = msg->hdr_content_len;
}
http_body_end:
/* we leave once we know we have nothing left to do. This means that we have
* enough bytes, or that we know we'll not get any more (buffer full, read
* buffer closed).
*/
if (req->l - body >= limit || /* enough bytes! */
req->flags & (BF_FULL | BF_READ_ERROR | BF_SHUTR | BF_READ_TIMEOUT) ||
tick_is_expired(req->analyse_exp, now_ms)) {
/* The situation will not evolve, so let's give up on the analysis. */
s->logs.tv_request = now; /* update the request timer to reflect full request */
req->analysers &= ~an_bit;
req->analyse_exp = TICK_ETERNITY;
return 1;
}
else {
/* Not enough data. We'll re-use the http-request
* timeout here. Ideally, we should set the timeout
* relative to the accept() date. We just set the
* request timeout once at the beginning of the
* request.
*/
buffer_dont_connect(req);
if (!tick_isset(req->analyse_exp))
req->analyse_exp = tick_add_ifset(now_ms, s->be->timeout.httpreq);
return 0;
}
}
/* This function performs all the processing enabled for the current response.
* It normally returns zero, but may return 1 if it absolutely needs to be
* called again after other functions. It relies on buffers flags, and updates
* t->rep->analysers. It might make sense to explode it into several other
* functions. It works like process_request (see indications above).
*/
int process_response(struct session *t)
{
struct http_txn *txn = &t->txn;
struct buffer *req = t->req;
struct buffer *rep = t->rep;
int n;
next_response:
DPRINTF(stderr,"[%u] %s: session=%p b=%p, exp(r,w)=%u,%u bf=%08x bl=%d analysers=%02x\n",
now_ms, __FUNCTION__,
t,
rep,
rep->rex, rep->wex,
rep->flags,
rep->l,
rep->analysers);
if (rep->analysers & AN_RTR_HTTP_HDR) { /* receiving server headers */
/*
* Now parse the partial (or complete) lines.
* We will check the response syntax, and also join multi-line
* headers. An index of all the lines will be elaborated while
* parsing.
*
* For the parsing, we use a 28 states FSM.
*
* Here is the information we currently have :
* rep->data + rep->som = beginning of response
* rep->data + rep->eoh = end of processed headers / start of current one
* rep->data + rep->eol = end of current header or line (LF or CRLF)
* rep->lr = first non-visited byte
* rep->r = end of data
*/
int cur_idx;
struct http_msg *msg = &txn->rsp;
struct proxy *cur_proxy;
if (likely(rep->lr < rep->r))
http_msg_analyzer(rep, msg, &txn->hdr_idx);
/* 1: we might have to print this header in debug mode */
if (unlikely((global.mode & MODE_DEBUG) &&
(!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) &&
(msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) {
char *eol, *sol;
sol = rep->data + msg->som;
eol = sol + msg->sl.rq.l;
debug_hdr("srvrep", t, sol, eol);
sol += hdr_idx_first_pos(&txn->hdr_idx);
cur_idx = hdr_idx_first_idx(&txn->hdr_idx);
while (cur_idx) {
eol = sol + txn->hdr_idx.v[cur_idx].len;
debug_hdr("srvhdr", t, sol, eol);
sol = eol + txn->hdr_idx.v[cur_idx].cr + 1;
cur_idx = txn->hdr_idx.v[cur_idx].next;
}
}
/*
* Now we quickly check if we have found a full valid response.
* If not so, we check the FD and buffer states before leaving.
* A full response is indicated by the fact that we have seen
* the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid
* responses are checked first.
*
* Depending on whether the client is still there or not, we
* may send an error response back or not. Note that normally
* we should only check for HTTP status there, and check I/O
* errors somewhere else.
*/
if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
/* Invalid response */
if (unlikely(msg->msg_state == HTTP_MSG_ERROR)) {
/* we detected a parsing error. We want to archive this response
* in the dedicated proxy area for later troubleshooting.
*/
hdr_response_bad:
if (msg->msg_state == HTTP_MSG_ERROR || msg->err_pos >= 0)
http_capture_bad_message(&t->be->invalid_rep, t, rep, msg, t->fe);
buffer_shutr_now(rep);
buffer_shutw_now(req);
if (t->srv)
t->srv->counters.failed_resp++;
t->be->counters.failed_resp++;
rep->analysers = 0;
txn->status = 502;
stream_int_return(rep->cons, error_message(t, HTTP_ERR_502));
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_PRXCOND;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_H;
return 0;
}
/* too large response does not fit in buffer. */
else if (rep->flags & BF_FULL) {
goto hdr_response_bad;
}
/* read error */
else if (rep->flags & BF_READ_ERROR) {
if (msg->err_pos >= 0)
http_capture_bad_message(&t->be->invalid_rep, t, rep, msg, t->fe);
buffer_shutr_now(rep);
buffer_shutw_now(req);
if (t->srv)
t->srv->counters.failed_resp++;
t->be->counters.failed_resp++;
rep->analysers = 0;
txn->status = 502;
stream_int_return(rep->cons, error_message(t, HTTP_ERR_502));
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVCL;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_H;
return 0;
}
/* read timeout : return a 504 to the client. */
else if (rep->flags & BF_READ_TIMEOUT) {
if (msg->err_pos >= 0)
http_capture_bad_message(&t->be->invalid_rep, t, rep, msg, t->fe);
buffer_shutr_now(rep);
buffer_shutw_now(req);
if (t->srv)
t->srv->counters.failed_resp++;
t->be->counters.failed_resp++;
rep->analysers = 0;
txn->status = 504;
stream_int_return(rep->cons, error_message(t, HTTP_ERR_504));
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVTO;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_H;
return 0;
}
/* close from server */
else if (rep->flags & BF_SHUTR) {
if (msg->err_pos >= 0)
http_capture_bad_message(&t->be->invalid_rep, t, rep, msg, t->fe);
buffer_shutw_now(req);
if (t->srv)
t->srv->counters.failed_resp++;
t->be->counters.failed_resp++;
rep->analysers = 0;
txn->status = 502;
stream_int_return(rep->cons, error_message(t, HTTP_ERR_502));
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_SRVCL;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_H;
return 0;
}
/* write error to client (we don't send any message then) */
else if (rep->flags & BF_WRITE_ERROR) {
if (msg->err_pos >= 0)
http_capture_bad_message(&t->be->invalid_rep, t, rep, msg, t->fe);
buffer_shutr_now(rep);
t->be->counters.failed_resp++;
rep->analysers = 0;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_CLICL;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_H;
return 0;
}
buffer_dont_close(rep);
return 0;
}
/*****************************************************************
* More interesting part now : we know that we have a complete *
* response which at least looks like HTTP. We have an indicator *
* of each header's length, so we can parse them quickly. *
****************************************************************/
if (msg->err_pos >= 0)
http_capture_bad_message(&t->be->invalid_rep, t, rep, msg, t->fe);
rep->analysers &= ~AN_RTR_HTTP_HDR;
/* ensure we keep this pointer to the beginning of the message */
msg->sol = rep->data + msg->som;
/*
* 1: get the status code and check for cacheability.
*/
t->logs.logwait &= ~LW_RESP;
txn->status = strl2ui(rep->data + msg->sl.st.c, msg->sl.st.c_l);
n = rep->data[msg->sl.st.c] - '0';
if (n < 1 || n > 5)
n = 0;
t->srv->counters.p.http.rsp[n]++;
t->be->counters.p.http.rsp[n]++;
switch (txn->status) {
case 200:
case 203:
case 206:
case 300:
case 301:
case 410:
/* RFC2616 @13.4:
* "A response received with a status code of
* 200, 203, 206, 300, 301 or 410 MAY be stored
* by a cache (...) unless a cache-control
* directive prohibits caching."
*
* RFC2616 @9.5: POST method :
* "Responses to this method are not cacheable,
* unless the response includes appropriate
* Cache-Control or Expires header fields."
*/
if (likely(txn->meth != HTTP_METH_POST) &&
(t->be->options & (PR_O_CHK_CACHE|PR_O_COOK_NOC)))
txn->flags |= TX_CACHEABLE | TX_CACHE_COOK;
break;
default:
break;
}
/*
* 2: we may need to capture headers
*/
if (unlikely((t->logs.logwait & LW_RSPHDR) && t->fe->rsp_cap))
capture_headers(rep->data + msg->som, &txn->hdr_idx,
txn->rsp.cap, t->fe->rsp_cap);
/*
* 3: we will have to evaluate the filters.
* As opposed to version 1.2, now they will be evaluated in the
* filters order and not in the header order. This means that
* each filter has to be validated among all headers.
*
* Filters are tried with ->be first, then with ->fe if it is
* different from ->be.
*/
t->flags &= ~SN_CONN_CLOSED; /* prepare for inspection */
cur_proxy = t->be;
while (1) {
struct proxy *rule_set = cur_proxy;
/* try headers filters */
if (rule_set->rsp_exp != NULL) {
if (apply_filters_to_response(t, rep, rule_set->rsp_exp) < 0) {
return_bad_resp:
if (t->srv)
t->srv->counters.failed_resp++;
cur_proxy->counters.failed_resp++;
return_srv_prx_502:
buffer_shutr_now(rep);
buffer_shutw_now(req);
rep->analysers = 0;
txn->status = 502;
stream_int_return(rep->cons, error_message(t, HTTP_ERR_502));
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_PRXCOND;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_H;
return 0;
}
}
/* has the response been denied ? */
if (txn->flags & TX_SVDENY) {
if (t->srv)
t->srv->counters.failed_secu++;
cur_proxy->counters.denied_resp++;
if (t->listener->counters)
t->listener->counters->denied_resp++;
goto return_srv_prx_502;
}
/* We might have to check for "Connection:" */
if (((t->fe->options | t->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO)) &&
!(t->flags & SN_CONN_CLOSED) &&
txn->status >= 200) {
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx, delta, val;
struct hdr_idx_elem *cur_hdr;
cur_next = rep->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
old_idx = 0;
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
val = http_header_match2(cur_ptr, cur_end, "Connection", 10);
if (val) {
/* 3 possibilities :
* - we have already set Connection: close,
* so we remove this line.
* - we have not yet set Connection: close,
* but this line indicates close. We leave
* it untouched and set the flag.
* - we have not yet set Connection: close,
* and this line indicates non-close. We
* replace it.
*/
if (t->flags & SN_CONN_CLOSED) {
delta = buffer_replace2(rep, cur_ptr, cur_next, NULL, 0);
txn->rsp.eoh += delta;
cur_next += delta;
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
} else {
if (strncasecmp(cur_ptr + val, "close", 5) != 0) {
delta = buffer_replace2(rep, cur_ptr + val, cur_end,
"close", 5);
cur_next += delta;
cur_hdr->len += delta;
txn->rsp.eoh += delta;
}
t->flags |= SN_CONN_CLOSED;
}
}
old_idx = cur_idx;
}
}
/* add response headers from the rule sets in the same order */
for (cur_idx = 0; cur_idx < rule_set->nb_rspadd; cur_idx++) {
if (txn->status < 200)
break;
if (unlikely(http_header_add_tail(rep, &txn->rsp, &txn->hdr_idx,
rule_set->rsp_add[cur_idx])) < 0)
goto return_bad_resp;
}
/* check whether we're already working on the frontend */
if (cur_proxy == t->fe)
break;
cur_proxy = t->fe;
}
/*
* 4: check for server cookie.
*/
if ((t->be->cookie_name || t->be->appsession_name || t->fe->capture_name
|| (t->be->options & PR_O_CHK_CACHE)) && txn->status >= 200)
manage_server_side_cookies(t, rep);
/*
* 5: check for cache-control or pragma headers if required.
*/
if ((t->be->options & (PR_O_COOK_NOC | PR_O_CHK_CACHE)) != 0 && txn->status >= 200)
check_response_for_cacheability(t, rep);
/*
* 6: add server cookie in the response if needed
*/
if ((t->srv) && !(t->flags & SN_DIRECT) && (t->be->options & PR_O_COOK_INS) &&
(!(t->be->options & PR_O_COOK_POST) || (txn->meth == HTTP_METH_POST)) &&
txn->status >= 200) {
int len;
/* the server is known, it's not the one the client requested, we have to
* insert a set-cookie here, except if we want to insert only on POST
* requests and this one isn't. Note that servers which don't have cookies
* (eg: some backup servers) will return a full cookie removal request.
*/
len = sprintf(trash, "Set-Cookie: %s=%s; path=/",
t->be->cookie_name,
t->srv->cookie ? t->srv->cookie : "; Expires=Thu, 01-Jan-1970 00:00:01 GMT");
if (t->be->cookie_domain)
len += sprintf(trash+len, "; domain=%s", t->be->cookie_domain);
if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
trash, len)) < 0)
goto return_bad_resp;
txn->flags |= TX_SCK_INSERTED;
/* Here, we will tell an eventual cache on the client side that we don't
* want it to cache this reply because HTTP/1.0 caches also cache cookies !
* Some caches understand the correct form: 'no-cache="set-cookie"', but
* others don't (eg: apache <= 1.3.26). So we use 'private' instead.
*/
if ((t->be->options & PR_O_COOK_NOC) && (txn->flags & TX_CACHEABLE)) {
txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
"Cache-control: private", 22)) < 0)
goto return_bad_resp;
}
}
/*
* 7: check if result will be cacheable with a cookie.
* We'll block the response if security checks have caught
* nasty things such as a cacheable cookie.
*/
if (((txn->flags & (TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) ==
(TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) &&
(t->be->options & PR_O_CHK_CACHE) &&
txn->status >= 200) {
/* we're in presence of a cacheable response containing
* a set-cookie header. We'll block it as requested by
* the 'checkcache' option, and send an alert.
*/
if (t->srv)
t->srv->counters.failed_secu++;
cur_proxy->counters.denied_resp++;
if (t->listener->counters)
t->listener->counters->denied_resp++;
Alert("Blocking cacheable cookie in response from instance %s, server %s.\n",
t->be->id, t->srv?t->srv->id:"<dispatch>");
send_log(t->be, LOG_ALERT,
"Blocking cacheable cookie in response from instance %s, server %s.\n",
t->be->id, t->srv?t->srv->id:"<dispatch>");
goto return_srv_prx_502;
}
/*
* 8: add "Connection: close" if needed and not yet set.
* Note that we do not need to add it in case of HTTP/1.0.
*/
if (!(t->flags & SN_CONN_CLOSED) &&
((t->fe->options | t->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO)) &&
txn->status >= 200) {
if ((unlikely(msg->sl.st.v_l != 8) ||
unlikely(req->data[msg->som + 7] != '0')) &&
unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
"Connection: close", 17)) < 0)
goto return_bad_resp;
t->flags |= SN_CONN_CLOSED;
}
/*
* 9: we may be facing a 1xx response (100 continue, 101 switching protocols),
* in which case this is not the right response, and we're waiting for the
* next one. Let's allow this response to go to the client and wait for the
* next one.
*/
if (txn->status < 200) {
hdr_idx_init(&txn->hdr_idx);
buffer_forward(rep, rep->lr - (rep->data + msg->som));
msg->msg_state = HTTP_MSG_RPBEFORE;
txn->status = 0;
rep->analysers |= AN_RTR_HTTP_HDR;
goto next_response;
}
/*************************************************************
* OK, that's finished for the headers. We have done what we *
* could. Let's switch to the DATA state. *
************************************************************/
buffer_set_rlim(rep, rep->size); /* no more rewrite needed */
t->logs.t_data = tv_ms_elapsed(&t->logs.tv_accept, &now);
/* if the user wants to log as soon as possible, without counting
* bytes from the server, then this is the right moment. We have
* to temporarily assign bytes_out to log what we currently have.
*/
if (t->fe->to_log && !(t->logs.logwait & LW_BYTES)) {
t->logs.t_close = t->logs.t_data; /* to get a valid end date */
t->logs.bytes_out = txn->rsp.eoh;
t->do_log(t);
t->logs.bytes_out = 0;
}
/* Note: we must not try to cheat by jumping directly to DATA,
* otherwise we would not let the client side wake up.
*/
return 0;
}
/* Note: eventhough nobody should set an unknown flag, clearing them right now will
* probably reduce one day's debugging session.
*/
#ifdef DEBUG_DEV
if (rep->analysers & ~(AN_RTR_HTTP_HDR)) {
fprintf(stderr, "FIXME !!!! unknown analysers flags %s:%d = 0x%08X\n",
__FILE__, __LINE__, rep->analysers);
ABORT_NOW();
}
#endif
rep->analysers &= AN_RTR_HTTP_HDR;
return 0;
}
/* Iterate the same filter through all request headers.
* Returns 1 if this filter can be stopped upon return, otherwise 0.
* Since it can manage the switch to another backend, it updates the per-proxy
* DENY stats.
*/
int apply_filter_to_req_headers(struct session *t, struct buffer *req, struct hdr_exp *exp)
{
char term;
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx, last_hdr;
struct http_txn *txn = &t->txn;
struct hdr_idx_elem *cur_hdr;
int len, delta;
last_hdr = 0;
cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
old_idx = 0;
while (!last_hdr) {
if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT)))
return 1;
else if (unlikely(txn->flags & TX_CLALLOW) &&
(exp->action == ACT_ALLOW ||
exp->action == ACT_DENY ||
exp->action == ACT_TARPIT))
return 0;
cur_idx = txn->hdr_idx.v[old_idx].next;
if (!cur_idx)
break;
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
/* Now we have one header between cur_ptr and cur_end,
* and the next header starts at cur_next.
*/
/* The annoying part is that pattern matching needs
* that we modify the contents to null-terminate all
* strings before testing them.
*/
term = *cur_end;
*cur_end = '\0';
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
switch (exp->action) {
case ACT_SETBE:
/* It is not possible to jump a second time.
* FIXME: should we return an HTTP/500 here so that
* the admin knows there's a problem ?
*/
if (t->be != t->fe)
break;
/* Swithing Proxy */
session_set_backend(t, (struct proxy *)exp->replace);
last_hdr = 1;
break;
case ACT_ALLOW:
txn->flags |= TX_CLALLOW;
last_hdr = 1;
break;
case ACT_DENY:
txn->flags |= TX_CLDENY;
last_hdr = 1;
t->be->counters.denied_req++;
if (t->listener->counters)
t->listener->counters->denied_resp++;
break;
case ACT_TARPIT:
txn->flags |= TX_CLTARPIT;
last_hdr = 1;
t->be->counters.denied_req++;
if (t->listener->counters)
t->listener->counters->denied_resp++;
break;
case ACT_REPLACE:
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
delta = buffer_replace2(req, cur_ptr, cur_end, trash, len);
/* FIXME: if the user adds a newline in the replacement, the
* index will not be recalculated for now, and the new line
* will not be counted as a new header.
*/
cur_end += delta;
cur_next += delta;
cur_hdr->len += delta;
txn->req.eoh += delta;
break;
case ACT_REMOVE:
delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
cur_next += delta;
/* FIXME: this should be a separate function */
txn->req.eoh += delta;
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
cur_end = NULL; /* null-term has been rewritten */
break;
}
}
if (cur_end)
*cur_end = term; /* restore the string terminator */
/* keep the link from this header to next one in case of later
* removal of next header.
*/
old_idx = cur_idx;
}
return 0;
}
/* Apply the filter to the request line.
* Returns 0 if nothing has been done, 1 if the filter has been applied,
* or -1 if a replacement resulted in an invalid request line.
* Since it can manage the switch to another backend, it updates the per-proxy
* DENY stats.
*/
int apply_filter_to_req_line(struct session *t, struct buffer *req, struct hdr_exp *exp)
{
char term;
char *cur_ptr, *cur_end;
int done;
struct http_txn *txn = &t->txn;
int len, delta;
if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT)))
return 1;
else if (unlikely(txn->flags & TX_CLALLOW) &&
(exp->action == ACT_ALLOW ||
exp->action == ACT_DENY ||
exp->action == ACT_TARPIT))
return 0;
else if (exp->action == ACT_REMOVE)
return 0;
done = 0;
cur_ptr = req->data + txn->req.som; /* should be equal to txn->sol */
cur_end = cur_ptr + txn->req.sl.rq.l;
/* Now we have the request line between cur_ptr and cur_end */
/* The annoying part is that pattern matching needs
* that we modify the contents to null-terminate all
* strings before testing them.
*/
term = *cur_end;
*cur_end = '\0';
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
switch (exp->action) {
case ACT_SETBE:
/* It is not possible to jump a second time.
* FIXME: should we return an HTTP/500 here so that
* the admin knows there's a problem ?
*/
if (t->be != t->fe)
break;
/* Swithing Proxy */
session_set_backend(t, (struct proxy *)exp->replace);
done = 1;
break;
case ACT_ALLOW:
txn->flags |= TX_CLALLOW;
done = 1;
break;
case ACT_DENY:
txn->flags |= TX_CLDENY;
t->be->counters.denied_req++;
if (t->listener->counters)
t->listener->counters->denied_resp++;
done = 1;
break;
case ACT_TARPIT:
txn->flags |= TX_CLTARPIT;
t->be->counters.denied_req++;
if (t->listener->counters)
t->listener->counters->denied_resp++;
done = 1;
break;
case ACT_REPLACE:
*cur_end = term; /* restore the string terminator */
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
delta = buffer_replace2(req, cur_ptr, cur_end, trash, len);
/* FIXME: if the user adds a newline in the replacement, the
* index will not be recalculated for now, and the new line
* will not be counted as a new header.
*/
txn->req.eoh += delta;
cur_end += delta;
txn->req.sol = req->data + txn->req.som; /* should be equal to txn->sol */
cur_end = (char *)http_parse_reqline(&txn->req, req->data,
HTTP_MSG_RQMETH,
cur_ptr, cur_end + 1,
NULL, NULL);
if (unlikely(!cur_end))
return -1;
/* we have a full request and we know that we have either a CR
* or an LF at <ptr>.
*/
txn->meth = find_http_meth(cur_ptr, txn->req.sl.rq.m_l);
hdr_idx_set_start(&txn->hdr_idx, txn->req.sl.rq.l, *cur_end == '\r');
/* there is no point trying this regex on headers */
return 1;
}
}
*cur_end = term; /* restore the string terminator */
return done;
}
/*
* Apply all the req filters <exp> to all headers in buffer <req> of session <t>.
* Returns 0 if everything is alright, or -1 in case a replacement lead to an
* unparsable request. Since it can manage the switch to another backend, it
* updates the per-proxy DENY stats.
*/
int apply_filters_to_request(struct session *t, struct buffer *req, struct hdr_exp *exp)
{
struct http_txn *txn = &t->txn;
/* iterate through the filters in the outer loop */
while (exp && !(txn->flags & (TX_CLDENY|TX_CLTARPIT))) {
int ret;
/*
* The interleaving of transformations and verdicts
* makes it difficult to decide to continue or stop
* the evaluation.
*/
if ((txn->flags & TX_CLALLOW) &&
(exp->action == ACT_ALLOW || exp->action == ACT_DENY ||
exp->action == ACT_TARPIT || exp->action == ACT_PASS)) {
exp = exp->next;
continue;
}
/* Apply the filter to the request line. */
ret = apply_filter_to_req_line(t, req, exp);
if (unlikely(ret < 0))
return -1;
if (likely(ret == 0)) {
/* The filter did not match the request, it can be
* iterated through all headers.
*/
apply_filter_to_req_headers(t, req, exp);
}
exp = exp->next;
}
return 0;
}
/*
* Manage client-side cookie. It can impact performance by about 2% so it is
* desirable to call it only when needed.
*/
void manage_client_side_cookies(struct session *t, struct buffer *req)
{
struct http_txn *txn = &t->txn;
char *p1, *p2, *p3, *p4;
char *del_colon, *del_cookie, *colon;
int app_cookies;
appsess *asession_temp = NULL;
appsess local_asession;
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx;
/* Iterate through the headers.
* we start with the start line.
*/
old_idx = 0;
cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
struct hdr_idx_elem *cur_hdr;
int val;
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
/* We have one full header between cur_ptr and cur_end, and the
* next header starts at cur_next. We're only interested in
* "Cookie:" headers.
*/
val = http_header_match2(cur_ptr, cur_end, "Cookie", 6);
if (!val) {
old_idx = cur_idx;
continue;
}
/* Now look for cookies. Conforming to RFC2109, we have to support
* attributes whose name begin with a '$', and associate them with
* the right cookie, if we want to delete this cookie.
* So there are 3 cases for each cookie read :
* 1) it's a special attribute, beginning with a '$' : ignore it.
* 2) it's a server id cookie that we *MAY* want to delete : save
* some pointers on it (last semi-colon, beginning of cookie...)
* 3) it's an application cookie : we *MAY* have to delete a previous
* "special" cookie.
* At the end of loop, if a "special" cookie remains, we may have to
* remove it. If no application cookie persists in the header, we
* *MUST* delete it
*/
colon = p1 = cur_ptr + val; /* first non-space char after 'Cookie:' */
/* del_cookie == NULL => nothing to be deleted */
del_colon = del_cookie = NULL;
app_cookies = 0;
while (p1 < cur_end) {
/* skip spaces and colons, but keep an eye on these ones */
while (p1 < cur_end) {
if (*p1 == ';' || *p1 == ',')
colon = p1;
else if (!isspace((unsigned char)*p1))
break;
p1++;
}
if (p1 == cur_end)
break;
/* p1 is at the beginning of the cookie name */
p2 = p1;
while (p2 < cur_end && *p2 != '=')
p2++;
if (p2 == cur_end)
break;
p3 = p2 + 1; /* skips the '=' sign */
if (p3 == cur_end)
break;
p4 = p3;
while (p4 < cur_end && !isspace((unsigned char)*p4) && *p4 != ';' && *p4 != ',')
p4++;
/* here, we have the cookie name between p1 and p2,
* and its value between p3 and p4.
* we can process it :
*
* Cookie: NAME=VALUE;
* | || || |
* | || || +--> p4
* | || |+-------> p3
* | || +--------> p2
* | |+------------> p1
* | +-------------> colon
* +--------------------> cur_ptr
*/
if (*p1 == '$') {
/* skip this one */
}
else {
/* first, let's see if we want to capture it */
if (t->fe->capture_name != NULL &&
txn->cli_cookie == NULL &&
(p4 - p1 >= t->fe->capture_namelen) &&
memcmp(p1, t->fe->capture_name, t->fe->capture_namelen) == 0) {
int log_len = p4 - p1;
if ((txn->cli_cookie = pool_alloc2(pool2_capture)) == NULL) {
Alert("HTTP logging : out of memory.\n");
} else {
if (log_len > t->fe->capture_len)
log_len = t->fe->capture_len;
memcpy(txn->cli_cookie, p1, log_len);
txn->cli_cookie[log_len] = 0;
}
}
if ((p2 - p1 == t->be->cookie_len) && (t->be->cookie_name != NULL) &&
(memcmp(p1, t->be->cookie_name, p2 - p1) == 0)) {
/* Cool... it's the right one */
struct server *srv = t->be->srv;
char *delim;
/* if we're in cookie prefix mode, we'll search the delimitor so that we
* have the server ID betweek p3 and delim, and the original cookie between
* delim+1 and p4. Otherwise, delim==p4 :
*
* Cookie: NAME=SRV~VALUE;
* | || || | |
* | || || | +--> p4
* | || || +--------> delim
* | || |+-----------> p3
* | || +------------> p2
* | |+----------------> p1
* | +-----------------> colon
* +------------------------> cur_ptr
*/
if (t->be->options & PR_O_COOK_PFX) {
for (delim = p3; delim < p4; delim++)
if (*delim == COOKIE_DELIM)
break;
}
else
delim = p4;
/* Here, we'll look for the first running server which supports the cookie.
* This allows to share a same cookie between several servers, for example
* to dedicate backup servers to specific servers only.
* However, to prevent clients from sticking to cookie-less backup server
* when they have incidentely learned an empty cookie, we simply ignore
* empty cookies and mark them as invalid.
*/
if (delim == p3)
srv = NULL;
while (srv) {
if (srv->cookie && (srv->cklen == delim - p3) &&
!memcmp(p3, srv->cookie, delim - p3)) {
if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
/* we found the server and it's usable */
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_VALID;
t->flags |= SN_DIRECT | SN_ASSIGNED;
t->srv = srv;
break;
} else {
/* we found a server, but it's down */
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_DOWN;
}
}
srv = srv->next;
}
if (!srv && !(txn->flags & TX_CK_DOWN)) {
/* no server matched this cookie */
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_INVALID;
}
/* depending on the cookie mode, we may have to either :
* - delete the complete cookie if we're in insert+indirect mode, so that
* the server never sees it ;
* - remove the server id from the cookie value, and tag the cookie as an
* application cookie so that it does not get accidentely removed later,
* if we're in cookie prefix mode
*/
if ((t->be->options & PR_O_COOK_PFX) && (delim != p4)) {
int delta; /* negative */
delta = buffer_replace2(req, p3, delim + 1, NULL, 0);
p4 += delta;
cur_end += delta;
cur_next += delta;
cur_hdr->len += delta;
txn->req.eoh += delta;
del_cookie = del_colon = NULL;
app_cookies++; /* protect the header from deletion */
}
else if (del_cookie == NULL &&
(t->be->options & (PR_O_COOK_INS | PR_O_COOK_IND)) == (PR_O_COOK_INS | PR_O_COOK_IND)) {
del_cookie = p1;
del_colon = colon;
}
} else {
/* now we know that we must keep this cookie since it's
* not ours. But if we wanted to delete our cookie
* earlier, we cannot remove the complete header, but we
* can remove the previous block itself.
*/
app_cookies++;
if (del_cookie != NULL) {
int delta; /* negative */
delta = buffer_replace2(req, del_cookie, p1, NULL, 0);
p4 += delta;
cur_end += delta;
cur_next += delta;
cur_hdr->len += delta;
txn->req.eoh += delta;
del_cookie = del_colon = NULL;
}
}
if ((t->be->appsession_name != NULL) &&
(memcmp(p1, t->be->appsession_name, p2 - p1) == 0)) {
/* first, let's see if the cookie is our appcookie*/
/* Cool... it's the right one */
asession_temp = &local_asession;
if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) {
Alert("Not enough memory process_cli():asession->sessid:malloc().\n");
send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession->sessid:malloc().\n");
return;
}
memcpy(asession_temp->sessid, p3, t->be->appsession_len);
asession_temp->sessid[t->be->appsession_len] = 0;
asession_temp->serverid = NULL;
/* only do insert, if lookup fails */
asession_temp = appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid);
if (asession_temp == NULL) {
if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) {
/* free previously allocated memory */
pool_free2(apools.sessid, local_asession.sessid);
Alert("Not enough memory process_cli():asession:calloc().\n");
send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
return;
}
asession_temp->sessid = local_asession.sessid;
asession_temp->serverid = local_asession.serverid;
asession_temp->request_count = 0;
appsession_hash_insert(&(t->be->htbl_proxy), asession_temp);
} else {
/* free previously allocated memory */
pool_free2(apools.sessid, local_asession.sessid);
}
if (asession_temp->serverid == NULL) {
/* TODO redispatch request */
Alert("Found Application Session without matching server.\n");
} else {
struct server *srv = t->be->srv;
while (srv) {
if (strcmp(srv->id, asession_temp->serverid) == 0) {
if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
/* we found the server and it's usable */
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_VALID;
t->flags |= SN_DIRECT | SN_ASSIGNED;
t->srv = srv;
break;
} else {
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_DOWN;
}
}
srv = srv->next;
}/* end while(srv) */
}/* end else if server == NULL */
asession_temp->expire = tick_add_ifset(now_ms, t->be->timeout.appsession);
asession_temp->request_count++;
#if defined(DEBUG_HASH)
Alert("manage_client_side_cookies\n");
appsession_hash_dump(&(t->be->htbl_proxy));
#endif
}/* end if ((t->proxy->appsession_name != NULL) ... */
}
/* we'll have to look for another cookie ... */
p1 = p4;
} /* while (p1 < cur_end) */
/* There's no more cookie on this line.
* We may have marked the last one(s) for deletion.
* We must do this now in two ways :
* - if there is no app cookie, we simply delete the header ;
* - if there are app cookies, we must delete the end of the
* string properly, including the colon/semi-colon before
* the cookie name.
*/
if (del_cookie != NULL) {
int delta;
if (app_cookies) {
delta = buffer_replace2(req, del_colon, cur_end, NULL, 0);
cur_end = del_colon;
cur_hdr->len += delta;
} else {
delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
/* FIXME: this should be a separate function */
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
}
cur_next += delta;
txn->req.eoh += delta;
}
/* keep the link from this header to next one */
old_idx = cur_idx;
} /* end of cookie processing on this header */
}
/* Iterate the same filter through all response headers contained in <rtr>.
* Returns 1 if this filter can be stopped upon return, otherwise 0.
*/
int apply_filter_to_resp_headers(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
{
char term;
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx, last_hdr;
struct http_txn *txn = &t->txn;
struct hdr_idx_elem *cur_hdr;
int len, delta;
last_hdr = 0;
cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
old_idx = 0;
while (!last_hdr) {
if (unlikely(txn->flags & TX_SVDENY))
return 1;
else if (unlikely(txn->flags & TX_SVALLOW) &&
(exp->action == ACT_ALLOW ||
exp->action == ACT_DENY))
return 0;
cur_idx = txn->hdr_idx.v[old_idx].next;
if (!cur_idx)
break;
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
/* Now we have one header between cur_ptr and cur_end,
* and the next header starts at cur_next.
*/
/* The annoying part is that pattern matching needs
* that we modify the contents to null-terminate all
* strings before testing them.
*/
term = *cur_end;
*cur_end = '\0';
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
switch (exp->action) {
case ACT_ALLOW:
txn->flags |= TX_SVALLOW;
last_hdr = 1;
break;
case ACT_DENY:
txn->flags |= TX_SVDENY;
last_hdr = 1;
break;
case ACT_REPLACE:
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len);
/* FIXME: if the user adds a newline in the replacement, the
* index will not be recalculated for now, and the new line
* will not be counted as a new header.
*/
cur_end += delta;
cur_next += delta;
cur_hdr->len += delta;
txn->rsp.eoh += delta;
break;
case ACT_REMOVE:
delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0);
cur_next += delta;
/* FIXME: this should be a separate function */
txn->rsp.eoh += delta;
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
cur_end = NULL; /* null-term has been rewritten */
break;
}
}
if (cur_end)
*cur_end = term; /* restore the string terminator */
/* keep the link from this header to next one in case of later
* removal of next header.
*/
old_idx = cur_idx;
}
return 0;
}
/* Apply the filter to the status line in the response buffer <rtr>.
* Returns 0 if nothing has been done, 1 if the filter has been applied,
* or -1 if a replacement resulted in an invalid status line.
*/
int apply_filter_to_sts_line(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
{
char term;
char *cur_ptr, *cur_end;
int done;
struct http_txn *txn = &t->txn;
int len, delta;
if (unlikely(txn->flags & TX_SVDENY))
return 1;
else if (unlikely(txn->flags & TX_SVALLOW) &&
(exp->action == ACT_ALLOW ||
exp->action == ACT_DENY))
return 0;
else if (exp->action == ACT_REMOVE)
return 0;
done = 0;
cur_ptr = rtr->data + txn->rsp.som; /* should be equal to txn->sol */
cur_end = cur_ptr + txn->rsp.sl.rq.l;
/* Now we have the status line between cur_ptr and cur_end */
/* The annoying part is that pattern matching needs
* that we modify the contents to null-terminate all
* strings before testing them.
*/
term = *cur_end;
*cur_end = '\0';
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
switch (exp->action) {
case ACT_ALLOW:
txn->flags |= TX_SVALLOW;
done = 1;
break;
case ACT_DENY:
txn->flags |= TX_SVDENY;
done = 1;
break;
case ACT_REPLACE:
*cur_end = term; /* restore the string terminator */
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len);
/* FIXME: if the user adds a newline in the replacement, the
* index will not be recalculated for now, and the new line
* will not be counted as a new header.
*/
txn->rsp.eoh += delta;
cur_end += delta;
txn->rsp.sol = rtr->data + txn->rsp.som; /* should be equal to txn->sol */
cur_end = (char *)http_parse_stsline(&txn->rsp, rtr->data,
HTTP_MSG_RPVER,
cur_ptr, cur_end + 1,
NULL, NULL);
if (unlikely(!cur_end))
return -1;
/* we have a full respnse and we know that we have either a CR
* or an LF at <ptr>.
*/
txn->status = strl2ui(rtr->data + txn->rsp.sl.st.c, txn->rsp.sl.st.c_l);
hdr_idx_set_start(&txn->hdr_idx, txn->rsp.sl.rq.l, *cur_end == '\r');
/* there is no point trying this regex on headers */
return 1;
}
}
*cur_end = term; /* restore the string terminator */
return done;
}
/*
* Apply all the resp filters <exp> to all headers in buffer <rtr> of session <t>.
* Returns 0 if everything is alright, or -1 in case a replacement lead to an
* unparsable response.
*/
int apply_filters_to_response(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
{
struct http_txn *txn = &t->txn;
/* iterate through the filters in the outer loop */
while (exp && !(txn->flags & TX_SVDENY)) {
int ret;
/*
* The interleaving of transformations and verdicts
* makes it difficult to decide to continue or stop
* the evaluation.
*/
if ((txn->flags & TX_SVALLOW) &&
(exp->action == ACT_ALLOW || exp->action == ACT_DENY ||
exp->action == ACT_PASS)) {
exp = exp->next;
continue;
}
/* Apply the filter to the status line. */
ret = apply_filter_to_sts_line(t, rtr, exp);
if (unlikely(ret < 0))
return -1;
if (likely(ret == 0)) {
/* The filter did not match the response, it can be
* iterated through all headers.
*/
apply_filter_to_resp_headers(t, rtr, exp);
}
exp = exp->next;
}
return 0;
}
/*
* Manage server-side cookies. It can impact performance by about 2% so it is
* desirable to call it only when needed.
*/
void manage_server_side_cookies(struct session *t, struct buffer *rtr)
{
struct http_txn *txn = &t->txn;
char *p1, *p2, *p3, *p4;
appsess *asession_temp = NULL;
appsess local_asession;
char *cur_ptr, *cur_end, *cur_next;
int cur_idx, old_idx, delta;
/* Iterate through the headers.
* we start with the start line.
*/
old_idx = 0;
cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
struct hdr_idx_elem *cur_hdr;
int val;
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
/* We have one full header between cur_ptr and cur_end, and the
* next header starts at cur_next. We're only interested in
* "Cookie:" headers.
*/
val = http_header_match2(cur_ptr, cur_end, "Set-Cookie", 10);
if (!val) {
old_idx = cur_idx;
continue;
}
/* OK, right now we know we have a set-cookie at cur_ptr */
txn->flags |= TX_SCK_ANY;
/* maybe we only wanted to see if there was a set-cookie. Note that
* the cookie capture is declared in the fronend.
*/
if (t->be->cookie_name == NULL &&
t->be->appsession_name == NULL &&
t->fe->capture_name == NULL)
return;
p1 = cur_ptr + val; /* first non-space char after 'Set-Cookie:' */
while (p1 < cur_end) { /* in fact, we'll break after the first cookie */
if (p1 == cur_end || *p1 == ';') /* end of cookie */
break;
/* p1 is at the beginning of the cookie name */
p2 = p1;
while (p2 < cur_end && *p2 != '=' && *p2 != ';')
p2++;
if (p2 == cur_end || *p2 == ';') /* next cookie */
break;
p3 = p2 + 1; /* skip the '=' sign */
if (p3 == cur_end)
break;
p4 = p3;
while (p4 < cur_end && !isspace((unsigned char)*p4) && *p4 != ';')
p4++;
/* here, we have the cookie name between p1 and p2,
* and its value between p3 and p4.
* we can process it.
*/
/* first, let's see if we want to capture it */
if (t->fe->capture_name != NULL &&
txn->srv_cookie == NULL &&
(p4 - p1 >= t->fe->capture_namelen) &&
memcmp(p1, t->fe->capture_name, t->fe->capture_namelen) == 0) {
int log_len = p4 - p1;
if ((txn->srv_cookie = pool_alloc2(pool2_capture)) == NULL) {
Alert("HTTP logging : out of memory.\n");
}
if (log_len > t->fe->capture_len)
log_len = t->fe->capture_len;
memcpy(txn->srv_cookie, p1, log_len);
txn->srv_cookie[log_len] = 0;
}
/* now check if we need to process it for persistence */
if ((p2 - p1 == t->be->cookie_len) && (t->be->cookie_name != NULL) &&
(memcmp(p1, t->be->cookie_name, p2 - p1) == 0)) {
/* Cool... it's the right one */
txn->flags |= TX_SCK_SEEN;
/* If the cookie is in insert mode on a known server, we'll delete
* this occurrence because we'll insert another one later.
* We'll delete it too if the "indirect" option is set and we're in
* a direct access. */
if (((t->srv) && (t->be->options & PR_O_COOK_INS)) ||
((t->flags & SN_DIRECT) && (t->be->options & PR_O_COOK_IND))) {
/* this header must be deleted */
delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0);
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
txn->hdr_idx.used--;
cur_hdr->len = 0;
cur_next += delta;
txn->rsp.eoh += delta;
txn->flags |= TX_SCK_DELETED;
}
else if ((t->srv) && (t->srv->cookie) &&
(t->be->options & PR_O_COOK_RW)) {
/* replace bytes p3->p4 with the cookie name associated
* with this server since we know it.
*/
delta = buffer_replace2(rtr, p3, p4, t->srv->cookie, t->srv->cklen);
cur_hdr->len += delta;
cur_next += delta;
txn->rsp.eoh += delta;
txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED;
}
else if ((t->srv) && (t->srv->cookie) &&
(t->be->options & PR_O_COOK_PFX)) {
/* insert the cookie name associated with this server
* before existing cookie, and insert a delimitor between them..
*/
delta = buffer_replace2(rtr, p3, p3, t->srv->cookie, t->srv->cklen + 1);
cur_hdr->len += delta;
cur_next += delta;
txn->rsp.eoh += delta;
p3[t->srv->cklen] = COOKIE_DELIM;
txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED;
}
}
/* next, let's see if the cookie is our appcookie */
else if ((t->be->appsession_name != NULL) &&
(memcmp(p1, t->be->appsession_name, p2 - p1) == 0)) {
/* Cool... it's the right one */
size_t server_id_len = strlen(t->srv->id) + 1;
asession_temp = &local_asession;
if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) {
Alert("Not enough Memory process_srv():asession->sessid:malloc().\n");
send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n");
return;
}
memcpy(asession_temp->sessid, p3, t->be->appsession_len);
asession_temp->sessid[t->be->appsession_len] = 0;
asession_temp->serverid = NULL;
/* only do insert, if lookup fails */
asession_temp = appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid);
if (asession_temp == NULL) {
if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) {
Alert("Not enough Memory process_srv():asession:calloc().\n");
send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession:calloc().\n");
return;
}
asession_temp->sessid = local_asession.sessid;
asession_temp->serverid = local_asession.serverid;
asession_temp->request_count = 0;
appsession_hash_insert(&(t->be->htbl_proxy), asession_temp);
} else {
/* free wasted memory */
pool_free2(apools.sessid, local_asession.sessid);
}
if (asession_temp->serverid == NULL) {
if ((asession_temp->serverid = pool_alloc2(apools.serverid)) == NULL) {
Alert("Not enough Memory process_srv():asession->sessid:malloc().\n");
send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n");
return;
}
asession_temp->serverid[0] = '\0';
}
if (asession_temp->serverid[0] == '\0')
memcpy(asession_temp->serverid, t->srv->id, server_id_len);
asession_temp->expire = tick_add_ifset(now_ms, t->be->timeout.appsession);
asession_temp->request_count++;
#if defined(DEBUG_HASH)
Alert("manage_server_side_cookies\n");
appsession_hash_dump(&(t->be->htbl_proxy));
#endif
}/* end if ((t->proxy->appsession_name != NULL) ... */
break; /* we don't want to loop again since there cannot be another cookie on the same line */
} /* we're now at the end of the cookie value */
/* keep the link from this header to next one */
old_idx = cur_idx;
} /* end of cookie processing on this header */
}
/*
* Check if response is cacheable or not. Updates t->flags.
*/
void check_response_for_cacheability(struct session *t, struct buffer *rtr)
{
struct http_txn *txn = &t->txn;
char *p1, *p2;
char *cur_ptr, *cur_end, *cur_next;
int cur_idx;
if (!(txn->flags & TX_CACHEABLE))
return;
/* Iterate through the headers.
* we start with the start line.
*/
cur_idx = 0;
cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) {
struct hdr_idx_elem *cur_hdr;
int val;
cur_hdr = &txn->hdr_idx.v[cur_idx];
cur_ptr = cur_next;
cur_end = cur_ptr + cur_hdr->len;
cur_next = cur_end + cur_hdr->cr + 1;
/* We have one full header between cur_ptr and cur_end, and the
* next header starts at cur_next. We're only interested in
* "Cookie:" headers.
*/
val = http_header_match2(cur_ptr, cur_end, "Pragma", 6);
if (val) {
if ((cur_end - (cur_ptr + val) >= 8) &&
strncasecmp(cur_ptr + val, "no-cache", 8) == 0) {
txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
return;
}
}
val = http_header_match2(cur_ptr, cur_end, "Cache-control", 13);
if (!val)
continue;
/* OK, right now we know we have a cache-control header at cur_ptr */
p1 = cur_ptr + val; /* first non-space char after 'cache-control:' */
if (p1 >= cur_end) /* no more info */
continue;
/* p1 is at the beginning of the value */
p2 = p1;
while (p2 < cur_end && *p2 != '=' && *p2 != ',' && !isspace((unsigned char)*p2))
p2++;
/* we have a complete value between p1 and p2 */
if (p2 < cur_end && *p2 == '=') {
/* we have something of the form no-cache="set-cookie" */
if ((cur_end - p1 >= 21) &&
strncasecmp(p1, "no-cache=\"set-cookie", 20) == 0
&& (p1[20] == '"' || p1[20] == ','))
txn->flags &= ~TX_CACHE_COOK;
continue;
}
/* OK, so we know that either p2 points to the end of string or to a comma */
if (((p2 - p1 == 7) && strncasecmp(p1, "private", 7) == 0) ||
((p2 - p1 == 8) && strncasecmp(p1, "no-store", 8) == 0) ||
((p2 - p1 == 9) && strncasecmp(p1, "max-age=0", 9) == 0) ||
((p2 - p1 == 10) && strncasecmp(p1, "s-maxage=0", 10) == 0)) {
txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
return;
}
if ((p2 - p1 == 6) && strncasecmp(p1, "public", 6) == 0) {
txn->flags |= TX_CACHEABLE | TX_CACHE_COOK;
continue;
}
}
}
/*
* Try to retrieve a known appsession in the URI, then the associated server.
* If the server is found, it's assigned to the session.
*/
void get_srv_from_appsession(struct session *t, const char *begin, int len)
{
struct http_txn *txn = &t->txn;
appsess *asession_temp = NULL;
appsess local_asession;
char *request_line;
if (t->be->appsession_name == NULL ||
(t->txn.meth != HTTP_METH_GET && t->txn.meth != HTTP_METH_POST) ||
(request_line = memchr(begin, ';', len)) == NULL ||
((1 + t->be->appsession_name_len + 1 + t->be->appsession_len) > (begin + len - request_line)))
return;
/* skip ';' */
request_line++;
/* look if we have a jsessionid */
if (strncasecmp(request_line, t->be->appsession_name, t->be->appsession_name_len) != 0)
return;
/* skip jsessionid= */
request_line += t->be->appsession_name_len + 1;
/* First try if we already have an appsession */
asession_temp = &local_asession;
if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) {
Alert("Not enough memory process_cli():asession_temp->sessid:calloc().\n");
send_log(t->be, LOG_ALERT, "Not enough Memory process_cli():asession_temp->sessid:calloc().\n");
return;
}
/* Copy the sessionid */
memcpy(asession_temp->sessid, request_line, t->be->appsession_len);
asession_temp->sessid[t->be->appsession_len] = 0;
asession_temp->serverid = NULL;
/* only do insert, if lookup fails */
asession_temp = appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid);
if (asession_temp == NULL) {
if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) {
/* free previously allocated memory */
pool_free2(apools.sessid, local_asession.sessid);
Alert("Not enough memory process_cli():asession:calloc().\n");
send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
return;
}
asession_temp->sessid = local_asession.sessid;
asession_temp->serverid = local_asession.serverid;
asession_temp->request_count=0;
appsession_hash_insert(&(t->be->htbl_proxy), asession_temp);
}
else {
/* free previously allocated memory */
pool_free2(apools.sessid, local_asession.sessid);
}
asession_temp->expire = tick_add_ifset(now_ms, t->be->timeout.appsession);
asession_temp->request_count++;
#if defined(DEBUG_HASH)
Alert("get_srv_from_appsession\n");
appsession_hash_dump(&(t->be->htbl_proxy));
#endif
if (asession_temp->serverid == NULL) {
/* TODO redispatch request */
Alert("Found Application Session without matching server.\n");
} else {
struct server *srv = t->be->srv;
while (srv) {
if (strcmp(srv->id, asession_temp->serverid) == 0) {
if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
/* we found the server and it's usable */
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_VALID;
t->flags |= SN_DIRECT | SN_ASSIGNED;
t->srv = srv;
break;
} else {
txn->flags &= ~TX_CK_MASK;
txn->flags |= TX_CK_DOWN;
}
}
srv = srv->next;
}
}
}
/*
* In a GET or HEAD request, check if the requested URI matches the stats uri
* for the current backend, and if an authorization has been passed and is valid.
*
* It is assumed that the request is either a HEAD or GET and that the
* t->be->uri_auth field is valid. An HTTP/401 response may be sent, or
* the stats I/O handler will be registered to start sending data.
*
* Returns 1 if the session's state changes, otherwise 0.
*/
int stats_check_uri_auth(struct session *t, struct proxy *backend)
{
struct http_txn *txn = &t->txn;
struct uri_auth *uri_auth = backend->uri_auth;
struct user_auth *user;
int authenticated, cur_idx;
char *h;
memset(&t->data_ctx.stats, 0, sizeof(t->data_ctx.stats));
/* check URI size */
if (uri_auth->uri_len > txn->req.sl.rq.u_l)
return 0;
h = t->req->data + txn->req.sl.rq.u;
/* the URI is in h */
if (memcmp(h, uri_auth->uri_prefix, uri_auth->uri_len) != 0)
return 0;
h += uri_auth->uri_len;
while (h <= t->req->data + txn->req.sl.rq.u + txn->req.sl.rq.u_l - 3) {
if (memcmp(h, ";up", 3) == 0) {
t->data_ctx.stats.flags |= STAT_HIDE_DOWN;
break;
}
h++;
}
if (uri_auth->refresh) {
h = t->req->data + txn->req.sl.rq.u + uri_auth->uri_len;
while (h <= t->req->data + txn->req.sl.rq.u + txn->req.sl.rq.u_l - 10) {
if (memcmp(h, ";norefresh", 10) == 0) {
t->data_ctx.stats.flags |= STAT_NO_REFRESH;
break;
}
h++;
}
}
h = t->req->data + txn->req.sl.rq.u + uri_auth->uri_len;
while (h <= t->req->data + txn->req.sl.rq.u + txn->req.sl.rq.u_l - 4) {
if (memcmp(h, ";csv", 4) == 0) {
t->data_ctx.stats.flags |= STAT_FMT_CSV;
break;
}
h++;
}
t->data_ctx.stats.flags |= STAT_SHOW_STAT | STAT_SHOW_INFO;
/* we are in front of a interceptable URI. Let's check
* if there's an authentication and if it's valid.
*/
user = uri_auth->users;
if (!user) {
/* no user auth required, it's OK */
authenticated = 1;
} else {
authenticated = 0;
/* a user list is defined, we have to check.
* skip 21 chars for "Authorization: Basic ".
*/
/* FIXME: this should move to an earlier place */
cur_idx = 0;
h = t->req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) {
int len = txn->hdr_idx.v[cur_idx].len;
if (len > 14 &&
!strncasecmp("Authorization:", h, 14)) {
chunk_initlen(&txn->auth_hdr, h, 0, len);
break;
}
h += len + txn->hdr_idx.v[cur_idx].cr + 1;
}
if (txn->auth_hdr.len < 21 ||
memcmp(txn->auth_hdr.str + 14, " Basic ", 7))
user = NULL;
while (user) {
if ((txn->auth_hdr.len == user->user_len + 14 + 7)
&& !memcmp(txn->auth_hdr.str + 14 + 7,
user->user_pwd, user->user_len)) {
authenticated = 1;
break;
}
user = user->next;
}
}
if (!authenticated) {
struct chunk msg;
/* no need to go further */
sprintf(trash, HTTP_401_fmt, uri_auth->auth_realm);
chunk_initlen(&msg, trash, sizeof(trash), strlen(trash));
txn->status = 401;
stream_int_retnclose(t->req->prod, &msg);
t->req->analysers = 0;
if (!(t->flags & SN_ERR_MASK))
t->flags |= SN_ERR_PRXCOND;
if (!(t->flags & SN_FINST_MASK))
t->flags |= SN_FINST_R;
return 1;
}
/* The request is valid, the user is authenticated. Let's start sending
* data.
*/
t->logs.tv_request = now;
t->data_source = DATA_SRC_STATS;
t->data_state = DATA_ST_INIT;
t->task->nice = -32; /* small boost for HTTP statistics */
stream_int_register_handler(t->rep->prod, http_stats_io_handler);
t->rep->prod->private = t;
t->rep->prod->st0 = t->rep->prod->st1 = 0;
return 1;
}
/*
* Capture a bad request or response and archive it in the proxy's structure.
*/
void http_capture_bad_message(struct error_snapshot *es, struct session *s,
struct buffer *buf, struct http_msg *msg,
struct proxy *other_end)
{
es->len = buf->r - (buf->data + msg->som);
memcpy(es->buf, buf->data + msg->som, MIN(es->len, sizeof(es->buf)));
if (msg->err_pos >= 0)
es->pos = msg->err_pos - msg->som;
else
es->pos = buf->lr - (buf->data + msg->som);
es->when = date; // user-visible date
es->sid = s->uniq_id;
es->srv = s->srv;
es->oe = other_end;
es->src = s->cli_addr;
}
/*
* Print a debug line with a header
*/
void debug_hdr(const char *dir, struct session *t, const char *start, const char *end)
{
int len, max;
len = sprintf(trash, "%08x:%s.%s[%04x:%04x]: ", t->uniq_id, t->be->id,
dir, (unsigned short)t->req->prod->fd, (unsigned short)t->req->cons->fd);
max = end - start;
UBOUND(max, sizeof(trash) - len - 1);
len += strlcpy2(trash + len, start, max + 1);
trash[len++] = '\n';
write(1, trash, len);
}
/************************************************************************/
/* The code below is dedicated to ACL parsing and matching */
/************************************************************************/
/* 1. Check on METHOD
* We use the pre-parsed method if it is known, and store its number as an
* integer. If it is unknown, we use the pointer and the length.
*/
static int acl_parse_meth(const char **text, struct acl_pattern *pattern, int *opaque)
{
int len, meth;
len = strlen(*text);
meth = find_http_meth(*text, len);
pattern->val.i = meth;
if (meth == HTTP_METH_OTHER) {
pattern->ptr.str = strdup(*text);
if (!pattern->ptr.str)
return 0;
pattern->len = len;
}
return 1;
}
static int
acl_fetch_meth(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
int meth;
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->req.msg_state != HTTP_MSG_BODY)
return 0;
meth = txn->meth;
test->i = meth;
if (meth == HTTP_METH_OTHER) {
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
/* ensure the indexes are not affected */
return 0;
test->len = txn->req.sl.rq.m_l;
test->ptr = txn->req.sol;
}
test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST;
return 1;
}
static int acl_match_meth(struct acl_test *test, struct acl_pattern *pattern)
{
int icase;
if (test->i != pattern->val.i)
return ACL_PAT_FAIL;
if (test->i != HTTP_METH_OTHER)
return ACL_PAT_PASS;
/* Other method, we must compare the strings */
if (pattern->len != test->len)
return ACL_PAT_FAIL;
icase = pattern->flags & ACL_PAT_F_IGNORE_CASE;
if ((icase && strncasecmp(pattern->ptr.str, test->ptr, test->len) != 0) ||
(!icase && strncmp(pattern->ptr.str, test->ptr, test->len) != 0))
return ACL_PAT_FAIL;
return ACL_PAT_PASS;
}
/* 2. Check on Request/Status Version
* We simply compare strings here.
*/
static int acl_parse_ver(const char **text, struct acl_pattern *pattern, int *opaque)
{
pattern->ptr.str = strdup(*text);
if (!pattern->ptr.str)
return 0;
pattern->len = strlen(*text);
return 1;
}
static int
acl_fetch_rqver(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
char *ptr;
int len;
if (!txn)
return 0;
if (txn->req.msg_state != HTTP_MSG_BODY)
return 0;
len = txn->req.sl.rq.v_l;
ptr = txn->req.sol + txn->req.sl.rq.v - txn->req.som;
while ((len-- > 0) && (*ptr++ != '/'));
if (len <= 0)
return 0;
test->ptr = ptr;
test->len = len;
test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST;
return 1;
}
static int
acl_fetch_stver(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
char *ptr;
int len;
if (!txn)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_BODY)
return 0;
len = txn->rsp.sl.st.v_l;
ptr = txn->rsp.sol;
while ((len-- > 0) && (*ptr++ != '/'));
if (len <= 0)
return 0;
test->ptr = ptr;
test->len = len;
test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST;
return 1;
}
/* 3. Check on Status Code. We manipulate integers here. */
static int
acl_fetch_stcode(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
char *ptr;
int len;
if (!txn)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_BODY)
return 0;
len = txn->rsp.sl.st.c_l;
ptr = txn->rsp.sol + txn->rsp.sl.st.c - txn->rsp.som;
test->i = __strl2ui(ptr, len);
test->flags = ACL_TEST_F_VOL_1ST;
return 1;
}
/* 4. Check on URL/URI. A pointer to the URI is stored. */
static int
acl_fetch_url(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->req.msg_state != HTTP_MSG_BODY)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
/* ensure the indexes are not affected */
return 0;
test->len = txn->req.sl.rq.u_l;
test->ptr = txn->req.sol + txn->req.sl.rq.u;
/* we do not need to set READ_ONLY because the data is in a buffer */
test->flags = ACL_TEST_F_VOL_1ST;
return 1;
}
static int
acl_fetch_url_ip(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->req.msg_state != HTTP_MSG_BODY)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
/* ensure the indexes are not affected */
return 0;
/* Parse HTTP request */
url2sa(txn->req.sol + txn->req.sl.rq.u, txn->req.sl.rq.u_l, &l4->srv_addr);
test->ptr = (void *)&((struct sockaddr_in *)&l4->srv_addr)->sin_addr;
test->i = AF_INET;
/*
* If we are parsing url in frontend space, we prepare backend stage
* to not parse again the same url ! optimization lazyness...
*/
if (px->options & PR_O_HTTP_PROXY)
l4->flags |= SN_ADDR_SET;
test->flags = ACL_TEST_F_READ_ONLY;
return 1;
}
static int
acl_fetch_url_port(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->req.msg_state != HTTP_MSG_BODY)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
/* ensure the indexes are not affected */
return 0;
/* Same optimization as url_ip */
url2sa(txn->req.sol + txn->req.sl.rq.u, txn->req.sl.rq.u_l, &l4->srv_addr);
test->i = ntohs(((struct sockaddr_in *)&l4->srv_addr)->sin_port);
if (px->options & PR_O_HTTP_PROXY)
l4->flags |= SN_ADDR_SET;
test->flags = ACL_TEST_F_READ_ONLY;
return 1;
}
/* 5. Check on HTTP header. A pointer to the beginning of the value is returned.
* This generic function is used by both acl_fetch_chdr() and acl_fetch_shdr().
*/
static int
acl_fetch_hdr(struct proxy *px, struct session *l4, void *l7, char *sol,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
struct hdr_idx *idx = &txn->hdr_idx;
struct hdr_ctx *ctx = (struct hdr_ctx *)test->ctx.a;
if (!txn)
return 0;
if (!(test->flags & ACL_TEST_F_FETCH_MORE))
/* search for header from the beginning */
ctx->idx = 0;
if (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, ctx)) {
test->flags |= ACL_TEST_F_FETCH_MORE;
test->flags |= ACL_TEST_F_VOL_HDR;
test->len = ctx->vlen;
test->ptr = (char *)ctx->line + ctx->val;
return 1;
}
test->flags &= ~ACL_TEST_F_FETCH_MORE;
test->flags |= ACL_TEST_F_VOL_HDR;
return 0;
}
static int
acl_fetch_chdr(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->req.msg_state != HTTP_MSG_BODY)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
/* ensure the indexes are not affected */
return 0;
return acl_fetch_hdr(px, l4, txn, txn->req.sol, expr, test);
}
static int
acl_fetch_shdr(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_BODY)
return 0;
return acl_fetch_hdr(px, l4, txn, txn->rsp.sol, expr, test);
}
/* 6. Check on HTTP header count. The number of occurrences is returned.
* This generic function is used by both acl_fetch_chdr* and acl_fetch_shdr*.
*/
static int
acl_fetch_hdr_cnt(struct proxy *px, struct session *l4, void *l7, char *sol,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
struct hdr_idx *idx = &txn->hdr_idx;
struct hdr_ctx ctx;
int cnt;
if (!txn)
return 0;
ctx.idx = 0;
cnt = 0;
while (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, &ctx))
cnt++;
test->i = cnt;
test->flags = ACL_TEST_F_VOL_HDR;
return 1;
}
static int
acl_fetch_chdr_cnt(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->req.msg_state != HTTP_MSG_BODY)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
/* ensure the indexes are not affected */
return 0;
return acl_fetch_hdr_cnt(px, l4, txn, txn->req.sol, expr, test);
}
static int
acl_fetch_shdr_cnt(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_BODY)
return 0;
return acl_fetch_hdr_cnt(px, l4, txn, txn->rsp.sol, expr, test);
}
/* 7. Check on HTTP header's integer value. The integer value is returned.
* FIXME: the type is 'int', it may not be appropriate for everything.
* This generic function is used by both acl_fetch_chdr* and acl_fetch_shdr*.
*/
static int
acl_fetch_hdr_val(struct proxy *px, struct session *l4, void *l7, char *sol,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
struct hdr_idx *idx = &txn->hdr_idx;
struct hdr_ctx *ctx = (struct hdr_ctx *)test->ctx.a;
if (!txn)
return 0;
if (!(test->flags & ACL_TEST_F_FETCH_MORE))
/* search for header from the beginning */
ctx->idx = 0;
if (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, ctx)) {
test->flags |= ACL_TEST_F_FETCH_MORE;
test->flags |= ACL_TEST_F_VOL_HDR;
test->i = strl2ic((char *)ctx->line + ctx->val, ctx->vlen);
return 1;
}
test->flags &= ~ACL_TEST_F_FETCH_MORE;
test->flags |= ACL_TEST_F_VOL_HDR;
return 0;
}
static int
acl_fetch_chdr_val(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->req.msg_state != HTTP_MSG_BODY)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
/* ensure the indexes are not affected */
return 0;
return acl_fetch_hdr_val(px, l4, txn, txn->req.sol, expr, test);
}
static int
acl_fetch_shdr_val(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_BODY)
return 0;
return acl_fetch_hdr_val(px, l4, txn, txn->rsp.sol, expr, test);
}
/* 7. Check on HTTP header's IPv4 address value. The IPv4 address is returned.
* This generic function is used by both acl_fetch_chdr* and acl_fetch_shdr*.
*/
static int
acl_fetch_hdr_ip(struct proxy *px, struct session *l4, void *l7, char *sol,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
struct hdr_idx *idx = &txn->hdr_idx;
struct hdr_ctx *ctx = (struct hdr_ctx *)test->ctx.a;
if (!txn)
return 0;
if (!(test->flags & ACL_TEST_F_FETCH_MORE))
/* search for header from the beginning */
ctx->idx = 0;
if (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, ctx)) {
test->flags |= ACL_TEST_F_FETCH_MORE;
test->flags |= ACL_TEST_F_VOL_HDR;
/* Same optimization as url_ip */
memset(&l4->srv_addr.sin_addr, 0, sizeof(l4->srv_addr.sin_addr));
url2ip((char *)ctx->line + ctx->val, &l4->srv_addr.sin_addr);
test->ptr = (void *)&l4->srv_addr.sin_addr;
test->i = AF_INET;
return 1;
}
test->flags &= ~ACL_TEST_F_FETCH_MORE;
test->flags |= ACL_TEST_F_VOL_HDR;
return 0;
}
static int
acl_fetch_chdr_ip(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->req.msg_state != HTTP_MSG_BODY)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
/* ensure the indexes are not affected */
return 0;
return acl_fetch_hdr_ip(px, l4, txn, txn->req.sol, expr, test);
}
static int
acl_fetch_shdr_ip(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
if (!txn)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_BODY)
return 0;
return acl_fetch_hdr_ip(px, l4, txn, txn->rsp.sol, expr, test);
}
/* 8. Check on URI PATH. A pointer to the PATH is stored. The path starts at
* the first '/' after the possible hostname, and ends before the possible '?'.
*/
static int
acl_fetch_path(struct proxy *px, struct session *l4, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct http_txn *txn = l7;
char *ptr, *end;
if (!txn)
return 0;
if (txn->req.msg_state != HTTP_MSG_BODY)
return 0;
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
/* ensure the indexes are not affected */
return 0;
end = txn->req.sol + txn->req.sl.rq.u + txn->req.sl.rq.u_l;
ptr = http_get_path(txn);
if (!ptr)
return 0;
/* OK, we got the '/' ! */
test->ptr = ptr;
while (ptr < end && *ptr != '?')
ptr++;
test->len = ptr - test->ptr;
/* we do not need to set READ_ONLY because the data is in a buffer */
test->flags = ACL_TEST_F_VOL_1ST;
return 1;
}
static int
acl_fetch_proto_http(struct proxy *px, struct session *s, void *l7, int dir,
struct acl_expr *expr, struct acl_test *test)
{
struct buffer *req = s->req;
struct http_txn *txn = &s->txn;
struct http_msg *msg = &txn->req;
/* Note: hdr_idx.v cannot be NULL in this ACL because the ACL is tagged
* as a layer7 ACL, which involves automatic allocation of hdr_idx.
*/
if (!s || !req)
return 0;
if (unlikely(msg->msg_state == HTTP_MSG_BODY)) {
/* Already decoded as OK */
test->flags |= ACL_TEST_F_SET_RES_PASS;
return 1;
}
/* Try to decode HTTP request */
if (likely(req->lr < req->r))
http_msg_analyzer(req, msg, &txn->hdr_idx);
if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
if ((msg->msg_state == HTTP_MSG_ERROR) || (req->flags & BF_FULL)) {
test->flags |= ACL_TEST_F_SET_RES_FAIL;
return 1;
}
/* wait for final state */
test->flags |= ACL_TEST_F_MAY_CHANGE;
return 0;
}
/* OK we got a valid HTTP request. We have some minor preparation to
* perform so that further checks can rely on HTTP tests.
*/
msg->sol = req->data + msg->som;
txn->meth = find_http_meth(&req->data[msg->som], msg->sl.rq.m_l);
if (txn->meth == HTTP_METH_GET || txn->meth == HTTP_METH_HEAD)
s->flags |= SN_REDIRECTABLE;
if (unlikely(msg->sl.rq.v_l == 0) && !http_upgrade_v09_to_v10(req, msg, txn)) {
test->flags |= ACL_TEST_F_SET_RES_FAIL;
return 1;
}
test->flags |= ACL_TEST_F_SET_RES_PASS;
return 1;
}
/************************************************************************/
/* All supported keywords must be declared here. */
/************************************************************************/
/* Note: must not be declared <const> as its list will be overwritten */
static struct acl_kw_list acl_kws = {{ },{
{ "req_proto_http", acl_parse_nothing, acl_fetch_proto_http, acl_match_nothing, ACL_USE_L7REQ_PERMANENT },
{ "method", acl_parse_meth, acl_fetch_meth, acl_match_meth, ACL_USE_L7REQ_PERMANENT },
{ "req_ver", acl_parse_ver, acl_fetch_rqver, acl_match_str, ACL_USE_L7REQ_VOLATILE },
{ "resp_ver", acl_parse_ver, acl_fetch_stver, acl_match_str, ACL_USE_L7RTR_VOLATILE },
{ "status", acl_parse_int, acl_fetch_stcode, acl_match_int, ACL_USE_L7RTR_PERMANENT },
{ "url", acl_parse_str, acl_fetch_url, acl_match_str, ACL_USE_L7REQ_VOLATILE },
{ "url_beg", acl_parse_str, acl_fetch_url, acl_match_beg, ACL_USE_L7REQ_VOLATILE },
{ "url_end", acl_parse_str, acl_fetch_url, acl_match_end, ACL_USE_L7REQ_VOLATILE },
{ "url_sub", acl_parse_str, acl_fetch_url, acl_match_sub, ACL_USE_L7REQ_VOLATILE },
{ "url_dir", acl_parse_str, acl_fetch_url, acl_match_dir, ACL_USE_L7REQ_VOLATILE },
{ "url_dom", acl_parse_str, acl_fetch_url, acl_match_dom, ACL_USE_L7REQ_VOLATILE },
{ "url_reg", acl_parse_reg, acl_fetch_url, acl_match_reg, ACL_USE_L7REQ_VOLATILE },
{ "url_ip", acl_parse_ip, acl_fetch_url_ip, acl_match_ip, ACL_USE_L7REQ_VOLATILE },
{ "url_port", acl_parse_int, acl_fetch_url_port, acl_match_int, ACL_USE_L7REQ_VOLATILE },
/* note: we should set hdr* to use ACL_USE_HDR_VOLATILE, and chdr* to use L7REQ_VOLATILE */
{ "hdr", acl_parse_str, acl_fetch_chdr, acl_match_str, ACL_USE_L7REQ_VOLATILE },
{ "hdr_reg", acl_parse_reg, acl_fetch_chdr, acl_match_reg, ACL_USE_L7REQ_VOLATILE },
{ "hdr_beg", acl_parse_str, acl_fetch_chdr, acl_match_beg, ACL_USE_L7REQ_VOLATILE },
{ "hdr_end", acl_parse_str, acl_fetch_chdr, acl_match_end, ACL_USE_L7REQ_VOLATILE },
{ "hdr_sub", acl_parse_str, acl_fetch_chdr, acl_match_sub, ACL_USE_L7REQ_VOLATILE },
{ "hdr_dir", acl_parse_str, acl_fetch_chdr, acl_match_dir, ACL_USE_L7REQ_VOLATILE },
{ "hdr_dom", acl_parse_str, acl_fetch_chdr, acl_match_dom, ACL_USE_L7REQ_VOLATILE },
{ "hdr_cnt", acl_parse_int, acl_fetch_chdr_cnt,acl_match_int, ACL_USE_L7REQ_VOLATILE },
{ "hdr_val", acl_parse_int, acl_fetch_chdr_val,acl_match_int, ACL_USE_L7REQ_VOLATILE },
{ "hdr_ip", acl_parse_ip, acl_fetch_chdr_ip, acl_match_ip, ACL_USE_L7REQ_VOLATILE },
{ "shdr", acl_parse_str, acl_fetch_shdr, acl_match_str, ACL_USE_L7RTR_VOLATILE },
{ "shdr_reg", acl_parse_reg, acl_fetch_shdr, acl_match_reg, ACL_USE_L7RTR_VOLATILE },
{ "shdr_beg", acl_parse_str, acl_fetch_shdr, acl_match_beg, ACL_USE_L7RTR_VOLATILE },
{ "shdr_end", acl_parse_str, acl_fetch_shdr, acl_match_end, ACL_USE_L7RTR_VOLATILE },
{ "shdr_sub", acl_parse_str, acl_fetch_shdr, acl_match_sub, ACL_USE_L7RTR_VOLATILE },
{ "shdr_dir", acl_parse_str, acl_fetch_shdr, acl_match_dir, ACL_USE_L7RTR_VOLATILE },
{ "shdr_dom", acl_parse_str, acl_fetch_shdr, acl_match_dom, ACL_USE_L7RTR_VOLATILE },
{ "shdr_cnt", acl_parse_int, acl_fetch_shdr_cnt,acl_match_int, ACL_USE_L7RTR_VOLATILE },
{ "shdr_val", acl_parse_int, acl_fetch_shdr_val,acl_match_int, ACL_USE_L7RTR_VOLATILE },
{ "shdr_ip", acl_parse_ip, acl_fetch_shdr_ip, acl_match_ip, ACL_USE_L7RTR_VOLATILE },
{ "path", acl_parse_str, acl_fetch_path, acl_match_str, ACL_USE_L7REQ_VOLATILE },
{ "path_reg", acl_parse_reg, acl_fetch_path, acl_match_reg, ACL_USE_L7REQ_VOLATILE },
{ "path_beg", acl_parse_str, acl_fetch_path, acl_match_beg, ACL_USE_L7REQ_VOLATILE },
{ "path_end", acl_parse_str, acl_fetch_path, acl_match_end, ACL_USE_L7REQ_VOLATILE },
{ "path_sub", acl_parse_str, acl_fetch_path, acl_match_sub, ACL_USE_L7REQ_VOLATILE },
{ "path_dir", acl_parse_str, acl_fetch_path, acl_match_dir, ACL_USE_L7REQ_VOLATILE },
{ "path_dom", acl_parse_str, acl_fetch_path, acl_match_dom, ACL_USE_L7REQ_VOLATILE },
{ NULL, NULL, NULL, NULL },
#if 0
{ "line", acl_parse_str, acl_fetch_line, acl_match_str },
{ "line_reg", acl_parse_reg, acl_fetch_line, acl_match_reg },
{ "line_beg", acl_parse_str, acl_fetch_line, acl_match_beg },
{ "line_end", acl_parse_str, acl_fetch_line, acl_match_end },
{ "line_sub", acl_parse_str, acl_fetch_line, acl_match_sub },
{ "line_dir", acl_parse_str, acl_fetch_line, acl_match_dir },
{ "line_dom", acl_parse_str, acl_fetch_line, acl_match_dom },
{ "cook", acl_parse_str, acl_fetch_cook, acl_match_str },
{ "cook_reg", acl_parse_reg, acl_fetch_cook, acl_match_reg },
{ "cook_beg", acl_parse_str, acl_fetch_cook, acl_match_beg },
{ "cook_end", acl_parse_str, acl_fetch_cook, acl_match_end },
{ "cook_sub", acl_parse_str, acl_fetch_cook, acl_match_sub },
{ "cook_dir", acl_parse_str, acl_fetch_cook, acl_match_dir },
{ "cook_dom", acl_parse_str, acl_fetch_cook, acl_match_dom },
{ "cook_pst", acl_parse_none, acl_fetch_cook, acl_match_pst },
{ "auth_user", acl_parse_str, acl_fetch_user, acl_match_str },
{ "auth_regex", acl_parse_reg, acl_fetch_user, acl_match_reg },
{ "auth_clear", acl_parse_str, acl_fetch_auth, acl_match_str },
{ "auth_md5", acl_parse_str, acl_fetch_auth, acl_match_md5 },
{ NULL, NULL, NULL, NULL },
#endif
}};
__attribute__((constructor))
static void __http_protocol_init(void)
{
acl_register_keywords(&acl_kws);
}
/*
* Local variables:
* c-indent-level: 8
* c-basic-offset: 8
* End:
*/