src/proto_http.c - haproxy - Gitiles

 /*
  * HTTP protocol analyzer
  *
  * Copyright 2000-2007 Willy Tarreau <w@1wt.eu>
  *
  * This program is free software; you can redistribute it and/or
  * modify it under the terms of the GNU General Public License
  * as published by the Free Software Foundation; either version
  * 2 of the License, or (at your option) any later version.
  *
  */

 #include <ctype.h>
 #include <errno.h>
 #include <fcntl.h>
 #include <stdio.h>
 #include <stdlib.h>
 #include <string.h>
 #include <syslog.h>
 #include <time.h>

 #include <sys/socket.h>
 #include <sys/stat.h>
 #include <sys/types.h>

 #include <common/appsession.h>
 #include <common/compat.h>
 #include <common/config.h>
 #include <common/debug.h>
 #include <common/memory.h>
 #include <common/mini-clist.h>
 #include <common/standard.h>
 #include <common/time.h>
 #include <common/uri_auth.h>
 #include <common/version.h>

 #include <types/capture.h>
 #include <types/client.h>
 #include <types/global.h>
 #include <types/httperr.h>
 #include <types/polling.h>
 #include <types/proxy.h>
 #include <types/server.h>

 #include <proto/backend.h>
 #include <proto/buffers.h>
 #include <proto/fd.h>
 #include <proto/log.h>
 #include <proto/hdr_idx.h>
 #include <proto/proto_http.h>
 #include <proto/queue.h>
 #include <proto/session.h>
 #include <proto/task.h>

 #ifdef CONFIG_HAP_TCPSPLICE
 #include <libtcpsplice.h>
 #endif

 #define DEBUG_PARSE_NO_SPEEDUP
 #undef DEBUG_PARSE_NO_SPEEDUP

 /* This is used to perform a quick jump as an alternative to a break/continue
  * instruction. The first argument is the label for normal operation, and the
  * second one is the break/continue instruction in the no_speedup mode.
  */

 #ifdef DEBUG_PARSE_NO_SPEEDUP
 #define QUICK_JUMP(x,y) y
 #else
 #define QUICK_JUMP(x,y) goto x
 #endif

 /* This is used by remote monitoring */
 const char HTTP_200[] =
 	"HTTP/1.0 200 OK\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Content-Type: text/html\r\n"
 	"\r\n"
 	"<html><body><h1>200 OK</h1>\nHAProxy: service ready.\n</body></html>\n";

 const struct chunk http_200_chunk = {
 	.str = (char *)&HTTP_200,
 	.len = sizeof(HTTP_200)-1
 };

 const char *HTTP_302 =
 	"HTTP/1.0 302 Found\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Location: "; /* not terminated since it will be concatenated with the URL */

 /* same as 302 except that the browser MUST retry with the GET method */
 const char *HTTP_303 =
 	"HTTP/1.0 303 See Other\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Location: "; /* not terminated since it will be concatenated with the URL */

 /* Warning: this one is an sprintf() fmt string, with <realm> as its only argument */
 const char *HTTP_401_fmt =
 	"HTTP/1.0 401 Unauthorized\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Content-Type: text/html\r\n"
 	"WWW-Authenticate: Basic realm=\"%s\"\r\n"
 	"\r\n"
 	"<html><body><h1>401 Unauthorized</h1>\nYou need a valid user and password to access this content.\n</body></html>\n";


 const int http_err_codes[HTTP_ERR_SIZE] = {
 	[HTTP_ERR_400] = 400,
 	[HTTP_ERR_403] = 403,
 	[HTTP_ERR_408] = 408,
 	[HTTP_ERR_500] = 500,
 	[HTTP_ERR_502] = 502,
 	[HTTP_ERR_503] = 503,
 	[HTTP_ERR_504] = 504,
 };

 static const char *http_err_msgs[HTTP_ERR_SIZE] = {
 	[HTTP_ERR_400] =
 	"HTTP/1.0 400 Bad request\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Content-Type: text/html\r\n"
 	"\r\n"
 	"<html><body><h1>400 Bad request</h1>\nYour browser sent an invalid request.\n</body></html>\n",

 	[HTTP_ERR_403] =
 	"HTTP/1.0 403 Forbidden\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Content-Type: text/html\r\n"
 	"\r\n"
 	"<html><body><h1>403 Forbidden</h1>\nRequest forbidden by administrative rules.\n</body></html>\n",

 	[HTTP_ERR_408] =
 	"HTTP/1.0 408 Request Time-out\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Content-Type: text/html\r\n"
 	"\r\n"
 	"<html><body><h1>408 Request Time-out</h1>\nYour browser didn't send a complete request in time.\n</body></html>\n",

 	[HTTP_ERR_500] =
 	"HTTP/1.0 500 Server Error\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Content-Type: text/html\r\n"
 	"\r\n"
 	"<html><body><h1>500 Server Error</h1>\nAn internal server error occured.\n</body></html>\n",

 	[HTTP_ERR_502] =
 	"HTTP/1.0 502 Bad Gateway\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Content-Type: text/html\r\n"
 	"\r\n"
 	"<html><body><h1>502 Bad Gateway</h1>\nThe server returned an invalid or incomplete response.\n</body></html>\n",

 	[HTTP_ERR_503] =
 	"HTTP/1.0 503 Service Unavailable\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Content-Type: text/html\r\n"
 	"\r\n"
 	"<html><body><h1>503 Service Unavailable</h1>\nNo server is available to handle this request.\n</body></html>\n",

 	[HTTP_ERR_504] =
 	"HTTP/1.0 504 Gateway Time-out\r\n"
 	"Cache-Control: no-cache\r\n"
 	"Connection: close\r\n"
 	"Content-Type: text/html\r\n"
 	"\r\n"
 	"<html><body><h1>504 Gateway Time-out</h1>\nThe server didn't respond in time.\n</body></html>\n",

 };

 /* We must put the messages here since GCC cannot initialize consts depending
  * on strlen().
  */
 struct chunk http_err_chunks[HTTP_ERR_SIZE];

 #define FD_SETS_ARE_BITFIELDS
 #ifdef FD_SETS_ARE_BITFIELDS
 /*
  * This map is used with all the FD_* macros to check whether a particular bit
  * is set or not. Each bit represents an ACSII code. FD_SET() sets those bytes
  * which should be encoded. When FD_ISSET() returns non-zero, it means that the
  * byte should be encoded. Be careful to always pass bytes from 0 to 255
  * exclusively to the macros.
  */
 fd_set hdr_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))];
 fd_set url_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))];

 #else
 #error "Check if your OS uses bitfields for fd_sets"
 #endif

 void init_proto_http()
 {
 	int i;
 	char *tmp;
 	int msg;

 	for (msg = 0; msg < HTTP_ERR_SIZE; msg++) {
 		if (!http_err_msgs[msg]) {
 			Alert("Internal error: no message defined for HTTP return code %d. Aborting.\n", msg);
 			abort();
 		}

 		http_err_chunks[msg].str = (char *)http_err_msgs[msg];
 		http_err_chunks[msg].len = strlen(http_err_msgs[msg]);
 	}

 	/* initialize the log header encoding map : '{|}"#' should be encoded with
 	 * '#' as prefix, as well as non-printable characters ( <32 or >= 127 ).
 	 * URL encoding only requires '"', '#' to be encoded as well as non-
 	 * printable characters above.
 	 */
 	memset(hdr_encode_map, 0, sizeof(hdr_encode_map));
 	memset(url_encode_map, 0, sizeof(url_encode_map));
 	for (i = 0; i < 32; i++) {
 		FD_SET(i, hdr_encode_map);
 		FD_SET(i, url_encode_map);
 	}
 	for (i = 127; i < 256; i++) {
 		FD_SET(i, hdr_encode_map);
 		FD_SET(i, url_encode_map);
 	}

 	tmp = "\"#{|}";
 	while (*tmp) {
 		FD_SET(*tmp, hdr_encode_map);
 		tmp++;
 	}

 	tmp = "\"#";
 	while (*tmp) {
 		FD_SET(*tmp, url_encode_map);
 		tmp++;
 	}
 }

 /*
  * We have 26 list of methods (1 per first letter), each of which can have
  * up to 3 entries (2 valid, 1 null).
  */
 struct http_method_desc {
 	http_meth_t meth;
 	int len;
 	const char text[8];
 };

 const struct http_method_desc http_methods[26][3] = {
 	['C' - 'A'] = {
 		[0] = {	.meth = HTTP_METH_CONNECT , .len=7, .text="CONNECT" },
 	},
 	['D' - 'A'] = {
 		[0] = {	.meth = HTTP_METH_DELETE  , .len=6, .text="DELETE"  },
 	},
 	['G' - 'A'] = {
 		[0] = {	.meth = HTTP_METH_GET     , .len=3, .text="GET"     },
 	},
 	['H' - 'A'] = {
 		[0] = {	.meth = HTTP_METH_HEAD    , .len=4, .text="HEAD"    },
 	},
 	['P' - 'A'] = {
 		[0] = {	.meth = HTTP_METH_POST    , .len=4, .text="POST"    },
 		[1] = {	.meth = HTTP_METH_PUT     , .len=3, .text="PUT"     },
 	},
 	['T' - 'A'] = {
 		[0] = {	.meth = HTTP_METH_TRACE   , .len=5, .text="TRACE"   },
 	},
 	/* rest is empty like this :
 	 *      [1] = {	.meth = HTTP_METH_NONE    , .len=0, .text=""        },
 	 */
 };

 /* It is about twice as fast on recent architectures to lookup a byte in a
  * table than two perform a boolean AND or OR between two tests. Refer to
  * RFC2616 for those chars.
  */

 const char http_is_spht[256] = {
 	[' '] = 1, ['\t'] = 1,
 };

 const char http_is_crlf[256] = {
 	['\r'] = 1, ['\n'] = 1,
 };

 const char http_is_lws[256] = {
 	[' '] = 1, ['\t'] = 1,
 	['\r'] = 1, ['\n'] = 1,
 };

 const char http_is_sep[256] = {
 	['('] = 1, [')']  = 1, ['<']  = 1, ['>'] = 1,
 	['@'] = 1, [',']  = 1, [';']  = 1, [':'] = 1,
 	['"'] = 1, ['/']  = 1, ['[']  = 1, [']'] = 1,
 	['{'] = 1, ['}']  = 1, ['?']  = 1, ['='] = 1,
 	[' '] = 1, ['\t'] = 1, ['\\'] = 1,
 };

 const char http_is_ctl[256] = {
 	[0 ... 31] = 1,
 	[127] = 1,
 };

 /*
  * A token is any ASCII char that is neither a separator nor a CTL char.
  * Do not overwrite values in assignment since gcc-2.95 will not handle
  * them correctly. Instead, define every non-CTL char's status.
  */
 const char http_is_token[256] = {
 	[' '] = 0, ['!'] = 1, ['"'] = 0, ['#'] = 1,
 	['$'] = 1, ['%'] = 1, ['&'] = 1, ['\''] = 1,
 	['('] = 0, [')'] = 0, ['*'] = 1, ['+'] = 1,
 	[','] = 0, ['-'] = 1, ['.'] = 1, ['/'] = 0,
 	['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1,
 	['4'] = 1, ['5'] = 1, ['6'] = 1, ['7'] = 1,
 	['8'] = 1, ['9'] = 1, [':'] = 0, [';'] = 0,
 	['<'] = 0, ['='] = 0, ['>'] = 0, ['?'] = 0,
 	['@'] = 0, ['A'] = 1, ['B'] = 1, ['C'] = 1,
 	['D'] = 1, ['E'] = 1, ['F'] = 1, ['G'] = 1,
 	['H'] = 1, ['I'] = 1, ['J'] = 1, ['K'] = 1,
 	['L'] = 1, ['M'] = 1, ['N'] = 1, ['O'] = 1,
 	['P'] = 1, ['Q'] = 1, ['R'] = 1, ['S'] = 1,
 	['T'] = 1, ['U'] = 1, ['V'] = 1, ['W'] = 1,
 	['X'] = 1, ['Y'] = 1, ['Z'] = 1, ['['] = 0,
 	['\\'] = 0, [']'] = 0, ['^'] = 1, ['_'] = 1,
 	['`'] = 1, ['a'] = 1, ['b'] = 1, ['c'] = 1,
 	['d'] = 1, ['e'] = 1, ['f'] = 1, ['g'] = 1,
 	['h'] = 1, ['i'] = 1, ['j'] = 1, ['k'] = 1,
 	['l'] = 1, ['m'] = 1, ['n'] = 1, ['o'] = 1,
 	['p'] = 1, ['q'] = 1, ['r'] = 1, ['s'] = 1,
 	['t'] = 1, ['u'] = 1, ['v'] = 1, ['w'] = 1,
 	['x'] = 1, ['y'] = 1, ['z'] = 1, ['{'] = 0,
 	['|'] = 1, ['}'] = 0, ['~'] = 1,
 };


 /*
  * An http ver_token is any ASCII which can be found in an HTTP version,
  * which includes 'H', 'T', 'P', '/', '.' and any digit.
  */
 const char http_is_ver_token[256] = {
 	['.'] = 1, ['/'] = 1,
 	['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1, ['4'] = 1,
 	['5'] = 1, ['6'] = 1, ['7'] = 1, ['8'] = 1, ['9'] = 1,
 	['H'] = 1, ['P'] = 1, ['T'] = 1,
 };


 #ifdef DEBUG_FULL
 static char *cli_stnames[5] = {"HDR", "DAT", "SHR", "SHW", "CLS" };
 static char *srv_stnames[7] = {"IDL", "CON", "HDR", "DAT", "SHR", "SHW", "CLS" };
 #endif

 static void http_sess_log(struct session *s);

 /*
  * Adds a header and its CRLF at the tail of buffer <b>, just before the last
  * CRLF. Text length is measured first, so it cannot be NULL.
  * The header is also automatically added to the index <hdr_idx>, and the end
  * of headers is automatically adjusted. The number of bytes added is returned
  * on success, otherwise <0 is returned indicating an error.
  */
 int http_header_add_tail(struct buffer *b, struct http_msg *msg,
 			 struct hdr_idx *hdr_idx, const char *text)
 {
 	int bytes, len;

 	len = strlen(text);
 	bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len);
 	if (!bytes)
 		return -1;
 	msg->eoh += bytes;
 	return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail);
 }

 /*
  * Adds a header and its CRLF at the tail of buffer <b>, just before the last
  * CRLF. <len> bytes are copied, not counting the CRLF. If <text> is NULL, then
  * the buffer is only opened and the space reserved, but nothing is copied.
  * The header is also automatically added to the index <hdr_idx>, and the end
  * of headers is automatically adjusted. The number of bytes added is returned
  * on success, otherwise <0 is returned indicating an error.
  */
 int http_header_add_tail2(struct buffer *b, struct http_msg *msg,
 			 struct hdr_idx *hdr_idx, const char *text, int len)
 {
 	int bytes;

 	bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len);
 	if (!bytes)
 		return -1;
 	msg->eoh += bytes;
 	return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail);
 }

 /*
  * Checks if <hdr> is exactly <name> for <len> chars, and ends with a colon.
  * If so, returns the position of the first non-space character relative to
  * <hdr>, or <end>-<hdr> if not found before. If no value is found, it tries
  * to return a pointer to the place after the first space. Returns 0 if the
  * header name does not match. Checks are case-insensitive.
  */
 int http_header_match2(const char *hdr, const char *end,
 		       const char *name, int len)
 {
 	const char *val;

 	if (hdr + len >= end)
 		return 0;
 	if (hdr[len] != ':')
 		return 0;
 	if (strncasecmp(hdr, name, len) != 0)
 		return 0;
 	val = hdr + len + 1;
 	while (val < end && HTTP_IS_SPHT(*val))
 		val++;
 	if ((val >= end) && (len + 2 <= end - hdr))
 		return len + 2; /* we may replace starting from second space */
 	return val - hdr;
 }

 /*
  * returns a message to the client ; the connection is shut down for read,
  * and the request is cleared so that no server connection can be initiated.
  * The client must be in a valid state for this (HEADER, DATA ...).
  * Nothing is performed on the server side. The message is contained in a
  * "chunk". If it is null, then an empty message is used.
  * The reply buffer doesn't need to be empty before this.
  */
 void client_retnclose(struct session *s, const struct chunk *msg)
 {
 	MY_FD_CLR(s->cli_fd, StaticReadEvent);
 	MY_FD_SET(s->cli_fd, StaticWriteEvent);
 	tv_eternity(&s->req->rex);
 	if (s->fe->clitimeout)
 		tv_delayfrom(&s->rep->wex, &now, s->fe->clitimeout);
 	else
 		tv_eternity(&s->rep->wex);
 	shutdown(s->cli_fd, SHUT_RD);
 	s->cli_state = CL_STSHUTR;
 	buffer_flush(s->rep);
 	if (msg->len)
 		buffer_write(s->rep, msg->str, msg->len);
 	s->req->l = 0;
 }


 /*
  * returns a message into the rep buffer, and flushes the req buffer.
  * The reply buffer doesn't need to be empty before this. The message
  * is contained in a "chunk". If it is null, then an empty message is
  * used.
  */
 void client_return(struct session *s, const struct chunk *msg)
 {
 	buffer_flush(s->rep);
 	if (msg->len)
 		buffer_write(s->rep, msg->str, msg->len);
 	s->req->l = 0;
 }


 /* This function turns the server state into the SV_STCLOSE, and sets
  * indicators accordingly. Note that if <status> is 0, or if the message
  * pointer is NULL, then no message is returned.
  */
 void srv_close_with_err(struct session *t, int err, int finst,
 			int status, const struct chunk *msg)
 {
 	t->srv_state = SV_STCLOSE;
 	if (status > 0 && msg) {
 		t->txn.status = status;
 		if (t->fe->mode == PR_MODE_HTTP)
 			client_return(t, msg);
 	}
 	if (!(t->flags & SN_ERR_MASK))
 		t->flags |= err;
 	if (!(t->flags & SN_FINST_MASK))
 		t->flags |= finst;
 }

 /* This function returns the appropriate error location for the given session
  * and message.
  */

 struct chunk *error_message(struct session *s, int msgnum)
 {
 	if (s->be->errmsg[msgnum].str)
 		return &s->be->errmsg[msgnum];
 	else if (s->fe->errmsg[msgnum].str)
 		return &s->fe->errmsg[msgnum];
 	else
 		return &http_err_chunks[msgnum];
 }

 /*
  * returns HTTP_METH_NONE if there is nothing valid to read (empty or non-text
  * string), HTTP_METH_OTHER for unknown methods, or the identified method.
  */
 static http_meth_t find_http_meth(const char *str, const int len)
 {
 	unsigned char m;
 	const struct http_method_desc *h;

 	m = ((unsigned)*str - 'A');

 	if (m < 26) {
 		for (h = http_methods[m]; h->len > 0; h++) {
 			if (unlikely(h->len != len))
 				continue;
 			if (likely(memcmp(str, h->text, h->len) == 0))
 				return h->meth;
 		};
 		return HTTP_METH_OTHER;
 	}
 	return HTTP_METH_NONE;

 }


 /* Processes the client and server jobs of a session task, then
  * puts it back to the wait queue in a clean state, or
  * cleans up its resources if it must be deleted. Returns
  * the time the task accepts to wait, or TIME_ETERNITY for
  * infinity.
  */
 int process_session(struct task *t)
 {
 	struct session *s = t->context;
 	int fsm_resync = 0;

 	do {
 		fsm_resync = 0;
 		//fprintf(stderr,"before_cli:cli=%d, srv=%d\n", s->cli_state, s->srv_state);
 		fsm_resync |= process_cli(s);
 		//fprintf(stderr,"cli/srv:cli=%d, srv=%d\n", s->cli_state, s->srv_state);
 		fsm_resync |= process_srv(s);
 		//fprintf(stderr,"after_srv:cli=%d, srv=%d\n", s->cli_state, s->srv_state);
 	} while (fsm_resync);

 	if (s->cli_state != CL_STCLOSE || s->srv_state != SV_STCLOSE) {
 		struct timeval min1, min2;
 		s->req->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE;
 		s->rep->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE;

 		tv_min(&min1, &s->req->rex, &s->req->wex);
 		tv_min(&min2, &s->rep->rex, &s->rep->wex);
 		tv_min(&min1, &min1, &s->req->cex);
 		tv_min(&t->expire, &min1, &min2);

 		/* restore t to its place in the task list */
 		task_queue(t);

 #ifdef DEBUG_FULL
 		/* DEBUG code : this should never ever happen, otherwise it indicates
 		 * that a task still has something to do and will provoke a quick loop.
 		 */
 		if (tv_remain2(&now, &t->expire) <= 0)
 			exit(100);
 #endif

 		return tv_remain2(&now, &t->expire); /* nothing more to do */
 	}

 	s->fe->feconn--;
 	if (s->flags & SN_BE_ASSIGNED)
 		s->be->beconn--;
 	actconn--;

 	if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
 		int len;
 		len = sprintf(trash, "%08x:%s.closed[%04x:%04x]\n",
 			      s->uniq_id, s->be->id,
 			      (unsigned short)s->cli_fd, (unsigned short)s->srv_fd);
 		write(1, trash, len);
 	}

 	s->logs.t_close = tv_diff(&s->logs.tv_accept, &now);
 	if (s->req != NULL)
 		s->logs.bytes_in = s->req->total;
 	if (s->rep != NULL)
 		s->logs.bytes_out = s->rep->total;

 	s->fe->bytes_in  += s->logs.bytes_in;
 	s->fe->bytes_out += s->logs.bytes_out;
 	if (s->be != s->fe) {
 		s->be->bytes_in  += s->logs.bytes_in;
 		s->be->bytes_out += s->logs.bytes_out;
 	}
 	if (s->srv) {
 		s->srv->bytes_in  += s->logs.bytes_in;
 		s->srv->bytes_out += s->logs.bytes_out;
 	}

 	/* let's do a final log if we need it */
 	if (s->logs.logwait &&
 	    !(s->flags & SN_MONITOR) &&
 	    (!(s->fe->options & PR_O_NULLNOLOG) || s->req->total)) {
 		if (s->fe->to_log & LW_REQ)
 			http_sess_log(s);
 		else
 			tcp_sess_log(s);
 	}

 	/* the task MUST not be in the run queue anymore */
 	task_delete(t);
 	session_free(s);
 	task_free(t);
 	return TIME_ETERNITY; /* rest in peace for eternity */
 }


 extern const char sess_term_cond[8];
 extern const char sess_fin_state[8];
 extern const char *monthname[12];
 const char sess_cookie[4]     = "NIDV";		/* No cookie, Invalid cookie, cookie for a Down server, Valid cookie */
 const char sess_set_cookie[8] = "N1I3PD5R";	/* No set-cookie, unknown, Set-Cookie Inserted, unknown,
 					    	   Set-cookie seen and left unchanged (passive), Set-cookie Deleted,
 						   unknown, Set-cookie Rewritten */
 void **pool_requri = NULL;

 /*
  * send a log for the session when we have enough info about it.
  * Will not log if the frontend has no log defined.
  */
 static void http_sess_log(struct session *s)
 {
 	char pn[INET6_ADDRSTRLEN + strlen(":65535")];
 	struct proxy *fe = s->fe;
 	struct proxy *be = s->be;
 	struct proxy *prx_log;
 	struct http_txn *txn = &s->txn;
 	int tolog;
 	char *uri, *h;
 	char *svid;
 	struct tm *tm;
 	static char tmpline[MAX_SYSLOG_LEN];
 	int hdr;

 	if (fe->logfac1 < 0 && fe->logfac2 < 0)
 		return;
 	prx_log = fe;

 	if (s->cli_addr.ss_family == AF_INET)
 		inet_ntop(AF_INET,
 			  (const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr,
 			  pn, sizeof(pn));
 	else
 		inet_ntop(AF_INET6,
 			  (const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr,
 			  pn, sizeof(pn));

 	tm = localtime((time_t *)&s->logs.tv_accept.tv_sec);


 	/* FIXME: let's limit ourselves to frontend logging for now. */
 	tolog = fe->to_log;

 	h = tmpline;
 	if (fe->to_log & LW_REQHDR &&
 	    txn->req.cap &&
 	    (h < tmpline + sizeof(tmpline) - 10)) {
 		*(h++) = ' ';
 		*(h++) = '{';
 		for (hdr = 0; hdr < fe->nb_req_cap; hdr++) {
 			if (hdr)
 				*(h++) = '|';
 			if (txn->req.cap[hdr] != NULL)
 				h = encode_string(h, tmpline + sizeof(tmpline) - 7,
 						  '#', hdr_encode_map, txn->req.cap[hdr]);
 		}
 		*(h++) = '}';
 	}

 	if (fe->to_log & LW_RSPHDR &&
 	    txn->rsp.cap &&
 	    (h < tmpline + sizeof(tmpline) - 7)) {
 		*(h++) = ' ';
 		*(h++) = '{';
 		for (hdr = 0; hdr < fe->nb_rsp_cap; hdr++) {
 			if (hdr)
 				*(h++) = '|';
 			if (txn->rsp.cap[hdr] != NULL)
 				h = encode_string(h, tmpline + sizeof(tmpline) - 4,
 						  '#', hdr_encode_map, txn->rsp.cap[hdr]);
 		}
 		*(h++) = '}';
 	}

 	if (h < tmpline + sizeof(tmpline) - 4) {
 		*(h++) = ' ';
 		*(h++) = '"';
 		uri = txn->uri ? txn->uri : "<BADREQ>";
 		h = encode_string(h, tmpline + sizeof(tmpline) - 1,
 				  '#', url_encode_map, uri);
 		*(h++) = '"';
 	}
 	*h = '\0';

 	svid = (tolog & LW_SVID) ?
 		(s->data_source != DATA_SRC_STATS) ?
 		(s->srv != NULL) ? s->srv->id : "<NOSRV>" : "<STATS>" : "-";

 	send_log(prx_log, LOG_INFO,
 		 "%s:%d [%02d/%s/%04d:%02d:%02d:%02d.%03d]"
 		 " %s %s/%s %d/%d/%d/%d/%s%d %d %s%lld"
 		 " %s %s %c%c%c%c %d/%d/%d/%d %d/%d%s\n",
 		 pn,
 		 (s->cli_addr.ss_family == AF_INET) ?
 		 ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) :
 		 ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port),
 		 tm->tm_mday, monthname[tm->tm_mon], tm->tm_year+1900,
 		 tm->tm_hour, tm->tm_min, tm->tm_sec, s->logs.tv_accept.tv_usec/1000,
 		 fe->id, be->id, svid,
 		 s->logs.t_request,
 		 (s->logs.t_queue >= 0) ? s->logs.t_queue - s->logs.t_request : -1,
 		 (s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_queue : -1,
 		 (s->logs.t_data >= 0) ? s->logs.t_data - s->logs.t_connect : -1,
 		 (tolog & LW_BYTES) ? "" : "+", s->logs.t_close,
 		 txn->status,
 		 (tolog & LW_BYTES) ? "" : "+", s->logs.bytes_in,
 		 txn->cli_cookie ? txn->cli_cookie : "-",
 		 txn->srv_cookie ? txn->srv_cookie : "-",
 		 sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT],
 		 sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT],
 		 (be->options & PR_O_COOK_ANY) ? sess_cookie[(txn->flags & TX_CK_MASK) >> TX_CK_SHIFT] : '-',
 		 (be->options & PR_O_COOK_ANY) ? sess_set_cookie[(txn->flags & TX_SCK_MASK) >> TX_SCK_SHIFT] : '-',
 		 actconn, fe->feconn, be->beconn, s->srv ? s->srv->cur_sess : 0,
 		 s->logs.srv_queue_size, s->logs.prx_queue_size, tmpline);

 	s->logs.logwait = 0;
 }


 /*
  * Capture headers from message starting at <som> according to header list
  * <cap_hdr>, and fill the <idx> structure appropriately.
  */
 void capture_headers(char *som, struct hdr_idx *idx,
 		     char **cap, struct cap_hdr *cap_hdr)
 {
 	char *eol, *sol, *col, *sov;
 	int cur_idx;
 	struct cap_hdr *h;
 	int len;

 	sol = som + hdr_idx_first_pos(idx);
 	cur_idx = hdr_idx_first_idx(idx);

 	while (cur_idx) {
 		eol = sol + idx->v[cur_idx].len;

 		col = sol;
 		while (col < eol && *col != ':')
 			col++;

 		sov = col + 1;
 		while (sov < eol && http_is_lws[(unsigned char)*sov])
 			sov++;

 		for (h = cap_hdr; h; h = h->next) {
 			if ((h->namelen == col - sol) &&
 			    (strncasecmp(sol, h->name, h->namelen) == 0)) {
 				if (cap[h->index] == NULL)
 					cap[h->index] =
 						pool_alloc_from(h->pool, h->len + 1);

 				if (cap[h->index] == NULL) {
 					Alert("HTTP capture : out of memory.\n");
 					continue;
 				}

 				len = eol - sov;
 				if (len > h->len)
 					len = h->len;

 				memcpy(cap[h->index], sov, len);
 				cap[h->index][len]=0;
 			}
 		}
 		sol = eol + idx->v[cur_idx].cr + 1;
 		cur_idx = idx->v[cur_idx].next;
 	}
 }


 /* either we find an LF at <ptr> or we jump to <bad>.
  */
 #define EXPECT_LF_HERE(ptr, bad)	do { if (unlikely(*(ptr) != '\n')) goto bad; } while (0)

 /* plays with variables <ptr>, <end> and <state>. Jumps to <good> if OK,
  * otherwise to <http_msg_ood> with <state> set to <st>.
  */
 #define EAT_AND_JUMP_OR_RETURN(good, st)   do { \
 		ptr++;                          \
 		if (likely(ptr < end))          \
 			goto good;              \
 		else {                          \
 			state = (st);           \
 			goto http_msg_ood;      \
 		}                               \
 	} while (0)


 /*
  * This function parses a status line between <ptr> and <end>, starting with
  * parser state <state>. Only states HTTP_MSG_RPVER, HTTP_MSG_RPVER_SP,
  * HTTP_MSG_RPCODE, HTTP_MSG_RPCODE_SP and HTTP_MSG_RPREASON are handled. Others
  * will give undefined results.
  * Note that it is upon the caller's responsibility to ensure that ptr < end,
  * and that msg->sol points to the beginning of the response.
  * If a complete line is found (which implies that at least one CR or LF is
  * found before <end>, the updated <ptr> is returned, otherwise NULL is
  * returned indicating an incomplete line (which does not mean that parts have
  * not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are
  * non-NULL, they are fed with the new <ptr> and <state> values to be passed
  * upon next call.
  *
  * This function was intentionnally designed to be called from
  * http_msg_analyzer() with the lowest overhead. It should integrate perfectly
  * within its state machine and use the same macros, hence the need for same
  * labels and variable names.
  */
 const char *http_parse_stsline(struct http_msg *msg, const char *msg_buf, int state,
 			       const char *ptr, const char *end,
 			       char **ret_ptr, int *ret_state)
 {
 	__label__
 		http_msg_rpver,
 		http_msg_rpver_sp,
 		http_msg_rpcode,
 		http_msg_rpcode_sp,
 		http_msg_rpreason,
 		http_msg_rpline_eol,
 		http_msg_ood,     /* out of data */
 		http_msg_invalid;

 	switch (state)	{
 	http_msg_rpver:
 	case HTTP_MSG_RPVER:
 		if (likely(HTTP_IS_VER_TOKEN(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rpver, HTTP_MSG_RPVER);

 		if (likely(HTTP_IS_SPHT(*ptr))) {
 			msg->sl.st.v_l = (ptr - msg_buf) - msg->som;
 			EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP);
 		}
 		goto http_msg_invalid;

 	http_msg_rpver_sp:
 	case HTTP_MSG_RPVER_SP:
 		if (likely(!HTTP_IS_LWS(*ptr))) {
 			msg->sl.st.c = ptr - msg_buf;
 			goto http_msg_rpcode;
 		}
 		if (likely(HTTP_IS_SPHT(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP);
 		/* so it's a CR/LF, this is invalid */
 		goto http_msg_invalid;

 	http_msg_rpcode:
 	case HTTP_MSG_RPCODE:
 		if (likely(!HTTP_IS_LWS(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rpcode, HTTP_MSG_RPCODE);

 		if (likely(HTTP_IS_SPHT(*ptr))) {
 			msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c;
 			EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP);
 		}

 		/* so it's a CR/LF, so there is no reason phrase */
 		msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c;
 	http_msg_rsp_reason:
 		/* FIXME: should we support HTTP responses without any reason phrase ? */
 		msg->sl.st.r = ptr - msg_buf;
 		msg->sl.st.r_l = 0;
 		goto http_msg_rpline_eol;

 	http_msg_rpcode_sp:
 	case HTTP_MSG_RPCODE_SP:
 		if (likely(!HTTP_IS_LWS(*ptr))) {
 			msg->sl.st.r = ptr - msg_buf;
 			goto http_msg_rpreason;
 		}
 		if (likely(HTTP_IS_SPHT(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP);
 		/* so it's a CR/LF, so there is no reason phrase */
 		goto http_msg_rsp_reason;

 	http_msg_rpreason:
 	case HTTP_MSG_RPREASON:
 		if (likely(!HTTP_IS_CRLF(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rpreason, HTTP_MSG_RPREASON);
 		msg->sl.st.r_l = (ptr - msg_buf) - msg->sl.st.r;
 	http_msg_rpline_eol:
 		/* We have seen the end of line. Note that we do not
 		 * necessarily have the \n yet, but at least we know that we
 		 * have EITHER \r OR \n, otherwise the response would not be
 		 * complete. We can then record the response length and return
 		 * to the caller which will be able to register it.
 		 */
 		msg->sl.st.l = ptr - msg->sol;
 		return ptr;

 #ifdef DEBUG_FULL
 	default:
 		fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
 		exit(1);
 #endif
 	}

  http_msg_ood:
 	/* out of data */
 	if (ret_state)
 		*ret_state = state;
 	if (ret_ptr)
 		*ret_ptr = (char *)ptr;
 	return NULL;

  http_msg_invalid:
 	/* invalid message */
 	if (ret_state)
 		*ret_state = HTTP_MSG_ERROR;
 	return NULL;
 }


 /*
  * This function parses a request line between <ptr> and <end>, starting with
  * parser state <state>. Only states HTTP_MSG_RQMETH, HTTP_MSG_RQMETH_SP,
  * HTTP_MSG_RQURI, HTTP_MSG_RQURI_SP and HTTP_MSG_RQVER are handled. Others
  * will give undefined results.
  * Note that it is upon the caller's responsibility to ensure that ptr < end,
  * and that msg->sol points to the beginning of the request.
  * If a complete line is found (which implies that at least one CR or LF is
  * found before <end>, the updated <ptr> is returned, otherwise NULL is
  * returned indicating an incomplete line (which does not mean that parts have
  * not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are
  * non-NULL, they are fed with the new <ptr> and <state> values to be passed
  * upon next call.
  *
  * This function was intentionnally designed to be called from
  * http_msg_analyzer() with the lowest overhead. It should integrate perfectly
  * within its state machine and use the same macros, hence the need for same
  * labels and variable names.
  */
 const char *http_parse_reqline(struct http_msg *msg, const char *msg_buf, int state,
 			       const char *ptr, const char *end,
 			       char **ret_ptr, int *ret_state)
 {
 	__label__
 		http_msg_rqmeth,
 		http_msg_rqmeth_sp,
 		http_msg_rquri,
 		http_msg_rquri_sp,
 		http_msg_rqver,
 		http_msg_rqline_eol,
 		http_msg_ood,     /* out of data */
 		http_msg_invalid;

 	switch (state)	{
 	http_msg_rqmeth:
 	case HTTP_MSG_RQMETH:
 		if (likely(HTTP_IS_TOKEN(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth, HTTP_MSG_RQMETH);

 		if (likely(HTTP_IS_SPHT(*ptr))) {
 			msg->sl.rq.m_l = (ptr - msg_buf) - msg->som;
 			EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP);
 		}

 		if (likely(HTTP_IS_CRLF(*ptr))) {
 			/* HTTP 0.9 request */
 			msg->sl.rq.m_l = (ptr - msg_buf) - msg->som;
 		http_msg_req09_uri:
 			msg->sl.rq.u = ptr - msg_buf;
 		http_msg_req09_uri_e:
 			msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u;
 		http_msg_req09_ver:
 			msg->sl.rq.v = ptr - msg_buf;
 			msg->sl.rq.v_l = 0;
 			goto http_msg_rqline_eol;
 		}
 		goto http_msg_invalid;

 	http_msg_rqmeth_sp:
 	case HTTP_MSG_RQMETH_SP:
 		if (likely(!HTTP_IS_LWS(*ptr))) {
 			msg->sl.rq.u = ptr - msg_buf;
 			goto http_msg_rquri;
 		}
 		if (likely(HTTP_IS_SPHT(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP);
 		/* so it's a CR/LF, meaning an HTTP 0.9 request */
 		goto http_msg_req09_uri;

 	http_msg_rquri:
 	case HTTP_MSG_RQURI:
 		if (likely(!HTTP_IS_LWS(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rquri, HTTP_MSG_RQURI);

 		if (likely(HTTP_IS_SPHT(*ptr))) {
 			msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u;
 			EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP);
 		}

 		/* so it's a CR/LF, meaning an HTTP 0.9 request */
 		goto http_msg_req09_uri_e;

 	http_msg_rquri_sp:
 	case HTTP_MSG_RQURI_SP:
 		if (likely(!HTTP_IS_LWS(*ptr))) {
 			msg->sl.rq.v = ptr - msg_buf;
 			goto http_msg_rqver;
 		}
 		if (likely(HTTP_IS_SPHT(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP);
 		/* so it's a CR/LF, meaning an HTTP 0.9 request */
 		goto http_msg_req09_ver;

 	http_msg_rqver:
 	case HTTP_MSG_RQVER:
 		if (likely(HTTP_IS_VER_TOKEN(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rqver, HTTP_MSG_RQVER);

 		if (likely(HTTP_IS_CRLF(*ptr))) {
 			msg->sl.rq.v_l = (ptr - msg_buf) - msg->sl.rq.v;
 		http_msg_rqline_eol:
 			/* We have seen the end of line. Note that we do not
 			 * necessarily have the \n yet, but at least we know that we
 			 * have EITHER \r OR \n, otherwise the request would not be
 			 * complete. We can then record the request length and return
 			 * to the caller which will be able to register it.
 			 */
 			msg->sl.rq.l = ptr - msg->sol;
 			return ptr;
 		}

 		/* neither an HTTP_VER token nor a CRLF */
 		goto http_msg_invalid;

 #ifdef DEBUG_FULL
 	default:
 		fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
 		exit(1);
 #endif
 	}

  http_msg_ood:
 	/* out of data */
 	if (ret_state)
 		*ret_state = state;
 	if (ret_ptr)
 		*ret_ptr = (char *)ptr;
 	return NULL;

  http_msg_invalid:
 	/* invalid message */
 	if (ret_state)
 		*ret_state = HTTP_MSG_ERROR;
 	return NULL;
 }


 /*
  * This function parses an HTTP message, either a request or a response,
  * depending on the initial msg->msg_state. It can be preempted everywhere
  * when data are missing and recalled at the exact same location with no
  * information loss. The header index is re-initialized when switching from
  * MSG_R[PQ]BEFORE to MSG_RPVER|MSG_RQMETH.
  */
 void http_msg_analyzer(struct buffer *buf, struct http_msg *msg, struct hdr_idx *idx)
 {
 	__label__
 		http_msg_rqbefore,
 		http_msg_rqbefore_cr,
 		http_msg_rqmeth,
 		http_msg_rqline_end,
 		http_msg_hdr_first,
 		http_msg_hdr_name,
 		http_msg_hdr_l1_sp,
 		http_msg_hdr_l1_lf,
 		http_msg_hdr_l1_lws,
 		http_msg_hdr_val,
 		http_msg_hdr_l2_lf,
 		http_msg_hdr_l2_lws,
 		http_msg_complete_header,
 		http_msg_last_lf,
 		http_msg_ood,     /* out of data */
 		http_msg_invalid;

 	int state;                /* updated only when leaving the FSM */
 	register char *ptr, *end; /* request pointers, to avoid dereferences */

 	state = msg->msg_state;
 	ptr = buf->lr;
 	end = buf->r;

 	if (unlikely(ptr >= end))
 		goto http_msg_ood;

 	switch (state)	{
 	/*
 	 * First, states that are specific to the response only.
 	 * We check them first so that request and headers are
 	 * closer to each other (accessed more often).
 	 */
 	http_msg_rpbefore:
 	case HTTP_MSG_RPBEFORE:
 		if (likely(HTTP_IS_TOKEN(*ptr))) {
 			if (likely(ptr == buf->data)) {
 				msg->sol = ptr;
 				msg->som = 0;
 			} else {
 #if PARSE_PRESERVE_EMPTY_LINES
 				/* only skip empty leading lines, don't remove them */
 				msg->sol = ptr;
 				msg->som = ptr - buf->data;
 #else
 				/* Remove empty leading lines, as recommended by
 				 * RFC2616. This takes a lot of time because we
 				 * must move all the buffer backwards, but this
 				 * is rarely needed. The method above will be
 				 * cleaner when we'll be able to start sending
 				 * the request from any place in the buffer.
 				 */
 				buf->lr = ptr;
 				buffer_replace2(buf, buf->data, buf->lr, NULL, 0);
 				msg->som = 0;
 				msg->sol = buf->data;
 				ptr = buf->data;
 				end = buf->r;
 #endif
 			}
 			hdr_idx_init(idx);
 			state = HTTP_MSG_RPVER;
 			goto http_msg_rpver;
 		}

 		if (unlikely(!HTTP_IS_CRLF(*ptr)))
 			goto http_msg_invalid;

 		if (unlikely(*ptr == '\n'))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE);
 		EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore_cr, HTTP_MSG_RPBEFORE_CR);
 		/* stop here */

 	http_msg_rpbefore_cr:
 	case HTTP_MSG_RPBEFORE_CR:
 		EXPECT_LF_HERE(ptr, http_msg_invalid);
 		EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE);
 		/* stop here */

 	http_msg_rpver:
 	case HTTP_MSG_RPVER:
 	case HTTP_MSG_RPVER_SP:
 	case HTTP_MSG_RPCODE:
 	case HTTP_MSG_RPCODE_SP:
 	case HTTP_MSG_RPREASON:
 		ptr = (char *)http_parse_stsline(msg, buf->data, state, ptr, end,
 						 &buf->lr, &msg->msg_state);
 		if (unlikely(!ptr))
 			return;

 		/* we have a full response and we know that we have either a CR
 		 * or an LF at <ptr>.
 		 */
 		//fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.st.l, *ptr);
 		hdr_idx_set_start(idx, msg->sl.st.l, *ptr == '\r');

 		msg->sol = ptr;
 		if (likely(*ptr == '\r'))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rpline_end, HTTP_MSG_RPLINE_END);
 		goto http_msg_rpline_end;

 	http_msg_rpline_end:
 	case HTTP_MSG_RPLINE_END:
 		/* msg->sol must point to the first of CR or LF. */
 		EXPECT_LF_HERE(ptr, http_msg_invalid);
 		EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST);
 		/* stop here */

 	/*
 	 * Second, states that are specific to the request only
 	 */
 	http_msg_rqbefore:
 	case HTTP_MSG_RQBEFORE:
 		if (likely(HTTP_IS_TOKEN(*ptr))) {
 			if (likely(ptr == buf->data)) {
 				msg->sol = ptr;
 				msg->som = 0;
 			} else {
 #if PARSE_PRESERVE_EMPTY_LINES
 				/* only skip empty leading lines, don't remove them */
 				msg->sol = ptr;
 				msg->som = ptr - buf->data;
 #else
 				/* Remove empty leading lines, as recommended by
 				 * RFC2616. This takes a lot of time because we
 				 * must move all the buffer backwards, but this
 				 * is rarely needed. The method above will be
 				 * cleaner when we'll be able to start sending
 				 * the request from any place in the buffer.
 				 */
 				buf->lr = ptr;
 				buffer_replace2(buf, buf->data, buf->lr, NULL, 0);
 				msg->som = 0;
 				msg->sol = buf->data;
 				ptr = buf->data;
 				end = buf->r;
 #endif
 			}
 			/* we will need this when keep-alive will be supported
 			   hdr_idx_init(idx);
 			 */
 			state = HTTP_MSG_RQMETH;
 			goto http_msg_rqmeth;
 		}

 		if (unlikely(!HTTP_IS_CRLF(*ptr)))
 			goto http_msg_invalid;

 		if (unlikely(*ptr == '\n'))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE);
 		EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore_cr, HTTP_MSG_RQBEFORE_CR);
 		/* stop here */

 	http_msg_rqbefore_cr:
 	case HTTP_MSG_RQBEFORE_CR:
 		EXPECT_LF_HERE(ptr, http_msg_invalid);
 		EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE);
 		/* stop here */

 	http_msg_rqmeth:
 	case HTTP_MSG_RQMETH:
 	case HTTP_MSG_RQMETH_SP:
 	case HTTP_MSG_RQURI:
 	case HTTP_MSG_RQURI_SP:
 	case HTTP_MSG_RQVER:
 		ptr = (char *)http_parse_reqline(msg, buf->data, state, ptr, end,
 						 &buf->lr, &msg->msg_state);
 		if (unlikely(!ptr))
 			return;

 		/* we have a full request and we know that we have either a CR
 		 * or an LF at <ptr>.
 		 */
 		//fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.rq.l, *ptr);
 		hdr_idx_set_start(idx, msg->sl.rq.l, *ptr == '\r');

 		msg->sol = ptr;
 		if (likely(*ptr == '\r'))
 			EAT_AND_JUMP_OR_RETURN(http_msg_rqline_end, HTTP_MSG_RQLINE_END);
 		goto http_msg_rqline_end;

 	http_msg_rqline_end:
 	case HTTP_MSG_RQLINE_END:
 		/* check for HTTP/0.9 request : no version information available.
 		 * msg->sol must point to the first of CR or LF.
 		 */
 		if (unlikely(msg->sl.rq.v_l == 0))
 			goto http_msg_last_lf;

 		EXPECT_LF_HERE(ptr, http_msg_invalid);
 		EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST);
 		/* stop here */

 	/*
 	 * Common states below
 	 */
 	http_msg_hdr_first:
 	case HTTP_MSG_HDR_FIRST:
 		msg->sol = ptr;
 		if (likely(!HTTP_IS_CRLF(*ptr))) {
 			goto http_msg_hdr_name;
 		}

 		if (likely(*ptr == '\r'))
 			EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF);
 		goto http_msg_last_lf;

 	http_msg_hdr_name:
 	case HTTP_MSG_HDR_NAME:
 		/* assumes msg->sol points to the first char */
 		if (likely(HTTP_IS_TOKEN(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_hdr_name, HTTP_MSG_HDR_NAME);

 		if (likely(*ptr == ':')) {
 			msg->col = ptr - buf->data;
 			EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP);
 		}

 		goto http_msg_invalid;

 	http_msg_hdr_l1_sp:
 	case HTTP_MSG_HDR_L1_SP:
 		/* assumes msg->sol points to the first char and msg->col to the colon */
 		if (likely(HTTP_IS_SPHT(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP);

 		/* header value can be basically anything except CR/LF */
 		msg->sov = ptr - buf->data;

 		if (likely(!HTTP_IS_CRLF(*ptr))) {
 			goto http_msg_hdr_val;
 		}

 		if (likely(*ptr == '\r'))
 			EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lf, HTTP_MSG_HDR_L1_LF);
 		goto http_msg_hdr_l1_lf;

 	http_msg_hdr_l1_lf:
 	case HTTP_MSG_HDR_L1_LF:
 		EXPECT_LF_HERE(ptr, http_msg_invalid);
 		EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lws, HTTP_MSG_HDR_L1_LWS);

 	http_msg_hdr_l1_lws:
 	case HTTP_MSG_HDR_L1_LWS:
 		if (likely(HTTP_IS_SPHT(*ptr))) {
 			/* replace HT,CR,LF with spaces */
 			for (; buf->data+msg->sov < ptr; msg->sov++)
 				buf->data[msg->sov] = ' ';
 			goto http_msg_hdr_l1_sp;
 		}
 		/* we had a header consisting only in spaces ! */
 		msg->eol = buf->data + msg->sov;
 		goto http_msg_complete_header;

 	http_msg_hdr_val:
 	case HTTP_MSG_HDR_VAL:
 		/* assumes msg->sol points to the first char, msg->col to the
 		 * colon, and msg->sov points to the first character of the
 		 * value.
 		 */
 		if (likely(!HTTP_IS_CRLF(*ptr)))
 			EAT_AND_JUMP_OR_RETURN(http_msg_hdr_val, HTTP_MSG_HDR_VAL);

 		msg->eol = ptr;
 		/* Note: we could also copy eol into ->eoh so that we have the
 		 * real header end in case it ends with lots of LWS, but is this
 		 * really needed ?
 		 */
 		if (likely(*ptr == '\r'))
 			EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lf, HTTP_MSG_HDR_L2_LF);
 		goto http_msg_hdr_l2_lf;

 	http_msg_hdr_l2_lf:
 	case HTTP_MSG_HDR_L2_LF:
 		EXPECT_LF_HERE(ptr, http_msg_invalid);
 		EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lws, HTTP_MSG_HDR_L2_LWS);

 	http_msg_hdr_l2_lws:
 	case HTTP_MSG_HDR_L2_LWS:
 		if (unlikely(HTTP_IS_SPHT(*ptr))) {
 			/* LWS: replace HT,CR,LF with spaces */
 			for (; msg->eol < ptr; msg->eol++)
 				*msg->eol = ' ';
 			goto http_msg_hdr_val;
 		}
 	http_msg_complete_header:
 		/*
 		 * It was a new header, so the last one is finished.
 		 * Assumes msg->sol points to the first char, msg->col to the
 		 * colon, msg->sov points to the first character of the value
 		 * and msg->eol to the first CR or LF so we know how the line
 		 * ends. We insert last header into the index.
 		 */
 		/*
 		  fprintf(stderr,"registering %-2d bytes : ", msg->eol - msg->sol);
 		  write(2, msg->sol, msg->eol-msg->sol);
 		  fprintf(stderr,"\n");
 		*/

 		if (unlikely(hdr_idx_add(msg->eol - msg->sol, *msg->eol == '\r',
 					 idx, idx->tail) < 0))
 			goto http_msg_invalid;

 		msg->sol = ptr;
 		if (likely(!HTTP_IS_CRLF(*ptr))) {
 			goto http_msg_hdr_name;
 		}

 		if (likely(*ptr == '\r'))
 			EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF);
 		goto http_msg_last_lf;

 	http_msg_last_lf:
 	case HTTP_MSG_LAST_LF:
 		/* Assumes msg->sol points to the first of either CR or LF */
 		EXPECT_LF_HERE(ptr, http_msg_invalid);
 		ptr++;
 		buf->lr = ptr;
 		msg->eoh = msg->sol - buf->data;
 		msg->msg_state = HTTP_MSG_BODY;
 		return;
 #ifdef DEBUG_FULL
 	default:
 		fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
 		exit(1);
 #endif
 	}
  http_msg_ood:
 	/* out of data */
 	msg->msg_state = state;
 	buf->lr = ptr;
 	return;

  http_msg_invalid:
 	/* invalid message */
 	msg->msg_state = HTTP_MSG_ERROR;
 	return;
 }

 /*
  * manages the client FSM and its socket. BTW, it also tries to handle the
  * cookie. It returns 1 if a state has changed (and a resync may be needed),
  * 0 else.
  */
 int process_cli(struct session *t)
 {
 	int s = t->srv_state;
 	int c = t->cli_state;
 	struct buffer *req = t->req;
 	struct buffer *rep = t->rep;

 	DPRINTF(stderr,"process_cli: c=%s s=%s set(r,w)=%d,%d exp(r,w)=%d.%d,%d.%d\n",
 		cli_stnames[c], srv_stnames[s],
 		MY_FD_ISSET(t->cli_fd, StaticReadEvent), MY_FD_ISSET(t->cli_fd, StaticWriteEvent),
 		req->rex.tv_sec, req->rex.tv_usec,
 		rep->wex.tv_sec, rep->wex.tv_usec);

 	if (c == CL_STHEADERS) {
 		/*
 		 * Now parse the partial (or complete) lines.
 		 * We will check the request syntax, and also join multi-line
 		 * headers. An index of all the lines will be elaborated while
 		 * parsing.
 		 *
 		 * For the parsing, we use a 28 states FSM.
 		 *
 		 * Here is the information we currently have :
 		 *   req->data + req->som  = beginning of request
 		 *   req->data + req->eoh  = end of processed headers / start of current one
 		 *   req->data + req->eol  = end of current header or line (LF or CRLF)
 		 *   req->lr = first non-visited byte
 		 *   req->r  = end of data
 		 */

 		int cur_idx;
 		struct http_txn *txn = &t->txn;
 		struct http_msg *msg = &txn->req;
 		struct proxy *cur_proxy;

 		if (likely(req->lr < req->r))
 			http_msg_analyzer(req, msg, &txn->hdr_idx);

 		/* 1: we might have to print this header in debug mode */
 		if (unlikely((global.mode & MODE_DEBUG) &&
 			     (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) &&
 			     (msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) {
 			char *eol, *sol;

 			sol = req->data + msg->som;
 			eol = sol + msg->sl.rq.l;
 			debug_hdr("clireq", t, sol, eol);

 			sol += hdr_idx_first_pos(&txn->hdr_idx);
 			cur_idx = hdr_idx_first_idx(&txn->hdr_idx);

 			while (cur_idx) {
 				eol = sol + txn->hdr_idx.v[cur_idx].len;
 				debug_hdr("clihdr", t, sol, eol);
 				sol = eol + txn->hdr_idx.v[cur_idx].cr + 1;
 				cur_idx = txn->hdr_idx.v[cur_idx].next;
 			}
 		}


 		/*
 		 * Now we quickly check if we have found a full valid request.
 		 * If not so, we check the FD and buffer states before leaving.
 		 * A full request is indicated by the fact that we have seen
 		 * the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid
 		 * requests are checked first.
 		 *
 		 */

 		if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
 			/*
 			 * First, let's catch bad requests.
 			 */
 			if (unlikely(msg->msg_state == HTTP_MSG_ERROR))
 				goto return_bad_req;

 			/* 1: Since we are in header mode, if there's no space
 			 *    left for headers, we won't be able to free more
 			 *    later, so the session will never terminate. We
 			 *    must terminate it now.
 			 */
 			if (unlikely(req->l >= req->rlim - req->data)) {
 				/* FIXME: check if URI is set and return Status
 				 * 414 Request URI too long instead.
 				 */
 				goto return_bad_req;
 			}

 			/* 2: have we encountered a read error or a close ? */
 			else if (unlikely(req->flags & (BF_READ_ERROR | BF_READ_NULL))) {
 				/* read error, or last read : give up. */
 				tv_eternity(&req->rex);
 				fd_delete(t->cli_fd);
 				t->cli_state = CL_STCLOSE;
 				t->fe->failed_req++;
 				if (!(t->flags & SN_ERR_MASK))
 					t->flags |= SN_ERR_CLICL;
 				if (!(t->flags & SN_FINST_MASK))
 					t->flags |= SN_FINST_R;
 				return 1;
 			}

 			/* 3: has the read timeout expired ? */
 			else if (unlikely(tv_cmp2_ms(&req->rex, &now) <= 0)) {
 				/* read timeout : give up with an error message. */
 				txn->status = 408;
 				client_retnclose(t, error_message(t, HTTP_ERR_408));
 				t->fe->failed_req++;
 				if (!(t->flags & SN_ERR_MASK))
 					t->flags |= SN_ERR_CLITO;
 				if (!(t->flags & SN_FINST_MASK))
 					t->flags |= SN_FINST_R;
 				return 1;
 			}

 			/* 4: do we need to re-enable the read socket ? */
 			else if (unlikely(! MY_FD_ISSET(t->cli_fd, StaticReadEvent))) {
 				/* fd in StaticReadEvent was disabled, perhaps because of a previous buffer
 				 * full. We cannot loop here since stream_sock_read will disable it only if
 				 * req->l == rlim-data
 				 */
 				MY_FD_SET(t->cli_fd, StaticReadEvent);
 				if (t->fe->clitimeout)
 					tv_delayfrom(&req->rex, &now, t->fe->clitimeout);
 				else
 					tv_eternity(&req->rex);
 			}
 			return t->cli_state != CL_STHEADERS;
 		}


 		/****************************************************************
 		 * More interesting part now : we know that we have a complete  *
 		 * request which at least looks like HTTP. We have an indicator *
 		 * of each header's length, so we can parse them quickly.       *
 		 ****************************************************************/

 		/*
 		 * 1: identify the method
 		 */
 		txn->meth = find_http_meth(&req->data[msg->som], msg->sl.rq.m_l);

 		/*
 		 * 2: check if the URI matches the monitor_uri.
 		 * We have to do this for every request which gets in, because
 		 * the monitor-uri is defined by the frontend.
 		 */
 		if (unlikely((t->fe->monitor_uri_len != 0) &&
 			     (t->fe->monitor_uri_len == msg->sl.rq.u_l) &&
 			     !memcmp(&req->data[msg->sl.rq.u],
 				     t->fe->monitor_uri,
 				     t->fe->monitor_uri_len))) {
 			/*
 			 * We have found the monitor URI
 			 */
 			t->flags |= SN_MONITOR;
 			txn->status = 200;
 			client_retnclose(t, &http_200_chunk);
 			goto return_prx_cond;
 		}

 		/*
 		 * 3: Maybe we have to copy the original REQURI for the logs ?
 		 * Note: we cannot log anymore if the request has been
 		 * classified as invalid.
 		 */
 		if (unlikely(t->logs.logwait & LW_REQ)) {
 			/* we have a complete HTTP request that we must log */
 			if ((txn->uri = pool_alloc(requri)) != NULL) {
 				int urilen = msg->sl.rq.l;

 				if (urilen >= REQURI_LEN)
 					urilen = REQURI_LEN - 1;
 				memcpy(txn->uri, &req->data[msg->som], urilen);
 				txn->uri[urilen] = 0;

 				if (!(t->logs.logwait &= ~LW_REQ))
 					http_sess_log(t);
 			} else {
 				Alert("HTTP logging : out of memory.\n");
 			}
 		}


 		/* 4. We may have to convert HTTP/0.9 requests to HTTP/1.0 */
 		if (unlikely(msg->sl.rq.v_l == 0)) {
 			int delta;
 			char *cur_end;
 			msg->sol = req->data + msg->som;
 			cur_end = msg->sol + msg->sl.rq.l;
 			delta = 0;

 			if (msg->sl.rq.u_l == 0) {
 				/* if no URI was set, add "/" */
 				delta = buffer_replace2(req, cur_end, cur_end, " /", 2);
 				cur_end += delta;
 				msg->eoh += delta;
 			}
 			/* add HTTP version */
 			delta = buffer_replace2(req, cur_end, cur_end, " HTTP/1.0\r\n", 11);
 			msg->eoh += delta;
 			cur_end += delta;
 			cur_end = (char *)http_parse_reqline(msg, req->data,
 							     HTTP_MSG_RQMETH,
 							     msg->sol, cur_end + 1,
 							     NULL, NULL);
 			if (unlikely(!cur_end))
 				goto return_bad_req;

 			/* we have a full HTTP/1.0 request now and we know that
 			 * we have either a CR or an LF at <ptr>.
 			 */
 			hdr_idx_set_start(&txn->hdr_idx, msg->sl.rq.l, *cur_end == '\r');
 		}


 		/* 5: we may need to capture headers */
 		if (unlikely((t->logs.logwait & LW_REQHDR) && t->fe->req_cap))
 			capture_headers(req->data + msg->som, &txn->hdr_idx,
 					txn->req.cap, t->fe->req_cap);

 		/*
 		 * 6: we will have to evaluate the filters.
 		 * As opposed to version 1.2, now they will be evaluated in the
 		 * filters order and not in the header order. This means that
 		 * each filter has to be validated among all headers.
 		 *
 		 * We can now check whether we want to switch to another
 		 * backend, in which case we will re-check the backend's
 		 * filters and various options. In order to support 3-level
 		 * switching, here's how we should proceed :
 		 *
 		 *  a) run be.
 		 *     if (switch) then switch ->be to the new backend.
 		 *  b) run be if (be != fe).
 		 *     There cannot be any switch from there, so ->be cannot be
 		 *     changed anymore.
 		 *
 		 * => filters always apply to ->be, then ->be may change.
 		 *
 		 * The response path will be able to apply either ->be, or
 		 * ->be then ->fe filters in order to match the reverse of
 		 * the forward sequence.
 		 */

 		do {
 			struct proxy *rule_set = t->be;
 			cur_proxy = t->be;

 			/* try headers filters */
 			if (rule_set->req_exp != NULL) {
 				if (apply_filters_to_request(t, req, rule_set->req_exp) < 0)
 					goto return_bad_req;
 			}

 			if (!(t->flags & SN_BE_ASSIGNED) && (t->be != cur_proxy)) {
 				/* to ensure correct connection accounting on
 				 * the backend, we count the connection for the
 				 * one managing the queue.
 				 */
 				t->be->beconn++;
 				if (t->be->beconn > t->be->beconn_max)
 					t->be->beconn_max = t->be->beconn;
 				t->be->cum_beconn++;
 				t->flags |= SN_BE_ASSIGNED;
 			}

 			/* has the request been denied ? */
 			if (txn->flags & TX_CLDENY) {
 				/* no need to go further */
 				txn->status = 403;
 				/* let's log the request time */
 				t->logs.t_request = tv_diff(&t->logs.tv_accept, &now);
 				client_retnclose(t, error_message(t, HTTP_ERR_403));
 				goto return_prx_cond;
 			}

 			/* We might have to check for "Connection:" */
 			if (((t->fe->options | t->be->options) & PR_O_HTTP_CLOSE) &&
 			    !(t->flags & SN_CONN_CLOSED)) {
 				char *cur_ptr, *cur_end, *cur_next;
 				int cur_idx, old_idx, delta, val;
 				struct hdr_idx_elem *cur_hdr;

 				cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
 				old_idx = 0;

 				while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
 					cur_hdr  = &txn->hdr_idx.v[cur_idx];
 					cur_ptr  = cur_next;
 					cur_end  = cur_ptr + cur_hdr->len;
 					cur_next = cur_end + cur_hdr->cr + 1;

 					val = http_header_match2(cur_ptr, cur_end, "Connection", 10);
 					if (val) {
 						/* 3 possibilities :
 						 * - we have already set Connection: close,
 						 *   so we remove this line.
 						 * - we have not yet set Connection: close,
 						 *   but this line indicates close. We leave
 						 *   it untouched and set the flag.
 						 * - we have not yet set Connection: close,
 						 *   and this line indicates non-close. We
 						 *   replace it.
 						 */
 						if (t->flags & SN_CONN_CLOSED) {
 							delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
 							txn->req.eoh += delta;
 							cur_next += delta;
 							txn->hdr_idx.v[old_idx].next = cur_hdr->next;
 							txn->hdr_idx.used--;
 							cur_hdr->len = 0;
 						} else {
 							if (strncasecmp(cur_ptr + val, "close", 5) != 0) {
 								delta = buffer_replace2(req, cur_ptr + val, cur_end,
 											"close", 5);
 								cur_next += delta;
 								cur_hdr->len += delta;
 								txn->req.eoh += delta;
 							}
 							t->flags |= SN_CONN_CLOSED;
 						}
 					}
 					old_idx = cur_idx;
 				}
 			}
 			/* add request headers from the rule sets in the same order */
 			for (cur_idx = 0; cur_idx < rule_set->nb_reqadd; cur_idx++) {
 				if (unlikely(http_header_add_tail(req,
 								  &txn->req,
 								  &txn->hdr_idx,
 								  rule_set->req_add[cur_idx])) < 0)
 					goto return_bad_req;
 			}

 			/* check if stats URI was requested, and if an auth is needed */
 			if (rule_set->uri_auth != NULL &&
 			    (txn->meth == HTTP_METH_GET || txn->meth == HTTP_METH_HEAD)) {
 				/* we have to check the URI and auth for this request */
 				if (stats_check_uri_auth(t, rule_set))
 					return 1;
 			}

 			if (!(t->flags & SN_BE_ASSIGNED) && cur_proxy->defbe.be) {
 				/* No backend was set, but there was a default
 				 * backend set in the frontend, so we use it and
 				 * loop again.
 				 */
 				t->be = cur_proxy->defbe.be;
 				t->be->beconn++;
 				if (t->be->beconn > t->be->beconn_max)
 					t->be->beconn_max = t->be->beconn;
 				t->be->cum_beconn++;
 				t->flags |= SN_BE_ASSIGNED;
 			}
 		} while (t->be != cur_proxy);  /* we loop only if t->be has changed */


 		if (!(t->flags & SN_BE_ASSIGNED)) {
 			/* To ensure correct connection accounting on
 			 * the backend, we count the connection for the
 			 * one managing the queue.
 			 */
 			t->be->beconn++;
 			if (t->be->beconn > t->be->beconn_max)
 				t->be->beconn_max = t->be->beconn;
 			t->be->cum_beconn++;
 			t->flags |= SN_BE_ASSIGNED;
 		}

 		/*
 		 * Right now, we know that we have processed the entire headers
 		 * and that unwanted requests have been filtered out. We can do
 		 * whatever we want with the remaining request. Also, now we
 		 * may have separate values for ->fe, ->be.
 		 */


 		/*
 		 * 7: the appsession cookie was looked up very early in 1.2,
 		 * so let's do the same now.
 		 */

 		/* It needs to look into the URI */
 		if (t->be->appsession_name) {
 			get_srv_from_appsession(t, &req->data[msg->som], msg->sl.rq.l);
 		}


 		/*
 		 * 8: Now we can work with the cookies.
 		 * Note that doing so might move headers in the request, but
 		 * the fields will stay coherent and the URI will not move.
 		 * This should only be performed in the backend.
 		 */
 		if (!(txn->flags & (TX_CLDENY|TX_CLTARPIT)))
 			manage_client_side_cookies(t, req);


 		/*
 		 * 9: add X-Forwarded-For if either the frontend or the backend
 		 * asks for it.
 		 */
 		if ((t->fe->options | t->be->options) & PR_O_FWDFOR) {
 			if (t->cli_addr.ss_family == AF_INET) {
 				/* Add an X-Forwarded-For header unless the source IP is
 				 * in the 'except' network range.
 				 */
 				if ((!t->fe->except_mask.s_addr ||
 				     (((struct sockaddr_in *)&t->cli_addr)->sin_addr.s_addr & t->fe->except_mask.s_addr)
 				     != t->fe->except_net.s_addr) &&
 				    (!t->be->except_mask.s_addr ||
 				     (((struct sockaddr_in *)&t->cli_addr)->sin_addr.s_addr & t->be->except_mask.s_addr)
 				     != t->be->except_net.s_addr)) {
 					int len;
 					unsigned char *pn;
 					pn = (unsigned char *)&((struct sockaddr_in *)&t->cli_addr)->sin_addr;

 					len = sprintf(trash, "X-Forwarded-For: %d.%d.%d.%d",
 						      pn[0], pn[1], pn[2], pn[3]);

 					if (unlikely(http_header_add_tail2(req, &txn->req,
 									   &txn->hdr_idx, trash, len)) < 0)
 						goto return_bad_req;
 				}
 			}
 			else if (t->cli_addr.ss_family == AF_INET6) {
 				/* FIXME: for the sake of completeness, we should also support
 				 * 'except' here, although it is mostly useless in this case.
 				 */
 				int len;
 				char pn[INET6_ADDRSTRLEN];
 				inet_ntop(AF_INET6,
 					  (const void *)&((struct sockaddr_in6 *)(&t->cli_addr))->sin6_addr,
 					  pn, sizeof(pn));
 				len = sprintf(trash, "X-Forwarded-For: %s", pn);
 				if (unlikely(http_header_add_tail2(req, &txn->req,
 								   &txn->hdr_idx, trash, len)) < 0)
 					goto return_bad_req;
 			}
 		}

 		/*
 		 * 10: add "Connection: close" if needed and not yet set.
 		 * Note that we do not need to add it in case of HTTP/1.0.
 		 */
 		if (!(t->flags & SN_CONN_CLOSED) &&
 		    ((t->fe->options | t->be->options) & PR_O_HTTP_CLOSE)) {
 			if ((unlikely(msg->sl.rq.v_l != 8) ||
 			     unlikely(req->data[msg->som + msg->sl.rq.v + 7] != '0')) &&
 			    unlikely(http_header_add_tail2(req, &txn->req, &txn->hdr_idx,
 							   "Connection: close", 17)) < 0)
 				goto return_bad_req;
 			t->flags |= SN_CONN_CLOSED;
 		}

 		/*************************************************************
 		 * OK, that's finished for the headers. We have done what we *
 		 * could. Let's switch to the DATA state.                    *
 		 ************************************************************/

 		t->cli_state = CL_STDATA;
 		req->rlim = req->data + BUFSIZE; /* no more rewrite needed */

 		t->logs.t_request = tv_diff(&t->logs.tv_accept, &now);

 		if (!t->fe->clitimeout ||
 		    (t->srv_state < SV_STDATA && t->be->srvtimeout)) {
 			/* If the client has no timeout, or if the server is not ready yet,
 			 * and we know for sure that it can expire, then it's cleaner to
 			 * disable the timeout on the client side so that too low values
 			 * cannot make the sessions abort too early.
 			 *
 			 * FIXME-20050705: the server needs a way to re-enable this time-out
 			 * when it switches its state, otherwise a client can stay connected
 			 * indefinitely. This now seems to be OK.
 			 */
 			tv_eternity(&req->rex);
 		}

 		/* When a connection is tarpitted, we use the queue timeout for the
 		 * tarpit delay, which currently happens to be the server's connect
 		 * timeout. If unset, then set it to zero because we really want it
 		 * to expire at one moment.
 		 */
 		if (txn->flags & TX_CLTARPIT) {
 			t->req->l = 0;
 			/* flush the request so that we can drop the connection early
 			 * if the client closes first.
 			 */
 			tv_delayfrom(&req->cex, &now,
 				     t->be->contimeout ? t->be->contimeout : 0);
 		}

 		/* OK let's go on with the BODY now */
 		goto process_data;

 	return_bad_req: /* let's centralize all bad requests */
 		txn->req.msg_state = HTTP_MSG_ERROR;
 		txn->status = 400;
 		client_retnclose(t, error_message(t, HTTP_ERR_400));
 		t->fe->failed_req++;
 	return_prx_cond:
 		if (!(t->flags & SN_ERR_MASK))
 			t->flags |= SN_ERR_PRXCOND;
 		if (!(t->flags & SN_FINST_MASK))
 			t->flags |= SN_FINST_R;
 		return 1;

 	}
 	else if (c == CL_STDATA) {
 	process_data:
 		/* FIXME: this error handling is partly buggy because we always report
 		 * a 'DATA' phase while we don't know if the server was in IDLE, CONN
 		 * or HEADER phase. BTW, it's not logical to expire the client while
 		 * we're waiting for the server to connect.
 		 */
 		/* read or write error */
 		if (rep->flags & BF_WRITE_ERROR || req->flags & BF_READ_ERROR) {
 			tv_eternity(&req->rex);
 			tv_eternity(&rep->wex);
 			fd_delete(t->cli_fd);
 			t->cli_state = CL_STCLOSE;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_CLICL;
 			if (!(t->flags & SN_FINST_MASK)) {
 				if (t->pend_pos)
 					t->flags |= SN_FINST_Q;
 				else if (s == SV_STCONN)
 					t->flags |= SN_FINST_C;
 				else
 					t->flags |= SN_FINST_D;
 			}
 			return 1;
 		}
 		/* last read, or end of server write */
 		else if (req->flags & BF_READ_NULL || s == SV_STSHUTW || s == SV_STCLOSE) {
 			MY_FD_CLR(t->cli_fd, StaticReadEvent);
 			tv_eternity(&req->rex);
 			shutdown(t->cli_fd, SHUT_RD);
 			t->cli_state = CL_STSHUTR;
 			return 1;
 		}
 		/* last server read and buffer empty */
 		else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0)) {
 			MY_FD_CLR(t->cli_fd, StaticWriteEvent);
 			tv_eternity(&rep->wex);
 			shutdown(t->cli_fd, SHUT_WR);
 			/* We must ensure that the read part is still alive when switching
 			 * to shutw */
 			MY_FD_SET(t->cli_fd, StaticReadEvent);
 			if (t->fe->clitimeout)
 				tv_delayfrom(&req->rex, &now, t->fe->clitimeout);
 			t->cli_state = CL_STSHUTW;
 			//fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
 			return 1;
 		}
 		/* read timeout */
 		else if (tv_cmp2_ms(&req->rex, &now) <= 0) {
 			MY_FD_CLR(t->cli_fd, StaticReadEvent);
 			tv_eternity(&req->rex);
 			shutdown(t->cli_fd, SHUT_RD);
 			t->cli_state = CL_STSHUTR;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_CLITO;
 			if (!(t->flags & SN_FINST_MASK)) {
 				if (t->pend_pos)
 					t->flags |= SN_FINST_Q;
 				else if (s == SV_STCONN)
 					t->flags |= SN_FINST_C;
 				else
 					t->flags |= SN_FINST_D;
 			}
 			return 1;
 		}
 		/* write timeout */
 		else if (tv_cmp2_ms(&rep->wex, &now) <= 0) {
 			MY_FD_CLR(t->cli_fd, StaticWriteEvent);
 			tv_eternity(&rep->wex);
 			shutdown(t->cli_fd, SHUT_WR);
 			/* We must ensure that the read part is still alive when switching
 			 * to shutw */
 			MY_FD_SET(t->cli_fd, StaticReadEvent);
 			if (t->fe->clitimeout)
 				tv_delayfrom(&req->rex, &now, t->fe->clitimeout);

 			t->cli_state = CL_STSHUTW;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_CLITO;
 			if (!(t->flags & SN_FINST_MASK)) {
 				if (t->pend_pos)
 					t->flags |= SN_FINST_Q;
 				else if (s == SV_STCONN)
 					t->flags |= SN_FINST_C;
 				else
 					t->flags |= SN_FINST_D;
 			}
 			return 1;
 		}

 		if (req->l >= req->rlim - req->data) {
 			/* no room to read more data */
 			if (MY_FD_ISSET(t->cli_fd, StaticReadEvent)) {
 				/* stop reading until we get some space */
 				MY_FD_CLR(t->cli_fd, StaticReadEvent);
 				tv_eternity(&req->rex);
 			}
 		} else {
 			/* there's still some space in the buffer */
 			if (! MY_FD_ISSET(t->cli_fd, StaticReadEvent)) {
 				MY_FD_SET(t->cli_fd, StaticReadEvent);
 				if (!t->fe->clitimeout ||
 				    (t->srv_state < SV_STDATA && t->be->srvtimeout))
 					/* If the client has no timeout, or if the server not ready yet, and we
 					 * know for sure that it can expire, then it's cleaner to disable the
 					 * timeout on the client side so that too low values cannot make the
 					 * sessions abort too early.
 					 */
 					tv_eternity(&req->rex);
 				else
 					tv_delayfrom(&req->rex, &now, t->fe->clitimeout);
 			}
 		}

 		if ((rep->l == 0) ||
 		    ((s < SV_STDATA) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) {
 			if (MY_FD_ISSET(t->cli_fd, StaticWriteEvent)) {
 				MY_FD_CLR(t->cli_fd, StaticWriteEvent); /* stop writing */
 				tv_eternity(&rep->wex);
 			}
 		} else {
 			/* buffer not empty */
 			if (! MY_FD_ISSET(t->cli_fd, StaticWriteEvent)) {
 				MY_FD_SET(t->cli_fd, StaticWriteEvent); /* restart writing */
 				if (t->fe->clitimeout) {
 					tv_delayfrom(&rep->wex, &now, t->fe->clitimeout);
 					/* FIXME: to prevent the client from expiring read timeouts during writes,
 					 * we refresh it. */
 					req->rex = rep->wex;
 				}
 				else
 					tv_eternity(&rep->wex);
 			}
 		}
 		return 0; /* other cases change nothing */
 	}
 	else if (c == CL_STSHUTR) {
 		if (rep->flags & BF_WRITE_ERROR) {
 			tv_eternity(&rep->wex);
 			fd_delete(t->cli_fd);
 			t->cli_state = CL_STCLOSE;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_CLICL;
 			if (!(t->flags & SN_FINST_MASK)) {
 				if (t->pend_pos)
 					t->flags |= SN_FINST_Q;
 				else if (s == SV_STCONN)
 					t->flags |= SN_FINST_C;
 				else
 					t->flags |= SN_FINST_D;
 			}
 			return 1;
 		}
 		else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0)
 			 && !(t->flags & SN_SELF_GEN)) {
 			tv_eternity(&rep->wex);
 			fd_delete(t->cli_fd);
 			t->cli_state = CL_STCLOSE;
 			return 1;
 		}
 		else if (tv_cmp2_ms(&rep->wex, &now) <= 0) {
 			tv_eternity(&rep->wex);
 			fd_delete(t->cli_fd);
 			t->cli_state = CL_STCLOSE;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_CLITO;
 			if (!(t->flags & SN_FINST_MASK)) {
 				if (t->pend_pos)
 					t->flags |= SN_FINST_Q;
 				else if (s == SV_STCONN)
 					t->flags |= SN_FINST_C;
 				else
 					t->flags |= SN_FINST_D;
 			}
 			return 1;
 		}

 		if (t->flags & SN_SELF_GEN) {
 			produce_content(t);
 			if (rep->l == 0) {
 				tv_eternity(&rep->wex);
 				fd_delete(t->cli_fd);
 				t->cli_state = CL_STCLOSE;
 				return 1;
 			}
 		}

 		if ((rep->l == 0)
 		    || ((s == SV_STHEADERS) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) {
 			if (MY_FD_ISSET(t->cli_fd, StaticWriteEvent)) {
 				MY_FD_CLR(t->cli_fd, StaticWriteEvent); /* stop writing */
 				tv_eternity(&rep->wex);
 			}
 		} else {
 			/* buffer not empty */
 			if (! MY_FD_ISSET(t->cli_fd, StaticWriteEvent)) {
 				MY_FD_SET(t->cli_fd, StaticWriteEvent); /* restart writing */
 				if (t->fe->clitimeout) {
 					tv_delayfrom(&rep->wex, &now, t->fe->clitimeout);
 					/* FIXME: to prevent the client from expiring read timeouts during writes,
 					 * we refresh it. */
 					req->rex = rep->wex;
 				}
 				else
 					tv_eternity(&rep->wex);
 			}
 		}
 		return 0;
 	}
 	else if (c == CL_STSHUTW) {
 		if (req->flags & BF_READ_ERROR) {
 			tv_eternity(&req->rex);
 			fd_delete(t->cli_fd);
 			t->cli_state = CL_STCLOSE;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_CLICL;
 			if (!(t->flags & SN_FINST_MASK)) {
 				if (t->pend_pos)
 					t->flags |= SN_FINST_Q;
 				else if (s == SV_STCONN)
 					t->flags |= SN_FINST_C;
 				else
 					t->flags |= SN_FINST_D;
 			}
 			return 1;
 		}
 		else if (req->flags & BF_READ_NULL || s == SV_STSHUTW || s == SV_STCLOSE) {
 			tv_eternity(&req->rex);
 			fd_delete(t->cli_fd);
 			t->cli_state = CL_STCLOSE;
 			return 1;
 		}
 		else if (tv_cmp2_ms(&req->rex, &now) <= 0) {
 			tv_eternity(&req->rex);
 			fd_delete(t->cli_fd);
 			t->cli_state = CL_STCLOSE;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_CLITO;
 			if (!(t->flags & SN_FINST_MASK)) {
 				if (t->pend_pos)
 					t->flags |= SN_FINST_Q;
 				else if (s == SV_STCONN)
 					t->flags |= SN_FINST_C;
 				else
 					t->flags |= SN_FINST_D;
 			}
 			return 1;
 		}
 		else if (req->l >= req->rlim - req->data) {
 			/* no room to read more data */

 			/* FIXME-20050705: is it possible for a client to maintain a session
 			 * after the timeout by sending more data after it receives a close ?
 			 */

 			if (MY_FD_ISSET(t->cli_fd, StaticReadEvent)) {
 				/* stop reading until we get some space */
 				MY_FD_CLR(t->cli_fd, StaticReadEvent);
 				tv_eternity(&req->rex);
 				//fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
 			}
 		} else {
 			/* there's still some space in the buffer */
 			if (! MY_FD_ISSET(t->cli_fd, StaticReadEvent)) {
 				MY_FD_SET(t->cli_fd, StaticReadEvent);
 				if (t->fe->clitimeout)
 					tv_delayfrom(&req->rex, &now, t->fe->clitimeout);
 				else
 					tv_eternity(&req->rex);
 				//fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
 			}
 		}
 		return 0;
 	}
 	else { /* CL_STCLOSE: nothing to do */
 		if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
 			int len;
 			len = sprintf(trash, "%08x:%s.clicls[%04x:%04x]\n", t->uniq_id, t->be->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
 			write(1, trash, len);
 		}
 		return 0;
 	}
 	return 0;
 }


 /*
  * manages the server FSM and its socket. It returns 1 if a state has changed
  * (and a resync may be needed), 0 else.
  */
 int process_srv(struct session *t)
 {
 	int s = t->srv_state;
 	int c = t->cli_state;
 	struct http_txn *txn = &t->txn;
 	struct buffer *req = t->req;
 	struct buffer *rep = t->rep;
 	int conn_err;

 #ifdef DEBUG_FULL
 	fprintf(stderr,"process_srv: c=%s, s=%s\n", cli_stnames[c], srv_stnames[s]);
 #endif
 	//fprintf(stderr,"process_srv: c=%d, s=%d, cr=%d, cw=%d, sr=%d, sw=%d\n", c, s,
 	//MY_FD_ISSET(t->cli_fd, StaticReadEvent), MY_FD_ISSET(t->cli_fd, StaticWriteEvent),
 	//MY_FD_ISSET(t->srv_fd, StaticReadEvent), MY_FD_ISSET(t->srv_fd, StaticWriteEvent)
 	//);
 	if (s == SV_STIDLE) {
 		if (c == CL_STHEADERS)
 			return 0;	/* stay in idle, waiting for data to reach the client side */
 		else if (c == CL_STCLOSE || c == CL_STSHUTW ||
 			 (c == CL_STSHUTR &&
 			  (t->req->l == 0 || t->be->options & PR_O_ABRT_CLOSE))) { /* give up */
 			tv_eternity(&req->cex);
 			if (t->pend_pos)
 				t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now);
 			/* note that this must not return any error because it would be able to
 			 * overwrite the client_retnclose() output.
 			 */
 			if (txn->flags & TX_CLTARPIT)
 				srv_close_with_err(t, SN_ERR_CLICL, SN_FINST_T, 0, NULL);
 			else
 				srv_close_with_err(t, SN_ERR_CLICL, t->pend_pos ? SN_FINST_Q : SN_FINST_C, 0, NULL);

 			return 1;
 		}
 		else {
 			if (txn->flags & TX_CLTARPIT) {
 				/* This connection is being tarpitted. The CLIENT side has
 				 * already set the connect expiration date to the right
 				 * timeout. We just have to check that it has not expired.
 				 */
 				if (tv_cmp2_ms(&req->cex, &now) > 0)
 					return 0;

 				/* We will set the queue timer to the time spent, just for
 				 * logging purposes. We fake a 500 server error, so that the
 				 * attacker will not suspect his connection has been tarpitted.
 				 * It will not cause trouble to the logs because we can exclude
 				 * the tarpitted connections by filtering on the 'PT' status flags.
 				 */
 				tv_eternity(&req->cex);
 				t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now);
 				srv_close_with_err(t, SN_ERR_PRXCOND, SN_FINST_T,
 						   500, error_message(t, HTTP_ERR_500));
 				return 1;
 			}

 			/* Right now, we will need to create a connection to the server.
 			 * We might already have tried, and got a connection pending, in
 			 * which case we will not do anything till it's pending. It's up
 			 * to any other session to release it and wake us up again.
 			 */
 			if (t->pend_pos) {
 				if (tv_cmp2_ms(&req->cex, &now) > 0)
 					return 0;
 				else {
 					/* we've been waiting too long here */
 					tv_eternity(&req->cex);
 					t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now);
 					srv_close_with_err(t, SN_ERR_SRVTO, SN_FINST_Q,
 							   503, error_message(t, HTTP_ERR_503));
 					if (t->srv)
 						t->srv->failed_conns++;
 					t->fe->failed_conns++;
 					return 1;
 				}
 			}

 			do {
 				/* first, get a connection */
 				if (srv_redispatch_connect(t))
 					return t->srv_state != SV_STIDLE;

 				/* try to (re-)connect to the server, and fail if we expire the
 				 * number of retries.
 				 */
 				if (srv_retryable_connect(t)) {
 					t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now);
 					return t->srv_state != SV_STIDLE;
 				}
 			} while (1);
 		}
 	}
 	else if (s == SV_STCONN) { /* connection in progress */
 		if (c == CL_STCLOSE || c == CL_STSHUTW ||
 		    (c == CL_STSHUTR &&
 		     (t->req->l == 0 || t->be->options & PR_O_ABRT_CLOSE))) { /* give up */
 			tv_eternity(&req->cex);
 			fd_delete(t->srv_fd);
 			if (t->srv)
 				t->srv->cur_sess--;

 			/* note that this must not return any error because it would be able to
 			 * overwrite the client_retnclose() output.
 			 */
 			srv_close_with_err(t, SN_ERR_CLICL, SN_FINST_C, 0, NULL);
 			return 1;
 		}
 		if (!(req->flags & BF_WRITE_STATUS) && tv_cmp2_ms(&req->cex, &now) > 0) {
 			//fprintf(stderr,"1: c=%d, s=%d, now=%d.%06d, exp=%d.%06d\n", c, s, now.tv_sec, now.tv_usec, req->cex.tv_sec, req->cex.tv_usec);
 			return 0; /* nothing changed */
 		}
 		else if (!(req->flags & BF_WRITE_STATUS) || (req->flags & BF_WRITE_ERROR)) {
 			/* timeout, asynchronous connect error or first write error */
 			//fprintf(stderr,"2: c=%d, s=%d\n", c, s);

 			fd_delete(t->srv_fd);
 			if (t->srv)
 				t->srv->cur_sess--;

 			if (!(req->flags & BF_WRITE_STATUS))
 				conn_err = SN_ERR_SRVTO; // it was a connect timeout.
 			else
 				conn_err = SN_ERR_SRVCL; // it was an asynchronous connect error.

 			/* ensure that we have enough retries left */
 			if (srv_count_retry_down(t, conn_err))
 				return 1;

 			if (t->srv && t->conn_retries == 0 && t->be->options & PR_O_REDISP) {
 				/* We're on our last chance, and the REDISP option was specified.
 				 * We will ignore cookie and force to balance or use the dispatcher.
 				 */
 				/* let's try to offer this slot to anybody */
 				if (may_dequeue_tasks(t->srv, t->be))
 					task_wakeup(&rq, t->srv->queue_mgt);

 				if (t->srv)
 					t->srv->failed_conns++;
 				t->be->failed_conns++;

 				t->flags &= ~(SN_DIRECT | SN_ASSIGNED | SN_ADDR_SET);
 				t->srv = NULL; /* it's left to the dispatcher to choose a server */
 				http_flush_cookie_flags(txn);

 				/* first, get a connection */
 				if (srv_redispatch_connect(t))
 					return t->srv_state != SV_STIDLE;
 			}

 			do {
 				/* Now we will try to either reconnect to the same server or
 				 * connect to another server. If the connection gets queued
 				 * because all servers are saturated, then we will go back to
 				 * the SV_STIDLE state.
 				 */
 				if (srv_retryable_connect(t)) {
 					t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now);
 					return t->srv_state != SV_STCONN;
 				}

 				/* we need to redispatch the connection to another server */
 				if (srv_redispatch_connect(t))
 					return t->srv_state != SV_STCONN;
 			} while (1);
 		}
 		else { /* no error or write 0 */
 			t->logs.t_connect = tv_diff(&t->logs.tv_accept, &now);

 			//fprintf(stderr,"3: c=%d, s=%d\n", c, s);
 			if (req->l == 0) /* nothing to write */ {
 				MY_FD_CLR(t->srv_fd, StaticWriteEvent);
 				tv_eternity(&req->wex);
 			} else  /* need the right to write */ {
 				MY_FD_SET(t->srv_fd, StaticWriteEvent);
 				if (t->be->srvtimeout) {
 					tv_delayfrom(&req->wex, &now, t->be->srvtimeout);
 					/* FIXME: to prevent the server from expiring read timeouts during writes,
 					 * we refresh it. */
 					rep->rex = req->wex;
 				}
 				else
 					tv_eternity(&req->wex);
 			}

 			if (t->be->mode == PR_MODE_TCP) { /* let's allow immediate data connection in this case */
 				MY_FD_SET(t->srv_fd, StaticReadEvent);
 				if (t->be->srvtimeout)
 					tv_delayfrom(&rep->rex, &now, t->be->srvtimeout);
 				else
 					tv_eternity(&rep->rex);

 				t->srv_state = SV_STDATA;
 				if (t->srv)
 					t->srv->cum_sess++;
 				rep->rlim = rep->data + BUFSIZE; /* no rewrite needed */

 				/* if the user wants to log as soon as possible, without counting
 				   bytes from the server, then this is the right moment. */
 				if (t->fe->to_log && !(t->logs.logwait & LW_BYTES)) {
 					t->logs.t_close = t->logs.t_connect; /* to get a valid end date */
 					tcp_sess_log(t);
 				}
 #ifdef CONFIG_HAP_TCPSPLICE
 				if ((t->fe->options & t->be->options) & PR_O_TCPSPLICE) {
 					/* TCP splicing supported by both FE and BE */
 					tcp_splice_splicefd(t->cli_fd, t->srv_fd, 0);
 				}
 #endif
 			}
 			else {
 				t->srv_state = SV_STHEADERS;
 				if (t->srv)
 					t->srv->cum_sess++;
 				rep->rlim = rep->data + BUFSIZE - MAXREWRITE; /* rewrite needed */
 				t->txn.rsp.msg_state = HTTP_MSG_RPBEFORE;
 				/* reset hdr_idx which was already initialized by the request.
 				 * right now, the http parser does it.
 				 * hdr_idx_init(&t->txn.hdr_idx);
 				 */
 			}
 			tv_eternity(&req->cex);
 			return 1;
 		}
 	}
 	else if (s == SV_STHEADERS) { /* receiving server headers */
 		/*
 		 * Now parse the partial (or complete) lines.
 		 * We will check the response syntax, and also join multi-line
 		 * headers. An index of all the lines will be elaborated while
 		 * parsing.
 		 *
 		 * For the parsing, we use a 28 states FSM.
 		 *
 		 * Here is the information we currently have :
 		 *   rep->data + req->som  = beginning of response
 		 *   rep->data + req->eoh  = end of processed headers / start of current one
 		 *   rep->data + req->eol  = end of current header or line (LF or CRLF)
 		 *   rep->lr = first non-visited byte
 		 *   rep->r  = end of data
 		 */

 		int cur_idx;
 		struct http_msg *msg = &txn->rsp;
 		struct proxy *cur_proxy;

 		if (likely(rep->lr < rep->r))
 			http_msg_analyzer(rep, msg, &txn->hdr_idx);

 		/* 1: we might have to print this header in debug mode */
 		if (unlikely((global.mode & MODE_DEBUG) &&
 			     (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) &&
 			     (msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) {
 			char *eol, *sol;

 			sol = rep->data + msg->som;
 			eol = sol + msg->sl.rq.l;
 			debug_hdr("srvrep", t, sol, eol);

 			sol += hdr_idx_first_pos(&txn->hdr_idx);
 			cur_idx = hdr_idx_first_idx(&txn->hdr_idx);

 			while (cur_idx) {
 				eol = sol + txn->hdr_idx.v[cur_idx].len;
 				debug_hdr("srvhdr", t, sol, eol);
 				sol = eol + txn->hdr_idx.v[cur_idx].cr + 1;
 				cur_idx = txn->hdr_idx.v[cur_idx].next;
 			}
 		}


 		if ((rep->l < rep->rlim - rep->data) && ! MY_FD_ISSET(t->srv_fd, StaticReadEvent)) {
 			/* fd in StaticReadEvent was disabled, perhaps because of a previous buffer
 			 * full. We cannot loop here since stream_sock_read will disable it only if
 			 * rep->l == rlim-data
 			 */
 			MY_FD_SET(t->srv_fd, StaticReadEvent);
 			if (t->be->srvtimeout)
 				tv_delayfrom(&rep->rex, &now, t->be->srvtimeout);
 			else
 				tv_eternity(&rep->rex);
 		}


 		/*
 		 * Now we quickly check if we have found a full valid response.
 		 * If not so, we check the FD and buffer states before leaving.
 		 * A full response is indicated by the fact that we have seen
 		 * the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid
 		 * responses are checked first.
 		 *
 		 * Depending on whether the client is still there or not, we
 		 * may send an error response back or not. Note that normally
 		 * we should only check for HTTP status there, and check I/O
 		 * errors somewhere else.
 		 */

 		if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {

 			/* Invalid response, or read error or write error */
 			if (unlikely((msg->msg_state == HTTP_MSG_ERROR) ||
 			             (req->flags & BF_WRITE_ERROR) ||
 			             (rep->flags & BF_READ_ERROR))) {
 				tv_eternity(&rep->rex);
 				tv_eternity(&req->wex);
 				fd_delete(t->srv_fd);
 				if (t->srv) {
 					t->srv->cur_sess--;
 					t->srv->failed_resp++;
 				}
 				t->be->failed_resp++;
 				t->srv_state = SV_STCLOSE;
 				txn->status = 502;
 				client_return(t, error_message(t, HTTP_ERR_502));
 				if (!(t->flags & SN_ERR_MASK))
 					t->flags |= SN_ERR_SRVCL;
 				if (!(t->flags & SN_FINST_MASK))
 					t->flags |= SN_FINST_H;
 				/* We used to have a free connection slot. Since we'll never use it,
 				 * we have to inform the server that it may be used by another session.
 				 */
 				if (t->srv && may_dequeue_tasks(t->srv, t->be))
 					task_wakeup(&rq, t->srv->queue_mgt);

 				return 1;
 			}

 			/* end of client write or end of server read.
 			 * since we are in header mode, if there's no space left for headers, we
 			 * won't be able to free more later, so the session will never terminate.
 			 */
 			else if (unlikely(rep->flags & BF_READ_NULL ||
 			                  c == CL_STSHUTW || c == CL_STCLOSE ||
 			                  rep->l >= rep->rlim - rep->data)) {
 				MY_FD_CLR(t->srv_fd, StaticReadEvent);
 				tv_eternity(&rep->rex);
 				shutdown(t->srv_fd, SHUT_RD);
 				t->srv_state = SV_STSHUTR;
 				//fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
 				return 1;
 			}

 			/* read timeout : return a 504 to the client.
 			 */
 			else if (unlikely(MY_FD_ISSET(t->srv_fd, StaticReadEvent) &&
 			                  tv_cmp2_ms(&rep->rex, &now) <= 0)) {
 				tv_eternity(&rep->rex);
 				tv_eternity(&req->wex);
 				fd_delete(t->srv_fd);
 				if (t->srv) {
 					t->srv->cur_sess--;
 					t->srv->failed_resp++;
 				}
 				t->be->failed_resp++;
 				t->srv_state = SV_STCLOSE;
 				txn->status = 504;
 				client_return(t, error_message(t, HTTP_ERR_504));
 				if (!(t->flags & SN_ERR_MASK))
 					t->flags |= SN_ERR_SRVTO;
 				if (!(t->flags & SN_FINST_MASK))
 					t->flags |= SN_FINST_H;
 				/* We used to have a free connection slot. Since we'll never use it,
 				 * we have to inform the server that it may be used by another session.
 				 */
 				if (t->srv && may_dequeue_tasks(t->srv, t->be))
 					task_wakeup(&rq, t->srv->queue_mgt);
 				return 1;
 			}

 			/* last client read and buffer empty */
 			/* FIXME!!! here, we don't want to switch to SHUTW if the
 			 * client shuts read too early, because we may still have
 			 * some work to do on the headers.
 			 * The side-effect is that if the client completely closes its
 			 * connection during SV_STHEADER, the connection to the server
 			 * is kept until a response comes back or the timeout is reached.
 			 */
 			else if (unlikely((/*c == CL_STSHUTR ||*/ c == CL_STCLOSE) &&
 			                  (req->l == 0))) {
 				MY_FD_CLR(t->srv_fd, StaticWriteEvent);
 				tv_eternity(&req->wex);

 				/* We must ensure that the read part is still
 				 * alive when switching to shutw */
 				MY_FD_SET(t->srv_fd, StaticReadEvent);
 				if (t->be->srvtimeout)
 					tv_delayfrom(&rep->rex, &now, t->be->srvtimeout);

 				shutdown(t->srv_fd, SHUT_WR);
 				t->srv_state = SV_STSHUTW;
 				return 1;
 			}

 			/* write timeout */
 			/* FIXME!!! here, we don't want to switch to SHUTW if the
 			 * client shuts read too early, because we may still have
 			 * some work to do on the headers.
 			 */
 			else if (unlikely(MY_FD_ISSET(t->srv_fd, StaticWriteEvent) &&
 			                  tv_cmp2_ms(&req->wex, &now) <= 0)) {
 				MY_FD_CLR(t->srv_fd, StaticWriteEvent);
 				tv_eternity(&req->wex);
 				shutdown(t->srv_fd, SHUT_WR);
 				/* We must ensure that the read part is still alive
 				 * when switching to shutw */
 				MY_FD_SET(t->srv_fd, StaticReadEvent);
 				if (t->be->srvtimeout)
 					tv_delayfrom(&rep->rex, &now, t->be->srvtimeout);

 				t->srv_state = SV_STSHUTW;
 				if (!(t->flags & SN_ERR_MASK))
 					t->flags |= SN_ERR_SRVTO;
 				if (!(t->flags & SN_FINST_MASK))
 					t->flags |= SN_FINST_H;
 				return 1;
 			}

 			/*
 			 * And now the non-error cases.
 			 */

 			/* Data remaining in the request buffer.
 			 * This happens during the first pass here, and during
 			 * long posts.
 			 */
 			else if (likely(req->l)) {
 				if (! MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
 					MY_FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */
 					if (t->be->srvtimeout) {
 						tv_delayfrom(&req->wex, &now, t->be->srvtimeout);
 						/* FIXME: to prevent the server from expiring read timeouts during writes,
 						 * we refresh it. */
 						rep->rex = req->wex;
 					}
 					else
 						tv_eternity(&req->wex);
 				}
 			}

 			/* nothing left in the request buffer */
 			else {
 				if (MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
 					MY_FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */
 					tv_eternity(&req->wex);
 				}
 			}

 			return t->srv_state != SV_STHEADERS;
 		}


 		/*****************************************************************
 		 * More interesting part now : we know that we have a complete   *
 		 * response which at least looks like HTTP. We have an indicator *
 		 * of each header's length, so we can parse them quickly.        *
 		 ****************************************************************/

 		/*
 		 * 1: get the status code and check for cacheability.
 		 */

 		t->logs.logwait &= ~LW_RESP;
 		txn->status = strl2ui(rep->data + msg->sl.st.c, msg->sl.st.c_l);

 		switch (txn->status) {
 		case 200:
 		case 203:
 		case 206:
 		case 300:
 		case 301:
 		case 410:
 			/* RFC2616 @13.4:
 			 *   "A response received with a status code of
 			 *    200, 203, 206, 300, 301 or 410 MAY be stored
 			 *    by a cache (...) unless a cache-control
 			 *    directive prohibits caching."
 			 *
 			 * RFC2616 @9.5: POST method :
 			 *   "Responses to this method are not cacheable,
 			 *    unless the response includes appropriate
 			 *    Cache-Control or Expires header fields."
 			 */
 			if (likely(txn->meth != HTTP_METH_POST) &&
 			    unlikely(t->be->options & PR_O_CHK_CACHE))
 				txn->flags |= TX_CACHEABLE | TX_CACHE_COOK;
 			break;
 		default:
 			break;
 		}

 		/*
 		 * 2: we may need to capture headers
 		 */
 		if (unlikely((t->logs.logwait & LW_RSPHDR) && t->fe->rsp_cap))
 			capture_headers(rep->data + msg->som, &txn->hdr_idx,
 					txn->rsp.cap, t->fe->rsp_cap);

 		/*
 		 * 3: we will have to evaluate the filters.
 		 * As opposed to version 1.2, now they will be evaluated in the
 		 * filters order and not in the header order. This means that
 		 * each filter has to be validated among all headers.
 		 *
 		 * Filters are tried with ->be first, then with ->fe if it is
 		 * different from ->be.
 		 */

 		t->flags &= ~SN_CONN_CLOSED; /* prepare for inspection */

 		cur_proxy = t->be;
 		while (1) {
 			struct proxy *rule_set = cur_proxy;

 			/* try headers filters */
 			if (rule_set->rsp_exp != NULL) {
 				if (apply_filters_to_response(t, rep, rule_set->rsp_exp) < 0) {
 				return_bad_resp:
 					if (t->srv) {
 						t->srv->cur_sess--;
 						t->srv->failed_resp++;
 					}
 					cur_proxy->failed_resp++;
 				return_srv_prx_502:
 					tv_eternity(&rep->rex);
 					tv_eternity(&req->wex);
 					fd_delete(t->srv_fd);
 					t->srv_state = SV_STCLOSE;
 					txn->status = 502;
 					client_return(t, error_message(t, HTTP_ERR_502));
 					if (!(t->flags & SN_ERR_MASK))
 						t->flags |= SN_ERR_PRXCOND;
 					if (!(t->flags & SN_FINST_MASK))
 						t->flags |= SN_FINST_H;
 					/* We used to have a free connection slot. Since we'll never use it,
 					 * we have to inform the server that it may be used by another session.
 					 */
 					if (t->srv && may_dequeue_tasks(t->srv, cur_proxy))
 						task_wakeup(&rq, t->srv->queue_mgt);
 					return 1;
 				}
 			}

 			/* has the response been denied ? */
 			if (txn->flags & TX_SVDENY) {
 				if (t->srv) {
 					t->srv->cur_sess--;
 					t->srv->failed_secu++;
 				}
 				cur_proxy->denied_resp++;
 				goto return_srv_prx_502;
 			}

 			/* We might have to check for "Connection:" */
 			if (((t->fe->options | t->be->options) & PR_O_HTTP_CLOSE) &&
 			    !(t->flags & SN_CONN_CLOSED)) {
 				char *cur_ptr, *cur_end, *cur_next;
 				int cur_idx, old_idx, delta, val;
 				struct hdr_idx_elem *cur_hdr;

 				cur_next = rep->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
 				old_idx = 0;

 				while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
 					cur_hdr  = &txn->hdr_idx.v[cur_idx];
 					cur_ptr  = cur_next;
 					cur_end  = cur_ptr + cur_hdr->len;
 					cur_next = cur_end + cur_hdr->cr + 1;

 					val = http_header_match2(cur_ptr, cur_end, "Connection", 10);
 					if (val) {
 						/* 3 possibilities :
 						 * - we have already set Connection: close,
 						 *   so we remove this line.
 						 * - we have not yet set Connection: close,
 						 *   but this line indicates close. We leave
 						 *   it untouched and set the flag.
 						 * - we have not yet set Connection: close,
 						 *   and this line indicates non-close. We
 						 *   replace it.
 						 */
 						if (t->flags & SN_CONN_CLOSED) {
 							delta = buffer_replace2(rep, cur_ptr, cur_next, NULL, 0);
 							txn->rsp.eoh += delta;
 							cur_next += delta;
 							txn->hdr_idx.v[old_idx].next = cur_hdr->next;
 							txn->hdr_idx.used--;
 							cur_hdr->len = 0;
 						} else {
 							if (strncasecmp(cur_ptr + val, "close", 5) != 0) {
 								delta = buffer_replace2(rep, cur_ptr + val, cur_end,
 											"close", 5);
 								cur_next += delta;
 								cur_hdr->len += delta;
 								txn->rsp.eoh += delta;
 							}
 							t->flags |= SN_CONN_CLOSED;
 						}
 					}
 					old_idx = cur_idx;
 				}
 			}

 			/* add response headers from the rule sets in the same order */
 			for (cur_idx = 0; cur_idx < rule_set->nb_rspadd; cur_idx++) {
 				if (unlikely(http_header_add_tail(rep, &txn->rsp, &txn->hdr_idx,
 								  rule_set->rsp_add[cur_idx])) < 0)
 					goto return_bad_resp;
 			}

 			/* check whether we're already working on the frontend */
 			if (cur_proxy == t->fe)
 				break;
 			cur_proxy = t->fe;
 		}

 		/*
 		 * 4: check for server cookie.
 		 */
 		manage_server_side_cookies(t, rep);

 		/*
 		 * 5: add server cookie in the response if needed
 		 */
 		if ((t->srv) && !(t->flags & SN_DIRECT) && (t->be->options & PR_O_COOK_INS) &&
 		    (!(t->be->options & PR_O_COOK_POST) || (txn->meth == HTTP_METH_POST))) {
 			int len;

 			/* the server is known, it's not the one the client requested, we have to
 			 * insert a set-cookie here, except if we want to insert only on POST
 			 * requests and this one isn't. Note that servers which don't have cookies
 			 * (eg: some backup servers) will return a full cookie removal request.
 			 */
 			len = sprintf(trash, "Set-Cookie: %s=%s; path=/",
 				      t->be->cookie_name,
 				      t->srv->cookie ? t->srv->cookie : "; Expires=Thu, 01-Jan-1970 00:00:01 GMT");

 			if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
 							   trash, len)) < 0)
 				goto return_bad_resp;
 			txn->flags |= TX_SCK_INSERTED;

 			/* Here, we will tell an eventual cache on the client side that we don't
 			 * want it to cache this reply because HTTP/1.0 caches also cache cookies !
 			 * Some caches understand the correct form: 'no-cache="set-cookie"', but
 			 * others don't (eg: apache <= 1.3.26). So we use 'private' instead.
 			 */
 			if (t->be->options & PR_O_COOK_NOC) {
 				if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
 								   "Cache-control: private", 22)) < 0)
 					goto return_bad_resp;
 			}
 		}


 		/*
 		 * 6: check for cache-control or pragma headers.
 		 */
 		check_response_for_cacheability(t, rep);


 		/*
 		 * 7: check if result will be cacheable with a cookie.
 		 * We'll block the response if security checks have caught
 		 * nasty things such as a cacheable cookie.
 		 */
 		if (((txn->flags & (TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) ==
 		     (TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) &&
 		    (t->be->options & PR_O_CHK_CACHE)) {

 			/* we're in presence of a cacheable response containing
 			 * a set-cookie header. We'll block it as requested by
 			 * the 'checkcache' option, and send an alert.
 			 */
 			if (t->srv) {
 				t->srv->cur_sess--;
 				t->srv->failed_secu++;
 			}
 			t->be->denied_resp++;

 			Alert("Blocking cacheable cookie in response from instance %s, server %s.\n",
 			      t->be->id, t->srv?t->srv->id:"<dispatch>");
 			send_log(t->be, LOG_ALERT,
 				 "Blocking cacheable cookie in response from instance %s, server %s.\n",
 				 t->be->id, t->srv?t->srv->id:"<dispatch>");
 			goto return_srv_prx_502;
 		}

 		/*
 		 * 8: add "Connection: close" if needed and not yet set.
 		 * Note that we do not need to add it in case of HTTP/1.0.
 		 */
 		if (!(t->flags & SN_CONN_CLOSED) &&
 		    ((t->fe->options | t->be->options) & PR_O_HTTP_CLOSE)) {
 			if ((unlikely(msg->sl.st.v_l != 8) ||
 			     unlikely(req->data[msg->som + 7] != '0')) &&
 			    unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
 							   "Connection: close", 17)) < 0)
 				goto return_bad_resp;
 			t->flags |= SN_CONN_CLOSED;
 		}


 		/*************************************************************
 		 * OK, that's finished for the headers. We have done what we *
 		 * could. Let's switch to the DATA state.                    *
 		 ************************************************************/

 		t->srv_state = SV_STDATA;
 		rep->rlim = rep->data + BUFSIZE; /* no more rewrite needed */
 		t->logs.t_data = tv_diff(&t->logs.tv_accept, &now);

 		/* client connection already closed or option 'forceclose' required :
 		 * we close the server's outgoing connection right now.
 		 */
 		if ((req->l == 0) &&
 		    (c == CL_STSHUTR || c == CL_STCLOSE || t->be->options & PR_O_FORCE_CLO)) {
 			MY_FD_CLR(t->srv_fd, StaticWriteEvent);
 			tv_eternity(&req->wex);

 			/* We must ensure that the read part is still alive when switching
 			 * to shutw */
 			MY_FD_SET(t->srv_fd, StaticReadEvent);
 			if (t->be->srvtimeout)
 				tv_delayfrom(&rep->rex, &now, t->be->srvtimeout);

 			shutdown(t->srv_fd, SHUT_WR);
 			t->srv_state = SV_STSHUTW;
 		}

 #ifdef CONFIG_HAP_TCPSPLICE
 		if ((t->fe->options & t->be->options) & PR_O_TCPSPLICE) {
 			/* TCP splicing supported by both FE and BE */
 			tcp_splice_splicefd(t->cli_fd, t->srv_fd, 0);
 		}
 #endif
 		/* if the user wants to log as soon as possible, without counting
 		   bytes from the server, then this is the right moment. */
 		if (t->fe->to_log && !(t->logs.logwait & LW_BYTES)) {
 			t->logs.t_close = t->logs.t_data; /* to get a valid end date */
 			t->logs.bytes_in = txn->rsp.eoh;
 			if (t->fe->to_log & LW_REQ)
 				http_sess_log(t);
 			else
 				tcp_sess_log(t);
 		}

 		/* Note: we must not try to cheat by jumping directly to DATA,
 		 * otherwise we would not let the client side wake up.
 		 */

 		return 1;
 	}
 	else if (s == SV_STDATA) {
 		/* read or write error */
 		if (req->flags & BF_WRITE_ERROR || rep->flags & BF_READ_ERROR) {
 			tv_eternity(&rep->rex);
 			tv_eternity(&req->wex);
 			fd_delete(t->srv_fd);
 			if (t->srv) {
 				t->srv->cur_sess--;
 				t->srv->failed_resp++;
 			}
 			t->be->failed_resp++;
 			t->srv_state = SV_STCLOSE;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_SRVCL;
 			if (!(t->flags & SN_FINST_MASK))
 				t->flags |= SN_FINST_D;
 			/* We used to have a free connection slot. Since we'll never use it,
 			 * we have to inform the server that it may be used by another session.
 			 */
 			if (may_dequeue_tasks(t->srv, t->be))
 				task_wakeup(&rq, t->srv->queue_mgt);

 			return 1;
 		}
 		/* last read, or end of client write */
 		else if (rep->flags & BF_READ_NULL || c == CL_STSHUTW || c == CL_STCLOSE) {
 			MY_FD_CLR(t->srv_fd, StaticReadEvent);
 			tv_eternity(&rep->rex);
 			shutdown(t->srv_fd, SHUT_RD);
 			t->srv_state = SV_STSHUTR;
 			//fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state);
 			return 1;
 		}
 		/* end of client read and no more data to send */
 		else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) {
 			MY_FD_CLR(t->srv_fd, StaticWriteEvent);
 			tv_eternity(&req->wex);
 			shutdown(t->srv_fd, SHUT_WR);
 			/* We must ensure that the read part is still alive when switching
 			 * to shutw */
 			MY_FD_SET(t->srv_fd, StaticReadEvent);
 			if (t->be->srvtimeout)
 				tv_delayfrom(&rep->rex, &now, t->be->srvtimeout);

 			t->srv_state = SV_STSHUTW;
 			return 1;
 		}
 		/* read timeout */
 		else if (tv_cmp2_ms(&rep->rex, &now) <= 0) {
 			MY_FD_CLR(t->srv_fd, StaticReadEvent);
 			tv_eternity(&rep->rex);
 			shutdown(t->srv_fd, SHUT_RD);
 			t->srv_state = SV_STSHUTR;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_SRVTO;
 			if (!(t->flags & SN_FINST_MASK))
 				t->flags |= SN_FINST_D;
 			return 1;
 		}
 		/* write timeout */
 		else if (tv_cmp2_ms(&req->wex, &now) <= 0) {
 			MY_FD_CLR(t->srv_fd, StaticWriteEvent);
 			tv_eternity(&req->wex);
 			shutdown(t->srv_fd, SHUT_WR);
 			/* We must ensure that the read part is still alive when switching
 			 * to shutw */
 			MY_FD_SET(t->srv_fd, StaticReadEvent);
 			if (t->be->srvtimeout)
 				tv_delayfrom(&rep->rex, &now, t->be->srvtimeout);
 			t->srv_state = SV_STSHUTW;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_SRVTO;
 			if (!(t->flags & SN_FINST_MASK))
 				t->flags |= SN_FINST_D;
 			return 1;
 		}

 		/* recompute request time-outs */
 		if (req->l == 0) {
 			if (MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
 				MY_FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */
 				tv_eternity(&req->wex);
 			}
 		}
 		else { /* buffer not empty, there are still data to be transferred */
 			if (! MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
 				MY_FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */
 				if (t->be->srvtimeout) {
 					tv_delayfrom(&req->wex, &now, t->be->srvtimeout);
 					/* FIXME: to prevent the server from expiring read timeouts during writes,
 					 * we refresh it. */
 					rep->rex = req->wex;
 				}
 				else
 					tv_eternity(&req->wex);
 			}
 		}

 		/* recompute response time-outs */
 		if (rep->l == BUFSIZE) { /* no room to read more data */
 			if (MY_FD_ISSET(t->srv_fd, StaticReadEvent)) {
 				MY_FD_CLR(t->srv_fd, StaticReadEvent);
 				tv_eternity(&rep->rex);
 			}
 		}
 		else {
 			if (! MY_FD_ISSET(t->srv_fd, StaticReadEvent)) {
 				MY_FD_SET(t->srv_fd, StaticReadEvent);
 				if (t->be->srvtimeout)
 					tv_delayfrom(&rep->rex, &now, t->be->srvtimeout);
 				else
 					tv_eternity(&rep->rex);
 			}
 		}

 		return 0; /* other cases change nothing */
 	}
 	else if (s == SV_STSHUTR) {
 		if (req->flags & BF_WRITE_ERROR) {
 			//MY_FD_CLR(t->srv_fd, StaticWriteEvent);
 			tv_eternity(&req->wex);
 			fd_delete(t->srv_fd);
 			if (t->srv) {
 				t->srv->cur_sess--;
 				t->srv->failed_resp++;
 			}
 			t->be->failed_resp++;
 			//close(t->srv_fd);
 			t->srv_state = SV_STCLOSE;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_SRVCL;
 			if (!(t->flags & SN_FINST_MASK))
 				t->flags |= SN_FINST_D;
 			/* We used to have a free connection slot. Since we'll never use it,
 			 * we have to inform the server that it may be used by another session.
 			 */
 			if (may_dequeue_tasks(t->srv, t->be))
 				task_wakeup(&rq, t->srv->queue_mgt);

 			return 1;
 		}
 		else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) {
 			//MY_FD_CLR(t->srv_fd, StaticWriteEvent);
 			tv_eternity(&req->wex);
 			fd_delete(t->srv_fd);
 			if (t->srv)
 				t->srv->cur_sess--;
 			//close(t->srv_fd);
 			t->srv_state = SV_STCLOSE;
 			/* We used to have a free connection slot. Since we'll never use it,
 			 * we have to inform the server that it may be used by another session.
 			 */
 			if (may_dequeue_tasks(t->srv, t->be))
 				task_wakeup(&rq, t->srv->queue_mgt);

 			return 1;
 		}
 		else if (tv_cmp2_ms(&req->wex, &now) <= 0) {
 			//MY_FD_CLR(t->srv_fd, StaticWriteEvent);
 			tv_eternity(&req->wex);
 			fd_delete(t->srv_fd);
 			if (t->srv)
 				t->srv->cur_sess--;
 			//close(t->srv_fd);
 			t->srv_state = SV_STCLOSE;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_SRVTO;
 			if (!(t->flags & SN_FINST_MASK))
 				t->flags |= SN_FINST_D;
 			/* We used to have a free connection slot. Since we'll never use it,
 			 * we have to inform the server that it may be used by another session.
 			 */
 			if (may_dequeue_tasks(t->srv, t->be))
 				task_wakeup(&rq, t->srv->queue_mgt);

 			return 1;
 		}
 		else if (req->l == 0) {
 			if (MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
 				MY_FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */
 				tv_eternity(&req->wex);
 			}
 		}
 		else { /* buffer not empty */
 			if (! MY_FD_ISSET(t->srv_fd, StaticWriteEvent)) {
 				MY_FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */
 				if (t->be->srvtimeout) {
 					tv_delayfrom(&req->wex, &now, t->be->srvtimeout);
 					/* FIXME: to prevent the server from expiring read timeouts during writes,
 					 * we refresh it. */
 					rep->rex = req->wex;
 				}
 				else
 					tv_eternity(&req->wex);
 			}
 		}
 		return 0;
 	}
 	else if (s == SV_STSHUTW) {
 		if (rep->flags & BF_READ_ERROR) {
 			//MY_FD_CLR(t->srv_fd, StaticReadEvent);
 			tv_eternity(&rep->rex);
 			fd_delete(t->srv_fd);
 			if (t->srv) {
 				t->srv->cur_sess--;
 				t->srv->failed_resp++;
 			}
 			t->be->failed_resp++;
 			//close(t->srv_fd);
 			t->srv_state = SV_STCLOSE;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_SRVCL;
 			if (!(t->flags & SN_FINST_MASK))
 				t->flags |= SN_FINST_D;
 			/* We used to have a free connection slot. Since we'll never use it,
 			 * we have to inform the server that it may be used by another session.
 			 */
 			if (may_dequeue_tasks(t->srv, t->be))
 				task_wakeup(&rq, t->srv->queue_mgt);

 			return 1;
 		}
 		else if (rep->flags & BF_READ_NULL || c == CL_STSHUTW || c == CL_STCLOSE) {
 			//MY_FD_CLR(t->srv_fd, StaticReadEvent);
 			tv_eternity(&rep->rex);
 			fd_delete(t->srv_fd);
 			if (t->srv)
 				t->srv->cur_sess--;
 			//close(t->srv_fd);
 			t->srv_state = SV_STCLOSE;
 			/* We used to have a free connection slot. Since we'll never use it,
 			 * we have to inform the server that it may be used by another session.
 			 */
 			if (may_dequeue_tasks(t->srv, t->be))
 				task_wakeup(&rq, t->srv->queue_mgt);

 			return 1;
 		}
 		else if (tv_cmp2_ms(&rep->rex, &now) <= 0) {
 			//MY_FD_CLR(t->srv_fd, StaticReadEvent);
 			tv_eternity(&rep->rex);
 			fd_delete(t->srv_fd);
 			if (t->srv)
 				t->srv->cur_sess--;
 			//close(t->srv_fd);
 			t->srv_state = SV_STCLOSE;
 			if (!(t->flags & SN_ERR_MASK))
 				t->flags |= SN_ERR_SRVTO;
 			if (!(t->flags & SN_FINST_MASK))
 				t->flags |= SN_FINST_D;
 			/* We used to have a free connection slot. Since we'll never use it,
 			 * we have to inform the server that it may be used by another session.
 			 */
 			if (may_dequeue_tasks(t->srv, t->be))
 				task_wakeup(&rq, t->srv->queue_mgt);

 			return 1;
 		}
 		else if (rep->l == BUFSIZE) { /* no room to read more data */
 			if (MY_FD_ISSET(t->srv_fd, StaticReadEvent)) {
 				MY_FD_CLR(t->srv_fd, StaticReadEvent);
 				tv_eternity(&rep->rex);
 			}
 		}
 		else {
 			if (! MY_FD_ISSET(t->srv_fd, StaticReadEvent)) {
 				MY_FD_SET(t->srv_fd, StaticReadEvent);
 				if (t->be->srvtimeout)
 					tv_delayfrom(&rep->rex, &now, t->be->srvtimeout);
 				else
 					tv_eternity(&rep->rex);
 			}
 		}
 		return 0;
 	}
 	else { /* SV_STCLOSE : nothing to do */
 		if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
 			int len;
 			len = sprintf(trash, "%08x:%s.srvcls[%04x:%04x]\n",
 				      t->uniq_id, t->be->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
 			write(1, trash, len);
 		}
 		return 0;
 	}
 	return 0;
 }


 /*
  * Produces data for the session <s> depending on its source. Expects to be
  * called with s->cli_state == CL_STSHUTR. Right now, only statistics can be
  * produced. It stops by itself by unsetting the SN_SELF_GEN flag from the
  * session, which it uses to keep on being called when there is free space in
  * the buffer, of simply by letting an empty buffer upon return. It returns 1
  * if it changes the session state from CL_STSHUTR, otherwise 0.
  */
 int produce_content(struct session *s)
 {
 	if (s->data_source == DATA_SRC_NONE) {
 		s->flags &= ~SN_SELF_GEN;
 		return 1;
 	}
 	else if (s->data_source == DATA_SRC_STATS) {
 		/* dump server statistics */
 		return produce_content_stats(s);
 	}
 	else {
 		/* unknown data source */
 		s->txn.status = 500;
 		client_retnclose(s, error_message(s, HTTP_ERR_500));
 		if (!(s->flags & SN_ERR_MASK))
 			s->flags |= SN_ERR_PRXCOND;
 		if (!(s->flags & SN_FINST_MASK))
 			s->flags |= SN_FINST_R;
 		s->flags &= ~SN_SELF_GEN;
 		return 1;
 	}
 }


 /*
  * Produces statistics data for the session <s>. Expects to be called with
  * s->cli_state == CL_STSHUTR. It stops by itself by unsetting the SN_SELF_GEN
  * flag from the session, which it uses to keep on being called when there is
  * free space in the buffer, of simply by letting an empty buffer upon return.
  * It returns 1 if it changes the session state from CL_STSHUTR, otherwise 0.
  */
 int produce_content_stats(struct session *s)
 {
 	struct buffer *rep = s->rep;
 	struct proxy *px;
 	struct chunk msg;
 	unsigned int up;

 	msg.len = 0;
 	msg.str = trash;

 	switch (s->data_state) {
 	case DATA_ST_INIT:
 		/* the function had not been called yet */
 		s->flags |= SN_SELF_GEN;  // more data will follow

 		chunk_printf(&msg, sizeof(trash),
 			     "HTTP/1.0 200 OK\r\n"
 			     "Cache-Control: no-cache\r\n"
 			     "Connection: close\r\n"
 			     "Content-Type: text/html\r\n"
 			     "\r\n");

 		s->txn.status = 200;
 		client_retnclose(s, &msg); // send the start of the response.
 		msg.len = 0;

 		if (!(s->flags & SN_ERR_MASK))  // this is not really an error but it is
 			s->flags |= SN_ERR_PRXCOND; // to mark that it comes from the proxy
 		if (!(s->flags & SN_FINST_MASK))
 			s->flags |= SN_FINST_R;

 		if (s->txn.meth == HTTP_METH_HEAD) {
 			/* that's all we return in case of HEAD request */
 			s->data_state = DATA_ST_FIN;
 			s->flags &= ~SN_SELF_GEN;
 			return 1;
 		}

 		s->data_state = DATA_ST_HEAD; /* let's start producing data */
 		/* fall through */

 	case DATA_ST_HEAD:
 		/* WARNING! This must fit in the first buffer !!! */
 		chunk_printf(&msg, sizeof(trash),
 			     "<html><head><title>Statistics Report for " PRODUCT_NAME "</title>\n"
 			     "<meta http-equiv=\"content-type\" content=\"text/html; charset=iso-8859-1\">\n"
 			     "<style type=\"text/css\"><!--\n"
 			     "body {"
 			     " font-family: helvetica, arial;"
 			     " font-size: 12px;"
 			     " font-weight: normal;"
 			     " color: black;"
 			     " background: white;"
 			     "}\n"
 			     "th,td {"
 			     " font-size: 0.8em;"
 			     " align: center;"
 			     "}\n"
 			     "h1 {"
 			     " font-size: xx-large;"
 			     " margin-bottom: 0.5em;"
 			     "}\n"
 			     "h2 {"
 			     " font-family: helvetica, arial;"
 			     " font-size: x-large;"
 			     " font-weight: bold;"
 			     " font-style: italic;"
 			     " color: #6020a0;"
 			     " margin-top: 0em;"
 			     " margin-bottom: 0em;"
 			     "}\n"
 			     "h3 {"
 			     " font-family: helvetica, arial;"
 			     " font-size: 16px;"
 			     " font-weight: bold;"
 			     " color: #b00040;"
 			     " background: #e8e8d0;"
 			     " margin-top: 0em;"
 			     " margin-bottom: 0em;"
 			     "}\n"
 			     "li {"
 			     " margin-top: 0.25em;"
 			     " margin-right: 2em;"
 			     "}\n"
 			     ".hr {margin-top: 0.25em;"
 			     " border-color: black;"
 			     " border-bottom-style: solid;"
 			     "}\n"
 			     ".pxname	{background: #b00040;color: #ffff40;font-weight: bold;}\n"
 			     ".titre	{background: #20D0D0;color: #000000;font-weight: bold;}\n"
 			     ".total	{background: #20D0D0;color: #ffff80;}\n"
 			     ".frontend	{background: #e8e8d0;}\n"
 			     ".backend	{background: #e8e8d0;}\n"
 			     ".active0	{background: #ff9090;}\n"
 			     ".active1	{background: #ffd020;}\n"
 			     ".active2	{background: #ffffa0;}\n"
 			     ".active3	{background: #c0ffc0;}\n"
 			     ".active4	{background: #e0e0e0;}\n"
 			     ".backup0	{background: #ff9090;}\n"
 			     ".backup1	{background: #ff80ff;}\n"
 			     ".backup2	{background: #c060ff;}\n"
 			     ".backup3	{background: #b0d0ff;}\n"
 			     ".backup4	{background: #e0e0e0;}\n"
 			     "table.tbl { border-collapse: collapse; border-style: none;}\n"
 			     "table.tbl td { border-width: 1px 1px 1px 1px; border-style: solid solid solid solid; padding: 2px 3px; border-color: gray;}\n"
 			     "table.tbl th { border-width: 1px; border-style: solid solid solid solid; border-color: gray;}\n"
 			     "table.tbl th.empty { border-style: none; empty-cells: hide;}\n"
 			     "table.lgd { border-collapse: collapse; border-width: 1px; border-style: none none none solid; border-color: black;}\n"
 			     "table.lgd td { border-width: 1px; border-style: solid solid solid solid; border-color: gray; padding: 2px;}\n"
 			     "table.lgd td.noborder { border-style: none; padding: 2px; white-space: nowrap;}\n"
 			     "-->\n"
 			     "</style></head>\n");

 		if (buffer_write_chunk(rep, &msg) != 0)
 			return 0;

 		s->data_state = DATA_ST_INFO;
 		/* fall through */

 	case DATA_ST_INFO:
 		up = (now.tv_sec - start_date.tv_sec);

 		/* WARNING! this has to fit the first packet too.
 			 * We are around 3.5 kB, add adding entries will
 			 * become tricky if we want to support 4kB buffers !
 			 */
 		chunk_printf(&msg, sizeof(trash),
 			     "<body><h1><a href=\"" PRODUCT_URL "\" style=\"text-decoration: none;\">"
 			     PRODUCT_NAME "</a></h1>\n"
 			     "<h2>Statistics Report for pid %d</h2>\n"
 			     "<hr width=\"100%%\" class=\"hr\">\n"
 			     "<h3>&gt; General process information</h3>\n"
 			     "<table border=0 cols=3><tr><td align=\"left\" nowrap width=\"1%%\">\n"
 			     "<p><b>pid = </b> %d (nbproc = %d)<br>\n"
 			     "<b>uptime = </b> %dd %dh%02dm%02ds<br>\n"
 			     "<b>system limits :</b> memmax = %s%s ; ulimit-n = %d<br>\n"
 			     "<b>maxsock = </b> %d<br>\n"
 			     "<b>maxconn = </b> %d (current conns = %d)<br>\n"
 			     "</td><td align=\"center\" nowrap>\n"
 			     "<table class=\"lgd\"><tr>\n"
 			     "<td class=\"active3\">&nbsp;</td><td class=\"noborder\">active UP </td>"
 			     "<td class=\"backup3\">&nbsp;</td><td class=\"noborder\">backup UP </td>"
 			     "</tr><tr>\n"
 			     "<td class=\"active2\"></td><td class=\"noborder\">active UP, going down </td>"
 			     "<td class=\"backup2\"></td><td class=\"noborder\">backup UP, going down </td>"
 			     "</tr><tr>\n"
 			     "<td class=\"active1\"></td><td class=\"noborder\">active DOWN, going up </td>"
 			     "<td class=\"backup1\"></td><td class=\"noborder\">backup DOWN, going up </td>"
 			     "</tr><tr>\n"
 			     "<td class=\"active0\"></td><td class=\"noborder\">active or backup DOWN &nbsp;</td>"
 			     "<td class=\"active4\"></td><td class=\"noborder\">not checked </td>"
 			     "</tr></table>\n"
 			     "</td>"
 			     "<td align=\"left\" nowrap width=\"1%%\">"
 			     "<b>External ressources:</b><ul style=\"margin-top: 0.25em;\">\n"
 			     "<li><a href=\"" PRODUCT_URL "\">Primary site</a><br>\n"
 			     "<li><a href=\"" PRODUCT_URL_UPD "\">Updates (v" PRODUCT_BRANCH ")</a><br>\n"
 			     "<li><a href=\"" PRODUCT_URL_DOC "\">Online manual</a><br>\n"
 			     "</ul>"
 			     "</td>"
 			     "</tr></table>\n"
 			     "",
 			     pid, pid, global.nbproc,
 			     up / 86400, (up % 86400) / 3600,
 			     (up % 3600) / 60, (up % 60),
 			     global.rlimit_memmax ? ultoa(global.rlimit_memmax) : "unlimited",
 			     global.rlimit_memmax ? " MB" : "",
 			     global.rlimit_nofile,
 			     global.maxsock,
 			     global.maxconn,
 			     actconn
 			     );

 		if (buffer_write_chunk(rep, &msg) != 0)
 			return 0;

 		memset(&s->data_ctx, 0, sizeof(s->data_ctx));

 		s->data_ctx.stats.px = proxy;
 		s->data_ctx.stats.px_st = DATA_ST_PX_INIT;
 		s->data_state = DATA_ST_LIST;
 		/* fall through */

 	case DATA_ST_LIST:
 		/* dump proxies */
 		while (s->data_ctx.stats.px) {
 			px = s->data_ctx.stats.px;
 			/* skip the disabled proxies and non-networked ones */
 			if (px->state != PR_STSTOPPED && (px->cap & (PR_CAP_FE | PR_CAP_BE)))
 				if (produce_content_stats_proxy(s, px) == 0)
 					return 0;

 			s->data_ctx.stats.px = px->next;
 			s->data_ctx.stats.px_st = DATA_ST_PX_INIT;
 		}
 		/* here, we just have reached the last proxy */

 		s->data_state = DATA_ST_END;
 		/* fall through */

 	case DATA_ST_END:
 		chunk_printf(&msg, sizeof(trash), "</body></html>\n");
 		if (buffer_write_chunk(rep, &msg) != 0)
 			return 0;

 		s->data_state = DATA_ST_FIN;
 		/* fall through */

 	case DATA_ST_FIN:
 		s->flags &= ~SN_SELF_GEN;
 		return 1;

 	default:
 		/* unknown state ! */
 		s->txn.status = 500;
 		client_retnclose(s, error_message(s, HTTP_ERR_500));
 		if (!(s->flags & SN_ERR_MASK))
 			s->flags |= SN_ERR_PRXCOND;
 		if (!(s->flags & SN_FINST_MASK))
 			s->flags |= SN_FINST_R;
 		s->flags &= ~SN_SELF_GEN;
 		return 1;
 	}
 }


 /*
  * Dumps statistics for a proxy.
  * Returns 0 if it had to stop dumping data because of lack of buffer space,
  * ot non-zero if everything completed.
  */
 int produce_content_stats_proxy(struct session *s, struct proxy *px)
 {
 	struct buffer *rep = s->rep;
 	struct server *sv;
 	struct chunk msg;

 	msg.len = 0;
 	msg.str = trash;

 	switch (s->data_ctx.stats.px_st) {
 	case DATA_ST_PX_INIT:
 		/* we are on a new proxy */

 		if (s->be->uri_auth && s->be->uri_auth->scope) {
 			/* we have a limited scope, we have to check the proxy name */
 			struct stat_scope *scope;
 			int len;

 			len = strlen(px->id);
 			scope = s->be->uri_auth->scope;

 			while (scope) {
 				/* match exact proxy name */
 				if (scope->px_len == len && !memcmp(px->id, scope->px_id, len))
 					break;

 				/* match '.' which means 'self' proxy */
 				if (!strcmp(scope->px_id, ".") && px == s->fe)
 					break;
 				scope = scope->next;
 			}

 			/* proxy name not found : don't dump anything */
 			if (scope == NULL)
 				return 1;
 		}

 		s->data_ctx.stats.px_st = DATA_ST_PX_TH;
 		/* fall through */

 	case DATA_ST_PX_TH:
 		/* print a new table */
 		chunk_printf(&msg, sizeof(trash),
 			     "<table cols=\"20\" class=\"tbl\" width=\"100%%\">\n"
 			     "<tr align=\"center\" class=\"titre\">"
 			     "<th colspan=2 class=\"pxname\">%s</th>"
 			     "<th colspan=18 class=\"empty\"></th>"
 			     "</tr>\n"
 			     "<tr align=\"center\" class=\"titre\">"
 			     "<th rowspan=2></th>"
 			     "<th colspan=2>Queue</th><th colspan=4>Sessions</th>"
 			     "<th colspan=2>Bytes</th><th colspan=2>Denied</th>"
 			     "<th colspan=3>Errors</th><th colspan=6>Server</th>"
 			     "</tr>\n"
 			     "<tr align=\"center\" class=\"titre\">"
 			     "<th>Cur</th><th>Max</th><th>Cur</th><th>Max</th>"
 			     "<th>Limit</th><th>Cumul</th><th>In</th><th>Out</th>"
 			     "<th>Req</th><th>Resp</th><th>Req</th><th>Conn</th>"
 			     "<th>Resp</th><th>Status</th><th>Weight</th><th>Act</th>"
 			     "<th>Bck</th><th>Check</th><th>Down</th></tr>\n"
 			     "",
 			     px->id);

 		if (buffer_write_chunk(rep, &msg) != 0)
 			return 0;

 		s->data_ctx.stats.px_st = DATA_ST_PX_FE;
 		/* fall through */

 	case DATA_ST_PX_FE:
 		/* print the frontend */
 		if (px->cap & PR_CAP_FE) {
 			chunk_printf(&msg, sizeof(trash),
 				     /* name, queue */
 				     "<tr align=center class=\"frontend\"><td>Frontend</td><td colspan=2></td>"
 				     /* sessions : current, max, limit, cumul. */
 				     "<td align=right>%d</td><td align=right>%d</td><td align=right>%d</td><td align=right>%d</td>"
 				     /* bytes : in, out */
 				     "<td align=right>%lld</td><td align=right>%lld</td>"
 				     /* denied: req, resp */
 				     "<td align=right>%d</td><td align=right>%d</td>"
 				     /* errors : request, connect, response */
 				     "<td align=right>%d</td><td align=right></td><td align=right></td>"
 				     /* server status : reflect backend status */
 				     "<td align=center>%s</td>"
 				     /* rest of server: nothing */
 				     "<td align=center colspan=5></td></tr>"
 				     "",
 				     px->feconn, px->feconn_max, px->maxconn, px->cum_feconn,
 				     px->bytes_in, px->bytes_out,
 				     px->denied_req, px->denied_resp,
 				     px->failed_req,
 				     px->state == PR_STRUN ? "OPEN" :
 				     px->state == PR_STIDLE ? "FULL" : "STOP");

 			if (buffer_write_chunk(rep, &msg) != 0)
 				return 0;
 		}

 		s->data_ctx.stats.sv = px->srv; /* may be NULL */
 		s->data_ctx.stats.px_st = DATA_ST_PX_SV;
 		/* fall through */

 	case DATA_ST_PX_SV:
 		/* stats.sv has been initialized above */
 		while (s->data_ctx.stats.sv != NULL) {
 			static char *srv_hlt_st[5] = { "DOWN", "DN %d/%d &uarr;", "UP %d/%d &darr;", "UP", "<i>no check</i>" };
 			int sv_state; /* 0=DOWN, 1=going up, 2=going down, 3=UP, 4=unchecked */

 			sv = s->data_ctx.stats.sv;

 			/* FIXME: produce some small strings for "UP/DOWN x/y &#xxxx;" */
 			if (!(sv->state & SRV_CHECKED))
 				sv_state = 4;
 			else if (sv->state & SRV_RUNNING)
 				if (sv->health == sv->rise + sv->fall - 1)
 					sv_state = 3; /* UP */
 				else
 					sv_state = 2; /* going down */
 			else
 				if (sv->health)
 					sv_state = 1; /* going up */
 				else
 					sv_state = 0; /* DOWN */

 			chunk_printf(&msg, sizeof(trash),
 				     /* name */
 				     "<tr align=\"center\" class=\"%s%d\"><td>%s</td>"
 				     /* queue : current, max */
 				     "<td align=right>%d</td><td align=right>%d</td>"
 				     /* sessions : current, max, limit, cumul */
 				     "<td align=right>%d</td><td align=right>%d</td><td align=right>%s</td><td align=right>%d</td>"
 				     /* bytes : in, out */
 				     "<td align=right>%lld</td><td align=right>%lld</td>"
 				     /* denied: req, resp */
 				     "<td align=right></td><td align=right>%d</td>"
 				     /* errors : request, connect, response */
 				     "<td align=right></td><td align=right>%d</td><td align=right>%d</td>\n"
 				     "",
 				     (sv->state & SRV_BACKUP) ? "backup" : "active",
 				     sv_state, sv->id,
 				     sv->nbpend, sv->nbpend_max,
 				     sv->cur_sess, sv->cur_sess_max, sv->maxconn ? ultoa(sv->maxconn) : "-", sv->cum_sess,
 				     sv->bytes_in, sv->bytes_out,
 				     sv->failed_secu,
 				     sv->failed_conns, sv->failed_resp);

 			/* status */
 			chunk_printf(&msg, sizeof(trash), "<td nowrap>");
 			chunk_printf(&msg, sizeof(trash),
 				     srv_hlt_st[sv_state],
 				     (sv->state & SRV_RUNNING) ? (sv->health - sv->rise + 1) : (sv->health),
 				     (sv->state & SRV_RUNNING) ? (sv->fall) : (sv->rise));

 			chunk_printf(&msg, sizeof(trash),
 				     /* weight */
 				     "</td><td>%d</td>"
 				     /* act, bck */
 				     "<td>%s</td><td>%s</td>"
 				     "",
 				     sv->uweight,
 				     (sv->state & SRV_BACKUP) ? "-" : "Y",
 				     (sv->state & SRV_BACKUP) ? "Y" : "-");

 			/* check failures : unique, fatal */
 			if (sv->state & SRV_CHECKED)
 				chunk_printf(&msg, sizeof(trash),
 					     "<td align=right>%d</td><td align=right>%d</td></tr>\n",
 					     sv->failed_checks, sv->down_trans);
 			else
 				chunk_printf(&msg, sizeof(trash),
 					     "<td colspan=2></td></tr>\n");

 			if (buffer_write_chunk(rep, &msg) != 0)
 				return 0;

 			s->data_ctx.stats.sv = sv->next;
 		} /* while sv */

 		s->data_ctx.stats.px_st = DATA_ST_PX_BE;
 		/* fall through */

 	case DATA_ST_PX_BE:
 		/* print the backend */
 		if (px->cap & PR_CAP_BE) {
 			chunk_printf(&msg, sizeof(trash),
 				     /* name */
 				     "<tr align=center class=\"backend\"><td>Backend</td>"
 				     /* queue : current, max */
 				     "<td align=right>%d</td><td align=right>%d</td>"
 				     /* sessions : current, max, limit, cumul. */
 				     "<td align=right>%d</td><td align=right>%d</td><td align=right>%d</td><td align=right>%d</td>"
 				     /* bytes : in, out */
 				     "<td align=right>%lld</td><td align=right>%lld</td>"
 				     /* denied: req, resp */
 				     "<td align=right>%d</td><td align=right>%d</td>"
 				     /* errors : request, connect, response */
 				     "<td align=right></td><td align=right>%d</td><td align=right>%d</td>\n"
 				     /* server status : reflect backend status (up/down) : we display UP
 				      * if the backend has known working servers or if it has no server at
 				      * all (eg: for stats). Tthen we display the total weight, number of
 				      * active and backups. */
 				     "<td align=center>%s</td><td align=center>%d</td>"
 				     "<td align=center>%d</td><td align=center>%d</td>"
 				     /* rest of server: nothing */
 				     "<td align=center colspan=2></td></tr>"
 				     "",
 				     px->nbpend /* or px->totpend ? */, px->nbpend_max,
 				     px->beconn, px->beconn_max, px->fullconn, px->cum_beconn,
 				     px->bytes_in, px->bytes_out,
 				     px->denied_req, px->denied_resp,
 				     px->failed_conns, px->failed_resp,
 				     (px->srv_map_sz > 0 || !px->srv) ? "UP" : "DOWN",
 				     px->srv_map_sz, px->srv_act, px->srv_bck);

 			if (buffer_write_chunk(rep, &msg) != 0)
 				return 0;
 		}

 		s->data_ctx.stats.px_st = DATA_ST_PX_END;
 		/* fall through */

 	case DATA_ST_PX_END:
 		chunk_printf(&msg, sizeof(trash), "</table><p>\n");

 		if (buffer_write_chunk(rep, &msg) != 0)
 			return 0;

 		s->data_ctx.stats.px_st = DATA_ST_PX_FIN;
 		/* fall through */

 	case DATA_ST_PX_FIN:
 		return 1;

 	default:
 		/* unknown state, we should put an abort() here ! */
 		return 1;
 	}
 }


 /* Iterate the same filter through all request headers.
  * Returns 1 if this filter can be stopped upon return, otherwise 0.
  * Since it can manage the switch to another backend, it updates the per-proxy
  * DENY stats.
  */
 int apply_filter_to_req_headers(struct session *t, struct buffer *req, struct hdr_exp *exp)
 {
 	char term;
 	char *cur_ptr, *cur_end, *cur_next;
 	int cur_idx, old_idx, last_hdr;
 	struct http_txn *txn = &t->txn;
 	struct hdr_idx_elem *cur_hdr;
 	int len, delta;

 	last_hdr = 0;

 	cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
 	old_idx = 0;

 	while (!last_hdr) {
 		if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT)))
 			return 1;
 		else if (unlikely(txn->flags & TX_CLALLOW) &&
 			 (exp->action == ACT_ALLOW ||
 			  exp->action == ACT_DENY ||
 			  exp->action == ACT_TARPIT))
 			return 0;

 		cur_idx = txn->hdr_idx.v[old_idx].next;
 		if (!cur_idx)
 			break;

 		cur_hdr  = &txn->hdr_idx.v[cur_idx];
 		cur_ptr  = cur_next;
 		cur_end  = cur_ptr + cur_hdr->len;
 		cur_next = cur_end + cur_hdr->cr + 1;

 		/* Now we have one header between cur_ptr and cur_end,
 		 * and the next header starts at cur_next.
 		 */

 		/* The annoying part is that pattern matching needs
 		 * that we modify the contents to null-terminate all
 		 * strings before testing them.
 		 */

 		term = *cur_end;
 		*cur_end = '\0';

 		if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
 			switch (exp->action) {
 			case ACT_SETBE:
 				/* It is not possible to jump a second time.
 				 * FIXME: should we return an HTTP/500 here so that
 				 * the admin knows there's a problem ?
 				 */
 				if (t->be != t->fe)
 					break;

 				/* Swithing Proxy */
 				t->be = (struct proxy *) exp->replace;

 				/* right now, the backend switch is not too much complicated
 				 * because we have associated req_cap and rsp_cap to the
 				 * frontend, and the beconn will be updated later.
 				 */

 				t->rep->rto = t->req->wto = t->be->srvtimeout;
 				t->req->cto = t->be->contimeout;
 				last_hdr = 1;
 				break;

 			case ACT_ALLOW:
 				txn->flags |= TX_CLALLOW;
 				last_hdr = 1;
 				break;

 			case ACT_DENY:
 				txn->flags |= TX_CLDENY;
 				last_hdr = 1;
 				t->be->denied_req++;
 				break;

 			case ACT_TARPIT:
 				txn->flags |= TX_CLTARPIT;
 				last_hdr = 1;
 				t->be->denied_req++;
 				break;

 			case ACT_REPLACE:
 				len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
 				delta = buffer_replace2(req, cur_ptr, cur_end, trash, len);
 				/* FIXME: if the user adds a newline in the replacement, the
 				 * index will not be recalculated for now, and the new line
 				 * will not be counted as a new header.
 				 */

 				cur_end += delta;
 				cur_next += delta;
 				cur_hdr->len += delta;
 				txn->req.eoh += delta;
 				break;

 			case ACT_REMOVE:
 				delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
 				cur_next += delta;

 				/* FIXME: this should be a separate function */
 				txn->req.eoh += delta;
 				txn->hdr_idx.v[old_idx].next = cur_hdr->next;
 				txn->hdr_idx.used--;
 				cur_hdr->len = 0;
 				cur_end = NULL; /* null-term has been rewritten */
 				break;

 			}
 		}
 		if (cur_end)
 			*cur_end = term; /* restore the string terminator */

 		/* keep the link from this header to next one in case of later
 		 * removal of next header.
 		 */
 		old_idx = cur_idx;
 	}
 	return 0;
 }


 /* Apply the filter to the request line.
  * Returns 0 if nothing has been done, 1 if the filter has been applied,
  * or -1 if a replacement resulted in an invalid request line.
  * Since it can manage the switch to another backend, it updates the per-proxy
  * DENY stats.
  */
 int apply_filter_to_req_line(struct session *t, struct buffer *req, struct hdr_exp *exp)
 {
 	char term;
 	char *cur_ptr, *cur_end;
 	int done;
 	struct http_txn *txn = &t->txn;
 	int len, delta;


 	if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT)))
 		return 1;
 	else if (unlikely(txn->flags & TX_CLALLOW) &&
 		 (exp->action == ACT_ALLOW ||
 		  exp->action == ACT_DENY ||
 		  exp->action == ACT_TARPIT))
 		return 0;
 	else if (exp->action == ACT_REMOVE)
 		return 0;

 	done = 0;

 	cur_ptr = req->data + txn->req.som;
 	cur_end = cur_ptr + txn->req.sl.rq.l;

 	/* Now we have the request line between cur_ptr and cur_end */

 	/* The annoying part is that pattern matching needs
 	 * that we modify the contents to null-terminate all
 	 * strings before testing them.
 	 */

 	term = *cur_end;
 	*cur_end = '\0';

 	if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
 		switch (exp->action) {
 		case ACT_SETBE:
 			/* It is not possible to jump a second time.
 			 * FIXME: should we return an HTTP/500 here so that
 			 * the admin knows there's a problem ?
 			 */
 			if (t->be != t->fe)
 				break;

 			/* Swithing Proxy */
 			t->be = (struct proxy *) exp->replace;

 			/* right now, the backend switch is not too much complicated
 			 * because we have associated req_cap and rsp_cap to the
 			 * frontend, and the beconn will be updated later.
 			 */

 			t->rep->rto = t->req->wto = t->be->srvtimeout;
 			t->req->cto = t->be->contimeout;
 			done = 1;
 			break;

 		case ACT_ALLOW:
 			txn->flags |= TX_CLALLOW;
 			done = 1;
 			break;

 		case ACT_DENY:
 			txn->flags |= TX_CLDENY;
 			t->be->denied_req++;
 			done = 1;
 			break;

 		case ACT_TARPIT:
 			txn->flags |= TX_CLTARPIT;
 			t->be->denied_req++;
 			done = 1;
 			break;

 		case ACT_REPLACE:
 			*cur_end = term; /* restore the string terminator */
 			len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
 			delta = buffer_replace2(req, cur_ptr, cur_end, trash, len);
 			/* FIXME: if the user adds a newline in the replacement, the
 			 * index will not be recalculated for now, and the new line
 			 * will not be counted as a new header.
 			 */

 			txn->req.eoh += delta;
 			cur_end += delta;

 			txn->req.sol = req->data + txn->req.som;
 			cur_end = (char *)http_parse_reqline(&txn->req, req->data,
 							     HTTP_MSG_RQMETH,
 							     cur_ptr, cur_end + 1,
 							     NULL, NULL);
 			if (unlikely(!cur_end))
 				return -1;

 			/* we have a full request and we know that we have either a CR
 			 * or an LF at <ptr>.
 			 */
 			txn->meth = find_http_meth(cur_ptr, txn->req.sl.rq.m_l);
 			hdr_idx_set_start(&txn->hdr_idx, txn->req.sl.rq.l, *cur_end == '\r');
 			/* there is no point trying this regex on headers */
 			return 1;
 		}
 	}
 	*cur_end = term; /* restore the string terminator */
 	return done;
 }


 /*
  * Apply all the req filters <exp> to all headers in buffer <req> of session <t>.
  * Returns 0 if everything is alright, or -1 in case a replacement lead to an
  * unparsable request. Since it can manage the switch to another backend, it
  * updates the per-proxy DENY stats.
  */
 int apply_filters_to_request(struct session *t, struct buffer *req, struct hdr_exp *exp)
 {
 	struct http_txn *txn = &t->txn;
 	/* iterate through the filters in the outer loop */
 	while (exp && !(txn->flags & (TX_CLDENY|TX_CLTARPIT))) {
 		int ret;

 		/*
 		 * The interleaving of transformations and verdicts
 		 * makes it difficult to decide to continue or stop
 		 * the evaluation.
 		 */

 		if ((txn->flags & TX_CLALLOW) &&
 		    (exp->action == ACT_ALLOW || exp->action == ACT_DENY ||
 		     exp->action == ACT_TARPIT || exp->action == ACT_PASS)) {
 			exp = exp->next;
 			continue;
 		}

 		/* Apply the filter to the request line. */
 		ret = apply_filter_to_req_line(t, req, exp);
 		if (unlikely(ret < 0))
 			return -1;

 		if (likely(ret == 0)) {
 			/* The filter did not match the request, it can be
 			 * iterated through all headers.
 			 */
 			apply_filter_to_req_headers(t, req, exp);
 		}
 		exp = exp->next;
 	}
 	return 0;
 }


 /*
  * Manager client-side cookie
  */
 void manage_client_side_cookies(struct session *t, struct buffer *req)
 {
 	struct http_txn *txn = &t->txn;
 	char *p1, *p2, *p3, *p4;
 	char *del_colon, *del_cookie, *colon;
 	int app_cookies;

 	appsess *asession_temp = NULL;
 	appsess local_asession;

 	char *cur_ptr, *cur_end, *cur_next;
 	int cur_idx, old_idx;

 	if (t->be->cookie_name == NULL &&
 	    t->be->appsession_name == NULL &&
 	    t->be->capture_name == NULL)
 		return;

 	/* Iterate through the headers.
 	 * we start with the start line.
 	 */
 	old_idx = 0;
 	cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);

 	while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
 		struct hdr_idx_elem *cur_hdr;
 		int val;

 		cur_hdr  = &txn->hdr_idx.v[cur_idx];
 		cur_ptr  = cur_next;
 		cur_end  = cur_ptr + cur_hdr->len;
 		cur_next = cur_end + cur_hdr->cr + 1;

 		/* We have one full header between cur_ptr and cur_end, and the
 		 * next header starts at cur_next. We're only interested in
 		 * "Cookie:" headers.
 		 */

 		val = http_header_match2(cur_ptr, cur_end, "Cookie", 6);
 		if (!val) {
 			old_idx = cur_idx;
 			continue;
 		}

 		/* Now look for cookies. Conforming to RFC2109, we have to support
 		 * attributes whose name begin with a '$', and associate them with
 		 * the right cookie, if we want to delete this cookie.
 		 * So there are 3 cases for each cookie read :
 		 * 1) it's a special attribute, beginning with a '$' : ignore it.
 		 * 2) it's a server id cookie that we *MAY* want to delete : save
 		 *    some pointers on it (last semi-colon, beginning of cookie...)
 		 * 3) it's an application cookie : we *MAY* have to delete a previous
 		 *    "special" cookie.
 		 * At the end of loop, if a "special" cookie remains, we may have to
 		 * remove it. If no application cookie persists in the header, we
 		 * *MUST* delete it
 		 */

 		colon = p1 = cur_ptr + val; /* first non-space char after 'Cookie:' */

 		/* del_cookie == NULL => nothing to be deleted */
 		del_colon = del_cookie = NULL;
 		app_cookies = 0;

 		while (p1 < cur_end) {
 			/* skip spaces and colons, but keep an eye on these ones */
 			while (p1 < cur_end) {
 				if (*p1 == ';' || *p1 == ',')
 					colon = p1;
 				else if (!isspace((int)*p1))
 					break;
 				p1++;
 			}

 			if (p1 == cur_end)
 				break;

 			/* p1 is at the beginning of the cookie name */
 			p2 = p1;
 			while (p2 < cur_end && *p2 != '=')
 				p2++;

 			if (p2 == cur_end)
 				break;

 			p3 = p2 + 1; /* skips the '=' sign */
 			if (p3 == cur_end)
 				break;

 			p4 = p3;
 			while (p4 < cur_end && !isspace((int)*p4) && *p4 != ';' && *p4 != ',')
 				p4++;

 			/* here, we have the cookie name between p1 and p2,
 			 * and its value between p3 and p4.
 			 * we can process it :
 			 *
 			 * Cookie: NAME=VALUE;
 			 * |      ||   ||    |
 			 * |      ||   ||    +--> p4
 			 * |      ||   |+-------> p3
 			 * |      ||   +--------> p2
 			 * |      |+------------> p1
 			 * |      +-------------> colon
 			 * +--------------------> cur_ptr
 			 */

 			if (*p1 == '$') {
 				/* skip this one */
 			}
 			else {
 				/* first, let's see if we want to capture it */
 				if (t->fe->capture_name != NULL &&
 				    txn->cli_cookie == NULL &&
 				    (p4 - p1 >= t->fe->capture_namelen) &&
 				    memcmp(p1, t->fe->capture_name, t->fe->capture_namelen) == 0) {
 					int log_len = p4 - p1;

 					if ((txn->cli_cookie = pool_alloc(capture)) == NULL) {
 						Alert("HTTP logging : out of memory.\n");
 					} else {
 						if (log_len > t->fe->capture_len)
 							log_len = t->fe->capture_len;
 						memcpy(txn->cli_cookie, p1, log_len);
 						txn->cli_cookie[log_len] = 0;
 					}
 				}

 				if ((p2 - p1 == t->be->cookie_len) && (t->be->cookie_name != NULL) &&
 				    (memcmp(p1, t->be->cookie_name, p2 - p1) == 0)) {
 					/* Cool... it's the right one */
 					struct server *srv = t->be->srv;
 					char *delim;

 					/* if we're in cookie prefix mode, we'll search the delimitor so that we
 					 * have the server ID betweek p3 and delim, and the original cookie between
 					 * delim+1 and p4. Otherwise, delim==p4 :
 					 *
 					 * Cookie: NAME=SRV~VALUE;
 					 * |      ||   ||  |     |
 					 * |      ||   ||  |     +--> p4
 					 * |      ||   ||  +--------> delim
 					 * |      ||   |+-----------> p3
 					 * |      ||   +------------> p2
 					 * |      |+----------------> p1
 					 * |      +-----------------> colon
 					 * +------------------------> cur_ptr
 					 */

 					if (t->be->options & PR_O_COOK_PFX) {
 						for (delim = p3; delim < p4; delim++)
 							if (*delim == COOKIE_DELIM)
 								break;
 					}
 					else
 						delim = p4;


 					/* Here, we'll look for the first running server which supports the cookie.
 					 * This allows to share a same cookie between several servers, for example
 					 * to dedicate backup servers to specific servers only.
 					 * However, to prevent clients from sticking to cookie-less backup server
 					 * when they have incidentely learned an empty cookie, we simply ignore
 					 * empty cookies and mark them as invalid.
 					 */
 					if (delim == p3)
 						srv = NULL;

 					while (srv) {
 						if (srv->cookie && (srv->cklen == delim - p3) &&
 						    !memcmp(p3, srv->cookie, delim - p3)) {
 							if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
 								/* we found the server and it's usable */
 								txn->flags &= ~TX_CK_MASK;
 								txn->flags |= TX_CK_VALID;
 								t->flags |= SN_DIRECT | SN_ASSIGNED;
 								t->srv = srv;
 								break;
 							} else {
 								/* we found a server, but it's down */
 								txn->flags &= ~TX_CK_MASK;
 								txn->flags |= TX_CK_DOWN;
 							}
 						}
 						srv = srv->next;
 					}

 					if (!srv && !(txn->flags & TX_CK_DOWN)) {
 						/* no server matched this cookie */
 						txn->flags &= ~TX_CK_MASK;
 						txn->flags |= TX_CK_INVALID;
 					}

 					/* depending on the cookie mode, we may have to either :
 					 * - delete the complete cookie if we're in insert+indirect mode, so that
 					 *   the server never sees it ;
 					 * - remove the server id from the cookie value, and tag the cookie as an
 					 *   application cookie so that it does not get accidentely removed later,
 					 *   if we're in cookie prefix mode
 					 */
 					if ((t->be->options & PR_O_COOK_PFX) && (delim != p4)) {
 						int delta; /* negative */

 						delta = buffer_replace2(req, p3, delim + 1, NULL, 0);
 						p4  += delta;
 						cur_end += delta;
 						cur_next += delta;
 						cur_hdr->len += delta;
 						txn->req.eoh += delta;

 						del_cookie = del_colon = NULL;
 						app_cookies++;	/* protect the header from deletion */
 					}
 					else if (del_cookie == NULL &&
 						 (t->be->options & (PR_O_COOK_INS | PR_O_COOK_IND)) == (PR_O_COOK_INS | PR_O_COOK_IND)) {
 						del_cookie = p1;
 						del_colon = colon;
 					}
 				} else {
 					/* now we know that we must keep this cookie since it's
 					 * not ours. But if we wanted to delete our cookie
 					 * earlier, we cannot remove the complete header, but we
 					 * can remove the previous block itself.
 					 */
 					app_cookies++;

 					if (del_cookie != NULL) {
 						int delta; /* negative */

 						delta = buffer_replace2(req, del_cookie, p1, NULL, 0);
 						p4  += delta;
 						cur_end += delta;
 						cur_next += delta;
 						cur_hdr->len += delta;
 						txn->req.eoh += delta;
 						del_cookie = del_colon = NULL;
 					}
 				}

 				if ((t->be->appsession_name != NULL) &&
 				    (memcmp(p1, t->be->appsession_name, p2 - p1) == 0)) {
 					/* first, let's see if the cookie is our appcookie*/

 					/* Cool... it's the right one */

 					asession_temp = &local_asession;

 					if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) {
 						Alert("Not enough memory process_cli():asession->sessid:malloc().\n");
 						send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession->sessid:malloc().\n");
 						return;
 					}

 					memcpy(asession_temp->sessid, p3, t->be->appsession_len);
 					asession_temp->sessid[t->be->appsession_len] = 0;
 					asession_temp->serverid = NULL;

 					/* only do insert, if lookup fails */
 					if (chtbl_lookup(&(t->be->htbl_proxy), (void *) &asession_temp) != 0) {
 						if ((asession_temp = pool_alloc(appsess)) == NULL) {
 							/* free previously allocated memory */
 							pool_free_to(apools.sessid, local_asession.sessid);
 							Alert("Not enough memory process_cli():asession:calloc().\n");
 							send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
 							return;
 						}

 						asession_temp->sessid = local_asession.sessid;
 						asession_temp->serverid = local_asession.serverid;
 						chtbl_insert(&(t->be->htbl_proxy), (void *) asession_temp);
 					} else {
 						/* free previously allocated memory */
 						pool_free_to(apools.sessid, local_asession.sessid);
 					}

 					if (asession_temp->serverid == NULL) {
 						Alert("Found Application Session without matching server.\n");
 					} else {
 						struct server *srv = t->be->srv;
 						while (srv) {
 							if (strcmp(srv->id, asession_temp->serverid) == 0) {
 								if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
 									/* we found the server and it's usable */
 									txn->flags &= ~TX_CK_MASK;
 									txn->flags |= TX_CK_VALID;
 									t->flags |= SN_DIRECT | SN_ASSIGNED;
 									t->srv = srv;
 									break;
 								} else {
 									txn->flags &= ~TX_CK_MASK;
 									txn->flags |= TX_CK_DOWN;
 								}
 							}
 							srv = srv->next;
 						}/* end while(srv) */
 					}/* end else if server == NULL */

 					tv_delayfrom(&asession_temp->expire, &now, t->be->appsession_timeout);
 				}/* end if ((t->proxy->appsession_name != NULL) ... */
 			}

 			/* we'll have to look for another cookie ... */
 			p1 = p4;
 		} /* while (p1 < cur_end) */

 		/* There's no more cookie on this line.
 		 * We may have marked the last one(s) for deletion.
 		 * We must do this now in two ways :
 		 *  - if there is no app cookie, we simply delete the header ;
 		 *  - if there are app cookies, we must delete the end of the
 		 *    string properly, including the colon/semi-colon before
 		 *    the cookie name.
 		 */
 		if (del_cookie != NULL) {
 			int delta;
 			if (app_cookies) {
 				delta = buffer_replace2(req, del_colon, cur_end, NULL, 0);
 				cur_end = del_colon;
 				cur_hdr->len += delta;
 			} else {
 				delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);

 				/* FIXME: this should be a separate function */
 				txn->hdr_idx.v[old_idx].next = cur_hdr->next;
 				txn->hdr_idx.used--;
 				cur_hdr->len = 0;
 			}
 			cur_next += delta;
 			txn->req.eoh += delta;
 		}

 		/* keep the link from this header to next one */
 		old_idx = cur_idx;
 	} /* end of cookie processing on this header */
 }


 /* Iterate the same filter through all response headers contained in <rtr>.
  * Returns 1 if this filter can be stopped upon return, otherwise 0.
  */
 int apply_filter_to_resp_headers(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
 {
 	char term;
 	char *cur_ptr, *cur_end, *cur_next;
 	int cur_idx, old_idx, last_hdr;
 	struct http_txn *txn = &t->txn;
 	struct hdr_idx_elem *cur_hdr;
 	int len, delta;

 	last_hdr = 0;

 	cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
 	old_idx = 0;

 	while (!last_hdr) {
 		if (unlikely(txn->flags & TX_SVDENY))
 			return 1;
 		else if (unlikely(txn->flags & TX_SVALLOW) &&
 			 (exp->action == ACT_ALLOW ||
 			  exp->action == ACT_DENY))
 			return 0;

 		cur_idx = txn->hdr_idx.v[old_idx].next;
 		if (!cur_idx)
 			break;

 		cur_hdr  = &txn->hdr_idx.v[cur_idx];
 		cur_ptr  = cur_next;
 		cur_end  = cur_ptr + cur_hdr->len;
 		cur_next = cur_end + cur_hdr->cr + 1;

 		/* Now we have one header between cur_ptr and cur_end,
 		 * and the next header starts at cur_next.
 		 */

 		/* The annoying part is that pattern matching needs
 		 * that we modify the contents to null-terminate all
 		 * strings before testing them.
 		 */

 		term = *cur_end;
 		*cur_end = '\0';

 		if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
 			switch (exp->action) {
 			case ACT_ALLOW:
 				txn->flags |= TX_SVALLOW;
 				last_hdr = 1;
 				break;

 			case ACT_DENY:
 				txn->flags |= TX_SVDENY;
 				last_hdr = 1;
 				break;

 			case ACT_REPLACE:
 				len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
 				delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len);
 				/* FIXME: if the user adds a newline in the replacement, the
 				 * index will not be recalculated for now, and the new line
 				 * will not be counted as a new header.
 				 */

 				cur_end += delta;
 				cur_next += delta;
 				cur_hdr->len += delta;
 				txn->rsp.eoh += delta;
 				break;

 			case ACT_REMOVE:
 				delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0);
 				cur_next += delta;

 				/* FIXME: this should be a separate function */
 				txn->rsp.eoh += delta;
 				txn->hdr_idx.v[old_idx].next = cur_hdr->next;
 				txn->hdr_idx.used--;
 				cur_hdr->len = 0;
 				cur_end = NULL; /* null-term has been rewritten */
 				break;

 			}
 		}
 		if (cur_end)
 			*cur_end = term; /* restore the string terminator */

 		/* keep the link from this header to next one in case of later
 		 * removal of next header.
 		 */
 		old_idx = cur_idx;
 	}
 	return 0;
 }


 /* Apply the filter to the status line in the response buffer <rtr>.
  * Returns 0 if nothing has been done, 1 if the filter has been applied,
  * or -1 if a replacement resulted in an invalid status line.
  */
 int apply_filter_to_sts_line(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
 {
 	char term;
 	char *cur_ptr, *cur_end;
 	int done;
 	struct http_txn *txn = &t->txn;
 	int len, delta;


 	if (unlikely(txn->flags & TX_SVDENY))
 		return 1;
 	else if (unlikely(txn->flags & TX_SVALLOW) &&
 		 (exp->action == ACT_ALLOW ||
 		  exp->action == ACT_DENY))
 		return 0;
 	else if (exp->action == ACT_REMOVE)
 		return 0;

 	done = 0;

 	cur_ptr = rtr->data + txn->rsp.som;
 	cur_end = cur_ptr + txn->rsp.sl.rq.l;

 	/* Now we have the status line between cur_ptr and cur_end */

 	/* The annoying part is that pattern matching needs
 	 * that we modify the contents to null-terminate all
 	 * strings before testing them.
 	 */

 	term = *cur_end;
 	*cur_end = '\0';

 	if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
 		switch (exp->action) {
 		case ACT_ALLOW:
 			txn->flags |= TX_SVALLOW;
 			done = 1;
 			break;

 		case ACT_DENY:
 			txn->flags |= TX_SVDENY;
 			done = 1;
 			break;

 		case ACT_REPLACE:
 			*cur_end = term; /* restore the string terminator */
 			len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
 			delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len);
 			/* FIXME: if the user adds a newline in the replacement, the
 			 * index will not be recalculated for now, and the new line
 			 * will not be counted as a new header.
 			 */

 			txn->rsp.eoh += delta;
 			cur_end += delta;

 			txn->rsp.sol = rtr->data + txn->rsp.som;
 			cur_end = (char *)http_parse_stsline(&txn->rsp, rtr->data,
 							     HTTP_MSG_RPVER,
 							     cur_ptr, cur_end + 1,
 							     NULL, NULL);
 			if (unlikely(!cur_end))
 				return -1;

 			/* we have a full respnse and we know that we have either a CR
 			 * or an LF at <ptr>.
 			 */
 			txn->status = strl2ui(rtr->data + txn->rsp.sl.st.c, txn->rsp.sl.st.c_l);
 			hdr_idx_set_start(&txn->hdr_idx, txn->rsp.sl.rq.l, *cur_end == '\r');
 			/* there is no point trying this regex on headers */
 			return 1;
 		}
 	}
 	*cur_end = term; /* restore the string terminator */
 	return done;
 }


 /*
  * Apply all the resp filters <exp> to all headers in buffer <rtr> of session <t>.
  * Returns 0 if everything is alright, or -1 in case a replacement lead to an
  * unparsable response.
  */
 int apply_filters_to_response(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
 {
 	struct http_txn *txn = &t->txn;
 	/* iterate through the filters in the outer loop */
 	while (exp && !(txn->flags & TX_SVDENY)) {
 		int ret;

 		/*
 		 * The interleaving of transformations and verdicts
 		 * makes it difficult to decide to continue or stop
 		 * the evaluation.
 		 */

 		if ((txn->flags & TX_SVALLOW) &&
 		    (exp->action == ACT_ALLOW || exp->action == ACT_DENY ||
 		     exp->action == ACT_PASS)) {
 			exp = exp->next;
 			continue;
 		}

 		/* Apply the filter to the status line. */
 		ret = apply_filter_to_sts_line(t, rtr, exp);
 		if (unlikely(ret < 0))
 			return -1;

 		if (likely(ret == 0)) {
 			/* The filter did not match the response, it can be
 			 * iterated through all headers.
 			 */
 			apply_filter_to_resp_headers(t, rtr, exp);
 		}
 		exp = exp->next;
 	}
 	return 0;
 }


 /*
  * Manager server-side cookies
  */
 void manage_server_side_cookies(struct session *t, struct buffer *rtr)
 {
 	struct http_txn *txn = &t->txn;
 	char *p1, *p2, *p3, *p4;

 	appsess *asession_temp = NULL;
 	appsess local_asession;

 	char *cur_ptr, *cur_end, *cur_next;
 	int cur_idx, old_idx, delta;

 	if (t->be->cookie_name == NULL &&
 	    t->be->appsession_name == NULL &&
 	    t->be->capture_name == NULL &&
 	    !(t->be->options & PR_O_CHK_CACHE))
 		return;

 	/* Iterate through the headers.
 	 * we start with the start line.
 	 */
 	old_idx = 0;
 	cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);

 	while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
 		struct hdr_idx_elem *cur_hdr;
 		int val;

 		cur_hdr  = &txn->hdr_idx.v[cur_idx];
 		cur_ptr  = cur_next;
 		cur_end  = cur_ptr + cur_hdr->len;
 		cur_next = cur_end + cur_hdr->cr + 1;

 		/* We have one full header between cur_ptr and cur_end, and the
 		 * next header starts at cur_next. We're only interested in
 		 * "Cookie:" headers.
 		 */

 		val = http_header_match2(cur_ptr, cur_end, "Set-Cookie", 10);
 		if (!val) {
 			old_idx = cur_idx;
 			continue;
 		}

 		/* OK, right now we know we have a set-cookie at cur_ptr */
 		txn->flags |= TX_SCK_ANY;


 		/* maybe we only wanted to see if there was a set-cookie */
 		if (t->be->cookie_name == NULL &&
 		    t->be->appsession_name == NULL &&
 		    t->be->capture_name == NULL)
 			return;

 		p1 = cur_ptr + val; /* first non-space char after 'Set-Cookie:' */

 		while (p1 < cur_end) { /* in fact, we'll break after the first cookie */
 			if (p1 == cur_end || *p1 == ';') /* end of cookie */
 				break;

 			/* p1 is at the beginning of the cookie name */
 			p2 = p1;

 			while (p2 < cur_end && *p2 != '=' && *p2 != ';')
 				p2++;

 			if (p2 == cur_end || *p2 == ';') /* next cookie */
 				break;

 			p3 = p2 + 1; /* skip the '=' sign */
 			if (p3 == cur_end)
 				break;

 			p4 = p3;
 			while (p4 < cur_end && !isspace((int)*p4) && *p4 != ';')
 				p4++;

 			/* here, we have the cookie name between p1 and p2,
 			 * and its value between p3 and p4.
 			 * we can process it.
 			 */

 			/* first, let's see if we want to capture it */
 			if (t->be->capture_name != NULL &&
 			    txn->srv_cookie == NULL &&
 			    (p4 - p1 >= t->be->capture_namelen) &&
 			    memcmp(p1, t->be->capture_name, t->be->capture_namelen) == 0) {
 				int log_len = p4 - p1;

 				if ((txn->srv_cookie = pool_alloc(capture)) == NULL) {
 					Alert("HTTP logging : out of memory.\n");
 				}

 				if (log_len > t->be->capture_len)
 					log_len = t->be->capture_len;
 				memcpy(txn->srv_cookie, p1, log_len);
 				txn->srv_cookie[log_len] = 0;
 			}

 			/* now check if we need to process it for persistence */
 			if ((p2 - p1 == t->be->cookie_len) && (t->be->cookie_name != NULL) &&
 			    (memcmp(p1, t->be->cookie_name, p2 - p1) == 0)) {
 				/* Cool... it's the right one */
 				txn->flags |= TX_SCK_SEEN;

 				/* If the cookie is in insert mode on a known server, we'll delete
 				 * this occurrence because we'll insert another one later.
 				 * We'll delete it too if the "indirect" option is set and we're in
 				 * a direct access. */
 				if (((t->srv) && (t->be->options & PR_O_COOK_INS)) ||
 				    ((t->flags & SN_DIRECT) && (t->be->options & PR_O_COOK_IND))) {
 					/* this header must be deleted */
 					delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0);
 					txn->hdr_idx.v[old_idx].next = cur_hdr->next;
 					txn->hdr_idx.used--;
 					cur_hdr->len = 0;
 					cur_next += delta;
 					txn->rsp.eoh += delta;

 					txn->flags |= TX_SCK_DELETED;
 				}
 				else if ((t->srv) && (t->srv->cookie) &&
 					 (t->be->options & PR_O_COOK_RW)) {
 					/* replace bytes p3->p4 with the cookie name associated
 					 * with this server since we know it.
 					 */
 					delta = buffer_replace2(rtr, p3, p4, t->srv->cookie, t->srv->cklen);
 					cur_hdr->len += delta;
 					cur_next += delta;
 					txn->rsp.eoh += delta;

 					txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED;
 				}
 				else if ((t->srv) && (t->srv->cookie) &&
 					 (t->be->options & PR_O_COOK_PFX)) {
 					/* insert the cookie name associated with this server
 					 * before existing cookie, and insert a delimitor between them..
 					 */
 					delta = buffer_replace2(rtr, p3, p3, t->srv->cookie, t->srv->cklen + 1);
 					cur_hdr->len += delta;
 					cur_next += delta;
 					txn->rsp.eoh += delta;

 					p3[t->srv->cklen] = COOKIE_DELIM;
 					txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED;
 				}
 			}
 			/* next, let's see if the cookie is our appcookie */
 			else if ((t->be->appsession_name != NULL) &&
 			         (memcmp(p1, t->be->appsession_name, p2 - p1) == 0)) {

 				/* Cool... it's the right one */

 				size_t server_id_len = strlen(t->srv->id) + 1;
 				asession_temp = &local_asession;

 				if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) {
 					Alert("Not enough Memory process_srv():asession->sessid:malloc().\n");
 					send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n");
 					return;
 				}
 				memcpy(asession_temp->sessid, p3, t->be->appsession_len);
 				asession_temp->sessid[t->be->appsession_len] = 0;
 				asession_temp->serverid = NULL;

 				/* only do insert, if lookup fails */
 				if (chtbl_lookup(&(t->be->htbl_proxy), (void *) &asession_temp) != 0) {
 					if ((asession_temp = pool_alloc(appsess)) == NULL) {
 						Alert("Not enough Memory process_srv():asession:calloc().\n");
 						send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession:calloc().\n");
 						return;
 					}
 					asession_temp->sessid = local_asession.sessid;
 					asession_temp->serverid = local_asession.serverid;
 					chtbl_insert(&(t->be->htbl_proxy), (void *) asession_temp);
 				}/* end if (chtbl_lookup()) */
 				else {
 					/* free wasted memory */
 					pool_free_to(apools.sessid, local_asession.sessid);
 				} /* end else from if (chtbl_lookup()) */

 				if (asession_temp->serverid == NULL) {
 					if ((asession_temp->serverid = pool_alloc_from(apools.serverid, apools.ser_msize)) == NULL) {
 						Alert("Not enough Memory process_srv():asession->sessid:malloc().\n");
 						send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n");
 						return;
 					}
 					asession_temp->serverid[0] = '\0';
 				}

 				if (asession_temp->serverid[0] == '\0')
 					memcpy(asession_temp->serverid, t->srv->id, server_id_len);

 				tv_delayfrom(&asession_temp->expire, &now, t->be->appsession_timeout);

 #if defined(DEBUG_HASH)
 				print_table(&(t->be->htbl_proxy));
 #endif
 			}/* end if ((t->proxy->appsession_name != NULL) ... */
 			break; /* we don't want to loop again since there cannot be another cookie on the same line */
 		} /* we're now at the end of the cookie value */

 		/* keep the link from this header to next one */
 		old_idx = cur_idx;
 	} /* end of cookie processing on this header */
 }


 /*
  * Check if response is cacheable or not. Updates t->flags.
  */
 void check_response_for_cacheability(struct session *t, struct buffer *rtr)
 {
 	struct http_txn *txn = &t->txn;
 	char *p1, *p2;

 	char *cur_ptr, *cur_end, *cur_next;
 	int cur_idx;

 	if (!txn->flags & TX_CACHEABLE)
 		return;

 	/* Iterate through the headers.
 	 * we start with the start line.
 	 */
 	cur_idx = 0;
 	cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);

 	while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) {
 		struct hdr_idx_elem *cur_hdr;
 		int val;

 		cur_hdr  = &txn->hdr_idx.v[cur_idx];
 		cur_ptr  = cur_next;
 		cur_end  = cur_ptr + cur_hdr->len;
 		cur_next = cur_end + cur_hdr->cr + 1;

 		/* We have one full header between cur_ptr and cur_end, and the
 		 * next header starts at cur_next. We're only interested in
 		 * "Cookie:" headers.
 		 */

 		val = http_header_match2(cur_ptr, cur_end, "Pragma", 6);
 		if (val) {
 			if ((cur_end - (cur_ptr + val) >= 8) &&
 			    strncasecmp(cur_ptr + val, "no-cache", 8) == 0) {
 				txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
 				return;
 			}
 		}

 		val = http_header_match2(cur_ptr, cur_end, "Cache-control", 13);
 		if (!val)
 			continue;

 		/* OK, right now we know we have a cache-control header at cur_ptr */

 		p1 = cur_ptr + val; /* first non-space char after 'cache-control:' */

 		if (p1 >= cur_end)	/* no more info */
 			continue;

 		/* p1 is at the beginning of the value */
 		p2 = p1;

 		while (p2 < cur_end && *p2 != '=' && *p2 != ',' && !isspace((int)*p2))
 			p2++;

 		/* we have a complete value between p1 and p2 */
 		if (p2 < cur_end && *p2 == '=') {
 			/* we have something of the form no-cache="set-cookie" */
 			if ((cur_end - p1 >= 21) &&
 			    strncasecmp(p1, "no-cache=\"set-cookie", 20) == 0
 			    && (p1[20] == '"' || p1[20] == ','))
 				txn->flags &= ~TX_CACHE_COOK;
 			continue;
 		}

 		/* OK, so we know that either p2 points to the end of string or to a comma */
 		if (((p2 - p1 ==  7) && strncasecmp(p1, "private", 7) == 0) ||
 		    ((p2 - p1 ==  8) && strncasecmp(p1, "no-store", 8) == 0) ||
 		    ((p2 - p1 ==  9) && strncasecmp(p1, "max-age=0", 9) == 0) ||
 		    ((p2 - p1 == 10) && strncasecmp(p1, "s-maxage=0", 10) == 0)) {
 			txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
 			return;
 		}

 		if ((p2 - p1 ==  6) && strncasecmp(p1, "public", 6) == 0) {
 			txn->flags |= TX_CACHEABLE | TX_CACHE_COOK;
 			continue;
 		}
 	}
 }


 /*
  * Try to retrieve a known appsession in the URI, then the associated server.
  * If the server is found, it's assigned to the session.
  */
 void get_srv_from_appsession(struct session *t, const char *begin, int len)
 {
 	struct http_txn *txn = &t->txn;
 	appsess *asession_temp = NULL;
 	appsess local_asession;
 	char *request_line;

 	if (t->be->appsession_name == NULL ||
 	    (t->txn.meth != HTTP_METH_GET && t->txn.meth != HTTP_METH_POST) ||
 	    (request_line = memchr(begin, ';', len)) == NULL ||
 	    ((1 + t->be->appsession_name_len + 1 + t->be->appsession_len) > (begin + len - request_line)))
 		return;

 	/* skip ';' */
 	request_line++;

 	/* look if we have a jsessionid */
 	if (strncasecmp(request_line, t->be->appsession_name, t->be->appsession_name_len) != 0)
 		return;

 	/* skip jsessionid= */
 	request_line += t->be->appsession_name_len + 1;

 	/* First try if we already have an appsession */
 	asession_temp = &local_asession;

 	if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) {
 		Alert("Not enough memory process_cli():asession_temp->sessid:calloc().\n");
 		send_log(t->be, LOG_ALERT, "Not enough Memory process_cli():asession_temp->sessid:calloc().\n");
 		return;
 	}

 	/* Copy the sessionid */
 	memcpy(asession_temp->sessid, request_line, t->be->appsession_len);
 	asession_temp->sessid[t->be->appsession_len] = 0;
 	asession_temp->serverid = NULL;

 	/* only do insert, if lookup fails */
 	if (chtbl_lookup(&(t->be->htbl_proxy), (void *)&asession_temp)) {
 		if ((asession_temp = pool_alloc(appsess)) == NULL) {
 			/* free previously allocated memory */
 			pool_free_to(apools.sessid, local_asession.sessid);
 			Alert("Not enough memory process_cli():asession:calloc().\n");
 			send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
 			return;
 		}
 		asession_temp->sessid = local_asession.sessid;
 		asession_temp->serverid = local_asession.serverid;
 		chtbl_insert(&(t->be->htbl_proxy), (void *) asession_temp);
 	}
 	else {
 		/* free previously allocated memory */
 		pool_free_to(apools.sessid, local_asession.sessid);
 	}

 	tv_delayfrom(&asession_temp->expire, &now, t->be->appsession_timeout);
 	asession_temp->request_count++;

 #if defined(DEBUG_HASH)
 	print_table(&(t->proxy->htbl_proxy));
 #endif
 	if (asession_temp->serverid == NULL) {
 		Alert("Found Application Session without matching server.\n");
 	} else {
 		struct server *srv = t->be->srv;
 		while (srv) {
 			if (strcmp(srv->id, asession_temp->serverid) == 0) {
 				if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
 					/* we found the server and it's usable */
 					txn->flags &= ~TX_CK_MASK;
 					txn->flags |= TX_CK_VALID;
 					t->flags |= SN_DIRECT | SN_ASSIGNED;
 					t->srv = srv;
 					break;
 				} else {
 					txn->flags &= ~TX_CK_MASK;
 					txn->flags |= TX_CK_DOWN;
 				}
 			}
 			srv = srv->next;
 		}
 	}
 }


 /*
  * In a GET or HEAD request, check if the requested URI matches the stats uri
  * for the current backend, and if an authorization has been passed and is valid.
  *
  * It is assumed that the request is either a HEAD or GET and that the
  * t->be->uri_auth field is valid. An HTTP/401 response may be sent, or
  * produce_content() can be called to start sending data.
  *
  * Returns 1 if the session's state changes, otherwise 0.
  */
 int stats_check_uri_auth(struct session *t, struct proxy *backend)
 {
 	struct http_txn *txn = &t->txn;
 	struct uri_auth *uri_auth = backend->uri_auth;
 	struct user_auth *user;
 	int authenticated, cur_idx;
 	char *h;

 	/* check URI size */
 	if (uri_auth->uri_len > txn->req.sl.rq.u_l)
 		return 0;

 	h = t->req->data + txn->req.sl.rq.u;

 	/* the URI is in h */
 	if (memcmp(h, uri_auth->uri_prefix, uri_auth->uri_len) != 0)
 		return 0;

 	/* we are in front of a interceptable URI. Let's check
 	 * if there's an authentication and if it's valid.
 	 */
 	user = uri_auth->users;
 	if (!user) {
 		/* no user auth required, it's OK */
 		authenticated = 1;
 	} else {
 		authenticated = 0;

 		/* a user list is defined, we have to check.
 		 * skip 21 chars for "Authorization: Basic ".
 		 */

 		/* FIXME: this should move to an earlier place */
 		cur_idx = 0;
 		h = t->req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
 		while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) {
 			int len = txn->hdr_idx.v[cur_idx].len;
 			if (len > 14 &&
 			    !strncasecmp("Authorization:", h, 14)) {
 				txn->auth_hdr.str = h;
 				txn->auth_hdr.len = len;
 				break;
 			}
 			h += len + txn->hdr_idx.v[cur_idx].cr + 1;
 		}

 		if (txn->auth_hdr.len < 21 ||
 		    memcmp(txn->auth_hdr.str + 14, " Basic ", 7))
 			user = NULL;

 		while (user) {
 			if ((txn->auth_hdr.len == user->user_len + 14 + 7)
 			    && !memcmp(txn->auth_hdr.str + 14 + 7,
 				       user->user_pwd, user->user_len)) {
 				authenticated = 1;
 				break;
 			}
 			user = user->next;
 		}
 	}

 	if (!authenticated) {
 		struct chunk msg;

 		/* no need to go further */
 		msg.str = trash;
 		msg.len = sprintf(trash, HTTP_401_fmt, uri_auth->auth_realm);
 		txn->status = 401;
 		client_retnclose(t, &msg);
 		if (!(t->flags & SN_ERR_MASK))
 			t->flags |= SN_ERR_PRXCOND;
 		if (!(t->flags & SN_FINST_MASK))
 			t->flags |= SN_FINST_R;
 		return 1;
 	}

 	/* The request is valid, the user is authenticate. Let's start sending
 	 * data.
 	 */
 	t->cli_state = CL_STSHUTR;
 	t->req->rlim = t->req->data + BUFSIZE; /* no more rewrite needed */
 	t->logs.t_request = tv_diff(&t->logs.tv_accept, &now);
 	t->data_source = DATA_SRC_STATS;
 	t->data_state  = DATA_ST_INIT;
 	produce_content(t);
 	return 1;
 }


 /*
  * Print a debug line with a header
  */
 void debug_hdr(const char *dir, struct session *t, const char *start, const char *end)
 {
 	int len, max;
 	len = sprintf(trash, "%08x:%s.%s[%04x:%04x]: ", t->uniq_id, t->be->id,
 		      dir, (unsigned  short)t->cli_fd, (unsigned short)t->srv_fd);
 	max = end - start;
 	UBOUND(max, sizeof(trash) - len - 1);
 	len += strlcpy2(trash + len, start, max + 1);
 	trash[len++] = '\n';
 	write(1, trash, len);
 }


 /*
  * Local variables:
  *  c-indent-level: 8
  *  c-basic-offset: 8
  * End:
  */