| /* |
| * HTTP protocol analyzer |
| * |
| * Copyright 2000-2008 Willy Tarreau <w@1wt.eu> |
| * |
| * This program is free software; you can redistribute it and/or |
| * modify it under the terms of the GNU General Public License |
| * as published by the Free Software Foundation; either version |
| * 2 of the License, or (at your option) any later version. |
| * |
| */ |
| |
| #include <ctype.h> |
| #include <errno.h> |
| #include <fcntl.h> |
| #include <stdio.h> |
| #include <stdlib.h> |
| #include <string.h> |
| #include <syslog.h> |
| #include <time.h> |
| |
| #include <sys/socket.h> |
| #include <sys/stat.h> |
| #include <sys/types.h> |
| |
| #include <common/appsession.h> |
| #include <common/compat.h> |
| #include <common/config.h> |
| #include <common/debug.h> |
| #include <common/memory.h> |
| #include <common/mini-clist.h> |
| #include <common/standard.h> |
| #include <common/ticks.h> |
| #include <common/time.h> |
| #include <common/uri_auth.h> |
| #include <common/version.h> |
| |
| #include <types/capture.h> |
| #include <types/global.h> |
| |
| #include <proto/acl.h> |
| #include <proto/backend.h> |
| #include <proto/buffers.h> |
| #include <proto/dumpstats.h> |
| #include <proto/fd.h> |
| #include <proto/log.h> |
| #include <proto/hdr_idx.h> |
| #include <proto/proto_tcp.h> |
| #include <proto/proto_http.h> |
| #include <proto/queue.h> |
| #include <proto/senddata.h> |
| #include <proto/session.h> |
| #include <proto/stream_interface.h> |
| #include <proto/stream_sock.h> |
| #include <proto/task.h> |
| |
| #ifdef CONFIG_HAP_TCPSPLICE |
| #include <libtcpsplice.h> |
| #endif |
| |
| #define DEBUG_PARSE_NO_SPEEDUP |
| #undef DEBUG_PARSE_NO_SPEEDUP |
| |
| /* This is used to perform a quick jump as an alternative to a break/continue |
| * instruction. The first argument is the label for normal operation, and the |
| * second one is the break/continue instruction in the no_speedup mode. |
| */ |
| |
| #ifdef DEBUG_PARSE_NO_SPEEDUP |
| #define QUICK_JUMP(x,y) y |
| #else |
| #define QUICK_JUMP(x,y) goto x |
| #endif |
| |
| /* This is used by remote monitoring */ |
| const char HTTP_200[] = |
| "HTTP/1.0 200 OK\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Content-Type: text/html\r\n" |
| "\r\n" |
| "<html><body><h1>200 OK</h1>\nHAProxy: service ready.\n</body></html>\n"; |
| |
| const struct chunk http_200_chunk = { |
| .str = (char *)&HTTP_200, |
| .len = sizeof(HTTP_200)-1 |
| }; |
| |
| const char *HTTP_301 = |
| "HTTP/1.0 301 Moved Permantenly\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Location: "; /* not terminated since it will be concatenated with the URL */ |
| |
| const char *HTTP_302 = |
| "HTTP/1.0 302 Found\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Location: "; /* not terminated since it will be concatenated with the URL */ |
| |
| /* same as 302 except that the browser MUST retry with the GET method */ |
| const char *HTTP_303 = |
| "HTTP/1.0 303 See Other\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Location: "; /* not terminated since it will be concatenated with the URL */ |
| |
| /* Warning: this one is an sprintf() fmt string, with <realm> as its only argument */ |
| const char *HTTP_401_fmt = |
| "HTTP/1.0 401 Unauthorized\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Content-Type: text/html\r\n" |
| "WWW-Authenticate: Basic realm=\"%s\"\r\n" |
| "\r\n" |
| "<html><body><h1>401 Unauthorized</h1>\nYou need a valid user and password to access this content.\n</body></html>\n"; |
| |
| |
| const int http_err_codes[HTTP_ERR_SIZE] = { |
| [HTTP_ERR_400] = 400, |
| [HTTP_ERR_403] = 403, |
| [HTTP_ERR_408] = 408, |
| [HTTP_ERR_500] = 500, |
| [HTTP_ERR_502] = 502, |
| [HTTP_ERR_503] = 503, |
| [HTTP_ERR_504] = 504, |
| }; |
| |
| static const char *http_err_msgs[HTTP_ERR_SIZE] = { |
| [HTTP_ERR_400] = |
| "HTTP/1.0 400 Bad request\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Content-Type: text/html\r\n" |
| "\r\n" |
| "<html><body><h1>400 Bad request</h1>\nYour browser sent an invalid request.\n</body></html>\n", |
| |
| [HTTP_ERR_403] = |
| "HTTP/1.0 403 Forbidden\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Content-Type: text/html\r\n" |
| "\r\n" |
| "<html><body><h1>403 Forbidden</h1>\nRequest forbidden by administrative rules.\n</body></html>\n", |
| |
| [HTTP_ERR_408] = |
| "HTTP/1.0 408 Request Time-out\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Content-Type: text/html\r\n" |
| "\r\n" |
| "<html><body><h1>408 Request Time-out</h1>\nYour browser didn't send a complete request in time.\n</body></html>\n", |
| |
| [HTTP_ERR_500] = |
| "HTTP/1.0 500 Server Error\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Content-Type: text/html\r\n" |
| "\r\n" |
| "<html><body><h1>500 Server Error</h1>\nAn internal server error occured.\n</body></html>\n", |
| |
| [HTTP_ERR_502] = |
| "HTTP/1.0 502 Bad Gateway\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Content-Type: text/html\r\n" |
| "\r\n" |
| "<html><body><h1>502 Bad Gateway</h1>\nThe server returned an invalid or incomplete response.\n</body></html>\n", |
| |
| [HTTP_ERR_503] = |
| "HTTP/1.0 503 Service Unavailable\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Content-Type: text/html\r\n" |
| "\r\n" |
| "<html><body><h1>503 Service Unavailable</h1>\nNo server is available to handle this request.\n</body></html>\n", |
| |
| [HTTP_ERR_504] = |
| "HTTP/1.0 504 Gateway Time-out\r\n" |
| "Cache-Control: no-cache\r\n" |
| "Connection: close\r\n" |
| "Content-Type: text/html\r\n" |
| "\r\n" |
| "<html><body><h1>504 Gateway Time-out</h1>\nThe server didn't respond in time.\n</body></html>\n", |
| |
| }; |
| |
| /* We must put the messages here since GCC cannot initialize consts depending |
| * on strlen(). |
| */ |
| struct chunk http_err_chunks[HTTP_ERR_SIZE]; |
| |
| #define FD_SETS_ARE_BITFIELDS |
| #ifdef FD_SETS_ARE_BITFIELDS |
| /* |
| * This map is used with all the FD_* macros to check whether a particular bit |
| * is set or not. Each bit represents an ACSII code. FD_SET() sets those bytes |
| * which should be encoded. When FD_ISSET() returns non-zero, it means that the |
| * byte should be encoded. Be careful to always pass bytes from 0 to 255 |
| * exclusively to the macros. |
| */ |
| fd_set hdr_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))]; |
| fd_set url_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))]; |
| |
| #else |
| #error "Check if your OS uses bitfields for fd_sets" |
| #endif |
| |
| int sess_update_st_con_tcp(struct session *s, struct stream_interface *si); |
| int sess_update_st_cer(struct session *s, struct stream_interface *si); |
| void sess_establish(struct session *s, struct stream_interface *si); |
| |
| void init_proto_http() |
| { |
| int i; |
| char *tmp; |
| int msg; |
| |
| for (msg = 0; msg < HTTP_ERR_SIZE; msg++) { |
| if (!http_err_msgs[msg]) { |
| Alert("Internal error: no message defined for HTTP return code %d. Aborting.\n", msg); |
| abort(); |
| } |
| |
| http_err_chunks[msg].str = (char *)http_err_msgs[msg]; |
| http_err_chunks[msg].len = strlen(http_err_msgs[msg]); |
| } |
| |
| /* initialize the log header encoding map : '{|}"#' should be encoded with |
| * '#' as prefix, as well as non-printable characters ( <32 or >= 127 ). |
| * URL encoding only requires '"', '#' to be encoded as well as non- |
| * printable characters above. |
| */ |
| memset(hdr_encode_map, 0, sizeof(hdr_encode_map)); |
| memset(url_encode_map, 0, sizeof(url_encode_map)); |
| for (i = 0; i < 32; i++) { |
| FD_SET(i, hdr_encode_map); |
| FD_SET(i, url_encode_map); |
| } |
| for (i = 127; i < 256; i++) { |
| FD_SET(i, hdr_encode_map); |
| FD_SET(i, url_encode_map); |
| } |
| |
| tmp = "\"#{|}"; |
| while (*tmp) { |
| FD_SET(*tmp, hdr_encode_map); |
| tmp++; |
| } |
| |
| tmp = "\"#"; |
| while (*tmp) { |
| FD_SET(*tmp, url_encode_map); |
| tmp++; |
| } |
| |
| /* memory allocations */ |
| pool2_requri = create_pool("requri", REQURI_LEN, MEM_F_SHARED); |
| pool2_capture = create_pool("capture", CAPTURE_LEN, MEM_F_SHARED); |
| } |
| |
| /* |
| * We have 26 list of methods (1 per first letter), each of which can have |
| * up to 3 entries (2 valid, 1 null). |
| */ |
| struct http_method_desc { |
| http_meth_t meth; |
| int len; |
| const char text[8]; |
| }; |
| |
| const struct http_method_desc http_methods[26][3] = { |
| ['C' - 'A'] = { |
| [0] = { .meth = HTTP_METH_CONNECT , .len=7, .text="CONNECT" }, |
| }, |
| ['D' - 'A'] = { |
| [0] = { .meth = HTTP_METH_DELETE , .len=6, .text="DELETE" }, |
| }, |
| ['G' - 'A'] = { |
| [0] = { .meth = HTTP_METH_GET , .len=3, .text="GET" }, |
| }, |
| ['H' - 'A'] = { |
| [0] = { .meth = HTTP_METH_HEAD , .len=4, .text="HEAD" }, |
| }, |
| ['P' - 'A'] = { |
| [0] = { .meth = HTTP_METH_POST , .len=4, .text="POST" }, |
| [1] = { .meth = HTTP_METH_PUT , .len=3, .text="PUT" }, |
| }, |
| ['T' - 'A'] = { |
| [0] = { .meth = HTTP_METH_TRACE , .len=5, .text="TRACE" }, |
| }, |
| /* rest is empty like this : |
| * [1] = { .meth = HTTP_METH_NONE , .len=0, .text="" }, |
| */ |
| }; |
| |
| /* It is about twice as fast on recent architectures to lookup a byte in a |
| * table than to perform a boolean AND or OR between two tests. Refer to |
| * RFC2616 for those chars. |
| */ |
| |
| const char http_is_spht[256] = { |
| [' '] = 1, ['\t'] = 1, |
| }; |
| |
| const char http_is_crlf[256] = { |
| ['\r'] = 1, ['\n'] = 1, |
| }; |
| |
| const char http_is_lws[256] = { |
| [' '] = 1, ['\t'] = 1, |
| ['\r'] = 1, ['\n'] = 1, |
| }; |
| |
| const char http_is_sep[256] = { |
| ['('] = 1, [')'] = 1, ['<'] = 1, ['>'] = 1, |
| ['@'] = 1, [','] = 1, [';'] = 1, [':'] = 1, |
| ['"'] = 1, ['/'] = 1, ['['] = 1, [']'] = 1, |
| ['{'] = 1, ['}'] = 1, ['?'] = 1, ['='] = 1, |
| [' '] = 1, ['\t'] = 1, ['\\'] = 1, |
| }; |
| |
| const char http_is_ctl[256] = { |
| [0 ... 31] = 1, |
| [127] = 1, |
| }; |
| |
| /* |
| * A token is any ASCII char that is neither a separator nor a CTL char. |
| * Do not overwrite values in assignment since gcc-2.95 will not handle |
| * them correctly. Instead, define every non-CTL char's status. |
| */ |
| const char http_is_token[256] = { |
| [' '] = 0, ['!'] = 1, ['"'] = 0, ['#'] = 1, |
| ['$'] = 1, ['%'] = 1, ['&'] = 1, ['\''] = 1, |
| ['('] = 0, [')'] = 0, ['*'] = 1, ['+'] = 1, |
| [','] = 0, ['-'] = 1, ['.'] = 1, ['/'] = 0, |
| ['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1, |
| ['4'] = 1, ['5'] = 1, ['6'] = 1, ['7'] = 1, |
| ['8'] = 1, ['9'] = 1, [':'] = 0, [';'] = 0, |
| ['<'] = 0, ['='] = 0, ['>'] = 0, ['?'] = 0, |
| ['@'] = 0, ['A'] = 1, ['B'] = 1, ['C'] = 1, |
| ['D'] = 1, ['E'] = 1, ['F'] = 1, ['G'] = 1, |
| ['H'] = 1, ['I'] = 1, ['J'] = 1, ['K'] = 1, |
| ['L'] = 1, ['M'] = 1, ['N'] = 1, ['O'] = 1, |
| ['P'] = 1, ['Q'] = 1, ['R'] = 1, ['S'] = 1, |
| ['T'] = 1, ['U'] = 1, ['V'] = 1, ['W'] = 1, |
| ['X'] = 1, ['Y'] = 1, ['Z'] = 1, ['['] = 0, |
| ['\\'] = 0, [']'] = 0, ['^'] = 1, ['_'] = 1, |
| ['`'] = 1, ['a'] = 1, ['b'] = 1, ['c'] = 1, |
| ['d'] = 1, ['e'] = 1, ['f'] = 1, ['g'] = 1, |
| ['h'] = 1, ['i'] = 1, ['j'] = 1, ['k'] = 1, |
| ['l'] = 1, ['m'] = 1, ['n'] = 1, ['o'] = 1, |
| ['p'] = 1, ['q'] = 1, ['r'] = 1, ['s'] = 1, |
| ['t'] = 1, ['u'] = 1, ['v'] = 1, ['w'] = 1, |
| ['x'] = 1, ['y'] = 1, ['z'] = 1, ['{'] = 0, |
| ['|'] = 1, ['}'] = 0, ['~'] = 1, |
| }; |
| |
| |
| /* |
| * An http ver_token is any ASCII which can be found in an HTTP version, |
| * which includes 'H', 'T', 'P', '/', '.' and any digit. |
| */ |
| const char http_is_ver_token[256] = { |
| ['.'] = 1, ['/'] = 1, |
| ['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1, ['4'] = 1, |
| ['5'] = 1, ['6'] = 1, ['7'] = 1, ['8'] = 1, ['9'] = 1, |
| ['H'] = 1, ['P'] = 1, ['T'] = 1, |
| }; |
| |
| |
| #ifdef DEBUG_FULL |
| static char *cli_stnames[4] = { "DAT", "SHR", "SHW", "CLS" }; |
| #endif |
| |
| static void http_sess_log(struct session *s); |
| |
| /* |
| * Adds a header and its CRLF at the tail of buffer <b>, just before the last |
| * CRLF. Text length is measured first, so it cannot be NULL. |
| * The header is also automatically added to the index <hdr_idx>, and the end |
| * of headers is automatically adjusted. The number of bytes added is returned |
| * on success, otherwise <0 is returned indicating an error. |
| */ |
| int http_header_add_tail(struct buffer *b, struct http_msg *msg, |
| struct hdr_idx *hdr_idx, const char *text) |
| { |
| int bytes, len; |
| |
| len = strlen(text); |
| bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len); |
| if (!bytes) |
| return -1; |
| msg->eoh += bytes; |
| return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail); |
| } |
| |
| /* |
| * Adds a header and its CRLF at the tail of buffer <b>, just before the last |
| * CRLF. <len> bytes are copied, not counting the CRLF. If <text> is NULL, then |
| * the buffer is only opened and the space reserved, but nothing is copied. |
| * The header is also automatically added to the index <hdr_idx>, and the end |
| * of headers is automatically adjusted. The number of bytes added is returned |
| * on success, otherwise <0 is returned indicating an error. |
| */ |
| int http_header_add_tail2(struct buffer *b, struct http_msg *msg, |
| struct hdr_idx *hdr_idx, const char *text, int len) |
| { |
| int bytes; |
| |
| bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len); |
| if (!bytes) |
| return -1; |
| msg->eoh += bytes; |
| return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail); |
| } |
| |
| /* |
| * Checks if <hdr> is exactly <name> for <len> chars, and ends with a colon. |
| * If so, returns the position of the first non-space character relative to |
| * <hdr>, or <end>-<hdr> if not found before. If no value is found, it tries |
| * to return a pointer to the place after the first space. Returns 0 if the |
| * header name does not match. Checks are case-insensitive. |
| */ |
| int http_header_match2(const char *hdr, const char *end, |
| const char *name, int len) |
| { |
| const char *val; |
| |
| if (hdr + len >= end) |
| return 0; |
| if (hdr[len] != ':') |
| return 0; |
| if (strncasecmp(hdr, name, len) != 0) |
| return 0; |
| val = hdr + len + 1; |
| while (val < end && HTTP_IS_SPHT(*val)) |
| val++; |
| if ((val >= end) && (len + 2 <= end - hdr)) |
| return len + 2; /* we may replace starting from second space */ |
| return val - hdr; |
| } |
| |
| /* Find the end of the header value contained between <s> and <e>. |
| * See RFC2616, par 2.2 for more information. Note that it requires |
| * a valid header to return a valid result. |
| */ |
| const char *find_hdr_value_end(const char *s, const char *e) |
| { |
| int quoted, qdpair; |
| |
| quoted = qdpair = 0; |
| for (; s < e; s++) { |
| if (qdpair) qdpair = 0; |
| else if (quoted && *s == '\\') qdpair = 1; |
| else if (quoted && *s == '"') quoted = 0; |
| else if (*s == '"') quoted = 1; |
| else if (*s == ',') return s; |
| } |
| return s; |
| } |
| |
| /* Find the first or next occurrence of header <name> in message buffer <sol> |
| * using headers index <idx>, and return it in the <ctx> structure. This |
| * structure holds everything necessary to use the header and find next |
| * occurrence. If its <idx> member is 0, the header is searched from the |
| * beginning. Otherwise, the next occurrence is returned. The function returns |
| * 1 when it finds a value, and 0 when there is no more. |
| */ |
| int http_find_header2(const char *name, int len, |
| const char *sol, struct hdr_idx *idx, |
| struct hdr_ctx *ctx) |
| { |
| __label__ return_hdr, next_hdr; |
| const char *eol, *sov; |
| int cur_idx; |
| |
| if (ctx->idx) { |
| /* We have previously returned a value, let's search |
| * another one on the same line. |
| */ |
| cur_idx = ctx->idx; |
| sol = ctx->line; |
| sov = sol + ctx->val + ctx->vlen; |
| eol = sol + idx->v[cur_idx].len; |
| |
| if (sov >= eol) |
| /* no more values in this header */ |
| goto next_hdr; |
| |
| /* values remaining for this header, skip the comma */ |
| sov++; |
| while (sov < eol && http_is_lws[(unsigned char)*sov]) |
| sov++; |
| |
| goto return_hdr; |
| } |
| |
| /* first request for this header */ |
| sol += hdr_idx_first_pos(idx); |
| cur_idx = hdr_idx_first_idx(idx); |
| |
| while (cur_idx) { |
| eol = sol + idx->v[cur_idx].len; |
| |
| if (len == 0) { |
| /* No argument was passed, we want any header. |
| * To achieve this, we simply build a fake request. */ |
| while (sol + len < eol && sol[len] != ':') |
| len++; |
| name = sol; |
| } |
| |
| if ((len < eol - sol) && |
| (sol[len] == ':') && |
| (strncasecmp(sol, name, len) == 0)) { |
| |
| sov = sol + len + 1; |
| while (sov < eol && http_is_lws[(unsigned char)*sov]) |
| sov++; |
| return_hdr: |
| ctx->line = sol; |
| ctx->idx = cur_idx; |
| ctx->val = sov - sol; |
| |
| eol = find_hdr_value_end(sov, eol); |
| ctx->vlen = eol - sov; |
| return 1; |
| } |
| next_hdr: |
| sol = eol + idx->v[cur_idx].cr + 1; |
| cur_idx = idx->v[cur_idx].next; |
| } |
| return 0; |
| } |
| |
| int http_find_header(const char *name, |
| const char *sol, struct hdr_idx *idx, |
| struct hdr_ctx *ctx) |
| { |
| return http_find_header2(name, strlen(name), sol, idx, ctx); |
| } |
| |
| /* This function shuts down the buffers on the server side, and sets indicators |
| * accordingly. The server's fd is supposed to already be closed. Note that if |
| * <status> is 0, or if the message pointer is NULL, then no message is returned. |
| */ |
| void srv_close_with_err(struct session *t, int err, int finst, |
| int status, const struct chunk *msg) |
| { |
| buffer_write_ena(t->rep); |
| t->req->cons->shutw(t->req->cons); |
| t->req->cons->shutr(t->req->cons); |
| if (status > 0 && msg) { |
| t->txn.status = status; |
| if (t->fe->mode == PR_MODE_HTTP) |
| client_return(t, msg); |
| } |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= err; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= finst; |
| } |
| |
| /* This function returns the appropriate error location for the given session |
| * and message. |
| */ |
| |
| struct chunk *error_message(struct session *s, int msgnum) |
| { |
| if (s->be->errmsg[msgnum].str) |
| return &s->be->errmsg[msgnum]; |
| else if (s->fe->errmsg[msgnum].str) |
| return &s->fe->errmsg[msgnum]; |
| else |
| return &http_err_chunks[msgnum]; |
| } |
| |
| /* |
| * returns HTTP_METH_NONE if there is nothing valid to read (empty or non-text |
| * string), HTTP_METH_OTHER for unknown methods, or the identified method. |
| */ |
| static http_meth_t find_http_meth(const char *str, const int len) |
| { |
| unsigned char m; |
| const struct http_method_desc *h; |
| |
| m = ((unsigned)*str - 'A'); |
| |
| if (m < 26) { |
| for (h = http_methods[m]; h->len > 0; h++) { |
| if (unlikely(h->len != len)) |
| continue; |
| if (likely(memcmp(str, h->text, h->len) == 0)) |
| return h->meth; |
| }; |
| return HTTP_METH_OTHER; |
| } |
| return HTTP_METH_NONE; |
| |
| } |
| |
| /* Parse the URI from the given transaction (which is assumed to be in request |
| * phase) and look for the "/" beginning the PATH. If not found, return NULL. |
| * It is returned otherwise. |
| */ |
| static char * |
| http_get_path(struct http_txn *txn) |
| { |
| char *ptr, *end; |
| |
| ptr = txn->req.sol + txn->req.sl.rq.u; |
| end = ptr + txn->req.sl.rq.u_l; |
| |
| if (ptr >= end) |
| return NULL; |
| |
| /* RFC2616, par. 5.1.2 : |
| * Request-URI = "*" | absuri | abspath | authority |
| */ |
| |
| if (*ptr == '*') |
| return NULL; |
| |
| if (isalpha((unsigned char)*ptr)) { |
| /* this is a scheme as described by RFC3986, par. 3.1 */ |
| ptr++; |
| while (ptr < end && |
| (isalnum((unsigned char)*ptr) || *ptr == '+' || *ptr == '-' || *ptr == '.')) |
| ptr++; |
| /* skip '://' */ |
| if (ptr == end || *ptr++ != ':') |
| return NULL; |
| if (ptr == end || *ptr++ != '/') |
| return NULL; |
| if (ptr == end || *ptr++ != '/') |
| return NULL; |
| } |
| /* skip [user[:passwd]@]host[:[port]] */ |
| |
| while (ptr < end && *ptr != '/') |
| ptr++; |
| |
| if (ptr == end) |
| return NULL; |
| |
| /* OK, we got the '/' ! */ |
| return ptr; |
| } |
| |
| |
| /* Update stream interface status for input states SI_ST_ASS, SI_ST_QUE, SI_ST_TAR. |
| * Other input states are simply ignored. |
| * Possible output states are SI_ST_CLO, SI_ST_TAR, SI_ST_ASS, SI_ST_REQ, SI_ST_CON. |
| * Flags must have previously been updated for timeouts and other conditions. |
| */ |
| void sess_update_stream_int(struct session *s, struct stream_interface *si) |
| { |
| DPRINTF(stderr,"[%u] %s: sess=%p rq=%p, rp=%p, exp(r,w)=%u,%u rqf=%08x rpf=%08x rql=%d rpl=%d cs=%d ss=%d\n", |
| now_ms, __FUNCTION__, |
| s, |
| s->req, s->rep, |
| s->req->rex, s->rep->wex, |
| s->req->flags, s->rep->flags, |
| s->req->l, s->rep->l, s->rep->cons->state, s->req->cons->state); |
| |
| if (si->state == SI_ST_ASS) { |
| /* Server assigned to connection request, we have to try to connect now */ |
| int conn_err; |
| |
| conn_err = connect_server(s); |
| if (conn_err == SN_ERR_NONE) { |
| /* state = SI_ST_CON now */ |
| return; |
| } |
| |
| /* We have received a synchronous error. We might have to |
| * abort, retry immediately or redispatch. |
| */ |
| if (conn_err == SN_ERR_INTERNAL) { |
| if (!si->err_type) { |
| si->err_type = SI_ET_CONN_OTHER; |
| si->err_loc = s->srv; |
| } |
| |
| if (s->srv) |
| s->srv->cum_sess++; |
| if (s->srv) |
| s->srv->failed_conns++; |
| s->be->failed_conns++; |
| |
| /* release other sessions waiting for this server */ |
| if (may_dequeue_tasks(s->srv, s->be)) |
| process_srv_queue(s->srv); |
| |
| /* Failed and not retryable. */ |
| si->shutr(si); |
| si->shutw(si); |
| si->ob->flags |= BF_WRITE_ERROR; |
| |
| s->logs.t_queue = tv_ms_elapsed(&s->logs.tv_accept, &now); |
| |
| /* no session was ever accounted for this server */ |
| si->state = SI_ST_CLO; |
| return; |
| } |
| |
| /* We are facing a retryable error, but we don't want to run a |
| * turn-around now, as the problem is likely a source port |
| * allocation problem, so we want to retry now. |
| */ |
| si->state = SI_ST_CER; |
| si->flags &= ~SI_FL_ERR; |
| sess_update_st_cer(s, si); |
| /* now si->state is one of SI_ST_CLO, SI_ST_TAR, SI_ST_ASS, SI_ST_REQ */ |
| return; |
| } |
| else if (si->state == SI_ST_QUE) { |
| /* connection request was queued, check for any update */ |
| if (!s->pend_pos) { |
| /* The connection is not in the queue anymore. Either |
| * we have a server connection slot available and we |
| * go directly to the assigned state, or we need to |
| * load-balance first and go to the INI state. |
| */ |
| si->exp = TICK_ETERNITY; |
| if (unlikely(!(s->flags & SN_ASSIGNED))) |
| si->state = SI_ST_REQ; |
| else { |
| s->logs.t_queue = tv_ms_elapsed(&s->logs.tv_accept, &now); |
| si->state = SI_ST_ASS; |
| } |
| return; |
| } |
| |
| /* Connection request still in queue... */ |
| if (si->flags & SI_FL_EXP) { |
| /* ... and timeout expired */ |
| si->exp = TICK_ETERNITY; |
| s->logs.t_queue = tv_ms_elapsed(&s->logs.tv_accept, &now); |
| if (s->srv) |
| s->srv->failed_conns++; |
| s->be->failed_conns++; |
| si->shutr(si); |
| si->shutw(si); |
| si->ob->flags |= BF_WRITE_TIMEOUT; |
| if (!si->err_type) |
| si->err_type = SI_ET_QUEUE_TO; |
| si->state = SI_ST_CLO; |
| return; |
| } |
| |
| /* Connection remains in queue, check if we have to abort it */ |
| if ((si->ob->flags & (BF_READ_ERROR|BF_SHUTW_NOW)) || /* abort requested */ |
| ((si->ob->flags & BF_SHUTR) && /* empty and client stopped */ |
| (si->ob->flags & BF_EMPTY || s->be->options & PR_O_ABRT_CLOSE))) { |
| /* give up */ |
| si->exp = TICK_ETERNITY; |
| s->logs.t_queue = tv_ms_elapsed(&s->logs.tv_accept, &now); |
| si->shutr(si); |
| si->shutw(si); |
| si->err_type |= SI_ET_QUEUE_ABRT; |
| si->state = SI_ST_CLO; |
| return; |
| } |
| |
| /* Nothing changed */ |
| return; |
| } |
| else if (si->state == SI_ST_TAR) { |
| /* Connection request might be aborted */ |
| if ((si->ob->flags & (BF_READ_ERROR|BF_SHUTW_NOW)) || /* abort requested */ |
| ((si->ob->flags & BF_SHUTR) && /* empty and client stopped */ |
| (si->ob->flags & BF_EMPTY || s->be->options & PR_O_ABRT_CLOSE))) { |
| /* give up */ |
| si->exp = TICK_ETERNITY; |
| si->shutr(si); |
| si->shutw(si); |
| si->err_type |= SI_ET_CONN_ABRT; |
| si->state = SI_ST_CLO; |
| return; |
| } |
| |
| if (!(si->flags & SI_FL_EXP)) |
| return; /* still in turn-around */ |
| |
| si->exp = TICK_ETERNITY; |
| |
| /* we keep trying on the same server as long as the session is |
| * marked "assigned". |
| * FIXME: Should we force a redispatch attempt when the server is down ? |
| */ |
| if (s->flags & SN_ASSIGNED) |
| si->state = SI_ST_ASS; |
| else |
| si->state = SI_ST_REQ; |
| return; |
| } |
| } |
| |
| |
| /* Returns a 302 for a redirectable request. This may only be called just after |
| * the stream interface has moved to SI_ST_ASS. Unprocessable requests are |
| * left unchanged and will follow normal proxy processing. |
| */ |
| static void perform_http_redirect(struct session *s, struct stream_interface *si) |
| { |
| struct http_txn *txn; |
| struct chunk rdr; |
| char *path; |
| int len; |
| |
| /* 1: create the response header */ |
| rdr.len = strlen(HTTP_302); |
| rdr.str = trash; |
| memcpy(rdr.str, HTTP_302, rdr.len); |
| |
| /* 2: add the server's prefix */ |
| if (rdr.len + s->srv->rdr_len > sizeof(trash)) |
| return; |
| |
| memcpy(rdr.str + rdr.len, s->srv->rdr_pfx, s->srv->rdr_len); |
| rdr.len += s->srv->rdr_len; |
| |
| /* 3: add the request URI */ |
| txn = &s->txn; |
| path = http_get_path(txn); |
| if (!path) |
| return; |
| |
| len = txn->req.sl.rq.u_l + (txn->req.sol+txn->req.sl.rq.u) - path; |
| if (rdr.len + len > sizeof(trash) - 4) /* 4 for CRLF-CRLF */ |
| return; |
| |
| memcpy(rdr.str + rdr.len, path, len); |
| rdr.len += len; |
| memcpy(rdr.str + rdr.len, "\r\n\r\n", 4); |
| rdr.len += 4; |
| |
| /* prepare to return without error. */ |
| si->shutr(si); |
| si->shutw(si); |
| si->err_type = SI_ET_NONE; |
| si->err_loc = NULL; |
| si->state = SI_ST_CLO; |
| |
| /* send the message */ |
| srv_close_with_err(s, SN_ERR_PRXCOND, SN_FINST_C, 302, &rdr); |
| |
| /* FIXME: we should increase a counter of redirects per server and per backend. */ |
| if (s->srv) |
| s->srv->cum_sess++; |
| } |
| |
| |
| /* This function initiates a server connection request on a stream interface |
| * already in SI_ST_REQ state. Upon success, the state goes to SI_ST_ASS, |
| * indicating that a server has been assigned. It may also return SI_ST_QUE, |
| * or SI_ST_CLO upon error. |
| */ |
| static void sess_prepare_conn_req(struct session *s, struct stream_interface *si) { |
| DPRINTF(stderr,"[%u] %s: sess=%p rq=%p, rp=%p, exp(r,w)=%u,%u rqf=%08x rpf=%08x rql=%d rpl=%d cs=%d ss=%d\n", |
| now_ms, __FUNCTION__, |
| s, |
| s->req, s->rep, |
| s->req->rex, s->rep->wex, |
| s->req->flags, s->rep->flags, |
| s->req->l, s->rep->l, s->rep->cons->state, s->req->cons->state); |
| |
| if (si->state != SI_ST_REQ) |
| return; |
| |
| /* Try to assign a server */ |
| if (srv_redispatch_connect(s) != 0) { |
| /* We did not get a server. Either we queued the |
| * connection request, or we encountered an error. |
| */ |
| if (si->state == SI_ST_QUE) |
| return; |
| |
| /* we did not get any server, let's check the cause */ |
| si->shutr(si); |
| si->shutw(si); |
| si->ob->flags |= BF_WRITE_ERROR; |
| if (!si->err_type) |
| si->err_type = SI_ET_CONN_OTHER; |
| si->state = SI_ST_CLO; |
| return; |
| } |
| |
| /* The server is assigned */ |
| s->logs.t_queue = tv_ms_elapsed(&s->logs.tv_accept, &now); |
| si->state = SI_ST_ASS; |
| } |
| |
| |
| /* Return the error message corresponding to err_type. It is assumed |
| * that the server side is closed. Note that err_type is actually a |
| * bitmask, where almost only aborts may be cumulated with other |
| * values. We consider that aborted operations are more important |
| * than timeouts or errors due to the fact that nobody else in the |
| * logs might explain incomplete retries. All others should avoid |
| * being cumulated. It should normally not be possible to have multiple |
| * aborts at once, but just in case, the first one in sequence is reported. |
| */ |
| void return_srv_error(struct session *s, int err_type) |
| { |
| s->req->wex = TICK_ETERNITY; |
| |
| if (err_type & SI_ET_QUEUE_ABRT) |
| srv_close_with_err(s, SN_ERR_CLICL, SN_FINST_Q, |
| 503, error_message(s, HTTP_ERR_503)); |
| else if (err_type & SI_ET_CONN_ABRT) |
| srv_close_with_err(s, SN_ERR_CLICL, SN_FINST_C, |
| 503, error_message(s, HTTP_ERR_503)); |
| else if (err_type & SI_ET_QUEUE_TO) |
| srv_close_with_err(s, SN_ERR_SRVTO, SN_FINST_Q, |
| 503, error_message(s, HTTP_ERR_503)); |
| else if (err_type & SI_ET_QUEUE_ERR) |
| srv_close_with_err(s, SN_ERR_SRVCL, SN_FINST_Q, |
| 503, error_message(s, HTTP_ERR_503)); |
| else if (err_type & SI_ET_CONN_TO) |
| srv_close_with_err(s, SN_ERR_SRVTO, SN_FINST_C, |
| 503, error_message(s, HTTP_ERR_503)); |
| else if (err_type & SI_ET_CONN_ERR) |
| srv_close_with_err(s, SN_ERR_SRVCL, SN_FINST_C, |
| 503, error_message(s, HTTP_ERR_503)); |
| else /* SI_ET_CONN_OTHER and others */ |
| srv_close_with_err(s, SN_ERR_INTERNAL, SN_FINST_C, |
| 500, error_message(s, HTTP_ERR_500)); |
| } |
| |
| /* Processes the client, server, request and response jobs of a session task, |
| * then puts it back to the wait queue in a clean state, or cleans up its |
| * resources if it must be deleted. Returns in <next> the date the task wants |
| * to be woken up, or TICK_ETERNITY. In order not to call all functions for |
| * nothing too many times, the request and response buffers flags are monitored |
| * and each function is called only if at least another function has changed at |
| * least one flag it is interested in. |
| */ |
| void process_session(struct task *t, int *next) |
| { |
| struct session *s = t->context; |
| int resync; |
| unsigned int rqf_cli, rpf_cli; |
| unsigned int rqf_srv, rpf_srv; |
| |
| //DPRINTF(stderr, "%s:%d: cs=%d ss=%d(%d) rqf=0x%08x rpf=0x%08x\n", __FUNCTION__, __LINE__, |
| // s->si[0].state, s->si[1].state, s->si[1].err_type, s->req->flags, s->rep->flags); |
| |
| /* 1a: Check for low level timeouts if needed. We just set a flag on |
| * stream interfaces when their timeouts have expired. |
| */ |
| if (unlikely(t->state & TASK_WOKEN_TIMER)) { |
| stream_int_check_timeouts(&s->si[0]); |
| stream_int_check_timeouts(&s->si[1]); |
| } |
| |
| /* 1b: check for low-level errors reported at the stream interface. |
| * First we check if it's a retryable error (in which case we don't |
| * want to tell the buffer). Otherwise we report the error one level |
| * upper by setting flags into the buffers. Note that the side towards |
| * the client cannot have connect (hence retryable) errors. |
| */ |
| if (s->si[0].state == SI_ST_EST) { |
| if (unlikely(s->si[0].flags & SI_FL_ERR)) { |
| s->si[0].state = SI_ST_DIS; |
| fd_delete(s->si[0].fd); |
| stream_int_report_error(&s->si[0]); |
| } |
| } |
| |
| if (s->si[1].state == SI_ST_EST) { |
| if (unlikely(s->si[1].flags & SI_FL_ERR)) { |
| s->si[1].state = SI_ST_DIS; |
| fd_delete(s->si[1].fd); |
| stream_int_report_error(&s->si[1]); |
| /////////// FIXME: the following must move somewhere else |
| s->be->failed_resp++; |
| if (s->srv) |
| s->srv->failed_resp++; |
| } |
| } |
| else if (s->si[1].state >= SI_ST_QUE && s->si[1].state <= SI_ST_CON) { |
| /* Maybe we were trying to establish a connection on the server side ? */ |
| if (s->si[1].state == SI_ST_CON) { |
| if (unlikely(!sess_update_st_con_tcp(s, &s->si[1]))) |
| sess_update_st_cer(s, &s->si[1]); |
| else if (s->si[1].state == SI_ST_EST) |
| sess_establish(s, &s->si[1]); |
| } |
| |
| /* now try to complete any initiated connection setup */ |
| if (s->si[1].state >= SI_ST_REQ && s->si[1].state < SI_ST_CON) { |
| do { |
| /* nb: step 1 might switch from QUE to ASS, but we first want |
| * to give a chance to step 2 to perform a redirect if needed. |
| */ |
| sess_update_stream_int(s, &s->si[1]); |
| if (s->si[1].state == SI_ST_REQ) |
| sess_prepare_conn_req(s, &s->si[1]); |
| |
| ///// FIXME: redirect should be handled later |
| if (s->si[1].state == SI_ST_ASS && s->srv && |
| s->srv->rdr_len && (s->flags & SN_REDIRECTABLE)) |
| perform_http_redirect(s, &s->si[1]); |
| |
| } while (s->si[1].state == SI_ST_ASS); |
| } |
| } |
| |
| /////// FIXME: do that later |
| /* FIXME: we might have got errors above, and we should process them below */ |
| if ((s->si[1].state == SI_ST_DIS || s->si[1].state == SI_ST_CLO) && |
| s->si[1].prev_state != SI_ST_CLO && s->si[1].err_type != SI_ET_NONE) |
| return_srv_error(s, s->si[1].err_type); |
| |
| |
| /* 1a: Check for low level timeouts if needed. We just set a flag on |
| * buffers and/or stream interfaces when their timeouts have expired. |
| */ |
| if (unlikely(t->state & TASK_WOKEN_TIMER)) { |
| buffer_check_timeouts(s->req); |
| buffer_check_timeouts(s->rep); |
| } |
| |
| /* 1c: Manage buffer timeouts. */ |
| if (unlikely(s->req->flags & (BF_READ_TIMEOUT|BF_WRITE_TIMEOUT))) { |
| if (s->req->flags & BF_READ_TIMEOUT) { |
| //buffer_shutr(s->req); |
| s->req->cons->shutr(s->req->prod); |
| } |
| if (s->req->flags & BF_WRITE_TIMEOUT) { |
| //buffer_shutw(s->req); |
| s->req->cons->shutw(s->req->cons); |
| } |
| } |
| |
| if (unlikely(s->rep->flags & (BF_READ_TIMEOUT|BF_WRITE_TIMEOUT))) { |
| if (s->rep->flags & BF_READ_TIMEOUT) { |
| //buffer_shutr(s->rep); |
| s->rep->cons->shutr(s->rep->prod); |
| } |
| if (s->rep->flags & BF_WRITE_TIMEOUT) { |
| //buffer_shutw(s->rep); |
| s->rep->cons->shutw(s->rep->cons); |
| } |
| } |
| |
| /* 2: Check if we need to close the write side. This can only happen |
| * when either SHUTR or EMPTY appears, because WRITE_ENA cannot appear |
| * from low level, and neither HIJACK nor SHUTW can disappear from low |
| * level. |
| */ |
| if (unlikely((s->req->flags & (BF_SHUTW|BF_EMPTY|BF_HIJACK|BF_WRITE_ENA|BF_SHUTR)) == (BF_EMPTY|BF_WRITE_ENA|BF_SHUTR)) || |
| unlikely((s->req->flags & (BF_SHUTW|BF_SHUTW_NOW)) == BF_SHUTW_NOW)) { |
| //buffer_shutw(s->req); |
| s->req->cons->shutw(s->req->cons); |
| } |
| |
| if (unlikely((s->req->flags & (BF_SHUTW|BF_SHUTR|BF_SHUTR_NOW)) == BF_SHUTW)) { |
| /* write closed on server side, let's forward it to the client */ |
| //buffer_shutr_now(s->req); |
| s->req->prod->shutr(s->req->prod); |
| } |
| |
| if (unlikely((s->rep->flags & (BF_SHUTW|BF_EMPTY|BF_HIJACK|BF_WRITE_ENA|BF_SHUTR)) == (BF_EMPTY|BF_WRITE_ENA|BF_SHUTR)) || |
| unlikely((s->rep->flags & (BF_SHUTW|BF_SHUTW_NOW)) == BF_SHUTW_NOW)) { |
| //buffer_shutw(s->rep); |
| s->rep->cons->shutw(s->rep->cons); |
| } |
| |
| if (unlikely((s->rep->flags & (BF_SHUTW|BF_SHUTR|BF_SHUTR_NOW)) == BF_SHUTW)) { |
| /* write closed on client side, let's forward it to the server */ |
| //buffer_shutr_now(s->rep); |
| s->rep->prod->shutr(s->rep->prod); |
| } |
| |
| /* 3: When a server-side connection is released, we have to |
| * count it and check for pending connections on this server. |
| */ |
| if (unlikely(s->req->cons->state == SI_ST_DIS)) { |
| s->req->cons->state = SI_ST_CLO; |
| if (s->srv) { |
| if (s->flags & SN_CURR_SESS) { |
| s->flags &= ~SN_CURR_SESS; |
| s->srv->cur_sess--; |
| } |
| sess_change_server(s, NULL); |
| if (may_dequeue_tasks(s->srv, s->be)) |
| process_srv_queue(s->srv); |
| } |
| } |
| |
| /* nothing special to be done on client side */ |
| if (unlikely(s->req->prod->state == SI_ST_DIS)) |
| s->req->prod->state = SI_ST_CLO; |
| |
| /* |
| * Note: all transient states (REQ, CER, DIS) have been eliminated at |
| * this point. |
| */ |
| |
| |
| /* Dirty trick: force one first pass everywhere */ |
| rqf_cli = rqf_srv = ~s->req->flags; |
| rpf_cli = rpf_srv = ~s->rep->flags; |
| |
| /* well, SI_ST_EST state is already handled properly */ |
| if (s->req->prod->state == SI_ST_EST) { |
| rqf_cli = s->req->flags; |
| rpf_cli = s->rep->flags; |
| } |
| |
| if (s->req->cons->state == SI_ST_EST) { |
| rqf_srv = s->req->flags; |
| rpf_srv = s->rep->flags; |
| } |
| |
| do { |
| DPRINTF(stderr,"[%u] %s: task=%p s=%p, sfl=0x%08x, rq=%p, rp=%p, exp(r,w)=%u,%u rqf=%08x rpf=%08x rql=%d rpl=%d cs=%d ss=%d, cet=0x%x set=0x%x retr=%d\n", |
| now_ms, __FUNCTION__, |
| t, |
| s, s->flags, |
| s->req, s->rep, |
| s->req->rex, s->rep->wex, |
| s->req->flags, s->rep->flags, |
| s->req->l, s->rep->l, s->rep->cons->state, s->req->cons->state, |
| s->rep->cons->err_type, s->req->cons->err_type, |
| s->conn_retries); |
| |
| resync = 0; |
| |
| /* Maybe resync client FD state */ |
| if (s->rep->cons->state != SI_ST_CLO) { |
| if (((rqf_cli ^ s->req->flags) & BF_MASK_INTERFACE_I) || |
| ((rpf_cli ^ s->rep->flags) & BF_MASK_INTERFACE_O)) { |
| |
| if (!(s->rep->flags & BF_SHUTW)) |
| buffer_check_shutw(s->rep); |
| if (!(s->req->flags & BF_SHUTR)) |
| buffer_check_shutr(s->req); |
| |
| rqf_cli = s->req->flags; |
| rpf_cli = s->rep->flags; |
| } |
| } |
| |
| /* Maybe resync server FD state */ |
| if (s->req->cons->state != SI_ST_CLO) { |
| if (((rpf_srv ^ s->rep->flags) & BF_MASK_INTERFACE_I) || |
| ((rqf_srv ^ s->req->flags) & BF_MASK_INTERFACE_O)) { |
| if (s->req->cons->state == SI_ST_INI && |
| (s->req->flags & (BF_WRITE_ENA|BF_SHUTW|BF_SHUTW_NOW)) == BF_WRITE_ENA) { |
| s->req->cons->state = SI_ST_REQ; |
| do { |
| sess_prepare_conn_req(s, &s->si[1]); |
| if (s->si[1].state != SI_ST_ASS) |
| break; |
| if (s->srv && s->srv->rdr_len && (s->flags & SN_REDIRECTABLE)) |
| perform_http_redirect(s, &s->si[1]); |
| sess_update_stream_int(s, &s->si[1]); |
| } while (s->si[1].state == SI_ST_REQ || s->si[1].state == SI_ST_ASS); |
| |
| /* FIXME: how to process this type of errors ? */ |
| if (s->si[1].state == SI_ST_CLO && s->si[1].err_type != SI_ET_NONE) |
| return_srv_error(s, s->si[1].err_type); |
| resync = 1; |
| } |
| |
| if (s->req->cons->state == SI_ST_EST) { |
| if ((s->req->flags & (BF_SHUTW|BF_EMPTY|BF_WRITE_ENA)) == (BF_EMPTY|BF_WRITE_ENA) && |
| s->be->options & PR_O_FORCE_CLO && |
| s->rep->flags & BF_READ_ACTIVITY) { |
| /* We want to force the connection to the server to close, |
| * and the server has begun to respond. That's the right |
| * time. |
| */ |
| buffer_shutw_now(s->req); |
| } |
| |
| if (!(s->req->flags & BF_SHUTW)) |
| buffer_check_shutw(s->req); |
| if (!(s->rep->flags & BF_SHUTR)) |
| buffer_check_shutr(s->rep); |
| |
| /* When a server-side connection is released, we have to |
| * count it and check for pending connections on this server. |
| */ |
| if (s->req->cons->state == SI_ST_DIS) { |
| s->req->cons->state = SI_ST_CLO; |
| if (s->srv) { |
| if (s->flags & SN_CURR_SESS) { |
| s->flags &= ~SN_CURR_SESS; |
| s->srv->cur_sess--; |
| } |
| sess_change_server(s, NULL); |
| if (may_dequeue_tasks(s->srv, s->be)) |
| process_srv_queue(s->srv); |
| } |
| } |
| } |
| rqf_srv = s->req->flags; |
| rpf_srv = s->rep->flags; |
| } |
| } |
| |
| /* we may have to resync because of pending connections */ |
| if (resync) |
| continue; |
| |
| /**** Process layer 7 below ****/ |
| |
| /* Analyse request */ |
| if (s->req->flags & BF_MASK_ANALYSER) { |
| unsigned int flags = s->req->flags; |
| |
| if (s->req->prod->state >= SI_ST_EST) { |
| /* it's up to the analysers to reset write_ena */ |
| buffer_write_ena(s->req); |
| if (s->req->analysers) |
| process_request(s); |
| } |
| s->req->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| if (s->req->flags != flags) |
| resync = 1; |
| } |
| |
| /* Analyse response */ |
| if (unlikely(s->rep->flags & BF_HIJACK)) { |
| /* In inject mode, we wake up everytime something has |
| * happened on the write side of the buffer. |
| */ |
| unsigned int flags = s->rep->flags; |
| |
| if ((s->rep->flags & (BF_WRITE_PARTIAL|BF_WRITE_ERROR|BF_SHUTW)) && |
| !(s->rep->flags & BF_FULL)) { |
| produce_content(s); |
| } |
| s->rep->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| if (s->rep->flags != flags) |
| resync = 1; |
| } |
| else if (s->rep->flags & BF_MASK_ANALYSER) { |
| unsigned int flags = s->rep->flags; |
| |
| if (s->rep->prod->state >= SI_ST_EST) { |
| /* it's up to the analysers to reset write_ena */ |
| buffer_write_ena(s->rep); |
| if (s->rep->analysers) |
| process_response(s); |
| } |
| s->rep->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| if (s->rep->flags != flags) |
| resync = 1; |
| } |
| |
| /* For the moment, we need to clean the client and server flags that |
| * have vanished. This is just a temporary measure though. |
| */ |
| rqf_cli &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| rqf_srv &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| rpf_cli &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| rpf_srv &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| } while (resync); |
| |
| /* This is needed only when debugging is enabled, to indicate |
| * client-side or server-side close. Please note that in the unlikely |
| * event where both sides would close at once, the sequence is reported |
| * on the server side first. |
| */ |
| if (unlikely((global.mode & MODE_DEBUG) && |
| (!(global.mode & MODE_QUIET) || |
| (global.mode & MODE_VERBOSE)))) { |
| int len; |
| |
| if (s->si[1].state == SI_ST_CLO && |
| s->si[1].prev_state == SI_ST_EST) { |
| len = sprintf(trash, "%08x:%s.srvcls[%04x:%04x]\n", |
| s->uniq_id, s->be->id, |
| (unsigned short)s->si[0].fd, |
| (unsigned short)s->si[1].fd); |
| write(1, trash, len); |
| } |
| |
| if (s->si[0].state == SI_ST_CLO && |
| s->si[0].prev_state == SI_ST_EST) { |
| len = sprintf(trash, "%08x:%s.clicls[%04x:%04x]\n", |
| s->uniq_id, s->be->id, |
| (unsigned short)s->si[0].fd, |
| (unsigned short)s->si[1].fd); |
| write(1, trash, len); |
| } |
| } |
| |
| if (likely((s->rep->cons->state != SI_ST_CLO) || |
| (s->req->cons->state > SI_ST_INI && s->req->cons->state < SI_ST_CLO))) { |
| |
| if ((s->fe->options & PR_O_CONTSTATS) && (s->flags & SN_BE_ASSIGNED)) |
| session_process_counters(s); |
| |
| if (s->rep->cons->state == SI_ST_EST) |
| stream_sock_data_finish(s->rep->cons->fd); |
| |
| if (s->req->cons->state == SI_ST_EST) |
| stream_sock_data_finish(s->req->cons->fd); |
| |
| s->req->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| s->rep->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT; |
| s->si[0].prev_state = s->si[0].state; |
| s->si[1].prev_state = s->si[1].state; |
| s->si[0].flags = s->si[1].flags = SI_FL_NONE; |
| |
| /* Trick: if a request is being waiting for the server to respond, |
| * and if we know the server can timeout, we don't want the timeout |
| * to expire on the client side first, but we're still interested |
| * in passing data from the client to the server (eg: POST). Thus, |
| * we can cancel the client's request timeout if the server's |
| * request timeout is set and the server has not yet sent a response. |
| */ |
| |
| if ((s->rep->flags & (BF_WRITE_ENA|BF_SHUTR)) == 0 && |
| (tick_isset(s->req->wex) || tick_isset(s->rep->rex))) |
| s->req->rex = TICK_ETERNITY; |
| |
| t->expire = tick_first(tick_first(s->req->rex, s->req->wex), |
| tick_first(s->rep->rex, s->rep->wex)); |
| if (s->req->analysers) |
| t->expire = tick_first(t->expire, s->req->analyse_exp); |
| |
| if (s->si[0].exp) |
| t->expire = tick_first(t->expire, s->si[0].exp); |
| |
| if (s->si[1].exp) |
| t->expire = tick_first(t->expire, s->si[1].exp); |
| |
| #ifdef DEBUG_FULL |
| fprintf(stderr, "[%u] queuing with exp=%u req->rex=%u req->wex=%u req->ana_exp=%u rep->rex=%u rep->wex=%u, cs=%d, ss=%d\n", |
| now_ms, t->expire, s->req->rex, s->req->wex, s->req->analyse_exp, s->rep->rex, s->rep->wex, s->si[0].state, s->si[1].state); |
| #endif |
| /* restore t to its place in the task list */ |
| task_queue(t); |
| |
| #ifdef DEBUG_DEV |
| /* this may only happen when no timeout is set or in case of an FSM bug */ |
| if (!t->expire) |
| ABORT_NOW(); |
| #endif |
| *next = t->expire; |
| return; /* nothing more to do */ |
| } |
| |
| s->fe->feconn--; |
| if (s->flags & SN_BE_ASSIGNED) |
| s->be->beconn--; |
| actconn--; |
| |
| if (unlikely((global.mode & MODE_DEBUG) && |
| (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)))) { |
| int len; |
| len = sprintf(trash, "%08x:%s.closed[%04x:%04x] (term_trace=0x%08x)\n", |
| s->uniq_id, s->be->id, |
| (unsigned short)s->req->prod->fd, (unsigned short)s->req->cons->fd, |
| s->term_trace); |
| write(1, trash, len); |
| } |
| |
| s->logs.t_close = tv_ms_elapsed(&s->logs.tv_accept, &now); |
| session_process_counters(s); |
| |
| /* let's do a final log if we need it */ |
| if (s->logs.logwait && |
| !(s->flags & SN_MONITOR) && |
| (!(s->fe->options & PR_O_NULLNOLOG) || s->req->total)) { |
| if (s->fe->to_log & LW_REQ) |
| http_sess_log(s); |
| else |
| tcp_sess_log(s); |
| } |
| |
| /* the task MUST not be in the run queue anymore */ |
| task_delete(t); |
| session_free(s); |
| task_free(t); |
| *next = TICK_ETERNITY; |
| } |
| |
| |
| extern const char sess_term_cond[8]; |
| extern const char sess_fin_state[8]; |
| extern const char *monthname[12]; |
| const char sess_cookie[4] = "NIDV"; /* No cookie, Invalid cookie, cookie for a Down server, Valid cookie */ |
| const char sess_set_cookie[8] = "N1I3PD5R"; /* No set-cookie, unknown, Set-Cookie Inserted, unknown, |
| Set-cookie seen and left unchanged (passive), Set-cookie Deleted, |
| unknown, Set-cookie Rewritten */ |
| struct pool_head *pool2_requri; |
| struct pool_head *pool2_capture; |
| |
| /* |
| * send a log for the session when we have enough info about it. |
| * Will not log if the frontend has no log defined. |
| */ |
| static void http_sess_log(struct session *s) |
| { |
| char pn[INET6_ADDRSTRLEN + strlen(":65535")]; |
| struct proxy *fe = s->fe; |
| struct proxy *be = s->be; |
| struct proxy *prx_log; |
| struct http_txn *txn = &s->txn; |
| int tolog; |
| char *uri, *h; |
| char *svid; |
| struct tm tm; |
| static char tmpline[MAX_SYSLOG_LEN]; |
| int t_request; |
| int hdr; |
| |
| if (fe->logfac1 < 0 && fe->logfac2 < 0) |
| return; |
| prx_log = fe; |
| |
| if (s->cli_addr.ss_family == AF_INET) |
| inet_ntop(AF_INET, |
| (const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr, |
| pn, sizeof(pn)); |
| else |
| inet_ntop(AF_INET6, |
| (const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr, |
| pn, sizeof(pn)); |
| |
| get_localtime(s->logs.accept_date.tv_sec, &tm); |
| |
| /* FIXME: let's limit ourselves to frontend logging for now. */ |
| tolog = fe->to_log; |
| |
| h = tmpline; |
| if (fe->to_log & LW_REQHDR && |
| txn->req.cap && |
| (h < tmpline + sizeof(tmpline) - 10)) { |
| *(h++) = ' '; |
| *(h++) = '{'; |
| for (hdr = 0; hdr < fe->nb_req_cap; hdr++) { |
| if (hdr) |
| *(h++) = '|'; |
| if (txn->req.cap[hdr] != NULL) |
| h = encode_string(h, tmpline + sizeof(tmpline) - 7, |
| '#', hdr_encode_map, txn->req.cap[hdr]); |
| } |
| *(h++) = '}'; |
| } |
| |
| if (fe->to_log & LW_RSPHDR && |
| txn->rsp.cap && |
| (h < tmpline + sizeof(tmpline) - 7)) { |
| *(h++) = ' '; |
| *(h++) = '{'; |
| for (hdr = 0; hdr < fe->nb_rsp_cap; hdr++) { |
| if (hdr) |
| *(h++) = '|'; |
| if (txn->rsp.cap[hdr] != NULL) |
| h = encode_string(h, tmpline + sizeof(tmpline) - 4, |
| '#', hdr_encode_map, txn->rsp.cap[hdr]); |
| } |
| *(h++) = '}'; |
| } |
| |
| if (h < tmpline + sizeof(tmpline) - 4) { |
| *(h++) = ' '; |
| *(h++) = '"'; |
| uri = txn->uri ? txn->uri : "<BADREQ>"; |
| h = encode_string(h, tmpline + sizeof(tmpline) - 1, |
| '#', url_encode_map, uri); |
| *(h++) = '"'; |
| } |
| *h = '\0'; |
| |
| svid = (tolog & LW_SVID) ? |
| (s->data_source != DATA_SRC_STATS) ? |
| (s->srv != NULL) ? s->srv->id : "<NOSRV>" : "<STATS>" : "-"; |
| |
| t_request = -1; |
| if (tv_isge(&s->logs.tv_request, &s->logs.tv_accept)) |
| t_request = tv_ms_elapsed(&s->logs.tv_accept, &s->logs.tv_request); |
| |
| send_log(prx_log, LOG_INFO, |
| "%s:%d [%02d/%s/%04d:%02d:%02d:%02d.%03d]" |
| " %s %s/%s %d/%d/%d/%d/%s%d %d %s%lld" |
| " %s %s %c%c%c%c %d/%d/%d/%d/%s%u %d/%d%s\n", |
| pn, |
| (s->cli_addr.ss_family == AF_INET) ? |
| ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) : |
| ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port), |
| tm.tm_mday, monthname[tm.tm_mon], tm.tm_year+1900, |
| tm.tm_hour, tm.tm_min, tm.tm_sec, s->logs.accept_date.tv_usec/1000, |
| fe->id, be->id, svid, |
| t_request, |
| (s->logs.t_queue >= 0) ? s->logs.t_queue - t_request : -1, |
| (s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_queue : -1, |
| (s->logs.t_data >= 0) ? s->logs.t_data - s->logs.t_connect : -1, |
| (tolog & LW_BYTES) ? "" : "+", s->logs.t_close, |
| txn->status, |
| (tolog & LW_BYTES) ? "" : "+", s->logs.bytes_out, |
| txn->cli_cookie ? txn->cli_cookie : "-", |
| txn->srv_cookie ? txn->srv_cookie : "-", |
| sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT], |
| sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT], |
| (be->options & PR_O_COOK_ANY) ? sess_cookie[(txn->flags & TX_CK_MASK) >> TX_CK_SHIFT] : '-', |
| (be->options & PR_O_COOK_ANY) ? sess_set_cookie[(txn->flags & TX_SCK_MASK) >> TX_SCK_SHIFT] : '-', |
| actconn, fe->feconn, be->beconn, s->srv ? s->srv->cur_sess : 0, |
| (s->flags & SN_REDISP)?"+":"", |
| (s->conn_retries>0)?(be->conn_retries - s->conn_retries):be->conn_retries, |
| s->logs.srv_queue_size, s->logs.prx_queue_size, tmpline); |
| |
| s->logs.logwait = 0; |
| } |
| |
| |
| /* |
| * Capture headers from message starting at <som> according to header list |
| * <cap_hdr>, and fill the <idx> structure appropriately. |
| */ |
| void capture_headers(char *som, struct hdr_idx *idx, |
| char **cap, struct cap_hdr *cap_hdr) |
| { |
| char *eol, *sol, *col, *sov; |
| int cur_idx; |
| struct cap_hdr *h; |
| int len; |
| |
| sol = som + hdr_idx_first_pos(idx); |
| cur_idx = hdr_idx_first_idx(idx); |
| |
| while (cur_idx) { |
| eol = sol + idx->v[cur_idx].len; |
| |
| col = sol; |
| while (col < eol && *col != ':') |
| col++; |
| |
| sov = col + 1; |
| while (sov < eol && http_is_lws[(unsigned char)*sov]) |
| sov++; |
| |
| for (h = cap_hdr; h; h = h->next) { |
| if ((h->namelen == col - sol) && |
| (strncasecmp(sol, h->name, h->namelen) == 0)) { |
| if (cap[h->index] == NULL) |
| cap[h->index] = |
| pool_alloc2(h->pool); |
| |
| if (cap[h->index] == NULL) { |
| Alert("HTTP capture : out of memory.\n"); |
| continue; |
| } |
| |
| len = eol - sov; |
| if (len > h->len) |
| len = h->len; |
| |
| memcpy(cap[h->index], sov, len); |
| cap[h->index][len]=0; |
| } |
| } |
| sol = eol + idx->v[cur_idx].cr + 1; |
| cur_idx = idx->v[cur_idx].next; |
| } |
| } |
| |
| |
| /* either we find an LF at <ptr> or we jump to <bad>. |
| */ |
| #define EXPECT_LF_HERE(ptr, bad) do { if (unlikely(*(ptr) != '\n')) goto bad; } while (0) |
| |
| /* plays with variables <ptr>, <end> and <state>. Jumps to <good> if OK, |
| * otherwise to <http_msg_ood> with <state> set to <st>. |
| */ |
| #define EAT_AND_JUMP_OR_RETURN(good, st) do { \ |
| ptr++; \ |
| if (likely(ptr < end)) \ |
| goto good; \ |
| else { \ |
| state = (st); \ |
| goto http_msg_ood; \ |
| } \ |
| } while (0) |
| |
| |
| /* |
| * This function parses a status line between <ptr> and <end>, starting with |
| * parser state <state>. Only states HTTP_MSG_RPVER, HTTP_MSG_RPVER_SP, |
| * HTTP_MSG_RPCODE, HTTP_MSG_RPCODE_SP and HTTP_MSG_RPREASON are handled. Others |
| * will give undefined results. |
| * Note that it is upon the caller's responsibility to ensure that ptr < end, |
| * and that msg->sol points to the beginning of the response. |
| * If a complete line is found (which implies that at least one CR or LF is |
| * found before <end>, the updated <ptr> is returned, otherwise NULL is |
| * returned indicating an incomplete line (which does not mean that parts have |
| * not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are |
| * non-NULL, they are fed with the new <ptr> and <state> values to be passed |
| * upon next call. |
| * |
| * This function was intentionally designed to be called from |
| * http_msg_analyzer() with the lowest overhead. It should integrate perfectly |
| * within its state machine and use the same macros, hence the need for same |
| * labels and variable names. Note that msg->sol is left unchanged. |
| */ |
| const char *http_parse_stsline(struct http_msg *msg, const char *msg_buf, |
| unsigned int state, const char *ptr, const char *end, |
| char **ret_ptr, unsigned int *ret_state) |
| { |
| __label__ |
| http_msg_rpver, |
| http_msg_rpver_sp, |
| http_msg_rpcode, |
| http_msg_rpcode_sp, |
| http_msg_rpreason, |
| http_msg_rpline_eol, |
| http_msg_ood, /* out of data */ |
| http_msg_invalid; |
| |
| switch (state) { |
| http_msg_rpver: |
| case HTTP_MSG_RPVER: |
| if (likely(HTTP_IS_VER_TOKEN(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpver, HTTP_MSG_RPVER); |
| |
| if (likely(HTTP_IS_SPHT(*ptr))) { |
| msg->sl.st.v_l = (ptr - msg_buf) - msg->som; |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP); |
| } |
| goto http_msg_invalid; |
| |
| http_msg_rpver_sp: |
| case HTTP_MSG_RPVER_SP: |
| if (likely(!HTTP_IS_LWS(*ptr))) { |
| msg->sl.st.c = ptr - msg_buf; |
| goto http_msg_rpcode; |
| } |
| if (likely(HTTP_IS_SPHT(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP); |
| /* so it's a CR/LF, this is invalid */ |
| goto http_msg_invalid; |
| |
| http_msg_rpcode: |
| case HTTP_MSG_RPCODE: |
| if (likely(!HTTP_IS_LWS(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpcode, HTTP_MSG_RPCODE); |
| |
| if (likely(HTTP_IS_SPHT(*ptr))) { |
| msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c; |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP); |
| } |
| |
| /* so it's a CR/LF, so there is no reason phrase */ |
| msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c; |
| http_msg_rsp_reason: |
| /* FIXME: should we support HTTP responses without any reason phrase ? */ |
| msg->sl.st.r = ptr - msg_buf; |
| msg->sl.st.r_l = 0; |
| goto http_msg_rpline_eol; |
| |
| http_msg_rpcode_sp: |
| case HTTP_MSG_RPCODE_SP: |
| if (likely(!HTTP_IS_LWS(*ptr))) { |
| msg->sl.st.r = ptr - msg_buf; |
| goto http_msg_rpreason; |
| } |
| if (likely(HTTP_IS_SPHT(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP); |
| /* so it's a CR/LF, so there is no reason phrase */ |
| goto http_msg_rsp_reason; |
| |
| http_msg_rpreason: |
| case HTTP_MSG_RPREASON: |
| if (likely(!HTTP_IS_CRLF(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpreason, HTTP_MSG_RPREASON); |
| msg->sl.st.r_l = (ptr - msg_buf) - msg->sl.st.r; |
| http_msg_rpline_eol: |
| /* We have seen the end of line. Note that we do not |
| * necessarily have the \n yet, but at least we know that we |
| * have EITHER \r OR \n, otherwise the response would not be |
| * complete. We can then record the response length and return |
| * to the caller which will be able to register it. |
| */ |
| msg->sl.st.l = ptr - msg->sol; |
| return ptr; |
| |
| #ifdef DEBUG_FULL |
| default: |
| fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state); |
| exit(1); |
| #endif |
| } |
| |
| http_msg_ood: |
| /* out of data */ |
| if (ret_state) |
| *ret_state = state; |
| if (ret_ptr) |
| *ret_ptr = (char *)ptr; |
| return NULL; |
| |
| http_msg_invalid: |
| /* invalid message */ |
| if (ret_state) |
| *ret_state = HTTP_MSG_ERROR; |
| return NULL; |
| } |
| |
| |
| /* |
| * This function parses a request line between <ptr> and <end>, starting with |
| * parser state <state>. Only states HTTP_MSG_RQMETH, HTTP_MSG_RQMETH_SP, |
| * HTTP_MSG_RQURI, HTTP_MSG_RQURI_SP and HTTP_MSG_RQVER are handled. Others |
| * will give undefined results. |
| * Note that it is upon the caller's responsibility to ensure that ptr < end, |
| * and that msg->sol points to the beginning of the request. |
| * If a complete line is found (which implies that at least one CR or LF is |
| * found before <end>, the updated <ptr> is returned, otherwise NULL is |
| * returned indicating an incomplete line (which does not mean that parts have |
| * not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are |
| * non-NULL, they are fed with the new <ptr> and <state> values to be passed |
| * upon next call. |
| * |
| * This function was intentionally designed to be called from |
| * http_msg_analyzer() with the lowest overhead. It should integrate perfectly |
| * within its state machine and use the same macros, hence the need for same |
| * labels and variable names. Note that msg->sol is left unchanged. |
| */ |
| const char *http_parse_reqline(struct http_msg *msg, const char *msg_buf, |
| unsigned int state, const char *ptr, const char *end, |
| char **ret_ptr, unsigned int *ret_state) |
| { |
| __label__ |
| http_msg_rqmeth, |
| http_msg_rqmeth_sp, |
| http_msg_rquri, |
| http_msg_rquri_sp, |
| http_msg_rqver, |
| http_msg_rqline_eol, |
| http_msg_ood, /* out of data */ |
| http_msg_invalid; |
| |
| switch (state) { |
| http_msg_rqmeth: |
| case HTTP_MSG_RQMETH: |
| if (likely(HTTP_IS_TOKEN(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth, HTTP_MSG_RQMETH); |
| |
| if (likely(HTTP_IS_SPHT(*ptr))) { |
| msg->sl.rq.m_l = (ptr - msg_buf) - msg->som; |
| EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP); |
| } |
| |
| if (likely(HTTP_IS_CRLF(*ptr))) { |
| /* HTTP 0.9 request */ |
| msg->sl.rq.m_l = (ptr - msg_buf) - msg->som; |
| http_msg_req09_uri: |
| msg->sl.rq.u = ptr - msg_buf; |
| http_msg_req09_uri_e: |
| msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u; |
| http_msg_req09_ver: |
| msg->sl.rq.v = ptr - msg_buf; |
| msg->sl.rq.v_l = 0; |
| goto http_msg_rqline_eol; |
| } |
| goto http_msg_invalid; |
| |
| http_msg_rqmeth_sp: |
| case HTTP_MSG_RQMETH_SP: |
| if (likely(!HTTP_IS_LWS(*ptr))) { |
| msg->sl.rq.u = ptr - msg_buf; |
| goto http_msg_rquri; |
| } |
| if (likely(HTTP_IS_SPHT(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP); |
| /* so it's a CR/LF, meaning an HTTP 0.9 request */ |
| goto http_msg_req09_uri; |
| |
| http_msg_rquri: |
| case HTTP_MSG_RQURI: |
| if (likely(!HTTP_IS_LWS(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rquri, HTTP_MSG_RQURI); |
| |
| if (likely(HTTP_IS_SPHT(*ptr))) { |
| msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u; |
| EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP); |
| } |
| |
| /* so it's a CR/LF, meaning an HTTP 0.9 request */ |
| goto http_msg_req09_uri_e; |
| |
| http_msg_rquri_sp: |
| case HTTP_MSG_RQURI_SP: |
| if (likely(!HTTP_IS_LWS(*ptr))) { |
| msg->sl.rq.v = ptr - msg_buf; |
| goto http_msg_rqver; |
| } |
| if (likely(HTTP_IS_SPHT(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP); |
| /* so it's a CR/LF, meaning an HTTP 0.9 request */ |
| goto http_msg_req09_ver; |
| |
| http_msg_rqver: |
| case HTTP_MSG_RQVER: |
| if (likely(HTTP_IS_VER_TOKEN(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rqver, HTTP_MSG_RQVER); |
| |
| if (likely(HTTP_IS_CRLF(*ptr))) { |
| msg->sl.rq.v_l = (ptr - msg_buf) - msg->sl.rq.v; |
| http_msg_rqline_eol: |
| /* We have seen the end of line. Note that we do not |
| * necessarily have the \n yet, but at least we know that we |
| * have EITHER \r OR \n, otherwise the request would not be |
| * complete. We can then record the request length and return |
| * to the caller which will be able to register it. |
| */ |
| msg->sl.rq.l = ptr - msg->sol; |
| return ptr; |
| } |
| |
| /* neither an HTTP_VER token nor a CRLF */ |
| goto http_msg_invalid; |
| |
| #ifdef DEBUG_FULL |
| default: |
| fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state); |
| exit(1); |
| #endif |
| } |
| |
| http_msg_ood: |
| /* out of data */ |
| if (ret_state) |
| *ret_state = state; |
| if (ret_ptr) |
| *ret_ptr = (char *)ptr; |
| return NULL; |
| |
| http_msg_invalid: |
| /* invalid message */ |
| if (ret_state) |
| *ret_state = HTTP_MSG_ERROR; |
| return NULL; |
| } |
| |
| |
| /* |
| * This function parses an HTTP message, either a request or a response, |
| * depending on the initial msg->msg_state. It can be preempted everywhere |
| * when data are missing and recalled at the exact same location with no |
| * information loss. The header index is re-initialized when switching from |
| * MSG_R[PQ]BEFORE to MSG_RPVER|MSG_RQMETH. It modifies msg->sol among other |
| * fields. |
| */ |
| void http_msg_analyzer(struct buffer *buf, struct http_msg *msg, struct hdr_idx *idx) |
| { |
| __label__ |
| http_msg_rqbefore, |
| http_msg_rqbefore_cr, |
| http_msg_rqmeth, |
| http_msg_rqline_end, |
| http_msg_hdr_first, |
| http_msg_hdr_name, |
| http_msg_hdr_l1_sp, |
| http_msg_hdr_l1_lf, |
| http_msg_hdr_l1_lws, |
| http_msg_hdr_val, |
| http_msg_hdr_l2_lf, |
| http_msg_hdr_l2_lws, |
| http_msg_complete_header, |
| http_msg_last_lf, |
| http_msg_ood, /* out of data */ |
| http_msg_invalid; |
| |
| unsigned int state; /* updated only when leaving the FSM */ |
| register char *ptr, *end; /* request pointers, to avoid dereferences */ |
| |
| state = msg->msg_state; |
| ptr = buf->lr; |
| end = buf->r; |
| |
| if (unlikely(ptr >= end)) |
| goto http_msg_ood; |
| |
| switch (state) { |
| /* |
| * First, states that are specific to the response only. |
| * We check them first so that request and headers are |
| * closer to each other (accessed more often). |
| */ |
| http_msg_rpbefore: |
| case HTTP_MSG_RPBEFORE: |
| if (likely(HTTP_IS_TOKEN(*ptr))) { |
| if (likely(ptr == buf->data)) { |
| msg->sol = ptr; |
| msg->som = 0; |
| } else { |
| #if PARSE_PRESERVE_EMPTY_LINES |
| /* only skip empty leading lines, don't remove them */ |
| msg->sol = ptr; |
| msg->som = ptr - buf->data; |
| #else |
| /* Remove empty leading lines, as recommended by |
| * RFC2616. This takes a lot of time because we |
| * must move all the buffer backwards, but this |
| * is rarely needed. The method above will be |
| * cleaner when we'll be able to start sending |
| * the request from any place in the buffer. |
| */ |
| buf->lr = ptr; |
| buffer_replace2(buf, buf->data, buf->lr, NULL, 0); |
| msg->som = 0; |
| msg->sol = buf->data; |
| ptr = buf->data; |
| end = buf->r; |
| #endif |
| } |
| hdr_idx_init(idx); |
| state = HTTP_MSG_RPVER; |
| goto http_msg_rpver; |
| } |
| |
| if (unlikely(!HTTP_IS_CRLF(*ptr))) |
| goto http_msg_invalid; |
| |
| if (unlikely(*ptr == '\n')) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE); |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore_cr, HTTP_MSG_RPBEFORE_CR); |
| /* stop here */ |
| |
| http_msg_rpbefore_cr: |
| case HTTP_MSG_RPBEFORE_CR: |
| EXPECT_LF_HERE(ptr, http_msg_invalid); |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE); |
| /* stop here */ |
| |
| http_msg_rpver: |
| case HTTP_MSG_RPVER: |
| case HTTP_MSG_RPVER_SP: |
| case HTTP_MSG_RPCODE: |
| case HTTP_MSG_RPCODE_SP: |
| case HTTP_MSG_RPREASON: |
| ptr = (char *)http_parse_stsline(msg, buf->data, state, ptr, end, |
| &buf->lr, &msg->msg_state); |
| if (unlikely(!ptr)) |
| return; |
| |
| /* we have a full response and we know that we have either a CR |
| * or an LF at <ptr>. |
| */ |
| //fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.st.l, *ptr); |
| hdr_idx_set_start(idx, msg->sl.st.l, *ptr == '\r'); |
| |
| msg->sol = ptr; |
| if (likely(*ptr == '\r')) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rpline_end, HTTP_MSG_RPLINE_END); |
| goto http_msg_rpline_end; |
| |
| http_msg_rpline_end: |
| case HTTP_MSG_RPLINE_END: |
| /* msg->sol must point to the first of CR or LF. */ |
| EXPECT_LF_HERE(ptr, http_msg_invalid); |
| EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST); |
| /* stop here */ |
| |
| /* |
| * Second, states that are specific to the request only |
| */ |
| http_msg_rqbefore: |
| case HTTP_MSG_RQBEFORE: |
| if (likely(HTTP_IS_TOKEN(*ptr))) { |
| if (likely(ptr == buf->data)) { |
| msg->sol = ptr; |
| msg->som = 0; |
| } else { |
| #if PARSE_PRESERVE_EMPTY_LINES |
| /* only skip empty leading lines, don't remove them */ |
| msg->sol = ptr; |
| msg->som = ptr - buf->data; |
| #else |
| /* Remove empty leading lines, as recommended by |
| * RFC2616. This takes a lot of time because we |
| * must move all the buffer backwards, but this |
| * is rarely needed. The method above will be |
| * cleaner when we'll be able to start sending |
| * the request from any place in the buffer. |
| */ |
| buf->lr = ptr; |
| buffer_replace2(buf, buf->data, buf->lr, NULL, 0); |
| msg->som = 0; |
| msg->sol = buf->data; |
| ptr = buf->data; |
| end = buf->r; |
| #endif |
| } |
| /* we will need this when keep-alive will be supported |
| hdr_idx_init(idx); |
| */ |
| state = HTTP_MSG_RQMETH; |
| goto http_msg_rqmeth; |
| } |
| |
| if (unlikely(!HTTP_IS_CRLF(*ptr))) |
| goto http_msg_invalid; |
| |
| if (unlikely(*ptr == '\n')) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE); |
| EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore_cr, HTTP_MSG_RQBEFORE_CR); |
| /* stop here */ |
| |
| http_msg_rqbefore_cr: |
| case HTTP_MSG_RQBEFORE_CR: |
| EXPECT_LF_HERE(ptr, http_msg_invalid); |
| EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE); |
| /* stop here */ |
| |
| http_msg_rqmeth: |
| case HTTP_MSG_RQMETH: |
| case HTTP_MSG_RQMETH_SP: |
| case HTTP_MSG_RQURI: |
| case HTTP_MSG_RQURI_SP: |
| case HTTP_MSG_RQVER: |
| ptr = (char *)http_parse_reqline(msg, buf->data, state, ptr, end, |
| &buf->lr, &msg->msg_state); |
| if (unlikely(!ptr)) |
| return; |
| |
| /* we have a full request and we know that we have either a CR |
| * or an LF at <ptr>. |
| */ |
| //fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.rq.l, *ptr); |
| hdr_idx_set_start(idx, msg->sl.rq.l, *ptr == '\r'); |
| |
| msg->sol = ptr; |
| if (likely(*ptr == '\r')) |
| EAT_AND_JUMP_OR_RETURN(http_msg_rqline_end, HTTP_MSG_RQLINE_END); |
| goto http_msg_rqline_end; |
| |
| http_msg_rqline_end: |
| case HTTP_MSG_RQLINE_END: |
| /* check for HTTP/0.9 request : no version information available. |
| * msg->sol must point to the first of CR or LF. |
| */ |
| if (unlikely(msg->sl.rq.v_l == 0)) |
| goto http_msg_last_lf; |
| |
| EXPECT_LF_HERE(ptr, http_msg_invalid); |
| EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST); |
| /* stop here */ |
| |
| /* |
| * Common states below |
| */ |
| http_msg_hdr_first: |
| case HTTP_MSG_HDR_FIRST: |
| msg->sol = ptr; |
| if (likely(!HTTP_IS_CRLF(*ptr))) { |
| goto http_msg_hdr_name; |
| } |
| |
| if (likely(*ptr == '\r')) |
| EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF); |
| goto http_msg_last_lf; |
| |
| http_msg_hdr_name: |
| case HTTP_MSG_HDR_NAME: |
| /* assumes msg->sol points to the first char */ |
| if (likely(HTTP_IS_TOKEN(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_hdr_name, HTTP_MSG_HDR_NAME); |
| |
| if (likely(*ptr == ':')) { |
| msg->col = ptr - buf->data; |
| EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP); |
| } |
| |
| goto http_msg_invalid; |
| |
| http_msg_hdr_l1_sp: |
| case HTTP_MSG_HDR_L1_SP: |
| /* assumes msg->sol points to the first char and msg->col to the colon */ |
| if (likely(HTTP_IS_SPHT(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP); |
| |
| /* header value can be basically anything except CR/LF */ |
| msg->sov = ptr - buf->data; |
| |
| if (likely(!HTTP_IS_CRLF(*ptr))) { |
| goto http_msg_hdr_val; |
| } |
| |
| if (likely(*ptr == '\r')) |
| EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lf, HTTP_MSG_HDR_L1_LF); |
| goto http_msg_hdr_l1_lf; |
| |
| http_msg_hdr_l1_lf: |
| case HTTP_MSG_HDR_L1_LF: |
| EXPECT_LF_HERE(ptr, http_msg_invalid); |
| EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lws, HTTP_MSG_HDR_L1_LWS); |
| |
| http_msg_hdr_l1_lws: |
| case HTTP_MSG_HDR_L1_LWS: |
| if (likely(HTTP_IS_SPHT(*ptr))) { |
| /* replace HT,CR,LF with spaces */ |
| for (; buf->data+msg->sov < ptr; msg->sov++) |
| buf->data[msg->sov] = ' '; |
| goto http_msg_hdr_l1_sp; |
| } |
| /* we had a header consisting only in spaces ! */ |
| msg->eol = buf->data + msg->sov; |
| goto http_msg_complete_header; |
| |
| http_msg_hdr_val: |
| case HTTP_MSG_HDR_VAL: |
| /* assumes msg->sol points to the first char, msg->col to the |
| * colon, and msg->sov points to the first character of the |
| * value. |
| */ |
| if (likely(!HTTP_IS_CRLF(*ptr))) |
| EAT_AND_JUMP_OR_RETURN(http_msg_hdr_val, HTTP_MSG_HDR_VAL); |
| |
| msg->eol = ptr; |
| /* Note: we could also copy eol into ->eoh so that we have the |
| * real header end in case it ends with lots of LWS, but is this |
| * really needed ? |
| */ |
| if (likely(*ptr == '\r')) |
| EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lf, HTTP_MSG_HDR_L2_LF); |
| goto http_msg_hdr_l2_lf; |
| |
| http_msg_hdr_l2_lf: |
| case HTTP_MSG_HDR_L2_LF: |
| EXPECT_LF_HERE(ptr, http_msg_invalid); |
| EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lws, HTTP_MSG_HDR_L2_LWS); |
| |
| http_msg_hdr_l2_lws: |
| case HTTP_MSG_HDR_L2_LWS: |
| if (unlikely(HTTP_IS_SPHT(*ptr))) { |
| /* LWS: replace HT,CR,LF with spaces */ |
| for (; msg->eol < ptr; msg->eol++) |
| *msg->eol = ' '; |
| goto http_msg_hdr_val; |
| } |
| http_msg_complete_header: |
| /* |
| * It was a new header, so the last one is finished. |
| * Assumes msg->sol points to the first char, msg->col to the |
| * colon, msg->sov points to the first character of the value |
| * and msg->eol to the first CR or LF so we know how the line |
| * ends. We insert last header into the index. |
| */ |
| /* |
| fprintf(stderr,"registering %-2d bytes : ", msg->eol - msg->sol); |
| write(2, msg->sol, msg->eol-msg->sol); |
| fprintf(stderr,"\n"); |
| */ |
| |
| if (unlikely(hdr_idx_add(msg->eol - msg->sol, *msg->eol == '\r', |
| idx, idx->tail) < 0)) |
| goto http_msg_invalid; |
| |
| msg->sol = ptr; |
| if (likely(!HTTP_IS_CRLF(*ptr))) { |
| goto http_msg_hdr_name; |
| } |
| |
| if (likely(*ptr == '\r')) |
| EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF); |
| goto http_msg_last_lf; |
| |
| http_msg_last_lf: |
| case HTTP_MSG_LAST_LF: |
| /* Assumes msg->sol points to the first of either CR or LF */ |
| EXPECT_LF_HERE(ptr, http_msg_invalid); |
| ptr++; |
| buf->lr = ptr; |
| msg->eoh = msg->sol - buf->data; |
| msg->msg_state = HTTP_MSG_BODY; |
| return; |
| #ifdef DEBUG_FULL |
| default: |
| fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state); |
| exit(1); |
| #endif |
| } |
| http_msg_ood: |
| /* out of data */ |
| msg->msg_state = state; |
| buf->lr = ptr; |
| return; |
| |
| http_msg_invalid: |
| /* invalid message */ |
| msg->msg_state = HTTP_MSG_ERROR; |
| return; |
| } |
| |
| /* This function performs all the processing enabled for the current request. |
| * It normally returns zero, but may return 1 if it absolutely needs to be |
| * called again after other functions. It relies on buffers flags, and updates |
| * t->req->analysers. It might make sense to explode it into several other |
| * functions. Its behaviour is rather simple : |
| * - all enabled analysers are called in turn from the lower to the higher |
| * bit. |
| * - if an analyser does not have enough data, it must return without calling |
| * other ones. It should also probably reset the BF_WRITE_ENA bit to ensure |
| * that unprocessed data will not be forwarded. But that probably depends on |
| * the protocol. Generally it is not reset in case of errors. |
| * - if an analyser has enough data, it just has to pass on to the next |
| * analyser without touching BF_WRITE_ENA (it is enabled prior to |
| * analysis). |
| * - if an analyser thinks it has no added value anymore staying here, it must |
| * reset its bit from the analysers flags in order not to be called anymore. |
| * |
| * In the future, analysers should be able to indicate that they want to be |
| * called after XXX bytes have been received (or transfered), and the min of |
| * all's wishes will be used to ring back (unless a special condition occurs). |
| * |
| * |
| */ |
| int process_request(struct session *t) |
| { |
| struct buffer *req = t->req; |
| struct buffer *rep = t->rep; |
| |
| DPRINTF(stderr,"[%u] %s: session=%p b=%p, exp(r,w)=%u,%u bf=%08x bl=%d analysers=%02x\n", |
| now_ms, __FUNCTION__, |
| t, |
| req, |
| req->rex, req->wex, |
| req->flags, |
| req->l, |
| req->analysers); |
| |
| /* The tcp-inspect analyser is always called alone */ |
| if (req->analysers & AN_REQ_INSPECT) { |
| struct tcp_rule *rule; |
| int partial; |
| |
| /* We will abort if we encounter a read error. In theory, we |
| * should not abort if we get a close, it might be valid, |
| * although very unlikely. FIXME: we'll abort for now, this |
| * will be easier to change later. |
| */ |
| if (req->flags & BF_READ_ERROR) { |
| req->analysers = 0; |
| //t->fe->failed_req++; |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_CLICL; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_R; |
| return 0; |
| } |
| |
| /* Abort if client read timeout has expired */ |
| else if (req->flags & BF_READ_TIMEOUT) { |
| req->analysers = 0; |
| t->fe->failed_req++; |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_CLITO; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_R; |
| return 0; |
| } |
| |
| /* We don't know whether we have enough data, so must proceed |
| * this way : |
| * - iterate through all rules in their declaration order |
| * - if one rule returns MISS, it means the inspect delay is |
| * not over yet, then return immediately, otherwise consider |
| * it as a non-match. |
| * - if one rule returns OK, then return OK |
| * - if one rule returns KO, then return KO |
| */ |
| |
| if (req->flags & BF_SHUTR || tick_is_expired(req->analyse_exp, now_ms)) |
| partial = 0; |
| else |
| partial = ACL_PARTIAL; |
| |
| list_for_each_entry(rule, &t->fe->tcp_req.inspect_rules, list) { |
| int ret = ACL_PAT_PASS; |
| |
| if (rule->cond) { |
| ret = acl_exec_cond(rule->cond, t->fe, t, NULL, ACL_DIR_REQ | partial); |
| if (ret == ACL_PAT_MISS) { |
| buffer_write_dis(req); |
| /* just set the request timeout once at the beginning of the request */ |
| if (!tick_isset(req->analyse_exp)) |
| req->analyse_exp = tick_add_ifset(now_ms, t->fe->tcp_req.inspect_delay); |
| return 0; |
| } |
| |
| ret = acl_pass(ret); |
| if (rule->cond->pol == ACL_COND_UNLESS) |
| ret = !ret; |
| } |
| |
| if (ret) { |
| /* we have a matching rule. */ |
| if (rule->action == TCP_ACT_REJECT) { |
| buffer_abort(req); |
| buffer_abort(rep); |
| //FIXME: this delete this |
| //fd_delete(t->cli_fd); |
| //t->cli_state = CL_STCLOSE; |
| req->analysers = 0; |
| t->fe->failed_req++; |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_PRXCOND; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_R; |
| return 0; |
| } |
| /* otherwise accept */ |
| break; |
| } |
| } |
| |
| /* if we get there, it means we have no rule which matches, or |
| * we have an explicit accept, so we apply the default accept. |
| */ |
| req->analysers &= ~AN_REQ_INSPECT; |
| req->analyse_exp = TICK_ETERNITY; |
| } |
| |
| if (req->analysers & AN_REQ_HTTP_HDR) { |
| /* |
| * Now parse the partial (or complete) lines. |
| * We will check the request syntax, and also join multi-line |
| * headers. An index of all the lines will be elaborated while |
| * parsing. |
| * |
| * For the parsing, we use a 28 states FSM. |
| * |
| * Here is the information we currently have : |
| * req->data + req->som = beginning of request |
| * req->data + req->eoh = end of processed headers / start of current one |
| * req->data + req->eol = end of current header or line (LF or CRLF) |
| * req->lr = first non-visited byte |
| * req->r = end of data |
| */ |
| |
| int cur_idx; |
| struct http_txn *txn = &t->txn; |
| struct http_msg *msg = &txn->req; |
| struct proxy *cur_proxy; |
| |
| if (likely(req->lr < req->r)) |
| http_msg_analyzer(req, msg, &txn->hdr_idx); |
| |
| /* 1: we might have to print this header in debug mode */ |
| if (unlikely((global.mode & MODE_DEBUG) && |
| (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) && |
| (msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) { |
| char *eol, *sol; |
| |
| sol = req->data + msg->som; |
| eol = sol + msg->sl.rq.l; |
| debug_hdr("clireq", t, sol, eol); |
| |
| sol += hdr_idx_first_pos(&txn->hdr_idx); |
| cur_idx = hdr_idx_first_idx(&txn->hdr_idx); |
| |
| while (cur_idx) { |
| eol = sol + txn->hdr_idx.v[cur_idx].len; |
| debug_hdr("clihdr", t, sol, eol); |
| sol = eol + txn->hdr_idx.v[cur_idx].cr + 1; |
| cur_idx = txn->hdr_idx.v[cur_idx].next; |
| } |
| } |
| |
| |
| /* |
| * Now we quickly check if we have found a full valid request. |
| * If not so, we check the FD and buffer states before leaving. |
| * A full request is indicated by the fact that we have seen |
| * the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid |
| * requests are checked first. |
| * |
| */ |
| |
| if (unlikely(msg->msg_state != HTTP_MSG_BODY)) { |
| /* |
| * First, let's catch bad requests. |
| */ |
| if (unlikely(msg->msg_state == HTTP_MSG_ERROR)) |
| goto return_bad_req; |
| |
| /* 1: Since we are in header mode, if there's no space |
| * left for headers, we won't be able to free more |
| * later, so the session will never terminate. We |
| * must terminate it now. |
| */ |
| if (unlikely(req->flags & BF_FULL)) { |
| /* FIXME: check if URI is set and return Status |
| * 414 Request URI too long instead. |
| */ |
| goto return_bad_req; |
| } |
| |
| /* 2: have we encountered a read error ? */ |
| else if (req->flags & BF_READ_ERROR) { |
| /* we cannot return any message on error */ |
| msg->msg_state = HTTP_MSG_ERROR; |
| req->analysers = 0; |
| //t->fe->failed_req++; |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_CLICL; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_R; |
| return 0; |
| } |
| |
| /* 3: has the read timeout expired ? */ |
| else if (req->flags & BF_READ_TIMEOUT || tick_is_expired(req->analyse_exp, now_ms)) { |
| /* read timeout : give up with an error message. */ |
| txn->status = 408; |
| client_retnclose(t, error_message(t, HTTP_ERR_408)); |
| msg->msg_state = HTTP_MSG_ERROR; |
| req->analysers = 0; |
| t->fe->failed_req++; |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_CLITO; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_R; |
| return 0; |
| } |
| |
| /* 4: have we encountered a close ? */ |
| else if (req->flags & BF_SHUTR) { |
| txn->status = 400; |
| client_retnclose(t, error_message(t, HTTP_ERR_400)); |
| msg->msg_state = HTTP_MSG_ERROR; |
| req->analysers = 0; |
| t->fe->failed_req++; |
| |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_CLICL; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_R; |
| return 0; |
| } |
| |
| buffer_write_dis(req); |
| /* just set the request timeout once at the beginning of the request */ |
| if (!tick_isset(req->analyse_exp)) |
| req->analyse_exp = tick_add_ifset(now_ms, t->fe->timeout.httpreq); |
| |
| /* we're not ready yet */ |
| return 0; |
| } |
| |
| |
| /**************************************************************** |
| * More interesting part now : we know that we have a complete * |
| * request which at least looks like HTTP. We have an indicator * |
| * of each header's length, so we can parse them quickly. * |
| ****************************************************************/ |
| |
| req->analysers &= ~AN_REQ_HTTP_HDR; |
| req->analyse_exp = TICK_ETERNITY; |
| |
| /* ensure we keep this pointer to the beginning of the message */ |
| msg->sol = req->data + msg->som; |
| |
| /* |
| * 1: identify the method |
| */ |
| txn->meth = find_http_meth(&req->data[msg->som], msg->sl.rq.m_l); |
| |
| /* we can make use of server redirect on GET and HEAD */ |
| if (txn->meth == HTTP_METH_GET || txn->meth == HTTP_METH_HEAD) |
| t->flags |= SN_REDIRECTABLE; |
| |
| /* |
| * 2: check if the URI matches the monitor_uri. |
| * We have to do this for every request which gets in, because |
| * the monitor-uri is defined by the frontend. |
| */ |
| if (unlikely((t->fe->monitor_uri_len != 0) && |
| (t->fe->monitor_uri_len == msg->sl.rq.u_l) && |
| !memcmp(&req->data[msg->sl.rq.u], |
| t->fe->monitor_uri, |
| t->fe->monitor_uri_len))) { |
| /* |
| * We have found the monitor URI |
| */ |
| struct acl_cond *cond; |
| cur_proxy = t->fe; |
| |
| t->flags |= SN_MONITOR; |
| |
| /* Check if we want to fail this monitor request or not */ |
| list_for_each_entry(cond, &cur_proxy->mon_fail_cond, list) { |
| int ret = acl_exec_cond(cond, cur_proxy, t, txn, ACL_DIR_REQ); |
| |
| ret = acl_pass(ret); |
| if (cond->pol == ACL_COND_UNLESS) |
| ret = !ret; |
| |
| if (ret) { |
| /* we fail this request, let's return 503 service unavail */ |
| txn->status = 503; |
| client_retnclose(t, error_message(t, HTTP_ERR_503)); |
| goto return_prx_cond; |
| } |
| } |
| |
| /* nothing to fail, let's reply normaly */ |
| txn->status = 200; |
| client_retnclose(t, &http_200_chunk); |
| goto return_prx_cond; |
| } |
| |
| /* |
| * 3: Maybe we have to copy the original REQURI for the logs ? |
| * Note: we cannot log anymore if the request has been |
| * classified as invalid. |
| */ |
| if (unlikely(t->logs.logwait & LW_REQ)) { |
| /* we have a complete HTTP request that we must log */ |
| if ((txn->uri = pool_alloc2(pool2_requri)) != NULL) { |
| int urilen = msg->sl.rq.l; |
| |
| if (urilen >= REQURI_LEN) |
| urilen = REQURI_LEN - 1; |
| memcpy(txn->uri, &req->data[msg->som], urilen); |
| txn->uri[urilen] = 0; |
| |
| if (!(t->logs.logwait &= ~LW_REQ)) |
| http_sess_log(t); |
| } else { |
| Alert("HTTP logging : out of memory.\n"); |
| } |
| } |
| |
| |
| /* 4. We may have to convert HTTP/0.9 requests to HTTP/1.0 */ |
| if (unlikely(msg->sl.rq.v_l == 0)) { |
| int delta; |
| char *cur_end; |
| msg->sol = req->data + msg->som; |
| cur_end = msg->sol + msg->sl.rq.l; |
| delta = 0; |
| |
| if (msg->sl.rq.u_l == 0) { |
| /* if no URI was set, add "/" */ |
| delta = buffer_replace2(req, cur_end, cur_end, " /", 2); |
| cur_end += delta; |
| msg->eoh += delta; |
| } |
| /* add HTTP version */ |
| delta = buffer_replace2(req, cur_end, cur_end, " HTTP/1.0\r\n", 11); |
| msg->eoh += delta; |
| cur_end += delta; |
| cur_end = (char *)http_parse_reqline(msg, req->data, |
| HTTP_MSG_RQMETH, |
| msg->sol, cur_end + 1, |
| NULL, NULL); |
| if (unlikely(!cur_end)) |
| goto return_bad_req; |
| |
| /* we have a full HTTP/1.0 request now and we know that |
| * we have either a CR or an LF at <ptr>. |
| */ |
| hdr_idx_set_start(&txn->hdr_idx, msg->sl.rq.l, *cur_end == '\r'); |
| } |
| |
| |
| /* 5: we may need to capture headers */ |
| if (unlikely((t->logs.logwait & LW_REQHDR) && t->fe->req_cap)) |
| capture_headers(req->data + msg->som, &txn->hdr_idx, |
| txn->req.cap, t->fe->req_cap); |
| |
| /* |
| * 6: we will have to evaluate the filters. |
| * As opposed to version 1.2, now they will be evaluated in the |
| * filters order and not in the header order. This means that |
| * each filter has to be validated among all headers. |
| * |
| * We can now check whether we want to switch to another |
| * backend, in which case we will re-check the backend's |
| * filters and various options. In order to support 3-level |
| * switching, here's how we should proceed : |
| * |
| * a) run be. |
| * if (switch) then switch ->be to the new backend. |
| * b) run be if (be != fe). |
| * There cannot be any switch from there, so ->be cannot be |
| * changed anymore. |
| * |
| * => filters always apply to ->be, then ->be may change. |
| * |
| * The response path will be able to apply either ->be, or |
| * ->be then ->fe filters in order to match the reverse of |
| * the forward sequence. |
| */ |
| |
| do { |
| struct acl_cond *cond; |
| struct redirect_rule *rule; |
| struct proxy *rule_set = t->be; |
| cur_proxy = t->be; |
| |
| /* first check whether we have some ACLs set to redirect this request */ |
| list_for_each_entry(rule, &cur_proxy->redirect_rules, list) { |
| int ret = acl_exec_cond(rule->cond, cur_proxy, t, txn, ACL_DIR_REQ); |
| |
| ret = acl_pass(ret); |
| if (rule->cond->pol == ACL_COND_UNLESS) |
| ret = !ret; |
| |
| if (ret) { |
| struct chunk rdr = { trash, 0 }; |
| const char *msg_fmt; |
| |
| /* build redirect message */ |
| switch(rule->code) { |
| case 303: |
| rdr.len = strlen(HTTP_303); |
| msg_fmt = HTTP_303; |
| break; |
| case 301: |
| rdr.len = strlen(HTTP_301); |
| msg_fmt = HTTP_301; |
| break; |
| case 302: |
| default: |
| rdr.len = strlen(HTTP_302); |
| msg_fmt = HTTP_302; |
| break; |
| } |
| |
| if (unlikely(rdr.len > sizeof(trash))) |
| goto return_bad_req; |
| memcpy(rdr.str, msg_fmt, rdr.len); |
| |
| switch(rule->type) { |
| case REDIRECT_TYPE_PREFIX: { |
| const char *path; |
| int pathlen; |
| |
| path = http_get_path(txn); |
| /* build message using path */ |
| if (path) { |
| pathlen = txn->req.sl.rq.u_l + (txn->req.sol+txn->req.sl.rq.u) - path; |
| } else { |
| path = "/"; |
| pathlen = 1; |
| } |
| |
| if (rdr.len + rule->rdr_len + pathlen > sizeof(trash) - 4) |
| goto return_bad_req; |
| |
| /* add prefix */ |
| memcpy(rdr.str + rdr.len, rule->rdr_str, rule->rdr_len); |
| rdr.len += rule->rdr_len; |
| |
| /* add path */ |
| memcpy(rdr.str + rdr.len, path, pathlen); |
| rdr.len += pathlen; |
| break; |
| } |
| case REDIRECT_TYPE_LOCATION: |
| default: |
| if (rdr.len + rule->rdr_len > sizeof(trash) - 4) |
| goto return_bad_req; |
| |
| /* add location */ |
| memcpy(rdr.str + rdr.len, rule->rdr_str, rule->rdr_len); |
| rdr.len += rule->rdr_len; |
| break; |
| } |
| |
| /* add end of headers */ |
| memcpy(rdr.str + rdr.len, "\r\n\r\n", 4); |
| rdr.len += 4; |
| |
| txn->status = rule->code; |
| /* let's log the request time */ |
| t->logs.tv_request = now; |
| client_retnclose(t, &rdr); |
| goto return_prx_cond; |
| } |
| } |
| |
| /* first check whether we have some ACLs set to block this request */ |
| list_for_each_entry(cond, &cur_proxy->block_cond, list) { |
| int ret = acl_exec_cond(cond, cur_proxy, t, txn, ACL_DIR_REQ); |
| |
| ret = acl_pass(ret); |
| if (cond->pol == ACL_COND_UNLESS) |
| ret = !ret; |
| |
| if (ret) { |
| txn->status = 403; |
| /* let's log the request time */ |
| t->logs.tv_request = now; |
| client_retnclose(t, error_message(t, HTTP_ERR_403)); |
| goto return_prx_cond; |
| } |
| } |
| |
| /* try headers filters */ |
| if (rule_set->req_exp != NULL) { |
| if (apply_filters_to_request(t, req, rule_set->req_exp) < 0) |
| goto return_bad_req; |
| } |
| |
| if (!(t->flags & SN_BE_ASSIGNED) && (t->be != cur_proxy)) { |
| /* to ensure correct connection accounting on |
| * the backend, we count the connection for the |
| * one managing the queue. |
| */ |
| t->be->beconn++; |
| if (t->be->beconn > t->be->beconn_max) |
| t->be->beconn_max = t->be->beconn; |
| t->be->cum_beconn++; |
| t->flags |= SN_BE_ASSIGNED; |
| } |
| |
| /* has the request been denied ? */ |
| if (txn->flags & TX_CLDENY) { |
| /* no need to go further */ |
| txn->status = 403; |
| /* let's log the request time */ |
| t->logs.tv_request = now; |
| client_retnclose(t, error_message(t, HTTP_ERR_403)); |
| goto return_prx_cond; |
| } |
| |
| /* We might have to check for "Connection:" */ |
| if (((t->fe->options | t->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO)) && |
| !(t->flags & SN_CONN_CLOSED)) { |
| char *cur_ptr, *cur_end, *cur_next; |
| int cur_idx, old_idx, delta, val; |
| struct hdr_idx_elem *cur_hdr; |
| |
| cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx); |
| old_idx = 0; |
| |
| while ((cur_idx = txn->hdr_idx.v[old_idx].next)) { |
| cur_hdr = &txn->hdr_idx.v[cur_idx]; |
| cur_ptr = cur_next; |
| cur_end = cur_ptr + cur_hdr->len; |
| cur_next = cur_end + cur_hdr->cr + 1; |
| |
| val = http_header_match2(cur_ptr, cur_end, "Connection", 10); |
| if (val) { |
| /* 3 possibilities : |
| * - we have already set Connection: close, |
| * so we remove this line. |
| * - we have not yet set Connection: close, |
| * but this line indicates close. We leave |
| * it untouched and set the flag. |
| * - we have not yet set Connection: close, |
| * and this line indicates non-close. We |
| * replace it. |
| */ |
| if (t->flags & SN_CONN_CLOSED) { |
| delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0); |
| txn->req.eoh += delta; |
| cur_next += delta; |
| txn->hdr_idx.v[old_idx].next = cur_hdr->next; |
| txn->hdr_idx.used--; |
| cur_hdr->len = 0; |
| } else { |
| if (strncasecmp(cur_ptr + val, "close", 5) != 0) { |
| delta = buffer_replace2(req, cur_ptr + val, cur_end, |
| "close", 5); |
| cur_next += delta; |
| cur_hdr->len += delta; |
| txn->req.eoh += delta; |
| } |
| t->flags |= SN_CONN_CLOSED; |
| } |
| } |
| old_idx = cur_idx; |
| } |
| } |
| /* add request headers from the rule sets in the same order */ |
| for (cur_idx = 0; cur_idx < rule_set->nb_reqadd; cur_idx++) { |
| if (unlikely(http_header_add_tail(req, |
| &txn->req, |
| &txn->hdr_idx, |
| rule_set->req_add[cur_idx])) < 0) |
| goto return_bad_req; |
| } |
| |
| /* check if stats URI was requested, and if an auth is needed */ |
| if (rule_set->uri_auth != NULL && |
| (txn->meth == HTTP_METH_GET || txn->meth == HTTP_METH_HEAD)) { |
| /* we have to check the URI and auth for this request. |
| * FIXME!!! that one is rather dangerous, we want to |
| * make it follow standard rules (eg: clear req->analysers). |
| */ |
| if (stats_check_uri_auth(t, rule_set)) |
| return 1; |
| } |
| |
| /* now check whether we have some switching rules for this request */ |
| if (!(t->flags & SN_BE_ASSIGNED)) { |
| struct switching_rule *rule; |
| |
| list_for_each_entry(rule, &cur_proxy->switching_rules, list) { |
| int ret; |
| |
| ret = acl_exec_cond(rule->cond, cur_proxy, t, txn, ACL_DIR_REQ); |
| |
| ret = acl_pass(ret); |
| if (rule->cond->pol == ACL_COND_UNLESS) |
| ret = !ret; |
| |
| if (ret) { |
| t->be = rule->be.backend; |
| t->be->beconn++; |
| if (t->be->beconn > t->be->beconn_max) |
| t->be->beconn_max = t->be->beconn; |
| t->be->cum_beconn++; |
| |
| /* assign new parameters to the session from the new backend */ |
| t->rep->rto = t->req->wto = t->be->timeout.server; |
| t->req->cto = t->be->timeout.connect; |
| t->conn_retries = t->be->conn_retries; |
| t->flags |= SN_BE_ASSIGNED; |
| break; |
| } |
| } |
| } |
| |
| if (!(t->flags & SN_BE_ASSIGNED) && cur_proxy->defbe.be) { |
| /* No backend was set, but there was a default |
| * backend set in the frontend, so we use it and |
| * loop again. |
| */ |
| t->be = cur_proxy->defbe.be; |
| t->be->beconn++; |
| if (t->be->beconn > t->be->beconn_max) |
| t->be->beconn_max = t->be->beconn; |
| t->be->cum_beconn++; |
| |
| /* assign new parameters to the session from the new backend */ |
| t->rep->rto = t->req->wto = t->be->timeout.server; |
| t->req->cto = t->be->timeout.connect; |
| t->conn_retries = t->be->conn_retries; |
| t->flags |= SN_BE_ASSIGNED; |
| } |
| } while (t->be != cur_proxy); /* we loop only if t->be has changed */ |
| |
| |
| if (!(t->flags & SN_BE_ASSIGNED)) { |
| /* To ensure correct connection accounting on |
| * the backend, we count the connection for the |
| * one managing the queue. |
| */ |
| t->be->beconn++; |
| if (t->be->beconn > t->be->beconn_max) |
| t->be->beconn_max = t->be->beconn; |
| t->be->cum_beconn++; |
| t->flags |= SN_BE_ASSIGNED; |
| } |
| |
| /* |
| * Right now, we know that we have processed the entire headers |
| * and that unwanted requests have been filtered out. We can do |
| * whatever we want with the remaining request. Also, now we |
| * may have separate values for ->fe, ->be. |
| */ |
| |
| /* |
| * If HTTP PROXY is set we simply get remote server address |
| * parsing incoming request. |
| */ |
| if ((t->be->options & PR_O_HTTP_PROXY) && !(t->flags & SN_ADDR_SET)) { |
| url2sa(req->data + msg->sl.rq.u, msg->sl.rq.u_l, &t->srv_addr); |
| } |
| |
| /* |
| * 7: the appsession cookie was looked up very early in 1.2, |
| * so let's do the same now. |
| */ |
| |
| /* It needs to look into the URI */ |
| if (t->be->appsession_name) { |
| get_srv_from_appsession(t, &req->data[msg->som], msg->sl.rq.l); |
| } |
| |
| |
| /* |
| * 8: Now we can work with the cookies. |
| * Note that doing so might move headers in the request, but |
| * the fields will stay coherent and the URI will not move. |
| * This should only be performed in the backend. |
| */ |
| if ((t->be->cookie_name || t->be->appsession_name || t->be->capture_name) |
| && !(txn->flags & (TX_CLDENY|TX_CLTARPIT))) |
| manage_client_side_cookies(t, req); |
| |
| |
| /* |
| * 9: add X-Forwarded-For if either the frontend or the backend |
| * asks for it. |
| */ |
| if ((t->fe->options | t->be->options) & PR_O_FWDFOR) { |
| if (t->cli_addr.ss_family == AF_INET) { |
| /* Add an X-Forwarded-For header unless the source IP is |
| * in the 'except' network range. |
| */ |
| if ((!t->fe->except_mask.s_addr || |
| (((struct sockaddr_in *)&t->cli_addr)->sin_addr.s_addr & t->fe->except_mask.s_addr) |
| != t->fe->except_net.s_addr) && |
| (!t->be->except_mask.s_addr || |
| (((struct sockaddr_in *)&t->cli_addr)->sin_addr.s_addr & t->be->except_mask.s_addr) |
| != t->be->except_net.s_addr)) { |
| int len; |
| unsigned char *pn; |
| pn = (unsigned char *)&((struct sockaddr_in *)&t->cli_addr)->sin_addr; |
| |
| /* Note: we rely on the backend to get the header name to be used for |
| * x-forwarded-for, because the header is really meant for the backends. |
| * However, if the backend did not specify any option, we have to rely |
| * on the frontend's header name. |
| */ |
| if (t->be->fwdfor_hdr_len) { |
| len = t->be->fwdfor_hdr_len; |
| memcpy(trash, t->be->fwdfor_hdr_name, len); |
| } else { |
| len = t->fe->fwdfor_hdr_len; |
| memcpy(trash, t->fe->fwdfor_hdr_name, len); |
| } |
| len += sprintf(trash + len, ": %d.%d.%d.%d", pn[0], pn[1], pn[2], pn[3]); |
| |
| if (unlikely(http_header_add_tail2(req, &txn->req, |
| &txn->hdr_idx, trash, len)) < 0) |
| goto return_bad_req; |
| } |
| } |
| else if (t->cli_addr.ss_family == AF_INET6) { |
| /* FIXME: for the sake of completeness, we should also support |
| * 'except' here, although it is mostly useless in this case. |
| */ |
| int len; |
| char pn[INET6_ADDRSTRLEN]; |
| inet_ntop(AF_INET6, |
| (const void *)&((struct sockaddr_in6 *)(&t->cli_addr))->sin6_addr, |
| pn, sizeof(pn)); |
| |
| /* Note: we rely on the backend to get the header name to be used for |
| * x-forwarded-for, because the header is really meant for the backends. |
| * However, if the backend did not specify any option, we have to rely |
| * on the frontend's header name. |
| */ |
| if (t->be->fwdfor_hdr_len) { |
| len = t->be->fwdfor_hdr_len; |
| memcpy(trash, t->be->fwdfor_hdr_name, len); |
| } else { |
| len = t->fe->fwdfor_hdr_len; |
| memcpy(trash, t->fe->fwdfor_hdr_name, len); |
| } |
| len += sprintf(trash + len, ": %s", pn); |
| |
| if (unlikely(http_header_add_tail2(req, &txn->req, |
| &txn->hdr_idx, trash, len)) < 0) |
| goto return_bad_req; |
| } |
| } |
| |
| /* |
| * 10: add "Connection: close" if needed and not yet set. |
| * Note that we do not need to add it in case of HTTP/1.0. |
| */ |
| if (!(t->flags & SN_CONN_CLOSED) && |
| ((t->fe->options | t->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO))) { |
| if ((unlikely(msg->sl.rq.v_l != 8) || |
| unlikely(req->data[msg->som + msg->sl.rq.v + 7] != '0')) && |
| unlikely(http_header_add_tail2(req, &txn->req, &txn->hdr_idx, |
| "Connection: close", 17)) < 0) |
| goto return_bad_req; |
| t->flags |= SN_CONN_CLOSED; |
| } |
| /* Before we switch to data, was assignment set in manage_client_side_cookie? |
| * If not assigned, perhaps we are balancing on url_param, but this is a |
| * POST; and the parameters are in the body, maybe scan there to find our server. |
| * (unless headers overflowed the buffer?) |
| */ |
| if (!(t->flags & (SN_ASSIGNED|SN_DIRECT)) && |
| t->txn.meth == HTTP_METH_POST && t->be->url_param_name != NULL && |
| t->be->url_param_post_limit != 0 && !(req->flags & BF_FULL) && |
| memchr(msg->sol + msg->sl.rq.u, '?', msg->sl.rq.u_l) == NULL) { |
| /* are there enough bytes here? total == l || r || rlim ? |
| * len is unsigned, but eoh is int, |
| * how many bytes of body have we received? |
| * eoh is the first empty line of the header |
| */ |
| /* already established CRLF or LF at eoh, move to start of message, find message length in buffer */ |
| unsigned long len = req->l - (msg->sol[msg->eoh] == '\r' ? msg->eoh + 2 : msg->eoh + 1); |
| |
| /* If we have HTTP/1.1 and Expect: 100-continue, then abort. |
| * We can't assume responsibility for the server's decision, |
| * on this URI and header set. See rfc2616: 14.20, 8.2.3, |
| * We also can't change our mind later, about which server to choose, so round robin. |
| */ |
| if ((likely(msg->sl.rq.v_l == 8) && req->data[msg->som + msg->sl.rq.v + 7] == '1')) { |
| struct hdr_ctx ctx; |
| ctx.idx = 0; |
| /* Expect is allowed in 1.1, look for it */ |
| http_find_header2("Expect", 6, msg->sol, &txn->hdr_idx, &ctx); |
| if (ctx.idx != 0 && |
| unlikely(ctx.vlen == 12 && strncasecmp(ctx.line+ctx.val, "100-continue", 12) == 0)) |
| /* We can't reliablly stall and wait for data, because of |
| * .NET clients that don't conform to rfc2616; so, no need for |
| * the next block to check length expectations. |
| * We could send 100 status back to the client, but then we need to |
| * re-write headers, and send the message. And this isn't the right |
| * place for that action. |
| * TODO: support Expect elsewhere and delete this block. |
| */ |
| goto end_check_maybe_wait_for_body; |
| } |
| |
| if (likely(len > t->be->url_param_post_limit)) { |
| /* nothing to do, we got enough */ |
| } else { |
| /* limit implies we are supposed to need this many bytes |
| * to find the parameter. Let's see how many bytes we can wait for. |
| */ |
| long long hint = len; |
| struct hdr_ctx ctx; |
| ctx.idx = 0; |
| http_find_header2("Transfer-Encoding", 17, msg->sol, &txn->hdr_idx, &ctx); |
| if (ctx.idx && ctx.vlen >= 7 && strncasecmp(ctx.line+ctx.val, "chunked", 7) == 0) { |
| buffer_write_dis(req); |
| req->analysers |= AN_REQ_HTTP_BODY; |
| } |
| else { |
| ctx.idx = 0; |
| http_find_header2("Content-Length", 14, msg->sol, &txn->hdr_idx, &ctx); |
| /* now if we have a length, we'll take the hint */ |
| if (ctx.idx) { |
| /* We have Content-Length */ |
| if (strl2llrc(ctx.line+ctx.val,ctx.vlen, &hint)) |
| hint = 0; /* parse failure, untrusted client */ |
| else { |
| if (hint > 0) |
| msg->hdr_content_len = hint; |
| else |
| hint = 0; /* bad client, sent negative length */ |
| } |
| } |
| /* but limited to what we care about, maybe we don't expect any entity data (hint == 0) */ |
| if (t->be->url_param_post_limit < hint) |
| hint = t->be->url_param_post_limit; |
| /* now do we really need to buffer more data? */ |
| if (len < hint) { |
| buffer_write_dis(req); |
| req->analysers |= AN_REQ_HTTP_BODY; |
| } |
| /* else... There are no body bytes to wait for */ |
| } |
| } |
| } |
| end_check_maybe_wait_for_body: |
| |
| /************************************************************* |
| * OK, that's finished for the headers. We have done what we * |
| * could. Let's switch to the DATA state. * |
| ************************************************************/ |
| |
| buffer_set_rlim(req, BUFSIZE); /* no more rewrite needed */ |
| t->logs.tv_request = now; |
| |
| /* When a connection is tarpitted, we use the tarpit timeout, |
| * which may be the same as the connect timeout if unspecified. |
| * If unset, then set it to zero because we really want it to |
| * eventually expire. We build the tarpit as an analyser. |
| */ |
| if (txn->flags & TX_CLTARPIT) { |
| buffer_flush(t->req); |
| /* flush the request so that we can drop the connection early |
| * if the client closes first. |
| */ |
| buffer_write_dis(req); |
| req->analysers |= AN_REQ_HTTP_TARPIT; |
| req->analyse_exp = tick_add_ifset(now_ms, t->be->timeout.tarpit); |
| if (!req->analyse_exp) |
| req->analyse_exp = now_ms; |
| } |
| |
| /* OK let's go on with the BODY now */ |
| goto end_of_headers; |
| |
| return_bad_req: /* let's centralize all bad requests */ |
| txn->req.msg_state = HTTP_MSG_ERROR; |
| txn->status = 400; |
| req->analysers = 0; |
| client_retnclose(t, error_message(t, HTTP_ERR_400)); |
| t->fe->failed_req++; |
| return_prx_cond: |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_PRXCOND; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_R; |
| return 0; |
| end_of_headers: |
| ; // to keep gcc happy |
| } |
| |
| if (req->analysers & AN_REQ_HTTP_TARPIT) { |
| struct http_txn *txn = &t->txn; |
| |
| /* This connection is being tarpitted. The CLIENT side has |
| * already set the connect expiration date to the right |
| * timeout. We just have to check that the client is still |
| * there and that the timeout has not expired. |
| */ |
| if ((req->flags & (BF_SHUTR|BF_READ_ERROR)) == 0 && |
| !tick_is_expired(req->analyse_exp, now_ms)) |
| return 0; |
| |
| /* We will set the queue timer to the time spent, just for |
| * logging purposes. We fake a 500 server error, so that the |
| * attacker will not suspect his connection has been tarpitted. |
| * It will not cause trouble to the logs because we can exclude |
| * the tarpitted connections by filtering on the 'PT' status flags. |
| */ |
| trace_term(t, TT_HTTP_SRV_2); |
| t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now); |
| |
| txn->status = 500; |
| if (req->flags != BF_READ_ERROR) |
| client_retnclose(t, error_message(t, HTTP_ERR_500)); |
| |
| req->analysers = 0; |
| req->analyse_exp = TICK_ETERNITY; |
| |
| t->fe->failed_req++; |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_PRXCOND; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_T; |
| return 0; |
| } |
| |
| if (req->analysers & AN_REQ_HTTP_BODY) { |
| /* We have to parse the HTTP request body to find any required data. |
| * "balance url_param check_post" should have been the only way to get |
| * into this. We were brought here after HTTP header analysis, so all |
| * related structures are ready. |
| */ |
| struct http_msg *msg = &t->txn.req; |
| unsigned long body = msg->sol[msg->eoh] == '\r' ? msg->eoh + 2 : msg->eoh + 1; |
| long long limit = t->be->url_param_post_limit; |
| struct hdr_ctx ctx; |
| |
| ctx.idx = 0; |
| |
| /* now if we have a length, we'll take the hint */ |
| http_find_header2("Transfer-Encoding", 17, msg->sol, &t->txn.hdr_idx, &ctx); |
| if (ctx.idx && ctx.vlen >= 7 && strncasecmp(ctx.line+ctx.val, "chunked", 7) == 0) { |
| unsigned int chunk = 0; |
| while (body < req->l && !HTTP_IS_CRLF(msg->sol[body])) { |
| char c = msg->sol[body]; |
| if (ishex(c)) { |
| unsigned int hex = toupper(c) - '0'; |
| if (hex > 9) |
| hex -= 'A' - '9' - 1; |
| chunk = (chunk << 4) | hex; |
| } else |
| break; |
| body++; |
| } |
| if (body + 2 >= req->l) /* we want CRLF too */ |
| goto http_body_end; /* end of buffer? data missing! */ |
| |
| if (memcmp(msg->sol+body, "\r\n", 2) != 0) |
| goto http_body_end; /* chunked encoding len ends with CRLF, and we don't have it yet */ |
| |
| body += 2; // skip CRLF |
| |
| /* if we support more then one chunk here, we have to do it again when assigning server |
| * 1. how much entity data do we have? new var |
| * 2. should save entity_start, entity_cursor, elen & rlen in req; so we don't repeat scanning here |
| * 3. test if elen > limit, or set new limit to elen if 0 (end of entity found) |
| */ |
| |
| if (chunk < limit) |
| limit = chunk; /* only reading one chunk */ |
| } else { |
| if (msg->hdr_content_len < limit) |
| limit = msg->hdr_content_len; |
| } |
| |
| http_body_end: |
| /* we leave once we know we have nothing left to do. This means that we have |
| * enough bytes, or that we know we'll not get any more (buffer full, read |
| * buffer closed). |
| */ |
| if (req->l - body >= limit || /* enough bytes! */ |
| req->flags & (BF_FULL | BF_READ_ERROR | BF_SHUTR | BF_READ_TIMEOUT) || |
| tick_is_expired(req->analyse_exp, now_ms)) { |
| /* The situation will not evolve, so let's give up on the analysis. */ |
| t->logs.tv_request = now; /* update the request timer to reflect full request */ |
| req->analysers &= ~AN_REQ_HTTP_BODY; |
| req->analyse_exp = TICK_ETERNITY; |
| } |
| else { |
| /* Not enough data. We'll re-use the http-request |
| * timeout here. Ideally, we should set the timeout |
| * relative to the accept() date. We just set the |
| * request timeout once at the beginning of the |
| * request. |
| */ |
| buffer_write_dis(req); |
| if (!tick_isset(req->analyse_exp)) |
| req->analyse_exp = tick_add_ifset(now_ms, t->fe->timeout.httpreq); |
| return 0; |
| } |
| } |
| |
| /* Note: eventhough nobody should set an unknown flag, clearing them right now will |
| * probably reduce one day's debugging session. |
| */ |
| #ifdef DEBUG_DEV |
| if (req->analysers & ~(AN_REQ_INSPECT | AN_REQ_HTTP_HDR | AN_REQ_HTTP_TARPIT | AN_REQ_HTTP_BODY)) { |
| fprintf(stderr, "FIXME !!!! unknown analysers flags %s:%d = 0x%08X\n", |
| __FILE__, __LINE__, req->analysers); |
| ABORT_NOW(); |
| } |
| #endif |
| req->analysers &= AN_REQ_INSPECT | AN_REQ_HTTP_HDR | AN_REQ_HTTP_TARPIT | AN_REQ_HTTP_BODY; |
| return 0; |
| } |
| |
| /* This function performs all the processing enabled for the current response. |
| * It normally returns zero, but may return 1 if it absolutely needs to be |
| * called again after other functions. It relies on buffers flags, and updates |
| * t->rep->analysers. It might make sense to explode it into several other |
| * functions. It works like process_request (see indications above). |
| */ |
| int process_response(struct session *t) |
| { |
| struct http_txn *txn = &t->txn; |
| struct buffer *req = t->req; |
| struct buffer *rep = t->rep; |
| |
| DPRINTF(stderr,"[%u] %s: session=%p b=%p, exp(r,w)=%u,%u bf=%08x bl=%d analysers=%02x\n", |
| now_ms, __FUNCTION__, |
| t, |
| rep, |
| rep->rex, rep->wex, |
| rep->flags, |
| rep->l, |
| rep->analysers); |
| |
| if (rep->analysers & AN_RTR_HTTP_HDR) { /* receiving server headers */ |
| /* |
| * Now parse the partial (or complete) lines. |
| * We will check the response syntax, and also join multi-line |
| * headers. An index of all the lines will be elaborated while |
| * parsing. |
| * |
| * For the parsing, we use a 28 states FSM. |
| * |
| * Here is the information we currently have : |
| * rep->data + rep->som = beginning of response |
| * rep->data + rep->eoh = end of processed headers / start of current one |
| * rep->data + rep->eol = end of current header or line (LF or CRLF) |
| * rep->lr = first non-visited byte |
| * rep->r = end of data |
| */ |
| |
| int cur_idx; |
| struct http_msg *msg = &txn->rsp; |
| struct proxy *cur_proxy; |
| |
| if (likely(rep->lr < rep->r)) |
| http_msg_analyzer(rep, msg, &txn->hdr_idx); |
| |
| /* 1: we might have to print this header in debug mode */ |
| if (unlikely((global.mode & MODE_DEBUG) && |
| (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) && |
| (msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) { |
| char *eol, *sol; |
| |
| sol = rep->data + msg->som; |
| eol = sol + msg->sl.rq.l; |
| debug_hdr("srvrep", t, sol, eol); |
| |
| sol += hdr_idx_first_pos(&txn->hdr_idx); |
| cur_idx = hdr_idx_first_idx(&txn->hdr_idx); |
| |
| while (cur_idx) { |
| eol = sol + txn->hdr_idx.v[cur_idx].len; |
| debug_hdr("srvhdr", t, sol, eol); |
| sol = eol + txn->hdr_idx.v[cur_idx].cr + 1; |
| cur_idx = txn->hdr_idx.v[cur_idx].next; |
| } |
| } |
| |
| /* |
| * Now we quickly check if we have found a full valid response. |
| * If not so, we check the FD and buffer states before leaving. |
| * A full response is indicated by the fact that we have seen |
| * the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid |
| * responses are checked first. |
| * |
| * Depending on whether the client is still there or not, we |
| * may send an error response back or not. Note that normally |
| * we should only check for HTTP status there, and check I/O |
| * errors somewhere else. |
| */ |
| |
| if (unlikely(msg->msg_state != HTTP_MSG_BODY)) { |
| /* Invalid response */ |
| if (unlikely(msg->msg_state == HTTP_MSG_ERROR)) { |
| hdr_response_bad: |
| //buffer_shutr(rep); |
| //buffer_shutw(req); |
| //fd_delete(req->cons->fd); |
| //req->cons->state = SI_ST_CLO; |
| buffer_shutr_now(rep); |
| buffer_shutw_now(req); |
| if (t->srv) { |
| //t->srv->cur_sess--; |
| t->srv->failed_resp++; |
| //sess_change_server(t, NULL); |
| } |
| t->be->failed_resp++; |
| rep->analysers = 0; |
| txn->status = 502; |
| client_return(t, error_message(t, HTTP_ERR_502)); |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_PRXCOND; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_H; |
| |
| //if (t->srv && may_dequeue_tasks(t->srv, t->be)) |
| // process_srv_queue(t->srv); |
| |
| return 0; |
| } |
| /* too large response does not fit in buffer. */ |
| else if (rep->flags & BF_FULL) { |
| goto hdr_response_bad; |
| } |
| /* read error */ |
| else if (rep->flags & BF_READ_ERROR) { |
| buffer_shutr_now(rep); |
| buffer_shutw_now(req); |
| //fd_delete(req->cons->fd); |
| //req->cons->state = SI_ST_CLO; |
| //if (t->srv) { |
| //t->srv->cur_sess--; |
| //t->srv->failed_resp++; |
| //sess_change_server(t, NULL); |
| //} |
| //t->be->failed_resp++; |
| rep->analysers = 0; |
| txn->status = 502; |
| client_return(t, error_message(t, HTTP_ERR_502)); |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_SRVCL; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_H; |
| |
| //if (t->srv && may_dequeue_tasks(t->srv, t->be)) |
| // process_srv_queue(t->srv); |
| |
| return 0; |
| } |
| /* read timeout : return a 504 to the client. */ |
| else if (rep->flags & BF_READ_TIMEOUT) { |
| buffer_shutr_now(rep); |
| buffer_shutw_now(req); |
| //fd_delete(req->cons->fd); |
| //req->cons->state = SI_ST_CLO; |
| if (t->srv) { |
| //t->srv->cur_sess--; |
| t->srv->failed_resp++; |
| //sess_change_server(t, NULL); |
| } |
| t->be->failed_resp++; |
| rep->analysers = 0; |
| txn->status = 504; |
| client_return(t, error_message(t, HTTP_ERR_504)); |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_SRVTO; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_H; |
| |
| //if (t->srv && may_dequeue_tasks(t->srv, t->be)) |
| // process_srv_queue(t->srv); |
| return 0; |
| } |
| /* write error to client, or close from server */ |
| else if (rep->flags & (BF_WRITE_ERROR|BF_SHUTR)) { |
| buffer_shutr_now(rep); |
| buffer_shutw_now(req); |
| //fd_delete(req->cons->fd); |
| //req->cons->state = SI_ST_CLO; |
| if (t->srv) { |
| //t->srv->cur_sess--; |
| t->srv->failed_resp++; |
| //sess_change_server(t, NULL); |
| } |
| t->be->failed_resp++; |
| rep->analysers = 0; |
| txn->status = 502; |
| client_return(t, error_message(t, HTTP_ERR_502)); |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_SRVCL; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_H; |
| |
| //if (t->srv && may_dequeue_tasks(t->srv, t->be)) |
| // process_srv_queue(t->srv); |
| |
| return 0; |
| } |
| buffer_write_dis(rep); |
| return 0; |
| } |
| |
| |
| /***************************************************************** |
| * More interesting part now : we know that we have a complete * |
| * response which at least looks like HTTP. We have an indicator * |
| * of each header's length, so we can parse them quickly. * |
| ****************************************************************/ |
| |
| rep->analysers &= ~AN_RTR_HTTP_HDR; |
| |
| /* ensure we keep this pointer to the beginning of the message */ |
| msg->sol = rep->data + msg->som; |
| |
| /* |
| * 1: get the status code and check for cacheability. |
| */ |
| |
| t->logs.logwait &= ~LW_RESP; |
| txn->status = strl2ui(rep->data + msg->sl.st.c, msg->sl.st.c_l); |
| |
| switch (txn->status) { |
| case 200: |
| case 203: |
| case 206: |
| case 300: |
| case 301: |
| case 410: |
| /* RFC2616 @13.4: |
| * "A response received with a status code of |
| * 200, 203, 206, 300, 301 or 410 MAY be stored |
| * by a cache (...) unless a cache-control |
| * directive prohibits caching." |
| * |
| * RFC2616 @9.5: POST method : |
| * "Responses to this method are not cacheable, |
| * unless the response includes appropriate |
| * Cache-Control or Expires header fields." |
| */ |
| if (likely(txn->meth != HTTP_METH_POST) && |
| (t->be->options & (PR_O_CHK_CACHE|PR_O_COOK_NOC))) |
| txn->flags |= TX_CACHEABLE | TX_CACHE_COOK; |
| break; |
| default: |
| break; |
| } |
| |
| /* |
| * 2: we may need to capture headers |
| */ |
| if (unlikely((t->logs.logwait & LW_RSPHDR) && t->fe->rsp_cap)) |
| capture_headers(rep->data + msg->som, &txn->hdr_idx, |
| txn->rsp.cap, t->fe->rsp_cap); |
| |
| /* |
| * 3: we will have to evaluate the filters. |
| * As opposed to version 1.2, now they will be evaluated in the |
| * filters order and not in the header order. This means that |
| * each filter has to be validated among all headers. |
| * |
| * Filters are tried with ->be first, then with ->fe if it is |
| * different from ->be. |
| */ |
| |
| t->flags &= ~SN_CONN_CLOSED; /* prepare for inspection */ |
| |
| cur_proxy = t->be; |
| while (1) { |
| struct proxy *rule_set = cur_proxy; |
| |
| /* try headers filters */ |
| if (rule_set->rsp_exp != NULL) { |
| if (apply_filters_to_response(t, rep, rule_set->rsp_exp) < 0) { |
| return_bad_resp: |
| if (t->srv) { |
| //t->srv->cur_sess--; |
| t->srv->failed_resp++; |
| //sess_change_server(t, NULL); |
| } |
| cur_proxy->failed_resp++; |
| return_srv_prx_502: |
| buffer_shutr_now(rep); |
| buffer_shutw_now(req); |
| //fd_delete(req->cons->fd); |
| //req->cons->state = SI_ST_CLO; |
| rep->analysers = 0; |
| txn->status = 502; |
| client_return(t, error_message(t, HTTP_ERR_502)); |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_PRXCOND; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_H; |
| /* We used to have a free connection slot. Since we'll never use it, |
| * we have to inform the server that it may be used by another session. |
| */ |
| //if (t->srv && may_dequeue_tasks(t->srv, cur_proxy)) |
| // process_srv_queue(t->srv); |
| return 0; |
| } |
| } |
| |
| /* has the response been denied ? */ |
| if (txn->flags & TX_SVDENY) { |
| if (t->srv) { |
| //t->srv->cur_sess--; |
| t->srv->failed_secu++; |
| //sess_change_server(t, NULL); |
| } |
| cur_proxy->denied_resp++; |
| goto return_srv_prx_502; |
| } |
| |
| /* We might have to check for "Connection:" */ |
| if (((t->fe->options | t->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO)) && |
| !(t->flags & SN_CONN_CLOSED)) { |
| char *cur_ptr, *cur_end, *cur_next; |
| int cur_idx, old_idx, delta, val; |
| struct hdr_idx_elem *cur_hdr; |
| |
| cur_next = rep->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx); |
| old_idx = 0; |
| |
| while ((cur_idx = txn->hdr_idx.v[old_idx].next)) { |
| cur_hdr = &txn->hdr_idx.v[cur_idx]; |
| cur_ptr = cur_next; |
| cur_end = cur_ptr + cur_hdr->len; |
| cur_next = cur_end + cur_hdr->cr + 1; |
| |
| val = http_header_match2(cur_ptr, cur_end, "Connection", 10); |
| if (val) { |
| /* 3 possibilities : |
| * - we have already set Connection: close, |
| * so we remove this line. |
| * - we have not yet set Connection: close, |
| * but this line indicates close. We leave |
| * it untouched and set the flag. |
| * - we have not yet set Connection: close, |
| * and this line indicates non-close. We |
| * replace it. |
| */ |
| if (t->flags & SN_CONN_CLOSED) { |
| delta = buffer_replace2(rep, cur_ptr, cur_next, NULL, 0); |
| txn->rsp.eoh += delta; |
| cur_next += delta; |
| txn->hdr_idx.v[old_idx].next = cur_hdr->next; |
| txn->hdr_idx.used--; |
| cur_hdr->len = 0; |
| } else { |
| if (strncasecmp(cur_ptr + val, "close", 5) != 0) { |
| delta = buffer_replace2(rep, cur_ptr + val, cur_end, |
| "close", 5); |
| cur_next += delta; |
| cur_hdr->len += delta; |
| txn->rsp.eoh += delta; |
| } |
| t->flags |= SN_CONN_CLOSED; |
| } |
| } |
| old_idx = cur_idx; |
| } |
| } |
| |
| /* add response headers from the rule sets in the same order */ |
| for (cur_idx = 0; cur_idx < rule_set->nb_rspadd; cur_idx++) { |
| if (unlikely(http_header_add_tail(rep, &txn->rsp, &txn->hdr_idx, |
| rule_set->rsp_add[cur_idx])) < 0) |
| goto return_bad_resp; |
| } |
| |
| /* check whether we're already working on the frontend */ |
| if (cur_proxy == t->fe) |
| break; |
| cur_proxy = t->fe; |
| } |
| |
| /* |
| * 4: check for server cookie. |
| */ |
| if (t->be->cookie_name || t->be->appsession_name || t->be->capture_name |
| || (t->be->options & PR_O_CHK_CACHE)) |
| manage_server_side_cookies(t, rep); |
| |
| |
| /* |
| * 5: check for cache-control or pragma headers if required. |
| */ |
| if ((t->be->options & (PR_O_COOK_NOC | PR_O_CHK_CACHE)) != 0) |
| check_response_for_cacheability(t, rep); |
| |
| /* |
| * 6: add server cookie in the response if needed |
| */ |
| if ((t->srv) && !(t->flags & SN_DIRECT) && (t->be->options & PR_O_COOK_INS) && |
| (!(t->be->options & PR_O_COOK_POST) || (txn->meth == HTTP_METH_POST))) { |
| int len; |
| |
| /* the server is known, it's not the one the client requested, we have to |
| * insert a set-cookie here, except if we want to insert only on POST |
| * requests and this one isn't. Note that servers which don't have cookies |
| * (eg: some backup servers) will return a full cookie removal request. |
| */ |
| len = sprintf(trash, "Set-Cookie: %s=%s; path=/", |
| t->be->cookie_name, |
| t->srv->cookie ? t->srv->cookie : "; Expires=Thu, 01-Jan-1970 00:00:01 GMT"); |
| |
| if (t->be->cookie_domain) |
| len += sprintf(trash+len, "; domain=%s", t->be->cookie_domain); |
| |
| if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx, |
| trash, len)) < 0) |
| goto return_bad_resp; |
| txn->flags |= TX_SCK_INSERTED; |
| |
| /* Here, we will tell an eventual cache on the client side that we don't |
| * want it to cache this reply because HTTP/1.0 caches also cache cookies ! |
| * Some caches understand the correct form: 'no-cache="set-cookie"', but |
| * others don't (eg: apache <= 1.3.26). So we use 'private' instead. |
| */ |
| if ((t->be->options & PR_O_COOK_NOC) && (txn->flags & TX_CACHEABLE)) { |
| |
| txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK; |
| |
| if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx, |
| "Cache-control: private", 22)) < 0) |
| goto return_bad_resp; |
| } |
| } |
| |
| |
| /* |
| * 7: check if result will be cacheable with a cookie. |
| * We'll block the response if security checks have caught |
| * nasty things such as a cacheable cookie. |
| */ |
| if (((txn->flags & (TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) == |
| (TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) && |
| (t->be->options & PR_O_CHK_CACHE)) { |
| |
| /* we're in presence of a cacheable response containing |
| * a set-cookie header. We'll block it as requested by |
| * the 'checkcache' option, and send an alert. |
| */ |
| if (t->srv) { |
| //t->srv->cur_sess--; |
| t->srv->failed_secu++; |
| //sess_change_server(t, NULL); |
| } |
| t->be->denied_resp++; |
| |
| Alert("Blocking cacheable cookie in response from instance %s, server %s.\n", |
| t->be->id, t->srv?t->srv->id:"<dispatch>"); |
| send_log(t->be, LOG_ALERT, |
| "Blocking cacheable cookie in response from instance %s, server %s.\n", |
| t->be->id, t->srv?t->srv->id:"<dispatch>"); |
| goto return_srv_prx_502; |
| } |
| |
| /* |
| * 8: add "Connection: close" if needed and not yet set. |
| * Note that we do not need to add it in case of HTTP/1.0. |
| */ |
| if (!(t->flags & SN_CONN_CLOSED) && |
| ((t->fe->options | t->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO))) { |
| if ((unlikely(msg->sl.st.v_l != 8) || |
| unlikely(req->data[msg->som + 7] != '0')) && |
| unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx, |
| "Connection: close", 17)) < 0) |
| goto return_bad_resp; |
| t->flags |= SN_CONN_CLOSED; |
| } |
| |
| /************************************************************* |
| * OK, that's finished for the headers. We have done what we * |
| * could. Let's switch to the DATA state. * |
| ************************************************************/ |
| |
| buffer_set_rlim(rep, BUFSIZE); /* no more rewrite needed */ |
| t->logs.t_data = tv_ms_elapsed(&t->logs.tv_accept, &now); |
| |
| #ifdef CONFIG_HAP_TCPSPLICE |
| if ((t->fe->options & t->be->options) & PR_O_TCPSPLICE) { |
| /* TCP splicing supported by both FE and BE */ |
| tcp_splice_splicefd(rep->cons->fd, rep->prod->fd, 0); |
| } |
| #endif |
| /* if the user wants to log as soon as possible, without counting |
| * bytes from the server, then this is the right moment. We have |
| * to temporarily assign bytes_out to log what we currently have. |
| */ |
| if (t->fe->to_log && !(t->logs.logwait & LW_BYTES)) { |
| t->logs.t_close = t->logs.t_data; /* to get a valid end date */ |
| t->logs.bytes_out = txn->rsp.eoh; |
| if (t->fe->to_log & LW_REQ) |
| http_sess_log(t); |
| else |
| tcp_sess_log(t); |
| t->logs.bytes_out = 0; |
| } |
| |
| /* Note: we must not try to cheat by jumping directly to DATA, |
| * otherwise we would not let the client side wake up. |
| */ |
| |
| return 0; |
| } |
| |
| /* Note: eventhough nobody should set an unknown flag, clearing them right now will |
| * probably reduce one day's debugging session. |
| */ |
| #ifdef DEBUG_DEV |
| if (rep->analysers & ~(AN_RTR_HTTP_HDR)) { |
| fprintf(stderr, "FIXME !!!! unknown analysers flags %s:%d = 0x%08X\n", |
| __FILE__, __LINE__, rep->analysers); |
| ABORT_NOW(); |
| } |
| #endif |
| rep->analysers &= AN_RTR_HTTP_HDR; |
| return 0; |
| } |
| |
| |
| /* This function is called with (si->state == SI_ST_CON) meaning that a |
| * connection was attempted and that the file descriptor is already allocated. |
| * We must check for establishment, error and abort. Possible output states |
| * are SI_ST_EST (established), SI_ST_CER (error), SI_ST_DIS (abort), and |
| * SI_ST_CON (no change). The function returns 0 if it switches to SI_ST_CER, |
| * otherwise 1. |
| */ |
| int sess_update_st_con_tcp(struct session *s, struct stream_interface *si) |
| { |
| struct buffer *req = si->ob; |
| struct buffer *rep = si->ib; |
| |
| DPRINTF(stderr,"[%u] %s: c=%s exp(r,w)=%u,%u req=%08x rep=%08x rql=%d rpl=%d, fds=%d\n", |
| now_ms, __FUNCTION__, |
| cli_stnames[s->cli_state], |
| rep->rex, req->wex, |
| req->flags, rep->flags, |
| req->l, rep->l, |
| fdtab[si->fd].state); |
| |
| |
| /* If we got an error, or if nothing happened and the connection timed |
| * out, we must give up. The CER state handler will take care of retry |
| * attempts and error reports. |
| */ |
| if (unlikely(si->flags & (SI_FL_EXP|SI_FL_ERR))) { |
| si->state = SI_ST_CER; |
| fd_delete(si->fd); |
| |
| if (si->err_type) |
| return 0; |
| |
| si->err_loc = s->srv; |
| if (si->flags & SI_FL_ERR) |
| si->err_type = SI_ET_CONN_ERR; |
| else |
| si->err_type = SI_ET_CONN_TO; |
| return 0; |
| } |
| |
| /* OK, maybe we want to abort */ |
| if (unlikely((req->flags & BF_SHUTW_NOW) || |
| (rep->flags & BF_SHUTW) || |
| ((req->flags & BF_SHUTR) && /* FIXME: this should not prevent a connection from establishing */ |
| ((req->flags & BF_EMPTY && !(req->flags & BF_WRITE_ACTIVITY)) || |
| s->be->options & PR_O_ABRT_CLOSE)))) { |
| /* give up */ |
| si->shutw(si); |
| si->err_type |= SI_ET_CONN_ABRT; |
| si->err_loc = s->srv; |
| return 1; |
| } |
| |
| /* we need to wait a bit more if there was no activity either */ |
| if (!(req->flags & BF_WRITE_ACTIVITY)) |
| return 1; |
| |
| /* OK, this means that a connection succeeded. The caller will be |
| * responsible for handling the transition from CON to EST. |
| */ |
| s->logs.t_connect = tv_ms_elapsed(&s->logs.tv_accept, &now); |
| si->state = SI_ST_EST; |
| si->err_type = SI_ET_NONE; |
| si->err_loc = NULL; |
| return 1; |
| } |
| |
| |
| /* |
| * This function handles the transition between the SI_ST_CON state and the |
| * SI_ST_EST state. It must only be called after switching from SI_ST_CON to |
| * SI_ST_EST. |
| */ |
| void sess_establish(struct session *s, struct stream_interface *si) |
| { |
| struct buffer *req = si->ob; |
| struct buffer *rep = si->ib; |
| |
| if (req->flags & BF_EMPTY) { |
| EV_FD_CLR(si->fd, DIR_WR); |
| req->wex = TICK_ETERNITY; |
| } else { |
| EV_FD_SET(si->fd, DIR_WR); |
| req->wex = tick_add_ifset(now_ms, s->be->timeout.server); |
| if (tick_isset(req->wex)) { |
| /* FIXME: to prevent the server from expiring read |
| * timeouts during writes, we refresh it. */ |
| rep->rex = req->wex; |
| } |
| } |
| |
| if (s->be->mode == PR_MODE_TCP) { /* let's allow immediate data connection in this case */ |
| if (!(rep->flags & BF_HIJACK)) { |
| EV_FD_SET(si->fd, DIR_RD); |
| rep->rex = tick_add_ifset(now_ms, s->be->timeout.server); |
| } |
| buffer_set_rlim(rep, BUFSIZE); /* no rewrite needed */ |
| |
| /* if the user wants to log as soon as possible, without counting |
| * bytes from the server, then this is the right moment. */ |
| if (s->fe->to_log && !(s->logs.logwait & LW_BYTES)) { |
| s->logs.t_close = s->logs.t_connect; /* to get a valid end date */ |
| tcp_sess_log(s); |
| } |
| #ifdef CONFIG_HAP_TCPSPLICE |
| if ((s->fe->options & s->be->options) & PR_O_TCPSPLICE) { |
| /* TCP splicing supported by both FE and BE */ |
| tcp_splice_splicefd(req->prod->fd, si->fd, 0); |
| } |
| #endif |
| } |
| else { |
| rep->analysers |= AN_RTR_HTTP_HDR; |
| buffer_set_rlim(rep, BUFSIZE - MAXREWRITE); /* rewrite needed */ |
| s->txn.rsp.msg_state = HTTP_MSG_RPBEFORE; |
| /* reset hdr_idx which was already initialized by the request. |
| * right now, the http parser does it. |
| * hdr_idx_init(&s->txn.hdr_idx); |
| */ |
| } |
| |
| rep->flags |= BF_READ_ATTACHED; /* producer is now attached */ |
| req->wex = TICK_ETERNITY; |
| } |
| |
| |
| /* This function is called with (si->state == SI_ST_CER) meaning that a |
| * previous connection attempt has failed and that the file descriptor |
| * has already been released. Possible causes include asynchronous error |
| * notification and time out. Possible output states are SI_ST_CLO when |
| * retries are exhausted, SI_ST_TAR when a delay is wanted before a new |
| * connection attempt, SI_ST_ASS when it's wise to retry on the same server, |
| * and SI_ST_REQ when an immediate redispatch is wanted. The buffers are |
| * marked as in error state. It returns 0. |
| */ |
| int sess_update_st_cer(struct session *s, struct stream_interface *si) |
| { |
| /* we probably have to release last session from the server */ |
| if (s->srv) { |
| if (s->flags & SN_CURR_SESS) { |
| s->flags &= ~SN_CURR_SESS; |
| s->srv->cur_sess--; |
| } |
| sess_change_server(s, NULL); |
| } |
| |
| /* ensure that we have enough retries left */ |
| s->conn_retries--; |
| if (s->conn_retries < 0) { |
| if (!si->err_type) { |
| si->err_type = SI_ET_CONN_ERR; |
| si->err_loc = s->srv; |
| } |
| |
| if (s->srv) |
| s->srv->failed_conns++; |
| s->be->failed_conns++; |
| if (may_dequeue_tasks(s->srv, s->be)) |
| process_srv_queue(s->srv); |
| |
| si->shutw(si); |
| si->ob->flags |= BF_WRITE_ERROR; |
| |
| si->shutr(si); |
| si->ib->flags |= BF_READ_ERROR; |
| |
| si->state = SI_ST_CLO; |
| return 0; |
| } |
| |
| /* If the "redispatch" option is set on the backend, we are allowed to |
| * retry on another server for the last retry. In order to achieve this, |
| * we must mark the session unassigned, and eventually clear the DIRECT |
| * bit to ignore any persistence cookie. We won't count a retry nor a |
| * redispatch yet, because this will depend on what server is selected. |
| */ |
| if (s->srv && s->conn_retries == 0 && s->be->options & PR_O_REDISP) { |
| if (may_dequeue_tasks(s->srv, s->be)) |
| process_srv_queue(s->srv); |
| |
| s->flags &= ~(SN_DIRECT | SN_ASSIGNED | SN_ADDR_SET); |
| s->prev_srv = s->srv; |
| si->state = SI_ST_REQ; |
| } else { |
| if (s->srv) |
| s->srv->retries++; |
| s->be->retries++; |
| si->state = SI_ST_ASS; |
| } |
| |
| if (si->flags & SI_FL_ERR) { |
| /* The error was an asynchronous connection error, and we will |
| * likely have to retry connecting to the same server, most |
| * likely leading to the same result. To avoid this, we wait |
| * one second before retrying. |
| */ |
| |
| if (!si->err_type) |
| si->err_type = SI_ET_CONN_ERR; |
| |
| si->state = SI_ST_TAR; |
| si->exp = tick_add(now_ms, MS_TO_TICKS(1000)); |
| return 0; |
| } |
| return 0; |
| } |
| |
| |
| /* |
| * Produces data for the session <s> depending on its source. Expects to be |
| * called with client socket shut down on input. Right now, only statistics can |
| * be produced. It stops by itself by unsetting the BF_HIJACK flag from the |
| * buffer, which it uses to keep on being called when there is free space in |
| * the buffer, or simply by letting an empty buffer upon return. It returns 1 |
| * when it wants to stop sending data, otherwise 0. |
| */ |
| int produce_content(struct session *s) |
| { |
| if (s->data_source == DATA_SRC_NONE) { |
| buffer_stop_hijack(s->rep); |
| return 1; |
| } |
| else if (s->data_source == DATA_SRC_STATS) { |
| /* dump server statistics */ |
| int ret = stats_dump_http(s, s->be->uri_auth); |
| if (ret >= 0) |
| return ret; |
| /* -1 indicates an error */ |
| } |
| |
| /* unknown data source or internal error */ |
| s->txn.status = 500; |
| client_retnclose(s, error_message(s, HTTP_ERR_500)); |
| trace_term(s, TT_HTTP_CNT_1); |
| if (!(s->flags & SN_ERR_MASK)) |
| s->flags |= SN_ERR_PRXCOND; |
| if (!(s->flags & SN_FINST_MASK)) |
| s->flags |= SN_FINST_R; |
| buffer_stop_hijack(s->rep); |
| return 1; |
| } |
| |
| |
| /* Iterate the same filter through all request headers. |
| * Returns 1 if this filter can be stopped upon return, otherwise 0. |
| * Since it can manage the switch to another backend, it updates the per-proxy |
| * DENY stats. |
| */ |
| int apply_filter_to_req_headers(struct session *t, struct buffer *req, struct hdr_exp *exp) |
| { |
| char term; |
| char *cur_ptr, *cur_end, *cur_next; |
| int cur_idx, old_idx, last_hdr; |
| struct http_txn *txn = &t->txn; |
| struct hdr_idx_elem *cur_hdr; |
| int len, delta; |
| |
| last_hdr = 0; |
| |
| cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx); |
| old_idx = 0; |
| |
| while (!last_hdr) { |
| if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT))) |
| return 1; |
| else if (unlikely(txn->flags & TX_CLALLOW) && |
| (exp->action == ACT_ALLOW || |
| exp->action == ACT_DENY || |
| exp->action == ACT_TARPIT)) |
| return 0; |
| |
| cur_idx = txn->hdr_idx.v[old_idx].next; |
| if (!cur_idx) |
| break; |
| |
| cur_hdr = &txn->hdr_idx.v[cur_idx]; |
| cur_ptr = cur_next; |
| cur_end = cur_ptr + cur_hdr->len; |
| cur_next = cur_end + cur_hdr->cr + 1; |
| |
| /* Now we have one header between cur_ptr and cur_end, |
| * and the next header starts at cur_next. |
| */ |
| |
| /* The annoying part is that pattern matching needs |
| * that we modify the contents to null-terminate all |
| * strings before testing them. |
| */ |
| |
| term = *cur_end; |
| *cur_end = '\0'; |
| |
| if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) { |
| switch (exp->action) { |
| case ACT_SETBE: |
| /* It is not possible to jump a second time. |
| * FIXME: should we return an HTTP/500 here so that |
| * the admin knows there's a problem ? |
| */ |
| if (t->be != t->fe) |
| break; |
| |
| /* Swithing Proxy */ |
| t->be = (struct proxy *) exp->replace; |
| |
| /* right now, the backend switch is not overly complicated |
| * because we have associated req_cap and rsp_cap to the |
| * frontend, and the beconn will be updated later. |
| */ |
| |
| t->rep->rto = t->req->wto = t->be->timeout.server; |
| t->req->cto = t->be->timeout.connect; |
| t->conn_retries = t->be->conn_retries; |
| last_hdr = 1; |
| break; |
| |
| case ACT_ALLOW: |
| txn->flags |= TX_CLALLOW; |
| last_hdr = 1; |
| break; |
| |
| case ACT_DENY: |
| txn->flags |= TX_CLDENY; |
| last_hdr = 1; |
| t->be->denied_req++; |
| break; |
| |
| case ACT_TARPIT: |
| txn->flags |= TX_CLTARPIT; |
| last_hdr = 1; |
| t->be->denied_req++; |
| break; |
| |
| case ACT_REPLACE: |
| len = exp_replace(trash, cur_ptr, exp->replace, pmatch); |
| delta = buffer_replace2(req, cur_ptr, cur_end, trash, len); |
| /* FIXME: if the user adds a newline in the replacement, the |
| * index will not be recalculated for now, and the new line |
| * will not be counted as a new header. |
| */ |
| |
| cur_end += delta; |
| cur_next += delta; |
| cur_hdr->len += delta; |
| txn->req.eoh += delta; |
| break; |
| |
| case ACT_REMOVE: |
| delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0); |
| cur_next += delta; |
| |
| /* FIXME: this should be a separate function */ |
| txn->req.eoh += delta; |
| txn->hdr_idx.v[old_idx].next = cur_hdr->next; |
| txn->hdr_idx.used--; |
| cur_hdr->len = 0; |
| cur_end = NULL; /* null-term has been rewritten */ |
| break; |
| |
| } |
| } |
| if (cur_end) |
| *cur_end = term; /* restore the string terminator */ |
| |
| /* keep the link from this header to next one in case of later |
| * removal of next header. |
| */ |
| old_idx = cur_idx; |
| } |
| return 0; |
| } |
| |
| |
| /* Apply the filter to the request line. |
| * Returns 0 if nothing has been done, 1 if the filter has been applied, |
| * or -1 if a replacement resulted in an invalid request line. |
| * Since it can manage the switch to another backend, it updates the per-proxy |
| * DENY stats. |
| */ |
| int apply_filter_to_req_line(struct session *t, struct buffer *req, struct hdr_exp *exp) |
| { |
| char term; |
| char *cur_ptr, *cur_end; |
| int done; |
| struct http_txn *txn = &t->txn; |
| int len, delta; |
| |
| |
| if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT))) |
| return 1; |
| else if (unlikely(txn->flags & TX_CLALLOW) && |
| (exp->action == ACT_ALLOW || |
| exp->action == ACT_DENY || |
| exp->action == ACT_TARPIT)) |
| return 0; |
| else if (exp->action == ACT_REMOVE) |
| return 0; |
| |
| done = 0; |
| |
| cur_ptr = req->data + txn->req.som; /* should be equal to txn->sol */ |
| cur_end = cur_ptr + txn->req.sl.rq.l; |
| |
| /* Now we have the request line between cur_ptr and cur_end */ |
| |
| /* The annoying part is that pattern matching needs |
| * that we modify the contents to null-terminate all |
| * strings before testing them. |
| */ |
| |
| term = *cur_end; |
| *cur_end = '\0'; |
| |
| if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) { |
| switch (exp->action) { |
| case ACT_SETBE: |
| /* It is not possible to jump a second time. |
| * FIXME: should we return an HTTP/500 here so that |
| * the admin knows there's a problem ? |
| */ |
| if (t->be != t->fe) |
| break; |
| |
| /* Swithing Proxy */ |
| t->be = (struct proxy *) exp->replace; |
| |
| /* right now, the backend switch is not too much complicated |
| * because we have associated req_cap and rsp_cap to the |
| * frontend, and the beconn will be updated later. |
| */ |
| |
| t->rep->rto = t->req->wto = t->be->timeout.server; |
| t->req->cto = t->be->timeout.connect; |
| t->conn_retries = t->be->conn_retries; |
| done = 1; |
| break; |
| |
| case ACT_ALLOW: |
| txn->flags |= TX_CLALLOW; |
| done = 1; |
| break; |
| |
| case ACT_DENY: |
| txn->flags |= TX_CLDENY; |
| t->be->denied_req++; |
| done = 1; |
| break; |
| |
| case ACT_TARPIT: |
| txn->flags |= TX_CLTARPIT; |
| t->be->denied_req++; |
| done = 1; |
| break; |
| |
| case ACT_REPLACE: |
| *cur_end = term; /* restore the string terminator */ |
| len = exp_replace(trash, cur_ptr, exp->replace, pmatch); |
| delta = buffer_replace2(req, cur_ptr, cur_end, trash, len); |
| /* FIXME: if the user adds a newline in the replacement, the |
| * index will not be recalculated for now, and the new line |
| * will not be counted as a new header. |
| */ |
| |
| txn->req.eoh += delta; |
| cur_end += delta; |
| |
| txn->req.sol = req->data + txn->req.som; /* should be equal to txn->sol */ |
| cur_end = (char *)http_parse_reqline(&txn->req, req->data, |
| HTTP_MSG_RQMETH, |
| cur_ptr, cur_end + 1, |
| NULL, NULL); |
| if (unlikely(!cur_end)) |
| return -1; |
| |
| /* we have a full request and we know that we have either a CR |
| * or an LF at <ptr>. |
| */ |
| txn->meth = find_http_meth(cur_ptr, txn->req.sl.rq.m_l); |
| hdr_idx_set_start(&txn->hdr_idx, txn->req.sl.rq.l, *cur_end == '\r'); |
| /* there is no point trying this regex on headers */ |
| return 1; |
| } |
| } |
| *cur_end = term; /* restore the string terminator */ |
| return done; |
| } |
| |
| |
| |
| /* |
| * Apply all the req filters <exp> to all headers in buffer <req> of session <t>. |
| * Returns 0 if everything is alright, or -1 in case a replacement lead to an |
| * unparsable request. Since it can manage the switch to another backend, it |
| * updates the per-proxy DENY stats. |
| */ |
| int apply_filters_to_request(struct session *t, struct buffer *req, struct hdr_exp *exp) |
| { |
| struct http_txn *txn = &t->txn; |
| /* iterate through the filters in the outer loop */ |
| while (exp && !(txn->flags & (TX_CLDENY|TX_CLTARPIT))) { |
| int ret; |
| |
| /* |
| * The interleaving of transformations and verdicts |
| * makes it difficult to decide to continue or stop |
| * the evaluation. |
| */ |
| |
| if ((txn->flags & TX_CLALLOW) && |
| (exp->action == ACT_ALLOW || exp->action == ACT_DENY || |
| exp->action == ACT_TARPIT || exp->action == ACT_PASS)) { |
| exp = exp->next; |
| continue; |
| } |
| |
| /* Apply the filter to the request line. */ |
| ret = apply_filter_to_req_line(t, req, exp); |
| if (unlikely(ret < 0)) |
| return -1; |
| |
| if (likely(ret == 0)) { |
| /* The filter did not match the request, it can be |
| * iterated through all headers. |
| */ |
| apply_filter_to_req_headers(t, req, exp); |
| } |
| exp = exp->next; |
| } |
| return 0; |
| } |
| |
| |
| |
| /* |
| * Manage client-side cookie. It can impact performance by about 2% so it is |
| * desirable to call it only when needed. |
| */ |
| void manage_client_side_cookies(struct session *t, struct buffer *req) |
| { |
| struct http_txn *txn = &t->txn; |
| char *p1, *p2, *p3, *p4; |
| char *del_colon, *del_cookie, *colon; |
| int app_cookies; |
| |
| appsess *asession_temp = NULL; |
| appsess local_asession; |
| |
| char *cur_ptr, *cur_end, *cur_next; |
| int cur_idx, old_idx; |
| |
| /* Iterate through the headers. |
| * we start with the start line. |
| */ |
| old_idx = 0; |
| cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx); |
| |
| while ((cur_idx = txn->hdr_idx.v[old_idx].next)) { |
| struct hdr_idx_elem *cur_hdr; |
| int val; |
| |
| cur_hdr = &txn->hdr_idx.v[cur_idx]; |
| cur_ptr = cur_next; |
| cur_end = cur_ptr + cur_hdr->len; |
| cur_next = cur_end + cur_hdr->cr + 1; |
| |
| /* We have one full header between cur_ptr and cur_end, and the |
| * next header starts at cur_next. We're only interested in |
| * "Cookie:" headers. |
| */ |
| |
| val = http_header_match2(cur_ptr, cur_end, "Cookie", 6); |
| if (!val) { |
| old_idx = cur_idx; |
| continue; |
| } |
| |
| /* Now look for cookies. Conforming to RFC2109, we have to support |
| * attributes whose name begin with a '$', and associate them with |
| * the right cookie, if we want to delete this cookie. |
| * So there are 3 cases for each cookie read : |
| * 1) it's a special attribute, beginning with a '$' : ignore it. |
| * 2) it's a server id cookie that we *MAY* want to delete : save |
| * some pointers on it (last semi-colon, beginning of cookie...) |
| * 3) it's an application cookie : we *MAY* have to delete a previous |
| * "special" cookie. |
| * At the end of loop, if a "special" cookie remains, we may have to |
| * remove it. If no application cookie persists in the header, we |
| * *MUST* delete it |
| */ |
| |
| colon = p1 = cur_ptr + val; /* first non-space char after 'Cookie:' */ |
| |
| /* del_cookie == NULL => nothing to be deleted */ |
| del_colon = del_cookie = NULL; |
| app_cookies = 0; |
| |
| while (p1 < cur_end) { |
| /* skip spaces and colons, but keep an eye on these ones */ |
| while (p1 < cur_end) { |
| if (*p1 == ';' || *p1 == ',') |
| colon = p1; |
| else if (!isspace((unsigned char)*p1)) |
| break; |
| p1++; |
| } |
| |
| if (p1 == cur_end) |
| break; |
| |
| /* p1 is at the beginning of the cookie name */ |
| p2 = p1; |
| while (p2 < cur_end && *p2 != '=') |
| p2++; |
| |
| if (p2 == cur_end) |
| break; |
| |
| p3 = p2 + 1; /* skips the '=' sign */ |
| if (p3 == cur_end) |
| break; |
| |
| p4 = p3; |
| while (p4 < cur_end && !isspace((unsigned char)*p4) && *p4 != ';' && *p4 != ',') |
| p4++; |
| |
| /* here, we have the cookie name between p1 and p2, |
| * and its value between p3 and p4. |
| * we can process it : |
| * |
| * Cookie: NAME=VALUE; |
| * | || || | |
| * | || || +--> p4 |
| * | || |+-------> p3 |
| * | || +--------> p2 |
| * | |+------------> p1 |
| * | +-------------> colon |
| * +--------------------> cur_ptr |
| */ |
| |
| if (*p1 == '$') { |
| /* skip this one */ |
| } |
| else { |
| /* first, let's see if we want to capture it */ |
| if (t->fe->capture_name != NULL && |
| txn->cli_cookie == NULL && |
| (p4 - p1 >= t->fe->capture_namelen) && |
| memcmp(p1, t->fe->capture_name, t->fe->capture_namelen) == 0) { |
| int log_len = p4 - p1; |
| |
| if ((txn->cli_cookie = pool_alloc2(pool2_capture)) == NULL) { |
| Alert("HTTP logging : out of memory.\n"); |
| } else { |
| if (log_len > t->fe->capture_len) |
| log_len = t->fe->capture_len; |
| memcpy(txn->cli_cookie, p1, log_len); |
| txn->cli_cookie[log_len] = 0; |
| } |
| } |
| |
| if ((p2 - p1 == t->be->cookie_len) && (t->be->cookie_name != NULL) && |
| (memcmp(p1, t->be->cookie_name, p2 - p1) == 0)) { |
| /* Cool... it's the right one */ |
| struct server *srv = t->be->srv; |
| char *delim; |
| |
| /* if we're in cookie prefix mode, we'll search the delimitor so that we |
| * have the server ID betweek p3 and delim, and the original cookie between |
| * delim+1 and p4. Otherwise, delim==p4 : |
| * |
| * Cookie: NAME=SRV~VALUE; |
| * | || || | | |
| * | || || | +--> p4 |
| * | || || +--------> delim |
| * | || |+-----------> p3 |
| * | || +------------> p2 |
| * | |+----------------> p1 |
| * | +-----------------> colon |
| * +------------------------> cur_ptr |
| */ |
| |
| if (t->be->options & PR_O_COOK_PFX) { |
| for (delim = p3; delim < p4; delim++) |
| if (*delim == COOKIE_DELIM) |
| break; |
| } |
| else |
| delim = p4; |
| |
| |
| /* Here, we'll look for the first running server which supports the cookie. |
| * This allows to share a same cookie between several servers, for example |
| * to dedicate backup servers to specific servers only. |
| * However, to prevent clients from sticking to cookie-less backup server |
| * when they have incidentely learned an empty cookie, we simply ignore |
| * empty cookies and mark them as invalid. |
| */ |
| if (delim == p3) |
| srv = NULL; |
| |
| while (srv) { |
| if (srv->cookie && (srv->cklen == delim - p3) && |
| !memcmp(p3, srv->cookie, delim - p3)) { |
| if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) { |
| /* we found the server and it's usable */ |
| txn->flags &= ~TX_CK_MASK; |
| txn->flags |= TX_CK_VALID; |
| t->flags |= SN_DIRECT | SN_ASSIGNED; |
| t->srv = srv; |
| break; |
| } else { |
| /* we found a server, but it's down */ |
| txn->flags &= ~TX_CK_MASK; |
| txn->flags |= TX_CK_DOWN; |
| } |
| } |
| srv = srv->next; |
| } |
| |
| if (!srv && !(txn->flags & TX_CK_DOWN)) { |
| /* no server matched this cookie */ |
| txn->flags &= ~TX_CK_MASK; |
| txn->flags |= TX_CK_INVALID; |
| } |
| |
| /* depending on the cookie mode, we may have to either : |
| * - delete the complete cookie if we're in insert+indirect mode, so that |
| * the server never sees it ; |
| * - remove the server id from the cookie value, and tag the cookie as an |
| * application cookie so that it does not get accidentely removed later, |
| * if we're in cookie prefix mode |
| */ |
| if ((t->be->options & PR_O_COOK_PFX) && (delim != p4)) { |
| int delta; /* negative */ |
| |
| delta = buffer_replace2(req, p3, delim + 1, NULL, 0); |
| p4 += delta; |
| cur_end += delta; |
| cur_next += delta; |
| cur_hdr->len += delta; |
| txn->req.eoh += delta; |
| |
| del_cookie = del_colon = NULL; |
| app_cookies++; /* protect the header from deletion */ |
| } |
| else if (del_cookie == NULL && |
| (t->be->options & (PR_O_COOK_INS | PR_O_COOK_IND)) == (PR_O_COOK_INS | PR_O_COOK_IND)) { |
| del_cookie = p1; |
| del_colon = colon; |
| } |
| } else { |
| /* now we know that we must keep this cookie since it's |
| * not ours. But if we wanted to delete our cookie |
| * earlier, we cannot remove the complete header, but we |
| * can remove the previous block itself. |
| */ |
| app_cookies++; |
| |
| if (del_cookie != NULL) { |
| int delta; /* negative */ |
| |
| delta = buffer_replace2(req, del_cookie, p1, NULL, 0); |
| p4 += delta; |
| cur_end += delta; |
| cur_next += delta; |
| cur_hdr->len += delta; |
| txn->req.eoh += delta; |
| del_cookie = del_colon = NULL; |
| } |
| } |
| |
| if ((t->be->appsession_name != NULL) && |
| (memcmp(p1, t->be->appsession_name, p2 - p1) == 0)) { |
| /* first, let's see if the cookie is our appcookie*/ |
| |
| /* Cool... it's the right one */ |
| |
| asession_temp = &local_asession; |
| |
| if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) { |
| Alert("Not enough memory process_cli():asession->sessid:malloc().\n"); |
| send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession->sessid:malloc().\n"); |
| return; |
| } |
| |
| memcpy(asession_temp->sessid, p3, t->be->appsession_len); |
| asession_temp->sessid[t->be->appsession_len] = 0; |
| asession_temp->serverid = NULL; |
| |
| /* only do insert, if lookup fails */ |
| asession_temp = appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid); |
| if (asession_temp == NULL) { |
| if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) { |
| /* free previously allocated memory */ |
| pool_free2(apools.sessid, local_asession.sessid); |
| Alert("Not enough memory process_cli():asession:calloc().\n"); |
| send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n"); |
| return; |
| } |
| |
| asession_temp->sessid = local_asession.sessid; |
| asession_temp->serverid = local_asession.serverid; |
| asession_temp->request_count = 0; |
| appsession_hash_insert(&(t->be->htbl_proxy), asession_temp); |
| } else { |
| /* free previously allocated memory */ |
| pool_free2(apools.sessid, local_asession.sessid); |
| } |
| if (asession_temp->serverid == NULL) { |
| /* TODO redispatch request */ |
| Alert("Found Application Session without matching server.\n"); |
| } else { |
| struct server *srv = t->be->srv; |
| while (srv) { |
| if (strcmp(srv->id, asession_temp->serverid) == 0) { |
| if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) { |
| /* we found the server and it's usable */ |
| txn->flags &= ~TX_CK_MASK; |
| txn->flags |= TX_CK_VALID; |
| t->flags |= SN_DIRECT | SN_ASSIGNED; |
| t->srv = srv; |
| break; |
| } else { |
| txn->flags &= ~TX_CK_MASK; |
| txn->flags |= TX_CK_DOWN; |
| } |
| } |
| srv = srv->next; |
| }/* end while(srv) */ |
| }/* end else if server == NULL */ |
| |
| asession_temp->expire = tick_add_ifset(now_ms, t->be->timeout.appsession); |
| asession_temp->request_count++; |
| #if defined(DEBUG_HASH) |
| Alert("manage_client_side_cookies\n"); |
| appsession_hash_dump(&(t->be->htbl_proxy)); |
| #endif |
| }/* end if ((t->proxy->appsession_name != NULL) ... */ |
| } |
| |
| /* we'll have to look for another cookie ... */ |
| p1 = p4; |
| } /* while (p1 < cur_end) */ |
| |
| /* There's no more cookie on this line. |
| * We may have marked the last one(s) for deletion. |
| * We must do this now in two ways : |
| * - if there is no app cookie, we simply delete the header ; |
| * - if there are app cookies, we must delete the end of the |
| * string properly, including the colon/semi-colon before |
| * the cookie name. |
| */ |
| if (del_cookie != NULL) { |
| int delta; |
| if (app_cookies) { |
| delta = buffer_replace2(req, del_colon, cur_end, NULL, 0); |
| cur_end = del_colon; |
| cur_hdr->len += delta; |
| } else { |
| delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0); |
| |
| /* FIXME: this should be a separate function */ |
| txn->hdr_idx.v[old_idx].next = cur_hdr->next; |
| txn->hdr_idx.used--; |
| cur_hdr->len = 0; |
| } |
| cur_next += delta; |
| txn->req.eoh += delta; |
| } |
| |
| /* keep the link from this header to next one */ |
| old_idx = cur_idx; |
| } /* end of cookie processing on this header */ |
| } |
| |
| |
| /* Iterate the same filter through all response headers contained in <rtr>. |
| * Returns 1 if this filter can be stopped upon return, otherwise 0. |
| */ |
| int apply_filter_to_resp_headers(struct session *t, struct buffer *rtr, struct hdr_exp *exp) |
| { |
| char term; |
| char *cur_ptr, *cur_end, *cur_next; |
| int cur_idx, old_idx, last_hdr; |
| struct http_txn *txn = &t->txn; |
| struct hdr_idx_elem *cur_hdr; |
| int len, delta; |
| |
| last_hdr = 0; |
| |
| cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx); |
| old_idx = 0; |
| |
| while (!last_hdr) { |
| if (unlikely(txn->flags & TX_SVDENY)) |
| return 1; |
| else if (unlikely(txn->flags & TX_SVALLOW) && |
| (exp->action == ACT_ALLOW || |
| exp->action == ACT_DENY)) |
| return 0; |
| |
| cur_idx = txn->hdr_idx.v[old_idx].next; |
| if (!cur_idx) |
| break; |
| |
| cur_hdr = &txn->hdr_idx.v[cur_idx]; |
| cur_ptr = cur_next; |
| cur_end = cur_ptr + cur_hdr->len; |
| cur_next = cur_end + cur_hdr->cr + 1; |
| |
| /* Now we have one header between cur_ptr and cur_end, |
| * and the next header starts at cur_next. |
| */ |
| |
| /* The annoying part is that pattern matching needs |
| * that we modify the contents to null-terminate all |
| * strings before testing them. |
| */ |
| |
| term = *cur_end; |
| *cur_end = '\0'; |
| |
| if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) { |
| switch (exp->action) { |
| case ACT_ALLOW: |
| txn->flags |= TX_SVALLOW; |
| last_hdr = 1; |
| break; |
| |
| case ACT_DENY: |
| txn->flags |= TX_SVDENY; |
| last_hdr = 1; |
| break; |
| |
| case ACT_REPLACE: |
| len = exp_replace(trash, cur_ptr, exp->replace, pmatch); |
| delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len); |
| /* FIXME: if the user adds a newline in the replacement, the |
| * index will not be recalculated for now, and the new line |
| * will not be counted as a new header. |
| */ |
| |
| cur_end += delta; |
| cur_next += delta; |
| cur_hdr->len += delta; |
| txn->rsp.eoh += delta; |
| break; |
| |
| case ACT_REMOVE: |
| delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0); |
| cur_next += delta; |
| |
| /* FIXME: this should be a separate function */ |
| txn->rsp.eoh += delta; |
| txn->hdr_idx.v[old_idx].next = cur_hdr->next; |
| txn->hdr_idx.used--; |
| cur_hdr->len = 0; |
| cur_end = NULL; /* null-term has been rewritten */ |
| break; |
| |
| } |
| } |
| if (cur_end) |
| *cur_end = term; /* restore the string terminator */ |
| |
| /* keep the link from this header to next one in case of later |
| * removal of next header. |
| */ |
| old_idx = cur_idx; |
| } |
| return 0; |
| } |
| |
| |
| /* Apply the filter to the status line in the response buffer <rtr>. |
| * Returns 0 if nothing has been done, 1 if the filter has been applied, |
| * or -1 if a replacement resulted in an invalid status line. |
| */ |
| int apply_filter_to_sts_line(struct session *t, struct buffer *rtr, struct hdr_exp *exp) |
| { |
| char term; |
| char *cur_ptr, *cur_end; |
| int done; |
| struct http_txn *txn = &t->txn; |
| int len, delta; |
| |
| |
| if (unlikely(txn->flags & TX_SVDENY)) |
| return 1; |
| else if (unlikely(txn->flags & TX_SVALLOW) && |
| (exp->action == ACT_ALLOW || |
| exp->action == ACT_DENY)) |
| return 0; |
| else if (exp->action == ACT_REMOVE) |
| return 0; |
| |
| done = 0; |
| |
| cur_ptr = rtr->data + txn->rsp.som; /* should be equal to txn->sol */ |
| cur_end = cur_ptr + txn->rsp.sl.rq.l; |
| |
| /* Now we have the status line between cur_ptr and cur_end */ |
| |
| /* The annoying part is that pattern matching needs |
| * that we modify the contents to null-terminate all |
| * strings before testing them. |
| */ |
| |
| term = *cur_end; |
| *cur_end = '\0'; |
| |
| if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) { |
| switch (exp->action) { |
| case ACT_ALLOW: |
| txn->flags |= TX_SVALLOW; |
| done = 1; |
| break; |
| |
| case ACT_DENY: |
| txn->flags |= TX_SVDENY; |
| done = 1; |
| break; |
| |
| case ACT_REPLACE: |
| *cur_end = term; /* restore the string terminator */ |
| len = exp_replace(trash, cur_ptr, exp->replace, pmatch); |
| delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len); |
| /* FIXME: if the user adds a newline in the replacement, the |
| * index will not be recalculated for now, and the new line |
| * will not be counted as a new header. |
| */ |
| |
| txn->rsp.eoh += delta; |
| cur_end += delta; |
| |
| txn->rsp.sol = rtr->data + txn->rsp.som; /* should be equal to txn->sol */ |
| cur_end = (char *)http_parse_stsline(&txn->rsp, rtr->data, |
| HTTP_MSG_RPVER, |
| cur_ptr, cur_end + 1, |
| NULL, NULL); |
| if (unlikely(!cur_end)) |
| return -1; |
| |
| /* we have a full respnse and we know that we have either a CR |
| * or an LF at <ptr>. |
| */ |
| txn->status = strl2ui(rtr->data + txn->rsp.sl.st.c, txn->rsp.sl.st.c_l); |
| hdr_idx_set_start(&txn->hdr_idx, txn->rsp.sl.rq.l, *cur_end == '\r'); |
| /* there is no point trying this regex on headers */ |
| return 1; |
| } |
| } |
| *cur_end = term; /* restore the string terminator */ |
| return done; |
| } |
| |
| |
| |
| /* |
| * Apply all the resp filters <exp> to all headers in buffer <rtr> of session <t>. |
| * Returns 0 if everything is alright, or -1 in case a replacement lead to an |
| * unparsable response. |
| */ |
| int apply_filters_to_response(struct session *t, struct buffer *rtr, struct hdr_exp *exp) |
| { |
| struct http_txn *txn = &t->txn; |
| /* iterate through the filters in the outer loop */ |
| while (exp && !(txn->flags & TX_SVDENY)) { |
| int ret; |
| |
| /* |
| * The interleaving of transformations and verdicts |
| * makes it difficult to decide to continue or stop |
| * the evaluation. |
| */ |
| |
| if ((txn->flags & TX_SVALLOW) && |
| (exp->action == ACT_ALLOW || exp->action == ACT_DENY || |
| exp->action == ACT_PASS)) { |
| exp = exp->next; |
| continue; |
| } |
| |
| /* Apply the filter to the status line. */ |
| ret = apply_filter_to_sts_line(t, rtr, exp); |
| if (unlikely(ret < 0)) |
| return -1; |
| |
| if (likely(ret == 0)) { |
| /* The filter did not match the response, it can be |
| * iterated through all headers. |
| */ |
| apply_filter_to_resp_headers(t, rtr, exp); |
| } |
| exp = exp->next; |
| } |
| return 0; |
| } |
| |
| |
| |
| /* |
| * Manage server-side cookies. It can impact performance by about 2% so it is |
| * desirable to call it only when needed. |
| */ |
| void manage_server_side_cookies(struct session *t, struct buffer *rtr) |
| { |
| struct http_txn *txn = &t->txn; |
| char *p1, *p2, *p3, *p4; |
| |
| appsess *asession_temp = NULL; |
| appsess local_asession; |
| |
| char *cur_ptr, *cur_end, *cur_next; |
| int cur_idx, old_idx, delta; |
| |
| /* Iterate through the headers. |
| * we start with the start line. |
| */ |
| old_idx = 0; |
| cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx); |
| |
| while ((cur_idx = txn->hdr_idx.v[old_idx].next)) { |
| struct hdr_idx_elem *cur_hdr; |
| int val; |
| |
| cur_hdr = &txn->hdr_idx.v[cur_idx]; |
| cur_ptr = cur_next; |
| cur_end = cur_ptr + cur_hdr->len; |
| cur_next = cur_end + cur_hdr->cr + 1; |
| |
| /* We have one full header between cur_ptr and cur_end, and the |
| * next header starts at cur_next. We're only interested in |
| * "Cookie:" headers. |
| */ |
| |
| val = http_header_match2(cur_ptr, cur_end, "Set-Cookie", 10); |
| if (!val) { |
| old_idx = cur_idx; |
| continue; |
| } |
| |
| /* OK, right now we know we have a set-cookie at cur_ptr */ |
| txn->flags |= TX_SCK_ANY; |
| |
| |
| /* maybe we only wanted to see if there was a set-cookie */ |
| if (t->be->cookie_name == NULL && |
| t->be->appsession_name == NULL && |
| t->be->capture_name == NULL) |
| return; |
| |
| p1 = cur_ptr + val; /* first non-space char after 'Set-Cookie:' */ |
| |
| while (p1 < cur_end) { /* in fact, we'll break after the first cookie */ |
| if (p1 == cur_end || *p1 == ';') /* end of cookie */ |
| break; |
| |
| /* p1 is at the beginning of the cookie name */ |
| p2 = p1; |
| |
| while (p2 < cur_end && *p2 != '=' && *p2 != ';') |
| p2++; |
| |
| if (p2 == cur_end || *p2 == ';') /* next cookie */ |
| break; |
| |
| p3 = p2 + 1; /* skip the '=' sign */ |
| if (p3 == cur_end) |
| break; |
| |
| p4 = p3; |
| while (p4 < cur_end && !isspace((unsigned char)*p4) && *p4 != ';') |
| p4++; |
| |
| /* here, we have the cookie name between p1 and p2, |
| * and its value between p3 and p4. |
| * we can process it. |
| */ |
| |
| /* first, let's see if we want to capture it */ |
| if (t->be->capture_name != NULL && |
| txn->srv_cookie == NULL && |
| (p4 - p1 >= t->be->capture_namelen) && |
| memcmp(p1, t->be->capture_name, t->be->capture_namelen) == 0) { |
| int log_len = p4 - p1; |
| |
| if ((txn->srv_cookie = pool_alloc2(pool2_capture)) == NULL) { |
| Alert("HTTP logging : out of memory.\n"); |
| } |
| |
| if (log_len > t->be->capture_len) |
| log_len = t->be->capture_len; |
| memcpy(txn->srv_cookie, p1, log_len); |
| txn->srv_cookie[log_len] = 0; |
| } |
| |
| /* now check if we need to process it for persistence */ |
| if ((p2 - p1 == t->be->cookie_len) && (t->be->cookie_name != NULL) && |
| (memcmp(p1, t->be->cookie_name, p2 - p1) == 0)) { |
| /* Cool... it's the right one */ |
| txn->flags |= TX_SCK_SEEN; |
| |
| /* If the cookie is in insert mode on a known server, we'll delete |
| * this occurrence because we'll insert another one later. |
| * We'll delete it too if the "indirect" option is set and we're in |
| * a direct access. */ |
| if (((t->srv) && (t->be->options & PR_O_COOK_INS)) || |
| ((t->flags & SN_DIRECT) && (t->be->options & PR_O_COOK_IND))) { |
| /* this header must be deleted */ |
| delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0); |
| txn->hdr_idx.v[old_idx].next = cur_hdr->next; |
| txn->hdr_idx.used--; |
| cur_hdr->len = 0; |
| cur_next += delta; |
| txn->rsp.eoh += delta; |
| |
| txn->flags |= TX_SCK_DELETED; |
| } |
| else if ((t->srv) && (t->srv->cookie) && |
| (t->be->options & PR_O_COOK_RW)) { |
| /* replace bytes p3->p4 with the cookie name associated |
| * with this server since we know it. |
| */ |
| delta = buffer_replace2(rtr, p3, p4, t->srv->cookie, t->srv->cklen); |
| cur_hdr->len += delta; |
| cur_next += delta; |
| txn->rsp.eoh += delta; |
| |
| txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED; |
| } |
| else if ((t->srv) && (t->srv->cookie) && |
| (t->be->options & PR_O_COOK_PFX)) { |
| /* insert the cookie name associated with this server |
| * before existing cookie, and insert a delimitor between them.. |
| */ |
| delta = buffer_replace2(rtr, p3, p3, t->srv->cookie, t->srv->cklen + 1); |
| cur_hdr->len += delta; |
| cur_next += delta; |
| txn->rsp.eoh += delta; |
| |
| p3[t->srv->cklen] = COOKIE_DELIM; |
| txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED; |
| } |
| } |
| /* next, let's see if the cookie is our appcookie */ |
| else if ((t->be->appsession_name != NULL) && |
| (memcmp(p1, t->be->appsession_name, p2 - p1) == 0)) { |
| |
| /* Cool... it's the right one */ |
| |
| size_t server_id_len = strlen(t->srv->id) + 1; |
| asession_temp = &local_asession; |
| |
| if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) { |
| Alert("Not enough Memory process_srv():asession->sessid:malloc().\n"); |
| send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n"); |
| return; |
| } |
| memcpy(asession_temp->sessid, p3, t->be->appsession_len); |
| asession_temp->sessid[t->be->appsession_len] = 0; |
| asession_temp->serverid = NULL; |
| |
| /* only do insert, if lookup fails */ |
| asession_temp = appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid); |
| if (asession_temp == NULL) { |
| if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) { |
| Alert("Not enough Memory process_srv():asession:calloc().\n"); |
| send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession:calloc().\n"); |
| return; |
| } |
| asession_temp->sessid = local_asession.sessid; |
| asession_temp->serverid = local_asession.serverid; |
| asession_temp->request_count = 0; |
| appsession_hash_insert(&(t->be->htbl_proxy), asession_temp); |
| } else { |
| /* free wasted memory */ |
| pool_free2(apools.sessid, local_asession.sessid); |
| } |
| |
| if (asession_temp->serverid == NULL) { |
| if ((asession_temp->serverid = pool_alloc2(apools.serverid)) == NULL) { |
| Alert("Not enough Memory process_srv():asession->sessid:malloc().\n"); |
| send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n"); |
| return; |
| } |
| asession_temp->serverid[0] = '\0'; |
| } |
| |
| if (asession_temp->serverid[0] == '\0') |
| memcpy(asession_temp->serverid, t->srv->id, server_id_len); |
| |
| asession_temp->expire = tick_add_ifset(now_ms, t->be->timeout.appsession); |
| asession_temp->request_count++; |
| #if defined(DEBUG_HASH) |
| Alert("manage_server_side_cookies\n"); |
| appsession_hash_dump(&(t->be->htbl_proxy)); |
| #endif |
| }/* end if ((t->proxy->appsession_name != NULL) ... */ |
| break; /* we don't want to loop again since there cannot be another cookie on the same line */ |
| } /* we're now at the end of the cookie value */ |
| |
| /* keep the link from this header to next one */ |
| old_idx = cur_idx; |
| } /* end of cookie processing on this header */ |
| } |
| |
| |
| |
| /* |
| * Check if response is cacheable or not. Updates t->flags. |
| */ |
| void check_response_for_cacheability(struct session *t, struct buffer *rtr) |
| { |
| struct http_txn *txn = &t->txn; |
| char *p1, *p2; |
| |
| char *cur_ptr, *cur_end, *cur_next; |
| int cur_idx; |
| |
| if (!(txn->flags & TX_CACHEABLE)) |
| return; |
| |
| /* Iterate through the headers. |
| * we start with the start line. |
| */ |
| cur_idx = 0; |
| cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx); |
| |
| while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) { |
| struct hdr_idx_elem *cur_hdr; |
| int val; |
| |
| cur_hdr = &txn->hdr_idx.v[cur_idx]; |
| cur_ptr = cur_next; |
| cur_end = cur_ptr + cur_hdr->len; |
| cur_next = cur_end + cur_hdr->cr + 1; |
| |
| /* We have one full header between cur_ptr and cur_end, and the |
| * next header starts at cur_next. We're only interested in |
| * "Cookie:" headers. |
| */ |
| |
| val = http_header_match2(cur_ptr, cur_end, "Pragma", 6); |
| if (val) { |
| if ((cur_end - (cur_ptr + val) >= 8) && |
| strncasecmp(cur_ptr + val, "no-cache", 8) == 0) { |
| txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK; |
| return; |
| } |
| } |
| |
| val = http_header_match2(cur_ptr, cur_end, "Cache-control", 13); |
| if (!val) |
| continue; |
| |
| /* OK, right now we know we have a cache-control header at cur_ptr */ |
| |
| p1 = cur_ptr + val; /* first non-space char after 'cache-control:' */ |
| |
| if (p1 >= cur_end) /* no more info */ |
| continue; |
| |
| /* p1 is at the beginning of the value */ |
| p2 = p1; |
| |
| while (p2 < cur_end && *p2 != '=' && *p2 != ',' && !isspace((unsigned char)*p2)) |
| p2++; |
| |
| /* we have a complete value between p1 and p2 */ |
| if (p2 < cur_end && *p2 == '=') { |
| /* we have something of the form no-cache="set-cookie" */ |
| if ((cur_end - p1 >= 21) && |
| strncasecmp(p1, "no-cache=\"set-cookie", 20) == 0 |
| && (p1[20] == '"' || p1[20] == ',')) |
| txn->flags &= ~TX_CACHE_COOK; |
| continue; |
| } |
| |
| /* OK, so we know that either p2 points to the end of string or to a comma */ |
| if (((p2 - p1 == 7) && strncasecmp(p1, "private", 7) == 0) || |
| ((p2 - p1 == 8) && strncasecmp(p1, "no-store", 8) == 0) || |
| ((p2 - p1 == 9) && strncasecmp(p1, "max-age=0", 9) == 0) || |
| ((p2 - p1 == 10) && strncasecmp(p1, "s-maxage=0", 10) == 0)) { |
| txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK; |
| return; |
| } |
| |
| if ((p2 - p1 == 6) && strncasecmp(p1, "public", 6) == 0) { |
| txn->flags |= TX_CACHEABLE | TX_CACHE_COOK; |
| continue; |
| } |
| } |
| } |
| |
| |
| /* |
| * Try to retrieve a known appsession in the URI, then the associated server. |
| * If the server is found, it's assigned to the session. |
| */ |
| void get_srv_from_appsession(struct session *t, const char *begin, int len) |
| { |
| struct http_txn *txn = &t->txn; |
| appsess *asession_temp = NULL; |
| appsess local_asession; |
| char *request_line; |
| |
| if (t->be->appsession_name == NULL || |
| (t->txn.meth != HTTP_METH_GET && t->txn.meth != HTTP_METH_POST) || |
| (request_line = memchr(begin, ';', len)) == NULL || |
| ((1 + t->be->appsession_name_len + 1 + t->be->appsession_len) > (begin + len - request_line))) |
| return; |
| |
| /* skip ';' */ |
| request_line++; |
| |
| /* look if we have a jsessionid */ |
| if (strncasecmp(request_line, t->be->appsession_name, t->be->appsession_name_len) != 0) |
| return; |
| |
| /* skip jsessionid= */ |
| request_line += t->be->appsession_name_len + 1; |
| |
| /* First try if we already have an appsession */ |
| asession_temp = &local_asession; |
| |
| if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) { |
| Alert("Not enough memory process_cli():asession_temp->sessid:calloc().\n"); |
| send_log(t->be, LOG_ALERT, "Not enough Memory process_cli():asession_temp->sessid:calloc().\n"); |
| return; |
| } |
| |
| /* Copy the sessionid */ |
| memcpy(asession_temp->sessid, request_line, t->be->appsession_len); |
| asession_temp->sessid[t->be->appsession_len] = 0; |
| asession_temp->serverid = NULL; |
| |
| /* only do insert, if lookup fails */ |
| asession_temp = appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid); |
| if (asession_temp == NULL) { |
| if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) { |
| /* free previously allocated memory */ |
| pool_free2(apools.sessid, local_asession.sessid); |
| Alert("Not enough memory process_cli():asession:calloc().\n"); |
| send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n"); |
| return; |
| } |
| asession_temp->sessid = local_asession.sessid; |
| asession_temp->serverid = local_asession.serverid; |
| asession_temp->request_count=0; |
| appsession_hash_insert(&(t->be->htbl_proxy), asession_temp); |
| } |
| else { |
| /* free previously allocated memory */ |
| pool_free2(apools.sessid, local_asession.sessid); |
| } |
| |
| asession_temp->expire = tick_add_ifset(now_ms, t->be->timeout.appsession); |
| asession_temp->request_count++; |
| |
| #if defined(DEBUG_HASH) |
| Alert("get_srv_from_appsession\n"); |
| appsession_hash_dump(&(t->be->htbl_proxy)); |
| #endif |
| if (asession_temp->serverid == NULL) { |
| /* TODO redispatch request */ |
| Alert("Found Application Session without matching server.\n"); |
| } else { |
| struct server *srv = t->be->srv; |
| while (srv) { |
| if (strcmp(srv->id, asession_temp->serverid) == 0) { |
| if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) { |
| /* we found the server and it's usable */ |
| txn->flags &= ~TX_CK_MASK; |
| txn->flags |= TX_CK_VALID; |
| t->flags |= SN_DIRECT | SN_ASSIGNED; |
| t->srv = srv; |
| break; |
| } else { |
| txn->flags &= ~TX_CK_MASK; |
| txn->flags |= TX_CK_DOWN; |
| } |
| } |
| srv = srv->next; |
| } |
| } |
| } |
| |
| |
| /* |
| * In a GET or HEAD request, check if the requested URI matches the stats uri |
| * for the current backend, and if an authorization has been passed and is valid. |
| * |
| * It is assumed that the request is either a HEAD or GET and that the |
| * t->be->uri_auth field is valid. An HTTP/401 response may be sent, or |
| * produce_content() can be called to start sending data. |
| * |
| * Returns 1 if the session's state changes, otherwise 0. |
| */ |
| int stats_check_uri_auth(struct session *t, struct proxy *backend) |
| { |
| struct http_txn *txn = &t->txn; |
| struct uri_auth *uri_auth = backend->uri_auth; |
| struct user_auth *user; |
| int authenticated, cur_idx; |
| char *h; |
| |
| memset(&t->data_ctx.stats, 0, sizeof(t->data_ctx.stats)); |
| |
| /* check URI size */ |
| if (uri_auth->uri_len > txn->req.sl.rq.u_l) |
| return 0; |
| |
| h = t->req->data + txn->req.sl.rq.u; |
| |
| /* the URI is in h */ |
| if (memcmp(h, uri_auth->uri_prefix, uri_auth->uri_len) != 0) |
| return 0; |
| |
| h += uri_auth->uri_len; |
| while (h <= t->req->data + txn->req.sl.rq.u + txn->req.sl.rq.u_l - 3) { |
| if (memcmp(h, ";up", 3) == 0) { |
| t->data_ctx.stats.flags |= STAT_HIDE_DOWN; |
| break; |
| } |
| h++; |
| } |
| |
| if (uri_auth->refresh) { |
| h = t->req->data + txn->req.sl.rq.u + uri_auth->uri_len; |
| while (h <= t->req->data + txn->req.sl.rq.u + txn->req.sl.rq.u_l - 10) { |
| if (memcmp(h, ";norefresh", 10) == 0) { |
| t->data_ctx.stats.flags |= STAT_NO_REFRESH; |
| break; |
| } |
| h++; |
| } |
| } |
| |
| h = t->req->data + txn->req.sl.rq.u + uri_auth->uri_len; |
| while (h <= t->req->data + txn->req.sl.rq.u + txn->req.sl.rq.u_l - 4) { |
| if (memcmp(h, ";csv", 4) == 0) { |
| t->data_ctx.stats.flags |= STAT_FMT_CSV; |
| break; |
| } |
| h++; |
| } |
| |
| t->data_ctx.stats.flags |= STAT_SHOW_STAT | STAT_SHOW_INFO; |
| |
| /* we are in front of a interceptable URI. Let's check |
| * if there's an authentication and if it's valid. |
| */ |
| user = uri_auth->users; |
| if (!user) { |
| /* no user auth required, it's OK */ |
| authenticated = 1; |
| } else { |
| authenticated = 0; |
| |
| /* a user list is defined, we have to check. |
| * skip 21 chars for "Authorization: Basic ". |
| */ |
| |
| /* FIXME: this should move to an earlier place */ |
| cur_idx = 0; |
| h = t->req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx); |
| while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) { |
| int len = txn->hdr_idx.v[cur_idx].len; |
| if (len > 14 && |
| !strncasecmp("Authorization:", h, 14)) { |
| txn->auth_hdr.str = h; |
| txn->auth_hdr.len = len; |
| break; |
| } |
| h += len + txn->hdr_idx.v[cur_idx].cr + 1; |
| } |
| |
| if (txn->auth_hdr.len < 21 || |
| memcmp(txn->auth_hdr.str + 14, " Basic ", 7)) |
| user = NULL; |
| |
| while (user) { |
| if ((txn->auth_hdr.len == user->user_len + 14 + 7) |
| && !memcmp(txn->auth_hdr.str + 14 + 7, |
| user->user_pwd, user->user_len)) { |
| authenticated = 1; |
| break; |
| } |
| user = user->next; |
| } |
| } |
| |
| if (!authenticated) { |
| struct chunk msg; |
| |
| /* no need to go further */ |
| msg.str = trash; |
| msg.len = sprintf(trash, HTTP_401_fmt, uri_auth->auth_realm); |
| txn->status = 401; |
| client_retnclose(t, &msg); |
| trace_term(t, TT_HTTP_URI_1); |
| t->req->analysers = 0; |
| if (!(t->flags & SN_ERR_MASK)) |
| t->flags |= SN_ERR_PRXCOND; |
| if (!(t->flags & SN_FINST_MASK)) |
| t->flags |= SN_FINST_R; |
| return 1; |
| } |
| |
| /* The request is valid, the user is authenticated. Let's start sending |
| * data. |
| */ |
| buffer_write_dis(t->req); |
| buffer_shutw_now(t->req); |
| buffer_shutr_now(t->rep); |
| buffer_start_hijack(t->rep); |
| t->logs.tv_request = now; |
| t->data_source = DATA_SRC_STATS; |
| t->data_state = DATA_ST_INIT; |
| t->task->nice = -32; /* small boost for HTTP statistics */ |
| produce_content(t); |
| return 1; |
| } |
| |
| |
| /* |
| * Print a debug line with a header |
| */ |
| void debug_hdr(const char *dir, struct session *t, const char *start, const char *end) |
| { |
| int len, max; |
| len = sprintf(trash, "%08x:%s.%s[%04x:%04x]: ", t->uniq_id, t->be->id, |
| dir, (unsigned short)t->req->prod->fd, (unsigned short)t->req->cons->fd); |
| max = end - start; |
| UBOUND(max, sizeof(trash) - len - 1); |
| len += strlcpy2(trash + len, start, max + 1); |
| trash[len++] = '\n'; |
| write(1, trash, len); |
| } |
| |
| |
| /************************************************************************/ |
| /* The code below is dedicated to ACL parsing and matching */ |
| /************************************************************************/ |
| |
| |
| |
| |
| /* 1. Check on METHOD |
| * We use the pre-parsed method if it is known, and store its number as an |
| * integer. If it is unknown, we use the pointer and the length. |
| */ |
| static int acl_parse_meth(const char **text, struct acl_pattern *pattern, int *opaque) |
| { |
| int len, meth; |
| |
| len = strlen(*text); |
| meth = find_http_meth(*text, len); |
| |
| pattern->val.i = meth; |
| if (meth == HTTP_METH_OTHER) { |
| pattern->ptr.str = strdup(*text); |
| if (!pattern->ptr.str) |
| return 0; |
| pattern->len = len; |
| } |
| return 1; |
| } |
| |
| static int |
| acl_fetch_meth(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| int meth; |
| struct http_txn *txn = l7; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->req.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| meth = txn->meth; |
| test->i = meth; |
| if (meth == HTTP_METH_OTHER) { |
| if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE) |
| /* ensure the indexes are not affected */ |
| return 0; |
| test->len = txn->req.sl.rq.m_l; |
| test->ptr = txn->req.sol; |
| } |
| test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST; |
| return 1; |
| } |
| |
| static int acl_match_meth(struct acl_test *test, struct acl_pattern *pattern) |
| { |
| int icase; |
| |
| if (test->i != pattern->val.i) |
| return ACL_PAT_FAIL; |
| |
| if (test->i != HTTP_METH_OTHER) |
| return ACL_PAT_PASS; |
| |
| /* Other method, we must compare the strings */ |
| if (pattern->len != test->len) |
| return ACL_PAT_FAIL; |
| |
| icase = pattern->flags & ACL_PAT_F_IGNORE_CASE; |
| if ((icase && strncasecmp(pattern->ptr.str, test->ptr, test->len) != 0) || |
| (!icase && strncmp(pattern->ptr.str, test->ptr, test->len) != 0)) |
| return ACL_PAT_FAIL; |
| return ACL_PAT_PASS; |
| } |
| |
| /* 2. Check on Request/Status Version |
| * We simply compare strings here. |
| */ |
| static int acl_parse_ver(const char **text, struct acl_pattern *pattern, int *opaque) |
| { |
| pattern->ptr.str = strdup(*text); |
| if (!pattern->ptr.str) |
| return 0; |
| pattern->len = strlen(*text); |
| return 1; |
| } |
| |
| static int |
| acl_fetch_rqver(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| char *ptr; |
| int len; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->req.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| len = txn->req.sl.rq.v_l; |
| ptr = txn->req.sol + txn->req.sl.rq.v - txn->req.som; |
| |
| while ((len-- > 0) && (*ptr++ != '/')); |
| if (len <= 0) |
| return 0; |
| |
| test->ptr = ptr; |
| test->len = len; |
| |
| test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST; |
| return 1; |
| } |
| |
| static int |
| acl_fetch_stver(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| char *ptr; |
| int len; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| len = txn->rsp.sl.st.v_l; |
| ptr = txn->rsp.sol; |
| |
| while ((len-- > 0) && (*ptr++ != '/')); |
| if (len <= 0) |
| return 0; |
| |
| test->ptr = ptr; |
| test->len = len; |
| |
| test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST; |
| return 1; |
| } |
| |
| /* 3. Check on Status Code. We manipulate integers here. */ |
| static int |
| acl_fetch_stcode(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| char *ptr; |
| int len; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| len = txn->rsp.sl.st.c_l; |
| ptr = txn->rsp.sol + txn->rsp.sl.st.c - txn->rsp.som; |
| |
| test->i = __strl2ui(ptr, len); |
| test->flags = ACL_TEST_F_VOL_1ST; |
| return 1; |
| } |
| |
| /* 4. Check on URL/URI. A pointer to the URI is stored. */ |
| static int |
| acl_fetch_url(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->req.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE) |
| /* ensure the indexes are not affected */ |
| return 0; |
| |
| test->len = txn->req.sl.rq.u_l; |
| test->ptr = txn->req.sol + txn->req.sl.rq.u; |
| |
| /* we do not need to set READ_ONLY because the data is in a buffer */ |
| test->flags = ACL_TEST_F_VOL_1ST; |
| return 1; |
| } |
| |
| static int |
| acl_fetch_url_ip(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->req.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE) |
| /* ensure the indexes are not affected */ |
| return 0; |
| |
| /* Parse HTTP request */ |
| url2sa(txn->req.sol + txn->req.sl.rq.u, txn->req.sl.rq.u_l, &l4->srv_addr); |
| test->ptr = (void *)&((struct sockaddr_in *)&l4->srv_addr)->sin_addr; |
| test->i = AF_INET; |
| |
| /* |
| * If we are parsing url in frontend space, we prepare backend stage |
| * to not parse again the same url ! optimization lazyness... |
| */ |
| if (px->options & PR_O_HTTP_PROXY) |
| l4->flags |= SN_ADDR_SET; |
| |
| test->flags = ACL_TEST_F_READ_ONLY; |
| return 1; |
| } |
| |
| static int |
| acl_fetch_url_port(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->req.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE) |
| /* ensure the indexes are not affected */ |
| return 0; |
| |
| /* Same optimization as url_ip */ |
| url2sa(txn->req.sol + txn->req.sl.rq.u, txn->req.sl.rq.u_l, &l4->srv_addr); |
| test->i = ntohs(((struct sockaddr_in *)&l4->srv_addr)->sin_port); |
| |
| if (px->options & PR_O_HTTP_PROXY) |
| l4->flags |= SN_ADDR_SET; |
| |
| test->flags = ACL_TEST_F_READ_ONLY; |
| return 1; |
| } |
| |
| /* 5. Check on HTTP header. A pointer to the beginning of the value is returned. |
| * This generic function is used by both acl_fetch_chdr() and acl_fetch_shdr(). |
| */ |
| static int |
| acl_fetch_hdr(struct proxy *px, struct session *l4, void *l7, char *sol, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| struct hdr_idx *idx = &txn->hdr_idx; |
| struct hdr_ctx *ctx = (struct hdr_ctx *)test->ctx.a; |
| |
| if (!txn) |
| return 0; |
| |
| if (!(test->flags & ACL_TEST_F_FETCH_MORE)) |
| /* search for header from the beginning */ |
| ctx->idx = 0; |
| |
| if (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, ctx)) { |
| test->flags |= ACL_TEST_F_FETCH_MORE; |
| test->flags |= ACL_TEST_F_VOL_HDR; |
| test->len = ctx->vlen; |
| test->ptr = (char *)ctx->line + ctx->val; |
| return 1; |
| } |
| |
| test->flags &= ~ACL_TEST_F_FETCH_MORE; |
| test->flags |= ACL_TEST_F_VOL_HDR; |
| return 0; |
| } |
| |
| static int |
| acl_fetch_chdr(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->req.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE) |
| /* ensure the indexes are not affected */ |
| return 0; |
| |
| return acl_fetch_hdr(px, l4, txn, txn->req.sol, expr, test); |
| } |
| |
| static int |
| acl_fetch_shdr(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| return acl_fetch_hdr(px, l4, txn, txn->rsp.sol, expr, test); |
| } |
| |
| /* 6. Check on HTTP header count. The number of occurrences is returned. |
| * This generic function is used by both acl_fetch_chdr* and acl_fetch_shdr*. |
| */ |
| static int |
| acl_fetch_hdr_cnt(struct proxy *px, struct session *l4, void *l7, char *sol, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| struct hdr_idx *idx = &txn->hdr_idx; |
| struct hdr_ctx ctx; |
| int cnt; |
| |
| if (!txn) |
| return 0; |
| |
| ctx.idx = 0; |
| cnt = 0; |
| while (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, &ctx)) |
| cnt++; |
| |
| test->i = cnt; |
| test->flags = ACL_TEST_F_VOL_HDR; |
| return 1; |
| } |
| |
| static int |
| acl_fetch_chdr_cnt(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->req.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE) |
| /* ensure the indexes are not affected */ |
| return 0; |
| |
| return acl_fetch_hdr_cnt(px, l4, txn, txn->req.sol, expr, test); |
| } |
| |
| static int |
| acl_fetch_shdr_cnt(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| return acl_fetch_hdr_cnt(px, l4, txn, txn->rsp.sol, expr, test); |
| } |
| |
| /* 7. Check on HTTP header's integer value. The integer value is returned. |
| * FIXME: the type is 'int', it may not be appropriate for everything. |
| * This generic function is used by both acl_fetch_chdr* and acl_fetch_shdr*. |
| */ |
| static int |
| acl_fetch_hdr_val(struct proxy *px, struct session *l4, void *l7, char *sol, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| struct hdr_idx *idx = &txn->hdr_idx; |
| struct hdr_ctx *ctx = (struct hdr_ctx *)test->ctx.a; |
| |
| if (!txn) |
| return 0; |
| |
| if (!(test->flags & ACL_TEST_F_FETCH_MORE)) |
| /* search for header from the beginning */ |
| ctx->idx = 0; |
| |
| if (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, ctx)) { |
| test->flags |= ACL_TEST_F_FETCH_MORE; |
| test->flags |= ACL_TEST_F_VOL_HDR; |
| test->i = strl2ic((char *)ctx->line + ctx->val, ctx->vlen); |
| return 1; |
| } |
| |
| test->flags &= ~ACL_TEST_F_FETCH_MORE; |
| test->flags |= ACL_TEST_F_VOL_HDR; |
| return 0; |
| } |
| |
| static int |
| acl_fetch_chdr_val(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->req.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE) |
| /* ensure the indexes are not affected */ |
| return 0; |
| |
| return acl_fetch_hdr_val(px, l4, txn, txn->req.sol, expr, test); |
| } |
| |
| static int |
| acl_fetch_shdr_val(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| return acl_fetch_hdr_val(px, l4, txn, txn->rsp.sol, expr, test); |
| } |
| |
| /* 8. Check on URI PATH. A pointer to the PATH is stored. The path starts at |
| * the first '/' after the possible hostname, and ends before the possible '?'. |
| */ |
| static int |
| acl_fetch_path(struct proxy *px, struct session *l4, void *l7, int dir, |
| struct acl_expr *expr, struct acl_test *test) |
| { |
| struct http_txn *txn = l7; |
| char *ptr, *end; |
| |
| if (!txn) |
| return 0; |
| |
| if (txn->req.msg_state != HTTP_MSG_BODY) |
| return 0; |
| |
| if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE) |
| /* ensure the indexes are not affected */ |
| return 0; |
| |
| end = txn->req.sol + txn->req.sl.rq.u + txn->req.sl.rq.u_l; |
| ptr = http_get_path(txn); |
| if (!ptr) |
| return 0; |
| |
| /* OK, we got the '/' ! */ |
| test->ptr = ptr; |
| |
| while (ptr < end && *ptr != '?') |
| ptr++; |
| |
| test->len = ptr - test->ptr; |
| |
| /* we do not need to set READ_ONLY because the data is in a buffer */ |
| test->flags = ACL_TEST_F_VOL_1ST; |
| return 1; |
| } |
| |
| |
| |
| /************************************************************************/ |
| /* All supported keywords must be declared here. */ |
| /************************************************************************/ |
| |
| /* Note: must not be declared <const> as its list will be overwritten */ |
| static struct acl_kw_list acl_kws = {{ },{ |
| { "method", acl_parse_meth, acl_fetch_meth, acl_match_meth, ACL_USE_L7REQ_PERMANENT }, |
| { "req_ver", acl_parse_ver, acl_fetch_rqver, acl_match_str, ACL_USE_L7REQ_VOLATILE }, |
| { "resp_ver", acl_parse_ver, acl_fetch_stver, acl_match_str, ACL_USE_L7RTR_VOLATILE }, |
| { "status", acl_parse_int, acl_fetch_stcode, acl_match_int, ACL_USE_L7RTR_PERMANENT }, |
| |
| { "url", acl_parse_str, acl_fetch_url, acl_match_str, ACL_USE_L7REQ_VOLATILE }, |
| { "url_beg", acl_parse_str, acl_fetch_url, acl_match_beg, ACL_USE_L7REQ_VOLATILE }, |
| { "url_end", acl_parse_str, acl_fetch_url, acl_match_end, ACL_USE_L7REQ_VOLATILE }, |
| { "url_sub", acl_parse_str, acl_fetch_url, acl_match_sub, ACL_USE_L7REQ_VOLATILE }, |
| { "url_dir", acl_parse_str, acl_fetch_url, acl_match_dir, ACL_USE_L7REQ_VOLATILE }, |
| { "url_dom", acl_parse_str, acl_fetch_url, acl_match_dom, ACL_USE_L7REQ_VOLATILE }, |
| { "url_reg", acl_parse_reg, acl_fetch_url, acl_match_reg, ACL_USE_L7REQ_VOLATILE }, |
| { "url_ip", acl_parse_ip, acl_fetch_url_ip, acl_match_ip, ACL_USE_L7REQ_VOLATILE }, |
| { "url_port", acl_parse_int, acl_fetch_url_port, acl_match_int, ACL_USE_L7REQ_VOLATILE }, |
| |
| /* note: we should set hdr* to use ACL_USE_HDR_VOLATILE, and chdr* to use L7REQ_VOLATILE */ |
| { "hdr", acl_parse_str, acl_fetch_chdr, acl_match_str, ACL_USE_L7REQ_VOLATILE }, |
| { "hdr_reg", acl_parse_reg, acl_fetch_chdr, acl_match_reg, ACL_USE_L7REQ_VOLATILE }, |
| { "hdr_beg", acl_parse_str, acl_fetch_chdr, acl_match_beg, ACL_USE_L7REQ_VOLATILE }, |
| { "hdr_end", acl_parse_str, acl_fetch_chdr, acl_match_end, ACL_USE_L7REQ_VOLATILE }, |
| { "hdr_sub", acl_parse_str, acl_fetch_chdr, acl_match_sub, ACL_USE_L7REQ_VOLATILE }, |
| { "hdr_dir", acl_parse_str, acl_fetch_chdr, acl_match_dir, ACL_USE_L7REQ_VOLATILE }, |
| { "hdr_dom", acl_parse_str, acl_fetch_chdr, acl_match_dom, ACL_USE_L7REQ_VOLATILE }, |
| { "hdr_cnt", acl_parse_int, acl_fetch_chdr_cnt,acl_match_int, ACL_USE_L7REQ_VOLATILE }, |
| { "hdr_val", acl_parse_int, acl_fetch_chdr_val,acl_match_int, ACL_USE_L7REQ_VOLATILE }, |
| |
| { "shdr", acl_parse_str, acl_fetch_shdr, acl_match_str, ACL_USE_L7RTR_VOLATILE }, |
| { "shdr_reg", acl_parse_reg, acl_fetch_shdr, acl_match_reg, ACL_USE_L7RTR_VOLATILE }, |
| { "shdr_beg", acl_parse_str, acl_fetch_shdr, acl_match_beg, ACL_USE_L7RTR_VOLATILE }, |
| { "shdr_end", acl_parse_str, acl_fetch_shdr, acl_match_end, ACL_USE_L7RTR_VOLATILE }, |
| { "shdr_sub", acl_parse_str, acl_fetch_shdr, acl_match_sub, ACL_USE_L7RTR_VOLATILE }, |
| { "shdr_dir", acl_parse_str, acl_fetch_shdr, acl_match_dir, ACL_USE_L7RTR_VOLATILE }, |
| { "shdr_dom", acl_parse_str, acl_fetch_shdr, acl_match_dom, ACL_USE_L7RTR_VOLATILE }, |
| { "shdr_cnt", acl_parse_int, acl_fetch_shdr_cnt,acl_match_int, ACL_USE_L7RTR_VOLATILE }, |
| { "shdr_val", acl_parse_int, acl_fetch_shdr_val,acl_match_int, ACL_USE_L7RTR_VOLATILE }, |
| |
| { "path", acl_parse_str, acl_fetch_path, acl_match_str, ACL_USE_L7REQ_VOLATILE }, |
| { "path_reg", acl_parse_reg, acl_fetch_path, acl_match_reg, ACL_USE_L7REQ_VOLATILE }, |
| { "path_beg", acl_parse_str, acl_fetch_path, acl_match_beg, ACL_USE_L7REQ_VOLATILE }, |
| { "path_end", acl_parse_str, acl_fetch_path, acl_match_end, ACL_USE_L7REQ_VOLATILE }, |
| { "path_sub", acl_parse_str, acl_fetch_path, acl_match_sub, ACL_USE_L7REQ_VOLATILE }, |
| { "path_dir", acl_parse_str, acl_fetch_path, acl_match_dir, ACL_USE_L7REQ_VOLATILE }, |
| { "path_dom", acl_parse_str, acl_fetch_path, acl_match_dom, ACL_USE_L7REQ_VOLATILE }, |
| |
| { NULL, NULL, NULL, NULL }, |
| |
| #if 0 |
| { "line", acl_parse_str, acl_fetch_line, acl_match_str }, |
| { "line_reg", acl_parse_reg, acl_fetch_line, acl_match_reg }, |
| { "line_beg", acl_parse_str, acl_fetch_line, acl_match_beg }, |
| { "line_end", acl_parse_str, acl_fetch_line, acl_match_end }, |
| { "line_sub", acl_parse_str, acl_fetch_line, acl_match_sub }, |
| { "line_dir", acl_parse_str, acl_fetch_line, acl_match_dir }, |
| { "line_dom", acl_parse_str, acl_fetch_line, acl_match_dom }, |
| |
| { "cook", acl_parse_str, acl_fetch_cook, acl_match_str }, |
| { "cook_reg", acl_parse_reg, acl_fetch_cook, acl_match_reg }, |
| { "cook_beg", acl_parse_str, acl_fetch_cook, acl_match_beg }, |
| { "cook_end", acl_parse_str, acl_fetch_cook, acl_match_end }, |
| { "cook_sub", acl_parse_str, acl_fetch_cook, acl_match_sub }, |
| { "cook_dir", acl_parse_str, acl_fetch_cook, acl_match_dir }, |
| { "cook_dom", acl_parse_str, acl_fetch_cook, acl_match_dom }, |
| { "cook_pst", acl_parse_none, acl_fetch_cook, acl_match_pst }, |
| |
| { "auth_user", acl_parse_str, acl_fetch_user, acl_match_str }, |
| { "auth_regex", acl_parse_reg, acl_fetch_user, acl_match_reg }, |
| { "auth_clear", acl_parse_str, acl_fetch_auth, acl_match_str }, |
| { "auth_md5", acl_parse_str, acl_fetch_auth, acl_match_md5 }, |
| { NULL, NULL, NULL, NULL }, |
| #endif |
| }}; |
| |
| |
| __attribute__((constructor)) |
| static void __http_protocol_init(void) |
| { |
| acl_register_keywords(&acl_kws); |
| } |
| |
| |
| /* |
| * Local variables: |
| * c-indent-level: 8 |
| * c-basic-offset: 8 |
| * End: |
| */ |